![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 0ACT GREASE XEP2 AUGUST 2014.pdf | 2014-08-19 16:06 | 293K | |
![[ ]](/icons/layout.gif) | 0ACT GREASE XEP2 December 2012.pdf | 2013-04-22 17:29 | 204K | |
![[ ]](/icons/layout.gif) | 0ANTI FREEZE ANTI BOIL PREMIX BLUE April 2013.pdf | 2013-04-30 17:03 | 204K | |
![[ ]](/icons/layout.gif) | 0ATF 33 JUNE 2013.pdf | 2013-10-15 11:42 | 232K | |
![[ ]](/icons/layout.gif) | 0ATF 33 Oct 2011.pdf | 2012-01-18 16:43 | 146K | |
![[ ]](/icons/layout.gif) | 0ATF 95LE.pdf | 2011-12-15 20:50 | 53K | |
![[ ]](/icons/layout.gif) | 0ATF 95LE JAN 2010.pdf | 2011-12-15 20:50 | 198K | |
![[ ]](/icons/layout.gif) | 0ATF BMV.pdf | 2012-08-03 13:40 | 72K | |
![[ ]](/icons/layout.gif) | 0ATF BMV NOVEMBER 2014.pdf | 2014-12-03 11:59 | 284K | |
![[ ]](/icons/layout.gif) | 0ATF BMV Oct 2011.pdf | 2012-08-03 13:42 | 158K | |
![[ ]](/icons/layout.gif) | 0ATF DX-III JAN 2011.pdf | 2011-12-15 20:50 | 204K | |
![[ ]](/icons/layout.gif) | 0ATF DX-III JUNE 2013.pdf | 2013-10-15 11:33 | 251K | |
![[ ]](/icons/layout.gif) | 0ATF DX-III JUNE 2015.pdf | 2015-06-22 14:58 | 256K | |
![[ ]](/icons/layout.gif) | 0ATF DX-III MARCH 2015.pdf | 2015-03-27 15:57 | 257K | |
![[ ]](/icons/layout.gif) | 0ATF DX-III MINERAL MULTI-VEHICLE AUTO TRANS Mar 2012.pdf | 2012-04-12 17:33 | 120K | |
![[ ]](/icons/layout.gif) | 0ATF DX-III MINERAL MULTIVEHICLE AUTO TRANS Oct 2011.pdf | 2012-01-18 16:45 | 157K | |
![[ ]](/icons/layout.gif) | 0ATF DX-VI JUN 2010.pdf | 2011-12-15 20:50 | 203K | |
![[ ]](/icons/layout.gif) | 0ATF DX-VI JUNE 2013.pdf | 2013-07-05 10:54 | 305K | |
![[ ]](/icons/layout.gif) | 0ATF FM5.pdf | 2011-12-15 20:50 | 51K | |
![[ ]](/icons/layout.gif) | 0ATF FS FULL SYNTHETIC MULTI VEHICLE AUTO TRANS Feb 2012.pdf | 2012-02-27 14:03 | 119K | |
![[ ]](/icons/layout.gif) | 0ATF FS FULL SYNTHETIC MULTI VEHICLE AUTO TRANS Nov 2011.pdf | 2011-12-15 20:50 | 160K | |
![[ ]](/icons/layout.gif) | 0ATF FS JULY 2014.pdf | 2014-08-01 09:53 | 356K | |
![[ ]](/icons/layout.gif) | 0ATF FS JUNE 2013.pdf | 2013-07-05 10:55 | 280K | |
![[ ]](/icons/layout.gif) | 0ATF LV MARCH 2015.pdf | 2015-03-27 14:45 | 305K | |
![[ ]](/icons/layout.gif) | 0ATF MHP.pdf | 2011-12-15 20:50 | 75K | |
![[ ]](/icons/layout.gif) | 0ATF MHP JUNE 2013.pdf | 2013-07-05 10:54 | 308K | |
![[ ]](/icons/layout.gif) | 0ATF MHP JUNE 2015.pdf | 2016-04-29 08:39 | 318K | |
![[ ]](/icons/layout.gif) | 0ATF MHP SEMI SYNTHETIC MULTVEHICLE AUTO TRANS Nov 2011.pdf | 2011-12-15 20:50 | 160K | |
![[ ]](/icons/layout.gif) | 0ATF TOP UP.pdf | 2011-12-15 20:50 | 50K | |
![[ ]](/icons/layout.gif) | 0ATF TOP UP Oct 2011.pdf | 2011-12-20 10:54 | 150K | |
![[ ]](/icons/layout.gif) | 0ATF Top Up June 2013.pdf | 2013-06-11 16:53 | 275K | |
![[ ]](/icons/layout.gif) | 0AUTO TRANS STOP LEAK - APRIL 2014.pdf | 2014-03-31 12:57 | 219K | |
![[ ]](/icons/layout.gif) | 0AUTO TRANS STOP LEAK - FEBRUARY 2015.pdf | 2015-02-17 12:09 | 222K | |
![[ ]](/icons/layout.gif) | 0AUTO TRANS STOP LEAK MAY 2015.pdf | 2015-06-22 16:29 | 222K | |
![[ ]](/icons/layout.gif) | 0Auto Trans Stop Leak January 2013.pdf | 2013-02-06 16:49 | 227K | |
![[ ]](/icons/layout.gif) | 0BENTONE HD GREASE AUGUST 2014.pdf | 2014-08-25 12:16 | 215K | |
![[ ]](/icons/layout.gif) | 0BIOMARINE OB TS August 2012.pdf | 2012-08-30 12:53 | 213K | |
![[ ]](/icons/layout.gif) | 0BIOMARINE OUTBOARD TWO STROKE OIL OCTOBER 2015.pdf | 2016-01-20 16:17 | 254K | |
![[ ]](/icons/layout.gif) | 0BRAKE FLUID 525 Oct 2011.pdf | 2011-12-20 14:21 | 149K | |
![[ ]](/icons/layout.gif) | 0BRAKE FLUID DOT 3 APRIL 2014.pdf | 2014-04-11 15:25 | 226K | |
![[ ]](/icons/layout.gif) | 0BRAKE FLUID DOT 3 APRIL 2015.pdf | 2015-04-01 15:30 | 227K | |
![[ ]](/icons/layout.gif) | 0BRAKE FLUID DOT 3 JULY 2013.pdf | 2013-07-12 15:10 | 221K | |
![[ ]](/icons/layout.gif) | 0BRAKE FLUID DOT 3 JUNE 2015.pdf | 2015-11-17 17:01 | 267K | |
![[ ]](/icons/layout.gif) | 0BRAKE FLUID DOT 4 ESP JULY 2015.pdf | 2015-11-19 11:07 | 225K | |
![[ ]](/icons/layout.gif) | 0BRAKE FLUID DOT 5.1 JULY 2014.pdf | 2014-07-11 12:40 | 318K | |
![[ ]](/icons/layout.gif) | 0BRAKE FLUID DOT 5.1 JUNE 2015.pdf | 2015-08-05 08:44 | 222K | |
![[ ]](/icons/layout.gif) | 0BRAKE FLUID RACING APRIL 2015.pdf | 2015-04-01 16:14 | 211K | |
![[ ]](/icons/layout.gif) | 0BRAKE FLUID RACING AUGUST 2015.pdf | 2015-08-05 12:07 | 198K | |
![[ ]](/icons/layout.gif) | 0BRAKE FLUID RACING JULY 2013.pdf | 2013-07-12 15:15 | 209K | |
![[ ]](/icons/layout.gif) | 0BRAKE FLUID RACING NOVEMBER 2013.pdf | 2014-02-05 09:07 | 209K | |
![[ ]](/icons/layout.gif) | 0BRAKE FLUID SUPER DOT 4 APRIL 2014.pdf | 2014-04-11 14:51 | 226K | |
![[ ]](/icons/layout.gif) | 0BRAKE FLUID SUPER DOT 4 JULY 2013.pdf | 2013-07-12 14:52 | 224K | |
![[ ]](/icons/layout.gif) | 0BRAKE FLUID Super DOT 4 February 2013.pdf | 2013-03-05 13:00 | 202K | |
![[ ]](/icons/layout.gif) | 0BRAKE FLUID Super DOT 4 March 2012.pdf | 2012-08-01 15:27 | 202K | |
![[ ]](/icons/layout.gif) | 0Bentone HD Grease December 2012.pdf | 2013-04-23 10:02 | 201K | |
![[ ]](/icons/layout.gif) | 0Brake Fluid Super DOT 4 April 2013.pdf | 2013-06-24 15:12 | 202K | |
![[ ]](/icons/layout.gif) | 0CAM ASSEMBLY LUBE AUGUST 2014.pdf | 2014-08-28 12:52 | 178K | |
![[ ]](/icons/layout.gif) | 0CAM ASSEMBLY LUBE Oct 2011.pdf | 2011-12-20 12:28 | 140K | |
![[ ]](/icons/layout.gif) | 0CAR & TRUCK WASH MARCH 2014.pdf | 2014-03-28 16:07 | 195K | |
![[ ]](/icons/layout.gif) | 0CHAINSAW BAR OIL JULY 2014.pdf | 2014-07-31 09:17 | 226K | |
![[ ]](/icons/layout.gif) | 0CHAIN SAW BAR OIL OCTOBER 2014.pdf | 2014-10-06 16:43 | 226K | |
![[ ]](/icons/layout.gif) | 0CHAINSAW BAR OIL Oct 2011.pdf | 2011-12-20 13:11 | 140K | |
![[ ]](/icons/layout.gif) | 0CHAINSAW BAR OIL SEPTEMBER 2013.pdf | 2014-02-14 08:36 | 223K | |
![[ ]](/icons/layout.gif) | 0CLASSIC ATF FEBRUARY 2016.pdf | 2016-05-11 09:54 | 300K | |
![[ ]](/icons/layout.gif) | 0CLASSIC ATF MARCH 2015.pdf | 2015-05-07 17:07 | 300K | |
![[ ]](/icons/layout.gif) | 0CLASSIC CAR COOLANT MAY 2015.pdf | 2015-05-01 13:21 | 221K | |
![[ ]](/icons/layout.gif) | 0CLASSIC CAR COOLANT Oct 2011.pdf | 2011-12-20 12:33 | 145K | |
![[ ]](/icons/layout.gif) | 0CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-08-28 11:53 | 312K | |
![[ ]](/icons/layout.gif) | 0CLASSIC ENGINE OILS FEBRUARY 2016.pdf | 2016-02-17 12:37 | 367K | |
![[ ]](/icons/layout.gif) | 0CLASSIC ENGINE OILS Feb 2012.pdf | 2012-02-14 10:00 | 145K | |
![[ ]](/icons/layout.gif) | 0CLASSIC ENGINE OILS Feb 2013.pdf | 2013-02-05 16:52 | 189K | |
![[ ]](/icons/layout.gif) | 0CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 15:04 | 447K | |
![[ ]](/icons/layout.gif) | 0CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-05 15:20 | 329K | |
![[ ]](/icons/layout.gif) | 0CLASSIC ENGINE OILS Oct 2011.pdf | 2011-12-15 20:50 | 145K | |
![[ ]](/icons/layout.gif) | 0CLASSIC MINI 20W-50 FEBRUARY 2016.pdf | 2016-02-18 14:50 | 319K | |
![[ ]](/icons/layout.gif) | 0CLASSIC MINI 20W-50 MAY 2015.pdf | 2015-05-06 16:21 | 297K | |
![[ ]](/icons/layout.gif) | 0CLASSIC MINI OIL DECEMBER 2013.pdf | 2014-02-06 09:48 | 269K | |
![[ ]](/icons/layout.gif) | 0CLASSIC TRIUMPH MARCH 2014.pdf | 2015-03-10 08:42 | 247K | |
![[ ]](/icons/layout.gif) | 0CLASSIC TRIUMPH MAY 2015.pdf | 2015-05-07 12:28 | 282K | |
![[ ]](/icons/layout.gif) | 0CLEAR SCREEN APRIL 2015.pdf | 2015-04-13 09:17 | 389K | |
![[ ]](/icons/layout.gif) | 0CLEAR SCREEN CONCENTRATE FEBRUARY 2014.pdf | 2014-02-04 13:01 | 388K | |
![[ ]](/icons/layout.gif) | 0CLEAR SCREEN CONCENTRATE SEPTEMBER 2013.pdf | 2013-10-24 14:35 | 387K | |
![[ ]](/icons/layout.gif) | 0COMPETITION DIFF OIL.pdf | 2011-12-15 20:50 | 51K | |
![[ ]](/icons/layout.gif) | 0COOL 100 COOLANT INHIBITOR - FEBRUARY 2015.pdf | 2015-04-14 16:37 | 274K | |
![[ ]](/icons/layout.gif) | 0COOLANT TEST STRIPS - JULY 2016.pdf | 2016-07-12 10:08 | 373K | |
![[ ]](/icons/layout.gif) | 0COPPER EZE AUGUST 2014.pdf | 2014-08-28 13:05 | 212K | |
![[ ]](/icons/layout.gif) | 0COPPER EZE December 2012.pdf | 2013-04-22 17:40 | 185K | |
![[ ]](/icons/layout.gif) | 0COPPER EZE FEBRUARY 2014.pdf | 2014-02-05 16:09 | 199K | |
![[ ]](/icons/layout.gif) | 0COPPER EZE JULY 2014.pdf | 2014-07-01 11:47 | 202K | |
![[ ]](/icons/layout.gif) | 0COPPER EZE MAY 2013.pdf | 2013-05-10 14:55 | 185K | |
![[ ]](/icons/layout.gif) | 0COPPER EZE Oct 2011.pdf | 2011-12-20 12:28 | 139K | |
![[ ]](/icons/layout.gif) | 0CVT Fluid.pdf | 2011-12-15 20:50 | 143K | |
![[ ]](/icons/layout.gif) | 0CVTV Fluid June 2013.pdf | 2013-07-09 11:45 | 285K | |
![[ ]](/icons/layout.gif) | 0CVTV Fluid October 2013.pdf | 2014-03-11 11:10 | 228K | |
![[ ]](/icons/layout.gif) | 0Chain Saw Bar.pdf | 2011-12-15 20:50 | 62K | |
![[ ]](/icons/layout.gif) | 0Chain Saw Bar JAN 2010.pdf | 2011-12-15 20:50 | 191K | |
![[ ]](/icons/layout.gif) | 0Classic Car Coolant.pdf | 2011-12-15 20:50 | 70K | |
![[ ]](/icons/layout.gif) | 0Classic Car Coolant MAR 2010.pdf | 2011-12-15 20:50 | 193K | |
![[ ]](/icons/layout.gif) | 0Classic Engine Oil 20W-50 Oct 2011.pdf | 2011-12-15 20:50 | 186K | |
![[ ]](/icons/layout.gif) | 0Classic Engine Oils.pdf | 2011-12-15 20:50 | 44K | |
![[ ]](/icons/layout.gif) | 0Classic Engine Oils JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | 0Classic Mini Oil July 2013.pdf | 2013-10-31 14:13 | 268K | |
![[ ]](/icons/layout.gif) | 0Copper Eze JAN 2010.pdf | 2011-12-15 20:50 | 192K | |
![[ ]](/icons/layout.gif) | 0DIESEL FUEL STABILISER JUNE 2016.pdf | 2016-06-07 08:43 | 317K | |
![[ ]](/icons/layout.gif) | 0DIESEL FUEL TREATMENT JULY 2014.pdf | 2014-07-28 08:57 | 185K | |
![[ ]](/icons/layout.gif) | 0DIESEL FX August 2012.pdf | 2012-08-30 12:04 | 191K | |
![[ ]](/icons/layout.gif) | 0DIESEL FX February 2012.pdf | 2012-07-18 16:07 | 149K | |
![[ ]](/icons/layout.gif) | 0DIESEL FX MARCH 2015.pdf | 2015-03-31 15:40 | 252K | |
![[ ]](/icons/layout.gif) | 0DIESEL FX MAY 2016.pdf | 2016-05-02 10:31 | 309K | |
![[ ]](/icons/layout.gif) | 0DIESEL FX November 2012.pdf | 2012-11-16 15:05 | 192K | |
![[ ]](/icons/layout.gif) | 0DIESEL FX SEPTEMBER 2015.pdf | 2015-09-17 09:11 | 251K | |
![[ ]](/icons/layout.gif) | 0DIESEL HD 15W-40 August 2012.pdf | 2012-08-21 09:36 | 194K | |
![[ ]](/icons/layout.gif) | 0DIESEL HD 15W-40 JUNE 2014.pdf | 2014-06-16 12:43 | 365K | |
![[ ]](/icons/layout.gif) | 0DIESEL HD 15W-40 SEPTEMBER 2013.pdf | 2013-09-18 17:24 | 368K | |
![[ ]](/icons/layout.gif) | 0DIESEL HD 15W40 February 2012.pdf | 2012-03-09 11:44 | 129K | |
![[ ]](/icons/layout.gif) | 0DIESEL HD FEBRUARY 2016.pdf | 2016-03-22 14:45 | 379K | |
![[ ]](/icons/layout.gif) | 0DIESEL HD MARCH 2015.pdf | 2015-03-27 12:54 | 377K | |
![[ ]](/icons/layout.gif) | 0DIESEL HD SEPTEMBER 2015.pdf | 2015-09-09 15:27 | 379K | |
![[ ]](/icons/layout.gif) | 0DIESEL INJECTOR CLEANER - FEBRUARY 2015.pdf | 2015-02-17 09:57 | 180K | |
![[ ]](/icons/layout.gif) | 0DIESEL INJECTOR CLEANER MAY 2015.pdf | 2015-06-23 16:53 | 197K | |
![[ ]](/icons/layout.gif) | 0DIESEL SP Oct 2011.pdf | 2011-12-20 11:56 | 148K | |
![[ ]](/icons/layout.gif) | 0DIESEL TOTAL SYSTEM CLEANER MAY 2015.pdf | 2015-07-27 17:22 | 317K | |
![[ ]](/icons/layout.gif) | 0DOT 3 BRAKE FLUID Aug 2012.pdf | 2012-08-03 12:17 | 202K | |
![[ ]](/icons/layout.gif) | 0DOT 3 BRAKE FLUID February 2013.pdf | 2013-03-05 13:01 | 203K | |
![[ ]](/icons/layout.gif) | 0DOT 3 BRAKE FLUID JULY 2012.pdf | 2012-07-20 14:11 | 203K | |
![[ ]](/icons/layout.gif) | 0DPF CLEANER APRIL 2015.pdf | 2015-05-04 16:27 | 517K | |
![[ ]](/icons/layout.gif) | 0DPF CLEANER JANUARY 2014.pdf | 2014-03-06 16:22 | 560K | |
![[ ]](/icons/layout.gif) | 0DPF CLEANER JANUARY 2015.pdf | 2015-02-16 16:11 | 517K | |
![[ ]](/icons/layout.gif) | 0DPF CLEANER JULY 2016.pdf | 2016-07-11 14:45 | 592K | |
![[ ]](/icons/layout.gif) | 0Diesel FX.pdf | 2011-12-15 20:50 | 45K | |
![[ ]](/icons/layout.gif) | 0Diesel FX April 2013.pdf | 2013-04-30 12:50 | 192K | |
![[ ]](/icons/layout.gif) | 0Diesel FX MAR 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | 0Diesel FX September 2013.pdf | 2013-10-03 12:53 | 250K | |
![[ ]](/icons/layout.gif) | 0Diesel Injector Cleaner January 2013.pdf | 2013-03-15 11:16 | 245K | |
![[ ]](/icons/layout.gif) | 0Diesel LA.pdf | 2011-12-15 20:50 | 55K | |
![[ ]](/icons/layout.gif) | 0Diesel SP.pdf | 2011-12-15 20:50 | 52K | |
![[ ]](/icons/layout.gif) | 0Diesel SP MAR 2011.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | 0ENDURO JULY 2014.pdf | 2014-07-17 11:43 | 406K | |
![[ ]](/icons/layout.gif) | 0ENDURO MARCH 2014.pdf | 2014-03-12 10:33 | 246K | |
![[ ]](/icons/layout.gif) | 0ENDURO Oct 2011.pdf | 2011-12-15 20:50 | 142K | |
![[ ]](/icons/layout.gif) | 0ENGINE FLUSH JUNE 2015.pdf | 2015-07-29 17:23 | 257K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 0W-20 JANUARY 2015.pdf | 2015-02-10 10:15 | 373K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 0W-20 MARCH 2015.pdf | 2015-03-26 11:43 | 361K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 0W-20 MAY 2015.pdf | 2015-05-05 13:11 | 404K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 5W-20 April 2013.pdf | 2013-04-18 11:44 | 192K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 5W-20 JANUARY 2015.pdf | 2015-01-19 17:12 | 325K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 5W-20 JUNE 2013.pdf | 2013-07-18 10:55 | 280K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 5W-20 MAY 2014.pdf | 2014-05-29 17:04 | 334K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 5W-20 MAY 2015.pdf | 2015-05-05 15:30 | 352K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 5W-30 DECEMBER 2015.pdf | 2015-12-08 12:47 | 474K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 5W-30 JANUARY 2015.pdf | 2015-04-22 17:06 | 361K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 5W-30 JUNE 2013.pdf | 2013-06-19 15:03 | 309K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 5W-30 May 2014.pdf | 2014-06-13 14:27 | 361K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 5W-40 APRIL 2015.pdf | 2015-04-16 11:36 | 371K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+5W-40 April 2012.pdf | 2012-04-04 15:50 | 132K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 5W-40 DECEMBER 2015.pdf | 2015-12-08 12:51 | 513K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 5W-40 FEBRUARY 2016.pdf | 2016-03-07 10:13 | 513K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 5W-40 JULY 2015.pdf | 2015-07-23 16:28 | 512K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+5W-40 JUNE 2013.pdf | 2013-07-18 10:57 | 326K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 5W-40 JUNE 2016.pdf | 2016-07-08 11:34 | 526K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 5W-40 June 2012.pdf | 2012-07-19 16:54 | 221K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 5W-40 Nov 2012.pdf | 2012-11-16 11:59 | 218K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 10W-40 JULY 2014.pdf | 2014-07-14 13:17 | 475K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 10W-40 June 2012.pdf | 2012-10-03 11:39 | 196K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ 10W-40 MAY 2014.pdf | 2014-05-30 12:45 | 277K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+10W40 Oct 2011.pdf | 2011-12-15 20:50 | 153K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ C-4 AUGUST 2014.pdf | 2014-08-22 10:38 | 378K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ C-4 JUNE 2013.pdf | 2013-07-18 13:05 | 283K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ C-4 MAY 2014.pdf | 2014-05-21 13:12 | 329K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ C2 APRIL 2016.pdf | 2016-06-08 11:59 | 431K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ C3 APRIL 2016.pdf | 2016-06-08 08:48 | 413K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+C3 AUGUST 2014.pdf | 2014-10-09 11:49 | 282K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+C3 DECEMEBR 2015.pdf | 2015-12-08 14:04 | 430K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+C4 Oct 2011.pdf | 2012-01-04 09:22 | 205K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ DL-1 Aug 2012.pdf | 2012-08-24 16:56 | 215K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ DL-1 JUNE 2013.pdf | 2013-07-18 13:03 | 315K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ DL-1 JUNE 2016.pdf | 2016-06-09 16:43 | 463K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ DL-1 May 2014.pdf | 2014-05-30 12:43 | 367K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ GF-5 April 2012.pdf | 2012-04-30 15:41 | 134K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ GF-5 JANUARY 2015.pdf | 2015-01-20 14:41 | 377K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ GF-5 JUNE 2013.pdf | 2013-07-18 13:02 | 318K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ GF-5 June 2012.pdf | 2012-07-19 10:48 | 213K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ GF-5 MAY 2014.pdf | 2014-05-30 12:43 | 376K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ GF-5 MAY 2015.pdf | 2015-07-10 12:41 | 399K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+ GF-5 SEPTEMBER 2015.pdf | 2015-09-09 11:15 | 536K | |
![[ ]](/icons/layout.gif) | 0ENVIRO+HYBRID 0W-16 JANUARY 2015.pdf | 2015-02-05 10:07 | 324K | |
![[ ]](/icons/layout.gif) | 0ENVIRO PLUS 10W-40 April 2012.pdf | 2012-04-23 17:30 | 93K | |
![[ ]](/icons/layout.gif) | 0ENVIRO PLUS 10W-40 MARCH 2015.pdf | 2015-03-24 16:06 | 287K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY 5W-30 April 2013.pdf | 2013-04-17 17:13 | 237K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY 5W-30 Aug 2012.pdf | 2012-08-30 10:50 | 203K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY 5W-30 July 2013.pdf | 2013-09-17 10:59 | 319K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY 10W-30 April 2013.pdf | 2013-04-17 17:13 | 252K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY 10W-30 Aug 2012.pdf | 2012-08-30 11:05 | 202K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY 10W-30 NOVEMBER 2014.pdf | 2015-03-05 15:47 | 320K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY 10W-30 SEPTEMBER 2014.pdf | 2014-10-08 12:10 | 320K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY 15W-40 April 2013.pdf | 2013-04-17 17:14 | 252K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY 15W-40 Aug 2012.pdf | 2012-08-30 11:03 | 202K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY 15W-40 SEPTEMBER 2014.pdf | 2014-10-08 12:07 | 303K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY 20W-50 April 2013.pdf | 2013-04-17 17:14 | 238K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY 20W-50 Aug 2012.pdf | 2012-08-30 11:00 | 201K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY 20W-50 FEBRUARY 2015.pdf | 2015-02-10 12:53 | 303K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY 20W-50 SEPTEMBER 2014.pdf | 2014-09-01 13:10 | 303K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY DRIVING 5W-30 MARCH 2015.pdf | 2015-03-26 12:54 | 321K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY DRIVING 10W-30 MARCH 2015.pdf | 2015-03-26 12:46 | 321K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY DRIVING 15W-40 MARCH 2015.pdf | 2015-03-26 12:44 | 315K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY DRIVING OILS Oct 2011.pdf | 2011-12-20 10:17 | 149K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY FULL SYNTHETIC 5W-30 FEB 2013.pdf | 2014-02-18 08:51 | 346K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY FULL SYNTHETIC 5W-30 JUNE 2014.pdf | 2015-03-26 14:47 | 346K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY FULL SYNTHETIC 10W-40 JUNE 2014.pdf | 2015-03-26 14:49 | 315K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY PLUS 5W-40 APRIL 2015.pdf | 2015-04-28 12:02 | 253K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY PLUS 5W-40 June 2012.pdf | 2012-08-14 14:07 | 92K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY PLUS 5W-40 SEPTEMBER 2013.pdf | 2013-09-17 09:58 | 192K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY PLUS 10W-40 APRIL 2015.pdf | 2015-04-28 09:35 | 261K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY PLUS 10W-40 JUNE 2012.pdf | 2012-08-14 14:09 | 92K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY PLUS 10W-40 SEPTEMBER 2013.pdf | 2013-10-02 15:18 | 197K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY PLUS 15W-40 APRIL 2015.pdf | 2015-04-28 12:04 | 255K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY PLUS 15W-40 May 2012.pdf | 2012-08-14 14:11 | 92K | |
![[ ]](/icons/layout.gif) | 0EVERYDAY PLUS 15W-40 SEPTEMBER 2013.pdf | 2013-10-02 15:21 | 191K | |
![[ ]](/icons/layout.gif) | 0EXTREME PRESSURE GREASE JULY 2014.pdf | 2014-07-21 10:06 | 181K | |
![[ ]](/icons/layout.gif) | 0EXTREME PRESSURE GREASE JULY 2015.pdf | 2015-07-03 11:50 | 180K | |
![[ ]](/icons/layout.gif) | 0EXTREME PRESSURE GREASE Oct 2011.pdf | 2011-12-20 12:27 | 144K | |
![[ ]](/icons/layout.gif) | 0Enduro JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | 0Enduro Rev 0.0 0912.pdf | 2012-12-07 15:26 | 126K | |
![[ ]](/icons/layout.gif) | 0Enviro + Engine Oils.pdf | 2011-12-15 20:50 | 63K | |
![[ ]](/icons/layout.gif) | 0Enviro Plus 0W40 and 10W50 APRIL 2010.pdf | 2011-12-15 20:50 | 200K | |
![[ ]](/icons/layout.gif) | 0Enviro Plus 0W40 and 10W50 JAN 2010.pdf | 2011-12-15 20:50 | 200K | |
![[ ]](/icons/layout.gif) | 0Enviro Plus 0W40 and 10W50 JAN 2011.pdf | 2011-12-15 20:50 | 208K | |
![[ ]](/icons/layout.gif) | 0Enviro Plus 5W-40 April2011.pdf | 2011-12-15 20:50 | 96K | |
![[ ]](/icons/layout.gif) | 0Enviro Plus 5W-40 JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | 0Enviro Plus 5W-40 MAR 2011.pdf | 2011-12-15 20:50 | 201K | |
![[ ]](/icons/layout.gif) | 0Everyday Diesel FX April 2013.pdf | 2013-04-30 12:52 | 192K | |
![[ ]](/icons/layout.gif) | 0Everyday Diesel FX September 2013.pdf | 2013-09-17 17:08 | 277K | |
![[ ]](/icons/layout.gif) | 0Everyday Driving Oils JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | 0Everyday Driving Oils JAN 2011.pdf | 2011-12-15 20:50 | 229K | |
![[ ]](/icons/layout.gif) | 0Everyday Driving Oils JUNE 2010.pdf | 2011-12-15 20:50 | 88K | |
![[ ]](/icons/layout.gif) | 0Everyday Euro Oils OCT 2011.pdf | 2011-12-20 10:24 | 186K | |
![[ ]](/icons/layout.gif) | 0Everyday Full Synthetic 5W-40 April 2011.pdf | 2011-12-15 20:50 | 93K | |
![[ ]](/icons/layout.gif) | 0Everyday Full Synthetic 10W-40 Aug 2012.pdf | 2012-10-22 12:45 | 202K | |
![[ ]](/icons/layout.gif) | 0Everyday Full Synthetic 10W-40 Jan 2011.pdf | 2011-12-20 10:26 | 202K | |
![[ ]](/icons/layout.gif) | 0Everyday Full Synthetic 10W-40 July 2013.pdf | 2013-07-09 17:22 | 313K | |
![[ ]](/icons/layout.gif) | 0Everyday Full Synthetic 10W-40 September 2012.pdf | 2012-09-11 12:38 | 202K | |
![[ ]](/icons/layout.gif) | 0Everyday Full Synthetic Oils.pdf | 2011-12-15 20:50 | 53K | |
![[ ]](/icons/layout.gif) | 0Everyday Full Synthetic Oils JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | 0Everyday Full Synthetic Oils OCT 2010.pdf | 2011-12-15 20:50 | 92K | |
![[ ]](/icons/layout.gif) | 0Extreme Pressure Grease.pdf | 2011-12-15 20:50 | 141K | |
![[ ]](/icons/layout.gif) | 0FD01 FLUID MAY 2015.pdf | 2015-05-11 11:38 | 186K | |
![[ ]](/icons/layout.gif) | 0FD01 FLUID Oct 2011.pdf | 2011-12-20 11:57 | 142K | |
![[ ]](/icons/layout.gif) | 0FLEET-GEAR 10 MAY 2015.pdf | 2015-05-11 11:01 | 215K | |
![[ ]](/icons/layout.gif) | 0FLEET-GEAR 30 MAY 2015.pdf | 2015-06-30 08:32 | 214K | |
![[ ]](/icons/layout.gif) | 0FLEET-GEAR 50 MAY 2015.pdf | 2015-06-30 08:36 | 214K | |
![[ ]](/icons/layout.gif) | 0FLEET GEAR 30 - NOVEMBER 2013.pdf | 2013-11-27 16:06 | 196K | |
![[ ]](/icons/layout.gif) | 0FLEETGEAR 30and50, FLEETRANSC4 August 2012.pdf | 2012-08-21 10:28 | 202K | |
![[ ]](/icons/layout.gif) | 0FLEETGEAR 30and50, FLEETRANSC4 December 2012.pdf | 2012-12-07 15:15 | 201K | |
![[ ]](/icons/layout.gif) | 0FLEETGEAR 30and50, FLEETRANSC4 Oct 2011.pdf | 2011-12-20 10:58 | 152K | |
![[ ]](/icons/layout.gif) | 0FULL SYNTHETIC 5W-30 APRIL 2016.pdf | 2016-04-27 13:48 | 353K | |
![[ ]](/icons/layout.gif) | 0FULL SYNTHETIC 5W-30 JUNE 2015.pdf | 2015-06-19 11:57 | 345K | |
![[ ]](/icons/layout.gif) | 0FULL SYNTHETIC 5W-30 MAY 2016.pdf | 2016-05-04 10:52 | 357K | |
![[ ]](/icons/layout.gif) | 0FULL SYNTHETIC 10W-40 JUNE 2015.pdf | 2015-06-19 12:03 | 307K | |
![[ ]](/icons/layout.gif) | 0FULL SYNTHETIC 10W-40 NOVEMBER 2015.pdf | 2015-11-23 11:51 | 342K | |
![[ ]](/icons/layout.gif) | 0Fleet Gear 30 and 50, Fleet-trans C4.pdf | 2011-12-15 20:50 | 193K | |
![[ ]](/icons/layout.gif) | 0Fleet Gear 30 and 50, Fleet-trans C4 JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | 0Fleet Gear 30 and 50 Fleet-trans C4 MAR 2010.pdf | 2011-12-15 20:50 | 185K | |
![[ ]](/icons/layout.gif) | 0Fleetgear 10, 30 & 50 April 2013.pdf | 2013-04-18 15:06 | 204K | |
![[ ]](/icons/layout.gif) | 0Foam Filter Oil November 2012.pdf | 2012-12-03 16:56 | 198K | |
![[ ]](/icons/layout.gif) | 0GEARBOX OIL 30 AND 40 MAY 2015.pdf | 2015-05-06 17:02 | 259K | |
![[ ]](/icons/layout.gif) | 0GEARBOX OIL 30 and 40 AUGUST 2013.pdf | 2013-08-28 11:54 | 237K | |
![[ ]](/icons/layout.gif) | 0GEARBOX OIL 30 and 40 Feb 2012.pdf | 2012-02-23 13:30 | 114K | |
![[ ]](/icons/layout.gif) | 0GEARBOX OIL 30and40Oct 2011.pdf | 2011-12-09 16:36 | 141K | |
![[ ]](/icons/layout.gif) | 0GEAR OIL 80W-90 AUGUST 2013.pdf | 2013-09-25 11:21 | 247K | |
![[ ]](/icons/layout.gif) | 0GEAR OIL 80W-90 MARCH 2015.pdf | 2015-03-31 15:43 | 249K | |
![[ ]](/icons/layout.gif) | 0GEAR OIL 85W-140 AUGUST 2013.pdf | 2013-09-25 11:25 | 249K | |
![[ ]](/icons/layout.gif) | 0GEAR OIL 85W-140 MARCH 2015.pdf | 2015-03-30 12:20 | 248K | |
![[ ]](/icons/layout.gif) | 0GEAR OIL 140 AUGUST 2013.pdf | 2013-09-25 11:26 | 183K | |
![[ ]](/icons/layout.gif) | 0GEAR OIL 140 MARCH 2015.pdf | 2015-03-31 15:57 | 186K | |
![[ ]](/icons/layout.gif) | 0GEAROIL EP Oct 2011.pdf | 2011-12-15 20:50 | 146K | |
![[ ]](/icons/layout.gif) | 0GEAROIL SYN 220 Oct 2011.pdf | 2012-01-10 13:16 | 146K | |
![[ ]](/icons/layout.gif) | 0GENERAL PURPOSE TWO STROKE OIL Oct 2011.pdf | 2011-12-20 12:22 | 143K | |
![[ ]](/icons/layout.gif) | 0GLASS CLEANER DECEMBER 2015.pdf | 2015-12-09 09:49 | 369K | |
![[ ]](/icons/layout.gif) | 0GLASS CLEANER SEPTEMBER 2013.pdf | 2013-12-02 15:06 | 295K | |
![[ ]](/icons/layout.gif) | 0GRAPHITE GREASE JULY 2014.pdf | 2014-07-21 17:15 | 166K | |
![[ ]](/icons/layout.gif) | 0GRAPHITE GREASE MAY 2015.pdf | 2015-05-07 09:58 | 166K | |
![[ ]](/icons/layout.gif) | 0GRAPHITE GREASE Oct 2011.pdf | 2011-12-20 12:28 | 140K | |
![[ ]](/icons/layout.gif) | 0Gear Box 30 and 40 JAN 2010.pdf | 2011-12-15 20:50 | 192K | |
![[ ]](/icons/layout.gif) | 0Gear Box 30 and 40 JAN 2011.pdf | 2011-12-15 20:50 | 200K | |
![[ ]](/icons/layout.gif) | 0Gear Oil EP.pdf | 2011-12-15 20:50 | 48K | |
![[ ]](/icons/layout.gif) | 0Gear Oil EP JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | 0HD GEAR OIL 80W-90 SEPTEMBER 2015.pdf | 2015-11-05 10:23 | 174K | |
![[ ]](/icons/layout.gif) | 0HD GEAR OIL 85W-140 JANUARY 2016.pdf | 2016-04-12 12:58 | 173K | |
![[ ]](/icons/layout.gif) | 0HD GEAR OIL 85W-140 SEPTEMBER 2015.pdf | 2015-10-08 12:13 | 173K | |
![[ ]](/icons/layout.gif) | 0HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL Aug 2012.pdf | 2012-08-27 14:17 | 193K | |
![[ ]](/icons/layout.gif) | 0HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL August 2012.pdf | 2012-08-30 17:05 | 192K | |
![[ ]](/icons/layout.gif) | 0HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL JAN 2012.pdf | 2012-08-06 13:33 | 156K | |
![[ ]](/icons/layout.gif) | 0HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL JANUARY 2015.pdf | 2015-01-14 10:04 | 229K | |
![[ ]](/icons/layout.gif) | 0HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL MAY 2015.pdf | 2015-05-01 11:24 | 215K | |
![[ ]](/icons/layout.gif) | 0HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL NOVEMBER 2013.pdf | 2013-11-13 10:59 | 245K | |
![[ ]](/icons/layout.gif) | 0HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL NOVEMBER 2014.pdf | 2014-11-26 17:00 | 285K | |
![[ ]](/icons/layout.gif) | 0HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL Nov 2011.pdf | 2012-02-01 16:48 | 156K | |
![[ ]](/icons/layout.gif) | 0HD OIL FEB 2014.pdf | 2014-03-13 10:00 | 225K | |
![[ ]](/icons/layout.gif) | 0HD OIL Nov 2011.pdf | 2011-12-15 20:50 | 141K | |
![[ ]](/icons/layout.gif) | 0HD OIL Oct 2011.pdf | 2011-12-20 12:15 | 141K | |
![[ ]](/icons/layout.gif) | 0HD Oil.pdf | 2011-12-15 20:50 | 89K | |
![[ ]](/icons/layout.gif) | 0HD Oil JAN 2010.pdf | 2011-12-15 20:50 | 193K | |
![[ ]](/icons/layout.gif) | 0HDPS FLUID APRIL 2010.pdf | 2011-12-15 20:50 | 181K | |
![[ ]](/icons/layout.gif) | 0HDPS FLUID Oct 2011.pdf | 2011-12-20 13:16 | 142K | |
![[ ]](/icons/layout.gif) | 0HDPS FLUID SEPTEMBER 2013.pdf | 2013-09-10 11:30 | 154K | |
![[ ]](/icons/layout.gif) | 0HEAVY DUTY AFAB 5050 PREMIX August 2012.pdf | 2012-09-03 12:17 | 203K | |
![[ ]](/icons/layout.gif) | 0HEAVY DUTY AFAB 5050 PREMIX Oct 2011.pdf | 2011-12-20 12:34 | 151K | |
![[ ]](/icons/layout.gif) | 0HERITAGE ENGINE OILS.pdf | 2011-12-15 20:50 | 90K | |
![[ ]](/icons/layout.gif) | 0HERITAGE LTM and MTH AUGUST 2013.pdf | 2013-08-28 11:50 | 227K | |
![[ ]](/icons/layout.gif) | 0HERITAGE LTM and MTH DECEMBER 2015.pdf | 2015-12-11 08:51 | 265K | |
![[ ]](/icons/layout.gif) | 0HERITAGE LTM and MTH FEBRUARY 2016.pdf | 2016-02-17 15:49 | 265K | |
![[ ]](/icons/layout.gif) | 0HERITAGE LTM and MTH MARCH 2014.pdf | 2014-03-28 16:41 | 227K | |
![[ ]](/icons/layout.gif) | 0HERITAGE LTMandMTH Oct 2011.pdf | 2011-12-09 16:18 | 143K | |
![[ ]](/icons/layout.gif) | 0HIGH TEMPERATURE WHEEL BEARING GREASE JULY 2015.pdf | 2015-07-29 17:13 | 189K | |
![[ ]](/icons/layout.gif) | 0HIGH TEMP WHEEL BEARING GREASE JULY 2014.pdf | 2014-07-18 16:52 | 426K | |
![[ ]](/icons/layout.gif) | 0HIGH TEMP WHEEL BEARING GREASE JUNE 2012.pdf | 2013-04-22 17:21 | 203K | |
![[ ]](/icons/layout.gif) | 0HIGH TEMP WHEEL BEARING GREASE Oct 2011.pdf | 2011-12-20 12:26 | 146K | |
![[ ]](/icons/layout.gif) | 0HIPER TWO STROKE Oct 2011.pdf | 2011-12-20 12:21 | 143K | |
![[ ]](/icons/layout.gif) | 0HONING OIL JAN 2010.pdf | 2011-12-15 20:50 | 193K | |
![[ ]](/icons/layout.gif) | 0HONING OIL Oct 2011.pdf | 2011-12-20 14:23 | 139K | |
![[ ]](/icons/layout.gif) | 0HPR 0 0W30 MAY 2012.pdf | 2012-05-23 12:49 | 114K | |
![[ ]](/icons/layout.gif) | 0HPR 0 0W30 Mar 2012.pdf | 2012-03-28 15:24 | 128K | |
![[ ]](/icons/layout.gif) | 0HPR 0 JANUARY 2015.pdf | 2015-01-30 11:42 | 295K | |
![[ ]](/icons/layout.gif) | 0HPR 0 June 2013.pdf | 2013-06-14 15:02 | 290K | |
![[ ]](/icons/layout.gif) | 0HPR 5 AUG 2012.pdf | 2012-10-22 10:13 | 221K | |
![[ ]](/icons/layout.gif) | 0HPR 5 FEBRUARY 2015.pdf | 2015-02-12 10:15 | 313K | |
![[ ]](/icons/layout.gif) | 0HPR 5 FEBRUARY 2016.pdf | 2016-07-20 12:40 | 404K | |
![[ ]](/icons/layout.gif) | 0HPR 5 JAN 2011.pdf | 2011-12-15 20:50 | 201K | |
![[ ]](/icons/layout.gif) | 0HPR 5 June 2013.pdf | 2013-06-06 10:39 | 306K | |
![[ ]](/icons/layout.gif) | 0HPR 5 MAY 2012.pdf | 2012-05-23 13:47 | 114K | |
![[ ]](/icons/layout.gif) | 0HPR 5 Mar 2012.pdf | 2012-04-18 12:34 | 93K | |
![[ ]](/icons/layout.gif) | 0HPR 5 NOVEMBER 2014.pdf | 2015-02-03 13:37 | 298K | |
![[ ]](/icons/layout.gif) | 0HPR 5 November 2013.pdf | 2013-11-19 14:36 | 294K | |
![[ ]](/icons/layout.gif) | 0HPR 5 Oct 2011.pdf | 2011-12-15 20:50 | 226K | |
![[ ]](/icons/layout.gif) | 0HPR 5 September 2012.pdf | 2012-09-20 11:06 | 217K | |
![[ ]](/icons/layout.gif) | 0HPR 5 September 2014.pdf | 2014-09-19 15:08 | 295K | |
![[ ]](/icons/layout.gif) | 0HPR 10 FEBRUARY 2015.pdf | 2015-02-11 16:32 | 301K | |
![[ ]](/icons/layout.gif) | 0HPR 10 June 2013.pdf | 2013-06-07 16:37 | 303K | |
![[ ]](/icons/layout.gif) | 0HPR 10 Oct 2011.pdf | 2012-04-03 15:06 | 130K | |
![[ ]](/icons/layout.gif) | 0HPR 10 September 2014.pdf | 2014-09-19 15:26 | 293K | |
![[ ]](/icons/layout.gif) | 0HPR 15.pdf | 2011-12-15 20:50 | 50K | |
![[ ]](/icons/layout.gif) | 0HPR 15 June 2013.pdf | 2013-06-07 16:38 | 299K | |
![[ ]](/icons/layout.gif) | 0HPR 15 Nov 2011.pdf | 2012-04-03 17:21 | 129K | |
![[ ]](/icons/layout.gif) | 0HPR 15 September 2014.pdf | 2014-09-19 15:46 | 289K | |
![[ ]](/icons/layout.gif) | 0HPR 30.pdf | 2011-12-15 20:50 | 49K | |
![[ ]](/icons/layout.gif) | 0HPR 30 DECEMBER 2015.pdf | 2015-12-07 10:33 | 377K | |
![[ ]](/icons/layout.gif) | 0HPR 30 JULY 2015.pdf | 2015-07-20 11:20 | 298K | |
![[ ]](/icons/layout.gif) | 0HPR 30 JUNE 2011.pdf | 2011-12-15 20:50 | 91K | |
![[ ]](/icons/layout.gif) | 0HPR 30 June 2013.pdf | 2013-06-06 10:37 | 236K | |
![[ ]](/icons/layout.gif) | 0HPR 30 MARCH 2015.pdf | 2015-03-19 13:15 | 298K | |
![[ ]](/icons/layout.gif) | 0HPR 30 MAY 2012.pdf | 2012-10-23 11:02 | 87K | |
![[ ]](/icons/layout.gif) | 0HPR 30 NOVEMBER 2014.pdf | 2014-11-05 16:27 | 298K | |
![[ ]](/icons/layout.gif) | 0HPR 30 OCTOBER 2014.pdf | 2014-10-16 14:33 | 285K | |
![[ ]](/icons/layout.gif) | 0HPR 30 Oct 2011.pdf | 2012-04-05 13:52 | 123K | |
![[ ]](/icons/layout.gif) | 0HPR 30 SEPTEMBER 2014.pdf | 2014-09-19 16:30 | 285K | |
![[ ]](/icons/layout.gif) | 0HPR 40.pdf | 2011-12-15 20:50 | 45K | |
![[ ]](/icons/layout.gif) | 0HPR 40 DECEMBER 2015.pdf | 2015-12-07 10:34 | 371K | |
![[ ]](/icons/layout.gif) | 0HPR 40 JULY 2014.pdf | 2014-07-17 10:51 | 454K | |
![[ ]](/icons/layout.gif) | 0HPR 40 JUNE 2015.pdf | 2015-06-17 15:21 | 348K | |
![[ ]](/icons/layout.gif) | 0HPR 40 June 2013.pdf | 2013-06-06 10:40 | 249K | |
![[ ]](/icons/layout.gif) | 0HPR 40 MARCH 2015.pdf | 2015-03-19 13:16 | 349K | |
![[ ]](/icons/layout.gif) | 0HPR 40 MAY 2012.pdf | 2012-05-23 15:30 | 92K | |
![[ ]](/icons/layout.gif) | 0HPR 40 Oct 2011.pdf | 2012-04-10 12:36 | 129K | |
![[ ]](/icons/layout.gif) | 0HPR 40 SEPTEMBER 2014.pdf | 2014-09-19 16:50 | 349K | |
![[ ]](/icons/layout.gif) | 0HPR 50.pdf | 2011-12-15 20:50 | 42K | |
![[ ]](/icons/layout.gif) | 0HPR 50 DECEMEBR 2015.pdf | 2015-12-07 10:36 | 385K | |
![[ ]](/icons/layout.gif) | 0HPR 50 JUNE 2015.pdf | 2015-06-17 15:15 | 374K | |
![[ ]](/icons/layout.gif) | 0HPR 50 June 2013.pdf | 2013-06-06 10:41 | 238K | |
![[ ]](/icons/layout.gif) | 0HPR 50 MARCH 2015.pdf | 2015-03-19 13:16 | 288K | |
![[ ]](/icons/layout.gif) | 0HPR 50 MAY 2012.pdf | 2012-05-23 17:00 | 91K | |
![[ ]](/icons/layout.gif) | 0HPR 50 Oct 2011.pdf | 2012-04-10 14:19 | 129K | |
![[ ]](/icons/layout.gif) | 0HPR 50 September 2014.pdf | 2014-09-19 17:31 | 282K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL.pdf | 2011-12-15 20:50 | 70K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL 5.pdf | 2011-12-15 20:50 | 51K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL 5 AUG 2012.pdf | 2012-08-13 14:37 | 219K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL 5 April 2012.pdf | 2012-04-17 11:55 | 131K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL 5 JULY 2012.pdf | 2012-10-03 11:44 | 219K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL 5 MAY 2012.pdf | 2012-05-23 15:45 | 94K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL 5 Oct 2011.pdf | 2012-02-22 15:23 | 212K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL 15.pdf | 2011-12-15 20:50 | 50K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL 15 AUG 2012.pdf | 2012-10-22 10:52 | 219K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL 15 JULY 2012.pdf | 2012-10-03 11:46 | 219K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL 15 MAY 2012.pdf | 2012-05-23 17:02 | 114K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL 15 Oct 2011.pdf | 2012-04-17 16:39 | 114K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL AUG 2012.pdf | 2012-08-13 14:53 | 216K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL August 2012.pdf | 2012-12-14 14:33 | 211K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL DECEMBER 2015.pdf | 2015-12-07 12:26 | 436K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL December 2012.pdf | 2012-12-17 08:37 | 211K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL JULY 2012.pdf | 2012-10-03 11:42 | 216K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL JULY 2015.pdf | 2015-07-20 11:29 | 353K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL MARCH 2015.pdf | 2015-03-27 13:02 | 297K | |
![[ ]](/icons/layout.gif) | 0HPR DIESEL MAY 2016.pdf | 2016-06-16 12:40 | 461K | |
![[ ]](/icons/layout.gif) | 0HPR Diesel 5 June 2013.pdf | 2013-06-17 10:22 | 299K | |
![[ ]](/icons/layout.gif) | 0HPR Diesel 10 June 2013.pdf | 2013-06-17 11:10 | 289K | |
![[ ]](/icons/layout.gif) | 0HPR Diesel 15 June 2013.pdf | 2013-06-17 10:25 | 293K | |
![[ ]](/icons/layout.gif) | 0HPR Diesel June 2013.pdf | 2013-06-17 10:27 | 286K | |
![[ ]](/icons/layout.gif) | 0HPR GAS.pdf | 2011-12-15 20:50 | 50K | |
![[ ]](/icons/layout.gif) | 0HPR GAS 10.pdf | 2011-12-15 20:50 | 73K | |
![[ ]](/icons/layout.gif) | 0HPR GAS 10 AUG 2012.pdf | 2012-10-22 10:18 | 217K | |
![[ ]](/icons/layout.gif) | 0HPR GAS 10 April 2012.pdf | 2012-04-13 11:47 | 113K | |
![[ ]](/icons/layout.gif) | 0HPR GAS 10 MAR 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | 0HPR GAS 10 MARCH 2015.pdf | 2015-03-31 15:19 | 300K | |
![[ ]](/icons/layout.gif) | 0HPR GAS 10 MAY 2012.pdf | 2012-05-23 17:44 | 114K | |
![[ ]](/icons/layout.gif) | 0HPR GAS 10 Oct 2011.pdf | 2011-12-15 20:50 | 211K | |
![[ ]](/icons/layout.gif) | 0HPR GAS AUG 2012.pdf | 2012-10-22 10:29 | 214K | |
![[ ]](/icons/layout.gif) | 0HPR GAS April 2012.pdf | 2012-04-13 11:35 | 113K | |
![[ ]](/icons/layout.gif) | 0HPR GAS JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | 0HPR GAS MAY 2012.pdf | 2012-05-23 17:44 | 113K | |
![[ ]](/icons/layout.gif) | 0HPR GAS Oct 2011.pdf | 2011-12-15 20:50 | 208K | |
![[ ]](/icons/layout.gif) | 0HPR Gas 10 June 2013.pdf | 2013-06-17 13:12 | 288K | |
![[ ]](/icons/layout.gif) | 0HPR Gas June 2013.pdf | 2013-06-17 13:13 | 287K | |
![[ ]](/icons/layout.gif) | 0HPSO.pdf | 2011-12-15 20:50 | 45K | |
![[ ]](/icons/layout.gif) | 0HPSO JULY 2013.pdf | 2013-10-08 15:50 | 271K | |
![[ ]](/icons/layout.gif) | 0HPSO Oct 2011.pdf | 2011-12-20 14:15 | 148K | |
![[ ]](/icons/layout.gif) | 0HTO 32 68 100 DECEMBER 2015.pdf | 2015-12-09 11:41 | 213K | |
![[ ]](/icons/layout.gif) | 0HTO 32 68 100 January 2014.pdf | 2014-01-24 10:41 | 202K | |
![[ ]](/icons/layout.gif) | 0HYDRAULIC JACK OIL OCT 2011.pdf | 2011-12-20 13:12 | 146K | |
![[ ]](/icons/layout.gif) | 0HYPOID 80W-90 MAY 2016.pdf | 2016-05-16 10:04 | 232K | |
![[ ]](/icons/layout.gif) | 0HYPOID 80W90 OCT 2011.pdf | 2011-12-20 11:02 | 148K | |
![[ ]](/icons/layout.gif) | 0HYPOID 85W-140 MAY 2016.pdf | 2016-05-16 10:07 | 233K | |
![[ ]](/icons/layout.gif) | 0HYPOID 85W140 OCT 2011.pdf | 2011-12-20 11:03 | 147K | |
![[ ]](/icons/layout.gif) | 0HYPOID 140 OCT 2011.pdf | 2011-12-20 11:04 | 143K | |
![[ ]](/icons/layout.gif) | 0Heavy Duty AFAB.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | 0Heavy Duty AFAB 50 Premix.pdf | 2011-12-15 20:50 | 57K | |
![[ ]](/icons/layout.gif) | 0Heritage LTM AND MTH JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | 0Heritage LTM AND MTH MAY 2010.pdf | 2011-12-15 20:50 | 200K | |
![[ ]](/icons/layout.gif) | 0Heritage LTM and MTH.pdf | 2011-12-15 20:50 | 87K | |
![[ ]](/icons/layout.gif) | 0HiPer Two Stroke JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | 0INDGEAR MP90 April 2013.pdf | 2013-04-22 15:19 | 200K | |
![[ ]](/icons/layout.gif) | 0INDGREASE 100 LXEP2 AUGUST 2014.pdf | 2014-08-18 10:55 | 241K | |
![[ ]](/icons/layout.gif) | 0INDGREASE 100 LXEP2 December 2012.pdf | 2013-04-22 17:27 | 202K | |
![[ ]](/icons/layout.gif) | 0INDGREASE 100 LXEP2 Oct 2011.pdf | 2011-12-20 12:29 | 147K | |
![[ ]](/icons/layout.gif) | 0INDGREASE 100 LXEP2 September 2013.pdf | 2013-11-27 09:04 | 203K | |
![[ ]](/icons/layout.gif) | 0INDGREASE 1615WR GREASE AUGUST 2014.pdf | 2014-08-25 15:15 | 169K | |
![[ ]](/icons/layout.gif) | 0INDGREASE BM3 AUGUST 2014.pdf | 2014-08-21 17:22 | 218K | |
![[ ]](/icons/layout.gif) | 0INDGREASE BM3 JULY 2015.pdf | 2015-08-13 14:50 | 219K | |
![[ ]](/icons/layout.gif) | 0INDGREASE BM3 Oct 2011.pdf | 2012-04-17 14:46 | 148K | |
![[ ]](/icons/layout.gif) | 0INDGREASE CXOG-05 AUGUST 2014.pdf | 2014-08-21 15:57 | 236K | |
![[ ]](/icons/layout.gif) | 0INDGREASE LCX 1100 AUGUST 2014.pdf | 2014-08-21 12:32 | 174K | |
![[ ]](/icons/layout.gif) | 0INDGREASE LITH EP 0 AUGUST 2014.pdf | 2014-08-18 09:31 | 162K | |
![[ ]](/icons/layout.gif) | 0INDGREASE LITH R3 AUGUST 2014.pdf | 2014-08-25 16:01 | 216K | |
![[ ]](/icons/layout.gif) | 0INDGREASE LITH R3 December 2012.pdf | 2012-12-10 16:20 | 200K | |
![[ ]](/icons/layout.gif) | 0INDGREASE MOLY HT AUGUST 2014.pdf | 2014-10-24 13:27 | 255K | |
![[ ]](/icons/layout.gif) | 0INDGREASE MOLY HT JUNE 2014.pdf | 2014-06-17 12:31 | 252K | |
![[ ]](/icons/layout.gif) | 0INDGREASE MOLY HT OCTOBER 2014.pdf | 2014-10-24 15:24 | 255K | |
![[ ]](/icons/layout.gif) | 0INDUS COMPRESSOL OIL 2KH SERIES June 2012.pdf | 2012-06-12 16:10 | 118K | |
![[ ]](/icons/layout.gif) | 0INDUS COMPRESSOR OIL 2KH SERIES DECEMBER 2014.pdf | 2014-12-02 12:00 | 223K | |
![[ ]](/icons/layout.gif) | 0INDUS COMPRESSOR OIL 4KH SERIES DECEMBER 2014.pdf | 2014-12-02 12:23 | 363K | |
![[ ]](/icons/layout.gif) | 0INDUS COMPRESSOR OIL 4KH SERIES FEBRUARY 2016.pdf | 2016-02-24 12:58 | 325K | |
![[ ]](/icons/layout.gif) | 0INDUS COMPRESSOR OIL 4KH Series April 2013.pdf | 2013-04-22 16:30 | 191K | |
![[ ]](/icons/layout.gif) | 0INDUS COMPRESSOR OIL 4KH Series December 2012.pdf | 2012-12-10 13:48 | 189K | |
![[ ]](/icons/layout.gif) | 0INDUS COMPRESSOR OIL 4KH Series July 2014.pdf | 2014-07-15 10:46 | 193K | |
![[ ]](/icons/layout.gif) | 0INDUS FRIGOL ABS 68 - FEBRUARY 2015.pdf | 2015-02-20 12:13 | 206K | |
![[ ]](/icons/layout.gif) | 0INDUS GEAR OIL EJ - DECEMBER 2014.pdf | 2014-12-09 17:05 | 163K | |
![[ ]](/icons/layout.gif) | 0INDUS GEAR OIL EJ December 2012.pdf | 2012-12-10 10:17 | 198K | |
![[ ]](/icons/layout.gif) | 0INDUS GEAR OIL EP - DECEMBER 2014.pdf | 2014-12-10 11:43 | 203K | |
![[ ]](/icons/layout.gif) | 0INDUS GEAR OIL EP August 2012.pdf | 2012-08-21 15:48 | 206K | |
![[ ]](/icons/layout.gif) | 0INDUS GEAR OIL EP MAY 2012.pdf | 2012-05-11 13:09 | 116K | |
![[ ]](/icons/layout.gif) | 0INDUS GEAR OIL SYN 220 - DECEMBER 2014.pdf | 2014-12-09 16:43 | 161K | |
![[ ]](/icons/layout.gif) | 0INDUS HV HYDRAULIC OIL AUGUST 2014.pdf | 2014-08-12 15:01 | 214K | |
![[ ]](/icons/layout.gif) | 0INDUS HV HYDRAULIC OIL April 2013.pdf | 2013-04-22 10:28 | 203K | |
![[ ]](/icons/layout.gif) | 0INDUS HV HYDRAULIC OIL August 2012.pdf | 2012-08-21 14:22 | 203K | |
![[ ]](/icons/layout.gif) | 0INDUS HV HYDRAULIC OIL DECEMBER 2014.pdf | 2014-12-05 13:18 | 214K | |
![[ ]](/icons/layout.gif) | 0INDUS HV HYDRAULIC OIL December 2011.pdf | 2011-12-15 20:50 | 149K | |
![[ ]](/icons/layout.gif) | 0INDUS HV HYDRAULIC OIL FEBRUARY 2014.pdf | 2014-02-18 12:01 | 214K | |
![[ ]](/icons/layout.gif) | 0INDUS HV HYDRAULIC OIL NOVEMBER 2013.pdf | 2013-11-14 15:54 | 211K | |
![[ ]](/icons/layout.gif) | 0INDUS HV HYDRAULIC OIL September 2012.pdf | 2012-10-01 13:21 | 203K | |
![[ ]](/icons/layout.gif) | 0INDUS INDGEAR B - DECEMBER 2014.pdf | 2014-12-10 13:10 | 160K | |
![[ ]](/icons/layout.gif) | 0INDUS INDGEAR B - DECEMBER 2015.pdf | 2015-12-09 13:06 | 174K | |
![[ ]](/icons/layout.gif) | 0INDUS INDGEAR B December 2012.pdf | 2012-12-10 09:38 | 201K | |
![[ ]](/icons/layout.gif) | 0INDUS MR 68 HYDRAULIC OIL NOVEMBER 2013.pdf | 2013-11-29 09:31 | 186K | |
![[ ]](/icons/layout.gif) | 0INDUS PRO HYDRAULIC OILS DEC 2011.pdf | 2012-08-06 13:36 | 148K | |
![[ ]](/icons/layout.gif) | 0INDUS PRO HYDRAULIC OILS DECEMBER 2013.pdf | 2013-12-04 16:06 | 234K | |
![[ ]](/icons/layout.gif) | 0INDUS PRO HYDRAULIC OILS DECEMBER 2014.pdf | 2014-12-15 17:02 | 234K | |
![[ ]](/icons/layout.gif) | 0INDUS PRO HYDRAULIC OILS MAY 2015.pdf | 2015-05-27 09:48 | 232K | |
![[ ]](/icons/layout.gif) | 0INDUS PRO HYDRAULIC OILS OCTOBER 2015.pdf | 2015-10-21 17:34 | 203K | |
![[ ]](/icons/layout.gif) | 0INTERIOR CLEANER SEPTEMBER 2013.pdf | 2013-10-10 17:09 | 294K | |
![[ ]](/icons/layout.gif) | 0Indgrease 1615WR February 2013.pdf | 2013-04-22 17:42 | 200K | |
![[ ]](/icons/layout.gif) | 0Indgrease CXOG-05 December 2012.pdf | 2013-04-22 17:36 | 203K | |
![[ ]](/icons/layout.gif) | 0Indgrease LCX 1100 December 2012.pdf | 2013-04-23 09:55 | 200K | |
![[ ]](/icons/layout.gif) | 0Indgrease Moly HT April 2013.pdf | 2013-04-23 11:38 | 189K | |
![[ ]](/icons/layout.gif) | 0Indus HV JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | 0Indus HV March 2011.pdf | 2011-12-15 20:50 | 93K | |
![[ ]](/icons/layout.gif) | 0Japan 25.pdf | 2011-12-15 20:50 | 132K | |
![[ ]](/icons/layout.gif) | 0LDAS APRIL 2015.pdf | 2015-04-01 17:01 | 222K | |
![[ ]](/icons/layout.gif) | 0LDAS FLUID AUGUST 2013.pdf | 2013-08-08 14:43 | 166K | |
![[ ]](/icons/layout.gif) | 0LDAS FLUID MARCH 2015.pdf | 2015-03-31 08:50 | 222K | |
![[ ]](/icons/layout.gif) | 0LDAS FLUID Oct 2011.pdf | 2011-12-20 14:16 | 157K | |
![[ ]](/icons/layout.gif) | 0LDAS MAR 2011.pdf | 2011-12-15 20:50 | 228K | |
![[ ]](/icons/layout.gif) | 0LHM PLUS JULY 2013.pdf | 2013-08-08 14:47 | 224K | |
![[ ]](/icons/layout.gif) | 0LHM PLUS JUNE 2015.pdf | 2015-06-24 16:16 | 234K | |
![[ ]](/icons/layout.gif) | 0LHM PLUS Oct 2011.pdf | 2011-12-20 14:13 | 154K | |
![[ ]](/icons/layout.gif) | 0LIMSLIP 85W-140 APRIL 2014.pdf | 2014-04-29 15:45 | 206K | |
![[ ]](/icons/layout.gif) | 0LIMSLIP 90, 854W140, 140 Oct 2011.pdf | 2011-12-20 11:07 | 149K | |
![[ ]](/icons/layout.gif) | 0LIMSLIP 90 MAY 2016.pdf | 2016-05-16 10:37 | 257K | |
![[ ]](/icons/layout.gif) | 0LIMSLIP ADDITIVE JUNE 2015.pdf | 2015-06-23 15:11 | 217K | |
![[ ]](/icons/layout.gif) | 0LIMSLIP ADDITIVE Oct 2011.pdf | 2011-12-20 11:10 | 145K | |
![[ ]](/icons/layout.gif) | 0LZ 7906 JAN 2010.pdf | 2011-12-15 20:50 | 229K | |
![[ ]](/icons/layout.gif) | 0LZ7906 Oct 2011.pdf | 2011-12-20 11:10 | 141K | |
![[ ]](/icons/layout.gif) | 0Limslip 90, 85-140 and 140.pdf | 2011-12-15 20:50 | 148K | |
![[ ]](/icons/layout.gif) | 0Limslip 90, 85W-140 and 140 April 2011.pdf | 2011-12-15 20:50 | 92K | |
![[ ]](/icons/layout.gif) | 0Limslip 90, 85W-140 and 140 JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | 0Limslip 90, 85W-140 and 140 JAN 2011.pdf | 2011-12-15 20:50 | 202K | |
![[ ]](/icons/layout.gif) | 0MANUAL GEAR OIL 70 OCT 2011.pdf | 2011-12-20 11:11 | 151K | |
![[ ]](/icons/layout.gif) | 0MANUAL GEAR OIL 75 OCT 2011.pdf | 2011-12-20 11:13 | 151K | |
![[ ]](/icons/layout.gif) | 0MANUAL GEAR OIL 80 OCT 2011.pdf | 2011-12-20 11:14 | 150K | |
![[ ]](/icons/layout.gif) | 0MARINE GEAR OIL 75W90 FEBRUARY 2015.pdf | 2015-02-13 15:35 | 232K | |
![[ ]](/icons/layout.gif) | 0MARINE GEAR OIL 75W90 OCT 2011.pdf | 2011-12-20 14:09 | 151K | |
![[ ]](/icons/layout.gif) | 0MARINE GEAR OIL SS150 & SS300 DECEMBER 2014.pdf | 2014-12-12 16:44 | 290K | |
![[ ]](/icons/layout.gif) | 0MARINE GEAR OIL SS150 & SS300 DECEMBER 2015.pdf | 2015-12-09 15:41 | 349K | |
![[ ]](/icons/layout.gif) | 0MARINE GEAR OIL SS150 & SS300 MARCH 2015.pdf | 2015-03-04 10:14 | 344K | |
![[ ]](/icons/layout.gif) | 0MARINE GREASE FEBRUARY 2015.pdf | 2015-02-12 17:24 | 238K | |
![[ ]](/icons/layout.gif) | 0MARINE GREASE JUNE 2014.pdf | 2014-06-20 10:00 | 173K | |
![[ ]](/icons/layout.gif) | 0MARINE GREASE NOVEMBER 2013.pdf | 2014-01-29 13:18 | 155K | |
![[ ]](/icons/layout.gif) | 0MARINE INBOARD FOUR STROKE 25W40 FEBRUARY 2015.pdf | 2015-02-13 10:41 | 183K | |
![[ ]](/icons/layout.gif) | 0MARINE OUTBOARD FOUR STROKE 10W30 DECEMBER 2013.pdf | 2013-12-20 12:08 | 182K | |
![[ ]](/icons/layout.gif) | 0MARINE OUTBOARD FOUR STROKE 10W30 FEBRUARY 2015.pdf | 2015-02-13 09:52 | 184K | |
![[ ]](/icons/layout.gif) | 0MARINE OUTBOARD FOUR STROKE 10W40 DECEMBER 2013.pdf | 2014-03-13 15:11 | 181K | |
![[ ]](/icons/layout.gif) | 0MARINE OUTBOARD FOUR STROKE OIL OCT 2011.pdf | 2011-12-20 14:10 | 146K | |
![[ ]](/icons/layout.gif) | 0MARINE OUTBOARD TWO STROKE OIL DECEMBER 2013.pdf | 2014-03-12 08:40 | 256K | |
![[ ]](/icons/layout.gif) | 0MARINE OUTBOARD TWO STROKE OIL June 2012.pdf | 2012-08-28 11:32 | 217K | |
![[ ]](/icons/layout.gif) | 0MARINE OUTBOARD TWO STROKE OIL OCT 2011.pdf | 2011-12-20 14:10 | 153K | |
![[ ]](/icons/layout.gif) | 0MARINE OUTBOARD TWO STROKE OIL OCTOBER 2015.pdf | 2015-12-09 16:31 | 260K | |
![[ ]](/icons/layout.gif) | 0MB 15 SUSPENSION FLUID APRIL 2015.pdf | 2015-05-11 12:12 | 269K | |
![[ ]](/icons/layout.gif) | 0MB 15 SUSPENSION FLUID JULY 2013.pdf | 2013-08-02 16:47 | 265K | |
![[ ]](/icons/layout.gif) | 0MB 15 SUSPENSION FLUID OCT 2011.pdf | 2011-12-20 14:15 | 150K | |
![[ ]](/icons/layout.gif) | 0MC-2 FULL SYNTHETIC TWO STROKE OIL APRIL 2015.pdf | 2015-04-16 13:07 | 308K | |
![[ ]](/icons/layout.gif) | 0MC-4 MINERAL 15W-50 APRIL 2015.pdf | 2016-03-03 16:17 | 355K | |
![[ ]](/icons/layout.gif) | 0MC-4 MINERAL 20W-50 MARCH 2016.pdf | 2016-06-16 12:13 | 395K | |
![[ ]](/icons/layout.gif) | 0MC-4 SEMI SYNTHETIC 10W-30 MARCH 2015.pdf | 2015-05-01 10:08 | 305K | |
![[ ]](/icons/layout.gif) | 0MC-4 SEMI SYNTHETIC 10W-50 APRIL 2015.pdf | 2015-05-01 10:26 | 341K | |
![[ ]](/icons/layout.gif) | 0MC-4 SEMI SYNTHETIC 15W-50 APRIL 2015.pdf | 2015-05-01 10:25 | 297K | |
![[ ]](/icons/layout.gif) | 0MC-4 V TWIN 20W-50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MAY 2016.pdf | 2016-05-13 15:19 | 366K | |
![[ ]](/icons/layout.gif) | 0MC2ST FULL SYNTHETIC TWO STROKE MOTORCYCLE OIL JULY 2013.pdf | 2013-09-05 17:12 | 307K | |
![[ ]](/icons/layout.gif) | 0MC2ST FULL SYNTH TWO STROKE MOTORCYCLE OIL August 2012.pdf | 2012-08-28 12:18 | 215K | |
![[ ]](/icons/layout.gif) | 0MC2ST SEMI SYNTHETIC TWO STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-02-04 13:46 | 326K | |
![[ ]](/icons/layout.gif) | 0MC2ST SEMI SYNTHETIC TWO STROKE MOTORCYCLE OIL JULY 2013.pdf | 2013-09-20 12:24 | 305K | |
![[ ]](/icons/layout.gif) | 0MC4-ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2016.pdf | 2016-06-16 12:15 | 342K | |
![[ ]](/icons/layout.gif) | 0MC4-ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL APRIL 2015.pdf | 2015-05-01 09:13 | 327K | |
![[ ]](/icons/layout.gif) | 0MC4-ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2016.pdf | 2016-06-16 12:18 | 372K | |
![[ ]](/icons/layout.gif) | 0MC4-ST 15W50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2016.pdf | 2016-06-16 12:20 | 370K | |
![[ ]](/icons/layout.gif) | 0MC4 FULL SYNTHETIC 10W40 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-03 15:38 | 341K | |
![[ ]](/icons/layout.gif) | 0MC4 MINERAL 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-03 15:37 | 318K | |
![[ ]](/icons/layout.gif) | 0MC4 SEMI SYNTHETIC 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-03 15:36 | 325K | |
![[ ]](/icons/layout.gif) | 0MC4ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL JULY 2013.pdf | 2013-12-12 16:25 | 309K | |
![[ ]](/icons/layout.gif) | 0MC4ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL JULY 2014.pdf | 2014-07-18 12:09 | 468K | |
![[ ]](/icons/layout.gif) | 0MC4ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-13 12:30 | 307K | |
![[ ]](/icons/layout.gif) | 0MC4ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-13 13:10 | 335K | |
![[ ]](/icons/layout.gif) | 0MC4ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL OCTOBER 2013.pdf | 2013-12-12 16:16 | 337K | |
![[ ]](/icons/layout.gif) | 0MC4ST 10W50 SEMI SYNTHETIC FOUR STROKE MOTORCYCLE OIL JANUARY 2015.pdf | 2015-02-16 15:35 | 357K | |
![[ ]](/icons/layout.gif) | 0MC4ST 10W50 SEMI SYNTHETIC FOUR STROKE MOTORCYCLE OIL JULY 2013.pdf | 2013-07-11 16:45 | 361K | |
![[ ]](/icons/layout.gif) | 0MC4ST 10W50 SEMI SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-17 16:55 | 324K | |
![[ ]](/icons/layout.gif) | 0MC4ST 15W50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-13 18:00 | 336K | |
![[ ]](/icons/layout.gif) | 0MC4ST 15W50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL OCTOBER 2013.pdf | 2013-12-12 16:25 | 338K | |
![[ ]](/icons/layout.gif) | 0MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-01-23 14:27 | 334K | |
![[ ]](/icons/layout.gif) | 0MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JULY 2013.pdf | 2013-10-03 15:11 | 349K | |
![[ ]](/icons/layout.gif) | 0MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2015.pdf | 2015-02-20 14:31 | 294K | |
![[ ]](/icons/layout.gif) | 0MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-13 11:34 | 248K | |
![[ ]](/icons/layout.gif) | 0MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL NOV 2012.pdf | 2013-12-17 11:05 | 206K | |
![[ ]](/icons/layout.gif) | 0MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL SEPTEMBER 2014.pdf | 2014-09-10 15:18 | 313K | |
![[ ]](/icons/layout.gif) | 0MC FOAM FILTER CLEANER JUNE 2013.pdf | 2014-06-20 14:15 | 283K | |
![[ ]](/icons/layout.gif) | 0MC FOAM FILTER OIL SEPTEMBER 2013.pdf | 2014-03-27 09:22 | 246K | |
![[ ]](/icons/layout.gif) | 0MC FORK OIL APRIL 2015.pdf | 2015-04-30 16:08 | 203K | |
![[ ]](/icons/layout.gif) | 0MC FORK OIL DECEMEBR 2015.pdf | 2015-12-08 15:28 | 248K | |
![[ ]](/icons/layout.gif) | 0MC FORK OIL JUNE 2015.pdf | 2015-06-30 11:29 | 232K | |
![[ ]](/icons/layout.gif) | 0MDEO RANGE (12 & 15 TBN) DECEMBER 2014.pdf | 2014-12-15 12:11 | 179K | |
![[ ]](/icons/layout.gif) | 0MILD EP GEAR OIL AUGUST 2013.pdf | 2013-12-02 09:53 | 287K | |
![[ ]](/icons/layout.gif) | 0MILD EP GEAR OIL OCT 2011.pdf | 2011-12-20 11:41 | 144K | |
![[ ]](/icons/layout.gif) | 0MOLYGREASE EP 3 APRIL 2014.pdf | 2014-07-18 09:25 | 468K | |
![[ ]](/icons/layout.gif) | 0MOLYGREASE EP 3 OCT 2011.pdf | 2012-01-18 16:56 | 144K | |
![[ ]](/icons/layout.gif) | 0MONO TRUCK 30 APRIL 2014.pdf | 2014-04-16 12:32 | 172K | |
![[ ]](/icons/layout.gif) | 0MONO TRUCK 30 NOVEMBER 2013.pdf | 2013-12-12 14:18 | 169K | |
![[ ]](/icons/layout.gif) | 0MONO TRUCK 40 APRIL 2014.pdf | 2014-04-16 15:23 | 180K | |
![[ ]](/icons/layout.gif) | 0MONO TRUCK 40 NOVEMBER 2013.pdf | 2013-12-12 14:19 | 182K | |
![[ ]](/icons/layout.gif) | 0MONO TRUCK 50 APRIL 2014.pdf | 2014-04-16 12:32 | 173K | |
![[ ]](/icons/layout.gif) | 0MONO TRUCK 50 NOVEMBER 2013.pdf | 2013-12-12 14:19 | 171K | |
![[ ]](/icons/layout.gif) | 0MONO TRUCK December 2012.pdf | 2012-12-07 15:00 | 201K | |
![[ ]](/icons/layout.gif) | 0MONO TRUCK OCT 2011.pdf | 2011-12-20 12:06 | 156K | |
![[ ]](/icons/layout.gif) | 0MOTORCYCLE FORK OILS MAY 2012.pdf | 2012-08-30 13:28 | 96K | |
![[ ]](/icons/layout.gif) | 0MOTORCYCLE FORK OILS OCTOBER 2014.pdf | 2014-10-28 12:14 | 193K | |
![[ ]](/icons/layout.gif) | 0MOTORCYCLE FORK OILS SEPTEMBER 2013.pdf | 2013-09-12 12:01 | 173K | |
![[ ]](/icons/layout.gif) | 0MOTORCYCLE GEAR OIL APRIL 2015.pdf | 2015-04-20 11:55 | 315K | |
![[ ]](/icons/layout.gif) | 0MULTI TRUCK 25 MAR 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | 0Manual Gear Oil 80.pdf | 2011-12-15 20:50 | 58K | |
![[ ]](/icons/layout.gif) | 0Marine Gear Oil JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | 0Marine Inboard 25W-40 REV 0 0 1211.pdf | 2012-08-30 12:49 | 79K | |
![[ ]](/icons/layout.gif) | 0Mild EP Gear oil JAN 2010.pdf | 2011-12-15 20:50 | 193K | |
![[ ]](/icons/layout.gif) | 0Moly 3% Grease.pdf | 2011-12-15 20:50 | 86K | |
![[ ]](/icons/layout.gif) | 0Mono Truck.pdf | 2011-12-15 20:50 | 57K | |
![[ ]](/icons/layout.gif) | 0Mono Truck JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | 0Motorcycle Gear Oil July 2013.pdf | 2013-10-23 16:26 | 381K | |
![[ ]](/icons/layout.gif) | 0P26 BRAKE PARTS CLEANER JANUARY 2016.pdf | 2016-01-15 10:36 | 267K | |
![[ ]](/icons/layout.gif) | 0P26 MULTI-PURPOSE DEGREASER JANUARY 2016.pdf | 2016-01-12 07:56 | 206K | |
![[ ]](/icons/layout.gif) | 0P26 MULTI-PURPOSE MoS2 LUBE JULY 2015.pdf | 2015-11-05 12:34 | 320K | |
![[ ]](/icons/layout.gif) | 0P26 MULTI-PURPOSE MoS2 LUBE JUNE 2016.pdf | 2016-06-08 07:58 | 315K | |
![[ ]](/icons/layout.gif) | 0P26 THROTTLE BODY & CARB CLEANER JANUARY 2016.pdf | 2016-01-15 10:42 | 210K | |
![[ ]](/icons/layout.gif) | 0PAS FLUID Aug 2012.pdf | 2012-08-30 14:44 | 211K | |
![[ ]](/icons/layout.gif) | 0PAS FLUID December 2012.pdf | 2012-12-07 14:43 | 198K | |
![[ ]](/icons/layout.gif) | 0PAS FLUID JULY 2013.pdf | 2013-10-08 15:48 | 155K | |
![[ ]](/icons/layout.gif) | 0PAS FLUID OCT 2011.pdf | 2011-12-20 14:14 | 151K | |
![[ ]](/icons/layout.gif) | 0PEN 4297 April 2013.pdf | 2013-04-22 12:34 | 200K | |
![[ ]](/icons/layout.gif) | 0PEN 4297 Aug 2012.pdf | 2012-08-16 11:36 | 197K | |
![[ ]](/icons/layout.gif) | 0PEN 4297 JULY 2013.pdf | 2014-03-31 13:09 | 204K | |
![[ ]](/icons/layout.gif) | 0PEN 4297 OCT 2011.pdf | 2011-12-20 10:55 | 141K | |
![[ ]](/icons/layout.gif) | 0PENBLUE NOVEMBER 2013.pdf | 2013-12-11 11:28 | 163K | |
![[ ]](/icons/layout.gif) | 0PENRITE HAND CLEANER JANUARY 2016.pdf | 2016-02-19 10:07 | 262K | |
![[ ]](/icons/layout.gif) | 0PETROL INJECTOR CLEANER - APRIL 2014.pdf | 2014-04-01 16:05 | 174K | |
![[ ]](/icons/layout.gif) | 0PETROL INJECTOR CLEANER - FEBRUARY 2015.pdf | 2015-02-17 12:12 | 236K | |
![[ ]](/icons/layout.gif) | 0PGXL COOLANT PREMIX MAY 2013.pdf | 2015-05-01 11:57 | 256K | |
![[ ]](/icons/layout.gif) | 0PGXL COOLANT PREMIX MAY 2015.pdf | 2015-05-22 09:51 | 256K | |
![[ ]](/icons/layout.gif) | 0PGXL Coolant Premix April 2013.pdf | 2013-04-18 12:31 | 191K | |
![[ ]](/icons/layout.gif) | 0PI_Gear Oil EP_PSD.pdf | 2011-12-15 20:50 | 131K | |
![[ ]](/icons/layout.gif) | 0POWER STEERING FLUID JULY 2013.pdf | 2013-10-08 15:41 | 235K | |
![[ ]](/icons/layout.gif) | 0POWER STEERING FLUID MARCH 2015.pdf | 2015-04-01 16:23 | 236K | |
![[ ]](/icons/layout.gif) | 0POWER STEERING FLUID May 2013.pdf | 2013-05-20 16:38 | 265K | |
![[ ]](/icons/layout.gif) | 0POWER STEERING FLUID OCT 2011.pdf | 2011-12-20 14:16 | 154K | |
![[ ]](/icons/layout.gif) | 0POWER STEERING STOP LEAK - APRIL 2014.pdf | 2014-04-01 12:06 | 218K | |
![[ ]](/icons/layout.gif) | 0PREMIUM MINERAL 5W-30 NOVEMBER 2015.pdf | 2015-11-23 15:14 | 334K | |
![[ ]](/icons/layout.gif) | 0PREMIUM MINERAL 10W-30 NOVEMBER 2015.pdf | 2015-11-23 10:22 | 337K | |
![[ ]](/icons/layout.gif) | 0PREMIUM MINERAL 15W-40 NOVEMBER 2015.pdf | 2015-11-23 10:30 | 336K | |
![[ ]](/icons/layout.gif) | 0PREMIUM MINERAL 20W-50 NOVEMBER 2015.pdf | 2015-11-23 13:13 | 335K | |
![[ ]](/icons/layout.gif) | 0PRO 5 5W-30 MAY 2016.pdf | 2016-05-05 15:01 | 339K | |
![[ ]](/icons/layout.gif) | 0PRO 10 10W-30 JUNE 2015.pdf | 2015-08-12 12:53 | 286K | |
![[ ]](/icons/layout.gif) | 0PRO COOLANT RADIATOR INHIBITOR AUGUST 2014.pdf | 2014-08-15 15:01 | 282K | |
![[ ]](/icons/layout.gif) | 0PRO COOLING SYSTEM OCT 2011.pdf | 2011-12-20 12:33 | 144K | |
![[ ]](/icons/layout.gif) | 0PRO ENGINE OIL 20 Aug 2012.pdf | 2012-08-15 16:40 | 200K | |
![[ ]](/icons/layout.gif) | 0PRO ENGINE OIL Pro Extra Aug 2012.pdf | 2012-08-15 16:52 | 199K | |
![[ ]](/icons/layout.gif) | 0PRO ENGINE OILS 5 & 10 Aug 2012.pdf | 2012-08-15 13:57 | 202K | |
![[ ]](/icons/layout.gif) | 0PRO ENGINE OILS 5 10 and 20 Aug 2012.pdf | 2012-08-09 17:15 | 203K | |
![[ ]](/icons/layout.gif) | 0PRO ENGINE OILS 5 10 and 20 OCT 2011.pdf | 2011-12-20 10:38 | 156K | |
![[ ]](/icons/layout.gif) | 0PRO ENGINE OILS 15 Plus Aug 2012.pdf | 2012-08-15 16:15 | 199K | |
![[ ]](/icons/layout.gif) | 0PRO ENGINE OILS Extra and 15 Plus Aug 2012.pdf | 2012-08-13 17:17 | 201K | |
![[ ]](/icons/layout.gif) | 0PRO ENGINE OILS Extra and 15 Plus Nov 2011.pdf | 2012-01-30 14:49 | 148K | |
![[ ]](/icons/layout.gif) | 0PRO GEAR 70W-75 August 2012.pdf | 2012-10-16 16:06 | 203K | |
![[ ]](/icons/layout.gif) | 0PRO GEAR 75W-85 AUGUST 2013.pdf | 2013-09-25 11:19 | 191K | |
![[ ]](/icons/layout.gif) | 0PRO GEAR 75W-85 August 2012.pdf | 2012-08-30 13:34 | 203K | |
![[ ]](/icons/layout.gif) | 0PRO GEAR 75W-90 AUGUST 2013.pdf | 2014-01-21 14:19 | 192K | |
![[ ]](/icons/layout.gif) | 0PRO GEAR 75W-90 JUNE 2015.pdf | 2015-06-22 17:12 | 179K | |
![[ ]](/icons/layout.gif) | 0PRO GEAR 80W-140 - JUNE 2014.pdf | 2014-06-17 12:40 | 186K | |
![[ ]](/icons/layout.gif) | 0PRO GEAR 80W-140 AUGUST 2013.pdf | 2013-09-25 11:59 | 188K | |
![[ ]](/icons/layout.gif) | 0PRO GEAR 85W-110 JUNE 2015.pdf | 2015-06-23 12:41 | 206K | |
![[ ]](/icons/layout.gif) | 0PRO GEAR 85W-110 MARCH 2015.pdf | 2015-03-30 12:43 | 182K | |
![[ ]](/icons/layout.gif) | 0PRO HYDRAULIC OILS August 2012.pdf | 2012-08-21 12:39 | 201K | |
![[ ]](/icons/layout.gif) | 0PRO HYDRAULIC OILS OCT 2011.pdf | 2011-12-15 20:50 | 148K | |
![[ ]](/icons/layout.gif) | 0PRO WORKSHOP - PRO 5 JAN 2014.pdf | 2014-02-06 12:36 | 326K | |
![[ ]](/icons/layout.gif) | 0PRO WORKSHOP - PRO EXTRA 10W-40 JUNE 2014.pdf | 2014-06-27 17:20 | 281K | |
![[ ]](/icons/layout.gif) | 0Penblue Oct 2011.pdf | 2012-11-08 12:30 | 149K | |
![[ ]](/icons/layout.gif) | 0Petrol Injector Cleaner Dec 2012.pdf | 2012-12-06 09:03 | 214K | |
![[ ]](/icons/layout.gif) | 0Power Steering Stop Leak January 2013.pdf | 2013-02-06 09:27 | 233K | |
![[ ]](/icons/layout.gif) | 0Pro Cooling System Inhibitor.pdf | 2011-12-15 20:50 | 85K | |
![[ ]](/icons/layout.gif) | 0Pro Engine Oils.pdf | 2011-12-15 20:50 | 53K | |
![[ ]](/icons/layout.gif) | 0Pro Engine Oils AUGUST 2011.pdf | 2011-12-15 20:50 | 99K | |
![[ ]](/icons/layout.gif) | 0Pro Engine Oils DEC 2010.pdf | 2011-12-15 20:50 | 204K | |
![[ ]](/icons/layout.gif) | 0Pro Engine Oils MAR 2010.pdf | 2011-12-15 20:50 | 206K | |
![[ ]](/icons/layout.gif) | 0Pro Engine Oils SEPTEMBER 2011 (2).pdf | 2011-12-15 20:50 | 97K | |
![[ ]](/icons/layout.gif) | 0Pro Hydraulic Oil.pdf | 2011-12-15 20:50 | 85K | |
![[ ]](/icons/layout.gif) | 0Pro Hydraulic Oil JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | 0Product Listing February 2012.pdf | 2012-02-17 17:31 | 798K | |
![[ ]](/icons/layout.gif) | 0QCA GREASE MX9 AUGUST 2014.pdf | 2014-08-20 15:16 | 244K | |
![[ ]](/icons/layout.gif) | 0QCA GREASE MX9 December 2012.pdf | 2013-04-22 17:31 | 204K | |
![[ ]](/icons/layout.gif) | 0QCA GREASE MX9 OCT 2011.pdf | 2011-12-20 12:27 | 143K | |
![[ ]](/icons/layout.gif) | 0QCS GREASE MXG 0 AUGUST 2014.pdf | 2014-08-21 09:17 | 240K | |
![[ ]](/icons/layout.gif) | 0QCS Grease MXG 0 December 2012.pdf | 2013-04-22 17:34 | 204K | |
![[ ]](/icons/layout.gif) | 0RACE CASTOR OIL JULY 2012.pdf | 2012-08-30 10:50 | 201K | |
![[ ]](/icons/layout.gif) | 0RACE CASTOR OIL NOV 2012.pdf | 2013-06-25 10:07 | 200K | |
![[ ]](/icons/layout.gif) | 0RACING BRAKE FLUID Aug 2012.pdf | 2013-04-02 09:18 | 200K | |
![[ ]](/icons/layout.gif) | 0RACING BRAKE FLUID JUNE 2012.pdf | 2012-08-14 16:03 | 99K | |
![[ ]](/icons/layout.gif) | 0RADIATOR FLUSH JUNE 2015.pdf | 2015-07-09 15:18 | 287K | |
![[ ]](/icons/layout.gif) | 0RADIATOR FLUSH October 2012.pdf | 2012-12-03 16:56 | 204K | |
![[ ]](/icons/layout.gif) | 0RADIATOR FLUSH SEPTEMBER 2013.pdf | 2013-09-12 10:02 | 269K | |
![[ ]](/icons/layout.gif) | 0RADIATOR INHIBITOR CONCENTRATE - APRIL 2014.pdf | 2014-04-02 11:43 | 284K | |
![[ ]](/icons/layout.gif) | 0RADIATOR STOP LEAK - APRIL 2014.pdf | 2014-04-02 13:31 | 219K | |
![[ ]](/icons/layout.gif) | 0ROCKSLIDE DECEMBER 2014.pdf | 2014-12-02 15:17 | 273K | |
![[ ]](/icons/layout.gif) | 0ROCKSLIDE December 2012.pdf | 2013-05-03 15:28 | 204K | |
![[ ]](/icons/layout.gif) | 0ROCKSLIDE November 2014.pdf | 2014-12-01 13:15 | 255K | |
![[ ]](/icons/layout.gif) | 0ROCKSLIDE OCT 2011.pdf | 2011-12-15 20:50 | 152K | |
![[ ]](/icons/layout.gif) | 0RUBBER GREASE JULY 2014.pdf | 2014-07-21 12:41 | 227K | |
![[ ]](/icons/layout.gif) | 0RUBBER GREASE OCT 2011.pdf | 2011-12-20 12:27 | 140K | |
![[ ]](/icons/layout.gif) | 0RUBBER PROTECTANT SEPTEMBER 2013.pdf | 2013-11-20 14:58 | 297K | |
![[ ]](/icons/layout.gif) | 0RUNNING IN OIL February 2013.pdf | 2013-02-07 17:32 | 200K | |
![[ ]](/icons/layout.gif) | 0RUNNING IN OIL OCT 2011.pdf | 2011-12-02 10:07 | 144K | |
![[ ]](/icons/layout.gif) | 0Radiator Inhibitor Aug 2012.pdf | 2012-08-17 11:11 | 197K | |
![[ ]](/icons/layout.gif) | 0Radiator Inhibitor Concentrate January 2013.pdf | 2013-04-24 17:18 | 224K | |
![[ ]](/icons/layout.gif) | 0Radiator Stop Leak January 2013.pdf | 2013-02-06 16:52 | 225K | |
![[ ]](/icons/layout.gif) | 0Rapid 7 Flush.pdf | 2011-12-15 20:50 | 84K | |
![[ ]](/icons/layout.gif) | 0Rockslide JAN 2010.pdf | 2011-12-15 20:50 | 217K | |
![[ ]](/icons/layout.gif) | 0Running in oil JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | 0SEMI FLUID GREASE JULY 2014.pdf | 2014-07-15 10:37 | 430K | |
![[ ]](/icons/layout.gif) | 0SEMI FLUID GREASE OCT 2011.pdf | 2011-12-20 12:28 | 140K | |
![[ ]](/icons/layout.gif) | 0SEMI FLUID GREASE OCTOBER 2013.pdf | 2013-10-31 16:34 | 216K | |
![[ ]](/icons/layout.gif) | 0SEMI SYNTHETIC 10W-40 FEBRUARY 2016.pdf | 2016-03-23 11:52 | 337K | |
![[ ]](/icons/layout.gif) | 0SEMI SYNTHETIC 10W-40 JULY 2015.pdf | 2015-08-31 16:49 | 287K | |
![[ ]](/icons/layout.gif) | 0SEMI SYNTHETIC 10W-40 NOVEMBER 2015.pdf | 2015-11-23 11:41 | 338K | |
![[ ]](/icons/layout.gif) | 0SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-08-28 11:51 | 338K | |
![[ ]](/icons/layout.gif) | 0SHELSLEY ENGINE OILS August 2012.pdf | 2012-08-21 16:23 | 201K | |
![[ ]](/icons/layout.gif) | 0SHELSLEY ENGINE OILS FEBRUARY 2016.pdf | 2016-02-18 14:38 | 412K | |
![[ ]](/icons/layout.gif) | 0SHELSLEY ENGINE OILS JULY 2014.pdf | 2014-07-16 15:43 | 591K | |
![[ ]](/icons/layout.gif) | 0SHELSLEY ENGINE OILS MARCH 2014.pdf | 2014-03-05 14:13 | 409K | |
![[ ]](/icons/layout.gif) | 0SHELSLEY ENGINE OILS OCT 2011.pdf | 2011-12-09 16:21 | 146K | |
![[ ]](/icons/layout.gif) | 0SHOCKER OILS AUGUST 2013.pdf | 2013-08-28 12:02 | 277K | |
![[ ]](/icons/layout.gif) | 0SHOCKER OILS JUNE 2014.pdf | 2014-06-02 16:36 | 277K | |
![[ ]](/icons/layout.gif) | 0SHOCKER OILS MAY 2015.pdf | 2015-05-08 09:03 | 301K | |
![[ ]](/icons/layout.gif) | 0SHOCKER OILS OCT 2011.pdf | 2011-12-09 16:44 | 140K | |
![[ ]](/icons/layout.gif) | 0SIN ATF.pdf | 2011-12-15 20:50 | 59K | |
![[ ]](/icons/layout.gif) | 0SIN BRAKE FLUID OCT 2011.pdf | 2011-12-20 14:21 | 149K | |
![[ ]](/icons/layout.gif) | 0SIN Comp Auto.pdf | 2011-12-15 20:50 | 70K | |
![[ ]](/icons/layout.gif) | 0SIN Comp Auto 33 JAN 2011.pdf | 2011-12-15 20:50 | 225K | |
![[ ]](/icons/layout.gif) | 0SIN Diesel.pdf | 2011-12-15 20:50 | 76K | |
![[ ]](/icons/layout.gif) | 0SIN Diff Oil.pdf | 2011-12-15 20:50 | 88K | |
![[ ]](/icons/layout.gif) | 0SIN Engine Oil 15 and 20 JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | 0SIN Engine Oil 15 and 20 JAN 2011.pdf | 2011-12-15 20:50 | 203K | |
![[ ]](/icons/layout.gif) | 0SIN Engine Oil 15 and 20 OCT 2010.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | 0SIN Engine Oil 15 and 25.pdf | 2011-12-15 20:50 | 73K | |
![[ ]](/icons/layout.gif) | 0SIN GEAR 75W90and80W140 OCT 2011.pdf | 2011-12-20 11:47 | 152K | |
![[ ]](/icons/layout.gif) | 0SIN Gear Oil 75 and 80.pdf | 2011-12-15 20:50 | 54K | |
![[ ]](/icons/layout.gif) | 0SIN Gear Oil 75 and 80 JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | 0SIN Gear Oil 75 and 80 JAN 2011.pdf | 2011-12-15 20:50 | 203K | |
![[ ]](/icons/layout.gif) | 0SIN MANUAL TRANS OCT 2011.pdf | 2011-12-20 11:49 | 148K | |
![[ ]](/icons/layout.gif) | 0SIN Manual Trans.pdf | 2011-12-15 20:50 | 71K | |
![[ ]](/icons/layout.gif) | 0SIN Manual Trans JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | 0SIN RACE CASTOR OCT 2011.pdf | 2011-12-20 13:18 | 140K | |
![[ ]](/icons/layout.gif) | 0SIN RACE COOLANT OCT 2011.pdf | 2011-12-20 12:35 | 144K | |
![[ ]](/icons/layout.gif) | 0SIN Race Castor.pdf | 2011-12-15 20:50 | 66K | |
![[ ]](/icons/layout.gif) | 0SIN Racing Coolant.pdf | 2012-02-01 16:58 | 65K | |
![[ ]](/icons/layout.gif) | 0SIN TWO STROKE OIL OCT 2011.pdf | 2011-12-20 12:21 | 146K | |
![[ ]](/icons/layout.gif) | 0SIN Two Stroke Oil JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | 0SMALL ENGINE FOUR STROKE MONOGRADE 30 April 2013.pdf | 2013-04-29 10:34 | 201K | |
![[ ]](/icons/layout.gif) | 0SMALL ENGINE FOUR STROKE MONOGRADE 30 OCT 2011.pdf | 2011-12-20 12:19 | 153K | |
![[ ]](/icons/layout.gif) | 0SMALL ENGINE FOUR STROKE MULTIGRADE 10W-30 MARCH 2015.pdf | 2015-03-31 10:13 | 207K | |
![[ ]](/icons/layout.gif) | 0SMALL ENGINE FOUR STROKE OIL 10W-30 APRIL 2012.pdf | 2012-04-19 13:49 | 117K | |
![[ ]](/icons/layout.gif) | 0SMALL ENGINE FOUR STROKE OIL 10W-30 August 2014.pdf | 2014-08-15 13:03 | 185K | |
![[ ]](/icons/layout.gif) | 0SMALL ENGINE FOUR STROKE OIL 10W-30 SEPTEMBER 2013.pdf | 2013-11-22 08:46 | 188K | |
![[ ]](/icons/layout.gif) | 0SMALL ENGINE FOUR STROKE OIL 10W-30 SEPTEMBER 2014.pdf | 2014-09-10 15:13 | 185K | |
![[ ]](/icons/layout.gif) | 0SMALL ENGINE FOUR STROKE OIL 20W-50 APRIL 2012.pdf | 2012-08-31 09:34 | 96K | |
![[ ]](/icons/layout.gif) | 0SMALL ENGINE FOUR STROKE OILS 10W30 and 20W50 OCT 2011.pdf | 2011-12-20 12:19 | 161K | |
![[ ]](/icons/layout.gif) | 0SMALL ENGINE GREENKEEPERS TWO STROKE Oct 2011.pdf | 2011-12-20 12:25 | 144K | |
![[ ]](/icons/layout.gif) | 0SMALL ENGINE HI-PER TWO STROKE August 2012.pdf | 2012-08-28 11:54 | 212K | |
![[ ]](/icons/layout.gif) | 0SMALL ENGINE HI-PER TWO STROKE SEPTEMBER 2013.pdf | 2014-08-27 12:52 | 188K | |
![[ ]](/icons/layout.gif) | 0SOLUBLE OIL APRIL 2015.pdf | 2015-06-29 14:38 | 179K | |
![[ ]](/icons/layout.gif) | 0SOLUBLE OIL OCT 2011.pdf | 2011-12-20 14:24 | 143K | |
![[ ]](/icons/layout.gif) | 0SOLVENT DEGREASER JANUARY 2016.pdf | 2016-03-31 11:59 | 276K | |
![[ ]](/icons/layout.gif) | 0STEERING BOX LUBE OCT 2011.pdf | 2011-12-20 13:04 | 140K | |
![[ ]](/icons/layout.gif) | 0SU DASHPOT and SU DAMPER AUGUST 2013.pdf | 2013-08-28 13:22 | 212K | |
![[ ]](/icons/layout.gif) | 0SU DASHPOT and SU DAMPER MAY 2015.pdf | 2015-05-08 08:56 | 237K | |
![[ ]](/icons/layout.gif) | 0SU DASHPOTandSU DAMPER OCT 2011.pdf | 2011-12-20 13:05 | 141K | |
![[ ]](/icons/layout.gif) | 0SU DASHPOTand SU DAMPER OCT 2012.pdf | 2012-10-01 13:21 | 185K | |
![[ ]](/icons/layout.gif) | 0SU Damper SU Dashpot JAN 2010.pdf | 2011-12-15 20:50 | 181K | |
![[ ]](/icons/layout.gif) | 0SYNFLEET 50 MAY 2015.pdf | 2015-06-30 09:15 | 244K | |
![[ ]](/icons/layout.gif) | 0SYNFLEET 50 OCT 2011.pdf | 2011-12-20 11:59 | 155K | |
![[ ]](/icons/layout.gif) | 0SYNMARINE OB TS OCT 2011.pdf | 2011-12-16 17:31 | 152K | |
![[ ]](/icons/layout.gif) | 0Shelsley Engine Oils.pdf | 2011-12-15 20:50 | 43K | |
![[ ]](/icons/layout.gif) | 0Shelsley Engine Oils JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | 0Small Engine Four Stroke 10W-30 and 20W-50.pdf | 2011-12-15 20:50 | 54K | |
![[ ]](/icons/layout.gif) | 0Small Engine Four Stroke 10W-30 and 20W-50 MAR 2010.pdf | 2011-12-15 20:50 | 198K | |
![[ ]](/icons/layout.gif) | 0Small Engine Four Stroke 10W-30 and 20W-50 MAR 2011.pdf | 2011-12-15 20:50 | 100K | |
![[ ]](/icons/layout.gif) | 0Soluble Oil JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | 0Synfleet 50 JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | 0TRAC TRANS AND HYD OIL MAY 2014.pdf | 2014-05-15 11:55 | 239K | |
![[ ]](/icons/layout.gif) | 0TRAC TRANS AND HYD OIL NOVEMBER 2013.pdf | 2013-11-27 13:17 | 248K | |
![[ ]](/icons/layout.gif) | 0TRAC TRANS AND HYD OIL OCT 2011.pdf | 2011-12-20 14:22 | 155K | |
![[ ]](/icons/layout.gif) | 0TRAC TRANS AND HYD OIL October 2012.pdf | 2012-10-26 14:47 | 203K | |
![[ ]](/icons/layout.gif) | 0TRANSAXLE 75 APRIL 2012.pdf | 2012-04-30 10:11 | 118K | |
![[ ]](/icons/layout.gif) | 0TRANSAXLE 75 OCT 2011.pdf | 2011-12-20 11:51 | 150K | |
![[ ]](/icons/layout.gif) | 0TRANSAXLE 80 OCT 2011.pdf | 2011-12-20 11:55 | 151K | |
![[ ]](/icons/layout.gif) | 0TRANS GEAR 75W-90 AUGUST 2013.pdf | 2013-09-25 11:20 | 250K | |
![[ ]](/icons/layout.gif) | 0TRANS GEAR 75W-90 August 2012.pdf | 2012-08-30 09:21 | 208K | |
![[ ]](/icons/layout.gif) | 0TRANS GEAR 75W-90 JUNE 2014.pdf | 2014-06-17 15:32 | 247K | |
![[ ]](/icons/layout.gif) | 0TRANS GEAR 75W-90 MARCH 2015.pdf | 2015-03-31 16:03 | 250K | |
![[ ]](/icons/layout.gif) | 0TRANSOIL 90 140 250 AUGUST 2013.pdf | 2013-08-28 11:58 | 237K | |
![[ ]](/icons/layout.gif) | 0TRANSOIL 90 140 250 MAY 2015.pdf | 2015-05-07 13:11 | 292K | |
![[ ]](/icons/layout.gif) | 0TRANSOIL 90 140 250 OCT 2011.pdf | 2011-12-09 16:54 | 144K | |
![[ ]](/icons/layout.gif) | 0TRANSOIL 90 140 250 OCTOBER 2013.pdf | 2013-10-18 12:33 | 240K | |
![[ ]](/icons/layout.gif) | 0TRANSOIL 90 140 250 OCTOBER 2015.pdf | 2015-10-05 14:58 | 292K | |
![[ ]](/icons/layout.gif) | 0Transaxle 80.pdf | 2011-12-15 20:50 | 49K | |
![[ ]](/icons/layout.gif) | 0Transoil 90 140 250 JAN 2010.pdf | 2011-12-15 20:50 | 192K | |
![[ ]](/icons/layout.gif) | 0UNIVERSAL FARM OIL NOV 2013.pdf | 2013-11-08 09:29 | 237K | |
![[ ]](/icons/layout.gif) | 0UNIVERSAL FARM OIL OCT 2011.pdf | 2011-12-20 14:23 | 156K | |
![[ ]](/icons/layout.gif) | 0UNIVERSAL TOP UP COOLANT PREMIX MAY 2015.pdf | 2015-06-22 11:30 | 326K | |
![[ ]](/icons/layout.gif) | 0UPPER CYLINDER and LPG LUBRICANT APRIL 2014.pdf | 2014-04-22 10:08 | 219K | |
![[ ]](/icons/layout.gif) | 0UPPER CYLINDER and LPG LUBRICANT DECEMBER 2013.pdf | 2013-12-04 12:32 | 217K | |
![[ ]](/icons/layout.gif) | 0UPPER CYLINDER and LPG LUBRICANT OCT 2011.pdf | 2011-12-20 14:19 | 141K | |
![[ ]](/icons/layout.gif) | 0UPPER CYLINDER and LPG LUBRICANT SEPTEMBER 2014.pdf | 2014-09-10 15:03 | 219K | |
![[ ]](/icons/layout.gif) | 0Universal Coolant Top Up July 2013.pdf | 2013-10-16 15:13 | 340K | |
![[ ]](/icons/layout.gif) | 0Upper Cylinder LPG Lubricant.pdf | 2011-12-15 20:50 | 43K | |
![[ ]](/icons/layout.gif) | 0Upper Cylinder LPG Lubricant JAN 2010.pdf | 2011-12-15 20:50 | 213K | |
![[ ]](/icons/layout.gif) | 0VALVE SHIELD APRIL 2015.pdf | 2015-05-04 16:11 | 297K | |
![[ ]](/icons/layout.gif) | 0VALVESHIELD APRIL 2015.pdf | 2015-04-02 10:29 | 281K | |
![[ ]](/icons/layout.gif) | 0VALVESHIELD AUGUST 2013.pdf | 2013-12-04 11:42 | 265K | |
![[ ]](/icons/layout.gif) | 0VALVESHIELD FEBRUARY 2015.pdf | 2015-04-01 11:39 | 281K | |
![[ ]](/icons/layout.gif) | 0VALVESHIELD OCT 2011.pdf | 2011-12-20 14:19 | 149K | |
![[ ]](/icons/layout.gif) | 0VALVESHIELD SEPTEMBER 2014.pdf | 2014-09-10 14:54 | 282K | |
![[ ]](/icons/layout.gif) | 0VANTAGE 10W-30 JUNE 2014.pdf | 2014-11-24 08:58 | 313K | |
![[ ]](/icons/layout.gif) | 0VANTAGE 15W-40 JUNE 2014.pdf | 2014-10-29 14:49 | 311K | |
![[ ]](/icons/layout.gif) | 0VANTAGE FULL SYNTHETIC 5W-30 MAY 2015.pdf | 2015-05-08 12:02 | 366K | |
![[ ]](/icons/layout.gif) | 0VANTAGE FULL SYNTHETIC 5W-30 OCTOBER 2015.pdf | 2016-02-10 11:59 | 363K | |
![[ ]](/icons/layout.gif) | 0VANTAGE FULL SYNTHETIC 10W-40 JANUARY 2016.pdf | 2016-03-31 11:14 | 360K | |
![[ ]](/icons/layout.gif) | 0VANTAGE PREMIUM MINERAL 5W-30 SEPTEMBER 2015.pdf | 2015-09-09 12:52 | 334K | |
![[ ]](/icons/layout.gif) | 0VANTAGE PREMIUM MINERAL 15W-40 OCTOBER 2015.pdf | 2015-11-18 11:22 | 312K | |
![[ ]](/icons/layout.gif) | 0VANTAGE PREMIUM MINERAL 20W-50 NOVEMBER 2015.pdf | 2015-11-23 14:27 | 312K | |
![[ ]](/icons/layout.gif) | 0VANTAGE SEMI 5W-30 FEBRUARY 2015.pdf | 2015-02-10 13:16 | 313K | |
![[ ]](/icons/layout.gif) | 0VANTAGE SEMI 5W-30 NOVEMBER 2014.pdf | 2015-01-23 16:40 | 314K | |
![[ ]](/icons/layout.gif) | 0VANTAGE SEMI 10W-40 JUNE 2014.pdf | 2014-10-14 12:22 | 255K | |
![[ ]](/icons/layout.gif) | 0VANTAGE SEMI SYNTHETIC 10W-40 FEBRUARY 2016.pdf | 2016-04-27 16:56 | 313K | |
![[ ]](/icons/layout.gif) | 0VANTAGE SEMI SYNTHETIC 10W-40 MARCH 2015.pdf | 2015-03-24 16:26 | 255K | |
![[ ]](/icons/layout.gif) | 0Valveshield.pdf | 2011-12-15 20:50 | 656K | |
![[ ]](/icons/layout.gif) | 0Valveshield JAN 2010.pdf | 2011-12-15 20:50 | 213K | |
![[ ]](/icons/layout.gif) | 0WATER PUMP GREASE JULY 2014.pdf | 2014-07-25 14:20 | 275K | |
![[ ]](/icons/layout.gif) | 0WATER PUMP GREASE OCT 2011.pdf | 2011-12-20 13:09 | 140K | |
![[ ]](/icons/layout.gif) | 0WHEEL RIM CLEANER JULY 2014.pdf | 2014-08-08 16:14 | 269K | |
![[ ]](/icons/layout.gif) | 0WHEEL RIM CLEANER SEPTEMBER 2013.pdf | 2013-10-16 12:53 | 266K | |
![[ ]](/icons/layout.gif) | 00MOTORCYCLE FORK OILS MAY 2012.pdf | 2012-09-14 16:11 | 96K | |
![[ ]](/icons/layout.gif) | 00 Penrite Product Listing July 2011.pdf | 2011-12-15 20:50 | 144K | |
![[ ]](/icons/layout.gif) | 00SIN Race Castor.pdf | 2012-01-12 16:55 | 66K | |
![[ ]](/icons/layout.gif) | 00Small Engine Four Stroke 10W-30 and 20W-50 MAR 2011.pdf | 2011-12-20 12:18 | 100K | |
![[ ]](/icons/layout.gif) | 01Small Engine Four Stroke 10W-30 and 20W-50 MAR 2010.pdf | 2012-08-08 07:50 | 198K | |
![[ ]](/icons/layout.gif) | 010 TENTHS CHAIN CLEANER AEROSOL DECEMBER 2015.pdf | 2015-12-23 10:09 | 275K | |
![[ ]](/icons/layout.gif) | 010 TENTHS FOAM FILTER OIL AEROSOL DECEMBER 2015.pdf | 2016-01-15 10:19 | 260K | |
![[ ]](/icons/layout.gif) | 010 TENTHS KO2ST FULL SYNTHETIC TWO STROKE OIL MARCH 2015.pdf | 2015-04-20 11:35 | 301K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM 0 APRIL 2014.pdf | 2014-04-04 08:50 | 256K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM 0 AUG 2012.pdf | 2012-10-22 12:14 | 235K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM 0 JUNE 2013.pdf | 2013-06-06 10:43 | 308K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM 0 Nov 2012.pdf | 2012-11-16 11:47 | 217K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM 0 SEPTEMBER 2013.pdf | 2013-09-20 16:56 | 259K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM 0 SEPTEMBER 2014.pdf | 2014-10-02 14:54 | 235K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM 5 APRIL 2014.pdf | 2014-04-04 08:55 | 257K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM 5 AUG 2012.pdf | 2012-10-22 12:18 | 235K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM 5 JUNE 2013.pdf | 2013-06-06 10:45 | 309K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM 5 Nov 2012.pdf | 2012-11-16 11:48 | 217K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM 5 SEPTEMBER 2013.pdf | 2013-09-20 16:58 | 261K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM 5 SEPTEMBER 2014.pdf | 2014-10-02 14:57 | 234K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM 10 APRIL 2014.pdf | 2014-04-04 08:59 | 259K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM 10 AUG 2012.pdf | 2012-08-30 08:27 | 234K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-06-06 10:48 | 309K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM 10 Nov 2012.pdf | 2012-11-16 11:48 | 216K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM 10 SEPTEMBER 2013.pdf | 2013-09-20 16:59 | 260K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM 10 SEPTEMBER 2014.pdf | 2014-10-02 15:00 | 233K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM FULL SYNTHETIC 5W-50 DECEMBER 2015.pdf | 2015-12-08 08:34 | 378K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM FULL SYNTHETIC 10W-60 DECEMBER 2015.pdf | 2015-12-08 08:40 | 383K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM FULL SYNTHETIC 10W-60 MARCH 2015.pdf | 2015-05-04 10:27 | 233K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM FULL SYNTHETIC OILS OCT 2011.pdf | 2011-12-15 20:50 | 214K | |
![[ ]](/icons/layout.gif) | 010 TENTHS PREMIUM OILS FEB 2012.pdf | 2012-02-14 09:59 | 214K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACE CASTOR OIL DECEMBER 2013.pdf | 2013-12-16 12:41 | 227K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACE CASTOR OIL JUNE 2014.pdf | 2014-06-02 13:01 | 228K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACE CASTOR OIL OCTOBER 2014.pdf | 2014-10-10 10:45 | 230K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACE CASTOR OIL SEPTEMBER 2013.pdf | 2013-09-19 12:04 | 227K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACE COOLANT INHIBITOR AUG 2012.pdf | 2012-10-25 13:57 | 199K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACE COOLANT INHIBITOR MAY 2015.pdf | 2015-05-01 15:08 | 220K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACE COOLANT INHIBITOR NOVEMBER 2013.pdf | 2013-12-02 15:38 | 218K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING 0W-20 DECEMBER 2015.pdf | 2015-12-08 12:06 | 397K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING 5W-30 DECEMBER 2015.pdf | 2015-12-08 11:55 | 409K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING 5W-30 MAY 2015.pdf | 2015-05-28 10:59 | 344K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING 10W-40 DECEMBER 2015.pdf | 2015-12-08 11:53 | 368K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING 15W-50 DECEMBER 2015.pdf | 2015-12-08 12:11 | 384K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 0 JULY 2014.pdf | 2014-07-18 12:02 | 475K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 0 JUNE 2013.pdf | 2013-06-12 08:52 | 246K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 0 Nov 2012.pdf | 2012-11-16 10:20 | 246K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 0 SEPTEMBER 2013.pdf | 2013-12-12 16:55 | 258K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 5 AUG 2012.pdf | 2012-08-13 15:02 | 249K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 5 JULY 2014.pdf | 2014-07-18 12:02 | 475K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 5 JUNE 2013.pdf | 2013-06-07 16:48 | 251K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 5 NOV 2012.pdf | 2012-11-16 14:31 | 251K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 5 SEPTEMBER 2013.pdf | 2013-12-12 16:57 | 260K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 10 APRIL 2014.pdf | 2014-04-03 17:07 | 256K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 10 AUG 2012.pdf | 2012-08-31 09:29 | 252K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 10 JULY 2014.pdf | 2014-07-18 11:35 | 431K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 10 JUNE 2013.pdf | 2013-06-12 08:59 | 305K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 10 NOV 2012.pdf | 2012-11-16 14:31 | 253K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 10 SEPTEMBER 2013.pdf | 2013-09-20 16:08 | 259K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 15 APRIL 2014.pdf | 2014-04-03 17:02 | 278K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 15 AUG 2012.pdf | 2012-10-22 12:38 | 251K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 15 JULY 2014.pdf | 2014-07-18 11:36 | 452K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 15 JUNE 2013.pdf | 2013-06-12 09:02 | 300K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 15 NOV 2012.pdf | 2012-11-16 14:32 | 252K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 15 SEPTEMBER 2013.pdf | 2013-09-20 16:25 | 278K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 20 APRIL 2014.pdf | 2014-04-03 17:12 | 276K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 20 JULY 2014.pdf | 2014-07-18 11:36 | 448K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 20 JUNE 2013.pdf | 2013-06-12 09:04 | 234K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 20 MAR 2012.pdf | 2012-10-22 12:41 | 137K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 20 NOV 2012.pdf | 2012-11-16 14:32 | 252K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OIL 20 SEPTEMBER 2013.pdf | 2013-09-20 16:27 | 280K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OILS FEB 2012.pdf | 2012-02-14 09:43 | 245K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RACING OILS NOV 2011.pdf | 2011-12-15 20:50 | 241K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RUNNING IN OIL APRIL 2014.pdf | 2014-04-04 08:38 | 169K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RUNNING IN OIL JANUARY 2015.pdf | 2015-01-27 16:40 | 180K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RUNNING IN OIL JUNE 2013.pdf | 2013-06-17 17:38 | 175K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RUNNING IN OIL MAY 2015.pdf | 2015-05-04 12:56 | 219K | |
![[ ]](/icons/layout.gif) | 010 TENTHS RUNNING IN OIL OCTOBER 2014.pdf | 2014-10-08 11:17 | 178K | |
![[ ]](/icons/layout.gif) | 0110 TENTHS PREMIUM FULL SYNTHETIC OILS OCT 2011.pdf | 2011-12-23 12:05 | 214K | |
![[ ]](/icons/layout.gif) | 02INDUS GEAR OIL EP August 2012.pdf | 2012-09-25 16:31 | 206K | |
![[ ]](/icons/layout.gif) | 03 YEAR STANDARD DRAIN ANTI FREEZE ANTI BOIL April 2013.pdf | 2013-05-13 11:32 | 221K | |
![[ ]](/icons/layout.gif) | 03 YEAR STANDARD DRAIN ANTI FREEZE ANTI BOIL Aug 2012.pdf | 2012-08-30 14:22 | 201K | |
![[ ]](/icons/layout.gif) | 03 YEAR STANDARD DRAIN ANTI FREEZE ANTI BOIL July 2012.pdf | 2012-07-27 15:19 | 202K | |
![[ ]](/icons/layout.gif) | 03 YEAR STANDARD DRAIN ANTI FREEZE ANTI BOIL NOVEMBER 2013.pdf | 2013-11-28 09:32 | 191K | |
![[ ]](/icons/layout.gif) | 0350,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-03-19 17:24 | 356K | |
![[ ]](/icons/layout.gif) | 04 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL April 2013.pdf | 2013-04-17 14:11 | 220K | |
![[ ]](/icons/layout.gif) | 04 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL Aug 2012.pdf | 2012-08-27 14:17 | 207K | |
![[ ]](/icons/layout.gif) | 04 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL August 2012.pdf | 2012-08-30 16:25 | 205K | |
![[ ]](/icons/layout.gif) | 04 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL December 2012.pdf | 2012-12-07 12:40 | 213K | |
![[ ]](/icons/layout.gif) | 04 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL FEBRUARY 2014.pdf | 2014-02-24 16:05 | 395K | |
![[ ]](/icons/layout.gif) | 04 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL Feb 2012.pdf | 2012-02-14 09:42 | 154K | |
![[ ]](/icons/layout.gif) | 04 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL JULY 2013.pdf | 2013-07-22 13:08 | 397K | |
![[ ]](/icons/layout.gif) | 04 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL January 2013.pdf | 2013-01-10 17:46 | 214K | |
![[ ]](/icons/layout.gif) | 04 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL March 2012.pdf | 2012-03-21 13:49 | 119K | |
![[ ]](/icons/layout.gif) | 04 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL Oct 2011.pdf | 2012-02-01 16:29 | 153K | |
![[ ]](/icons/layout.gif) | 04 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-09-07 12:25 | 215K | |
![[ ]](/icons/layout.gif) | 05 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL April 2013.pdf | 2013-04-17 14:12 | 203K | |
![[ ]](/icons/layout.gif) | 05 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL Aug 2012.pdf | 2012-08-27 14:18 | 197K | |
![[ ]](/icons/layout.gif) | 05 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL August 2012.pdf | 2012-08-30 16:35 | 193K | |
![[ ]](/icons/layout.gif) | 05 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL Feb 2012.pdf | 2012-02-14 09:42 | 146K | |
![[ ]](/icons/layout.gif) | 05 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL January 2013.pdf | 2013-01-10 17:58 | 195K | |
![[ ]](/icons/layout.gif) | 05 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL July 2012.pdf | 2012-08-06 13:26 | 194K | |
![[ ]](/icons/layout.gif) | 05 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL March 2012.pdf | 2012-02-17 15:55 | 193K | |
![[ ]](/icons/layout.gif) | 05 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL Oct 2011.pdf | 2012-02-01 16:36 | 146K | |
![[ ]](/icons/layout.gif) | 05 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL September 2012.pdf | 2012-09-07 12:26 | 195K | |
![[ ]](/icons/layout.gif) | 0510 TENTHS RACING OILS NOV 2011.pdf | 2012-01-18 16:33 | 241K | |
![[ ]](/icons/layout.gif) | 06 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL JULY 2013.pdf | 2013-09-09 16:02 | 376K | |
![[ ]](/icons/layout.gif) | 07 YEAR 450,000KM BLUE COOLANT - FEBRUARY 2015.pdf | 2015-03-19 15:06 | 368K | |
![[ ]](/icons/layout.gif) | 07 YEAR 450,000KM BLUE COOLANT - MAY 2016.pdf | 2016-05-11 16:28 | 457K | |
![[ ]](/icons/layout.gif) | 07 YEAR 450,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-03-19 16:42 | 361K | |
![[ ]](/icons/layout.gif) | 08 YEAR 500,000KM RED COOLANT - FEBRUARY 2015.pdf | 2015-03-19 15:31 | 305K | |
![[ ]](/icons/layout.gif) | 1ACT GREASE XEP2 AUGUST 2014.pdf | 2014-08-19 16:07 | 293K | |
![[ ]](/icons/layout.gif) | 1ACT GREASE XEP2 December 2012.pdf | 2013-04-23 09:50 | 204K | |
![[ ]](/icons/layout.gif) | 1ANTI FREEZE ANTI BOIL PREMIX BLUE April 2013.pdf | 2013-06-25 10:58 | 204K | |
![[ ]](/icons/layout.gif) | 1ATF 33 Oct 2011.pdf | 2012-06-05 10:15 | 146K | |
![[ ]](/icons/layout.gif) | 1ATF BMV NOVEMBER 2014.pdf | 2015-01-30 08:29 | 273K | |
![[ ]](/icons/layout.gif) | 1ATF DX-III JUNE 2013.pdf | 2013-11-28 15:06 | 251K | |
![[ ]](/icons/layout.gif) | 1ATF DX-VI JUNE 2013.pdf | 2013-10-15 11:38 | 318K | |
![[ ]](/icons/layout.gif) | 1ATF FS FULL SYNTHETIC MULTI VEHICLE AUTO TRANS Feb 2012.pdf | 2012-03-13 15:10 | 119K | |
![[ ]](/icons/layout.gif) | 1ATF FS JULY 2014.pdf | 2014-08-01 10:19 | 356K | |
![[ ]](/icons/layout.gif) | 1ATF FS JUNE 2013.pdf | 2013-10-15 11:25 | 287K | |
![[ ]](/icons/layout.gif) | 1ATF LV MARCH 2015.pdf | 2015-03-27 15:26 | 305K | |
![[ ]](/icons/layout.gif) | 1ATF MHP.pdf | 2011-12-15 20:50 | 50K | |
![[ ]](/icons/layout.gif) | 1ATF MHP JUNE 2013.pdf | 2013-10-15 11:29 | 319K | |
![[ ]](/icons/layout.gif) | 1ATF Top Up June 2013.pdf | 2013-06-11 17:25 | 275K | |
![[ ]](/icons/layout.gif) | 1BENTONE HD GREASE AUGUST 2014.pdf | 2014-08-25 12:17 | 215K | |
![[ ]](/icons/layout.gif) | 1BRAKE FLUID 525 Oct 2011.pdf | 2012-01-19 10:29 | 149K | |
![[ ]](/icons/layout.gif) | 1BRAKE FLUID DOT 3 APRIL 2014.pdf | 2014-04-11 15:26 | 226K | |
![[ ]](/icons/layout.gif) | 1BRAKE FLUID DOT 3 APRIL 2015.pdf | 2015-04-01 16:05 | 227K | |
![[ ]](/icons/layout.gif) | 1BRAKE FLUID DOT 3 JULY 2013.pdf | 2013-07-12 16:55 | 224K | |
![[ ]](/icons/layout.gif) | 1BRAKE FLUID DOT 5.1 JULY 2014.pdf | 2014-07-11 15:28 | 318K | |
![[ ]](/icons/layout.gif) | 1BRAKE FLUID RACING NOVEMBER 2013.pdf | 2014-02-05 09:12 | 209K | |
![[ ]](/icons/layout.gif) | 1BRAKE FLUID SUPER DOT 4 APRIL 2014.pdf | 2014-04-11 14:51 | 226K | |
![[ ]](/icons/layout.gif) | 1BRAKE FLUID SUPER DOT 4 JULY 2013.pdf | 2013-07-12 16:44 | 226K | |
![[ ]](/icons/layout.gif) | 1Bentone HD Grease December 2012.pdf | 2013-04-23 11:58 | 201K | |
![[ ]](/icons/layout.gif) | 1CAM ASSEMBLY LUBE AUGUST 2014.pdf | 2014-08-28 12:54 | 178K | |
![[ ]](/icons/layout.gif) | 1CAM ASSEMBLY LUBE Oct 2011.pdf | 2012-01-19 10:26 | 140K | |
![[ ]](/icons/layout.gif) | 1CHAINSAW BAR OIL JULY 2014.pdf | 2014-07-31 09:21 | 226K | |
![[ ]](/icons/layout.gif) | 1CHAINSAW BAR OIL Oct 2011.pdf | 2011-12-20 13:15 | 140K | |
![[ ]](/icons/layout.gif) | 1CLASSIC CAR COOLANT MAY 2015.pdf | 2015-05-07 17:20 | 243K | |
![[ ]](/icons/layout.gif) | 1CLASSIC CAR COOLANT Oct 2011.pdf | 2011-12-20 12:50 | 145K | |
![[ ]](/icons/layout.gif) | 1CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-08-28 11:53 | 312K | |
![[ ]](/icons/layout.gif) | 1CLASSIC ENGINE OILS FEBRUARY 2016.pdf | 2016-02-17 12:39 | 367K | |
![[ ]](/icons/layout.gif) | 1CLASSIC ENGINE OILS Feb 2012.pdf | 2012-02-14 10:01 | 145K | |
![[ ]](/icons/layout.gif) | 1CLASSIC ENGINE OILS Feb 2013.pdf | 2013-02-05 16:53 | 189K | |
![[ ]](/icons/layout.gif) | 1CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 15:05 | 447K | |
![[ ]](/icons/layout.gif) | 1CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-05 15:20 | 329K | |
![[ ]](/icons/layout.gif) | 1CLASSIC ENGINE OILS Oct 2011.pdf | 2011-12-09 16:23 | 145K | |
![[ ]](/icons/layout.gif) | 1CLASSIC MINI 20W-50 MAY 2015.pdf | 2015-05-07 12:07 | 318K | |
![[ ]](/icons/layout.gif) | 1CLASSIC TRIUMPH MAY 2015.pdf | 2015-05-07 12:30 | 274K | |
![[ ]](/icons/layout.gif) | 1COOL 100 COOLANT INHIBITOR - FEBRUARY 2015.pdf | 2015-06-22 11:23 | 274K | |
![[ ]](/icons/layout.gif) | 1COPPER EZE AUGUST 2014.pdf | 2014-08-28 13:07 | 212K | |
![[ ]](/icons/layout.gif) | 1COPPER EZE December 2012.pdf | 2013-04-23 10:01 | 185K | |
![[ ]](/icons/layout.gif) | 1COPPER EZE FEBRUARY 2014.pdf | 2014-02-05 16:10 | 199K | |
![[ ]](/icons/layout.gif) | 1COPPER EZE MAY 2013.pdf | 2013-05-10 15:00 | 185K | |
![[ ]](/icons/layout.gif) | 1CVTV Fluid October 2013.pdf | 2014-05-20 17:17 | 229K | |
![[ ]](/icons/layout.gif) | 1Classic Engine Oil 20W-50 Oct 2011.pdf | 2012-01-27 09:45 | 186K | |
![[ ]](/icons/layout.gif) | 1Classic Engine Oils.pdf | 2011-12-15 20:50 | 44K | |
![[ ]](/icons/layout.gif) | 1Classic Engine Oils JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | 1Classic Mini Oil July 2013.pdf | 2013-10-31 14:19 | 268K | |
![[ ]](/icons/layout.gif) | 1DIESEL FX August 2012.pdf | 2012-10-15 15:17 | 191K | |
![[ ]](/icons/layout.gif) | 1DIESEL FX MAY 2016.pdf | 2016-05-11 14:58 | 273K | |
![[ ]](/icons/layout.gif) | 1DIESEL FX SEPTEMBER 2015.pdf | 2015-09-18 16:54 | 251K | |
![[ ]](/icons/layout.gif) | 1DIESEL HD 15W-40 JUNE 2014.pdf | 2014-06-16 12:44 | 365K | |
![[ ]](/icons/layout.gif) | 1DIESEL HD 15W-40 SEPTEMBER 2013.pdf | 2013-09-18 17:26 | 368K | |
![[ ]](/icons/layout.gif) | 1DIESEL INJECTOR CLEANER - FEBRUARY 2015.pdf | 2015-02-17 11:47 | 180K | |
![[ ]](/icons/layout.gif) | 1DIESEL TOTAL SYSTEM CLEANER MAY 2015.pdf | 2016-06-07 08:24 | 317K | |
![[ ]](/icons/layout.gif) | 1DOT 3 BRAKE FLUID Aug 2012.pdf | 2012-08-03 12:50 | 202K | |
![[ ]](/icons/layout.gif) | 1DOT 3 BRAKE FLUID JULY 2012.pdf | 2012-08-01 15:19 | 203K | |
![[ ]](/icons/layout.gif) | 1DPF CLEANER APRIL 2015.pdf | 2015-05-08 17:33 | 591K | |
![[ ]](/icons/layout.gif) | 1DPF CLEANER JANUARY 2014.pdf | 2014-03-11 12:48 | 560K | |
![[ ]](/icons/layout.gif) | 1Diesel FX April 2013.pdf | 2013-04-30 12:50 | 192K | |
![[ ]](/icons/layout.gif) | 1Diesel FX MAR 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | 1Diesel LA.pdf | 2011-12-15 20:50 | 55K | |
![[ ]](/icons/layout.gif) | 1ENDURO JULY 2014.pdf | 2014-07-17 11:43 | 406K | |
![[ ]](/icons/layout.gif) | 1ENDURO MARCH 2014.pdf | 2014-03-12 10:41 | 246K | |
![[ ]](/icons/layout.gif) | 1ENDURO Oct 2011.pdf | 2011-12-20 12:09 | 142K | |
![[ ]](/icons/layout.gif) | 1ENGINE FLUSH JUNE 2015.pdf | 2015-08-19 14:13 | 257K | |
![[ ]](/icons/layout.gif) | 1ENVIRO+ 0W-20 JANUARY 2015.pdf | 2015-02-23 15:32 | 358K | |
![[ ]](/icons/layout.gif) | 1ENVIRO+ 0W-20 MAY 2015.pdf | 2015-05-05 13:16 | 404K | |
![[ ]](/icons/layout.gif) | 1ENVIRO+ 5W-20 JANUARY 2015.pdf | 2015-02-05 11:58 | 325K | |
![[ ]](/icons/layout.gif) | 1ENVIRO+ 5W-20 JUNE 2013.pdf | 2013-11-21 14:42 | 279K | |
![[ ]](/icons/layout.gif) | 1ENVIRO+ 5W-20 MAY 2014.pdf | 2014-05-30 12:44 | 323K | |
![[ ]](/icons/layout.gif) | 1ENVIRO+ 5W-20 MAY 2015.pdf | 2015-06-17 16:56 | 415K | |
![[ ]](/icons/layout.gif) | 1ENVIRO+ 5W-30 JUNE 2013.pdf | 2013-07-18 10:54 | 309K | |
![[ ]](/icons/layout.gif) | 1ENVIRO+5W-40 JUNE 2013.pdf | 2013-07-22 15:59 | 326K | |
![[ ]](/icons/layout.gif) | 1ENVIRO+ 5W-40 Nov 2012.pdf | 2012-11-16 12:01 | 218K | |
![[ ]](/icons/layout.gif) | 1ENVIRO+ 10W-40 JULY 2014.pdf | 2014-10-10 14:25 | 287K | |
![[ ]](/icons/layout.gif) | 1ENVIRO+ 10W-40 MAY 2014.pdf | 2014-05-30 12:49 | 284K | |
![[ ]](/icons/layout.gif) | 1ENVIRO+ C-4 MAY 2014.pdf | 2014-05-30 12:44 | 379K | |
![[ ]](/icons/layout.gif) | 1ENVIRO+ GF-5 JUNE 2013.pdf | 2013-07-22 16:00 | 318K | |
![[ ]](/icons/layout.gif) | 1ENVIRO+ GF-5 SEPTEMBER 2015.pdf | 2015-09-09 11:22 | 537K | |
![[ ]](/icons/layout.gif) | 1ENVIRO+HYBRID 0W-16 JANUARY 2015.pdf | 2015-02-05 11:49 | 324K | |
![[ ]](/icons/layout.gif) | 1ENVIRO PLUS 10W-40 MARCH 2015.pdf | 2015-03-24 17:20 | 287K | |
![[ ]](/icons/layout.gif) | 1EVERYDAY 5W-30 July 2013.pdf | 2013-09-17 11:02 | 320K | |
![[ ]](/icons/layout.gif) | 1EVERYDAY 20W-50 Aug 2012.pdf | 2013-03-08 11:45 | 200K | |
![[ ]](/icons/layout.gif) | 1EVERYDAY 20W-50 SEPTEMBER 2014.pdf | 2014-10-08 12:08 | 303K | |
![[ ]](/icons/layout.gif) | 1EVERYDAY DRIVING OILS Oct 2011.pdf | 2011-12-20 10:19 | 149K | |
![[ ]](/icons/layout.gif) | 1EVERYDAY FULL SYNTHETIC 10W-40 JUNE 2014.pdf | 2015-04-27 10:28 | 315K | |
![[ ]](/icons/layout.gif) | 1EVERYDAY PLUS 5W-40 APRIL 2015.pdf | 2015-04-28 12:51 | 253K | |
![[ ]](/icons/layout.gif) | 1EVERYDAY PLUS 5W-40 SEPTEMBER 2013.pdf | 2013-10-02 15:14 | 192K | |
![[ ]](/icons/layout.gif) | 1EVERYDAY PLUS 10W-40 APRIL 2015.pdf | 2015-04-28 10:30 | 261K | |
![[ ]](/icons/layout.gif) | 1EVERYDAY PLUS 15W-40 APRIL 2015.pdf | 2015-04-28 13:04 | 255K | |
![[ ]](/icons/layout.gif) | 1EXTREME PRESSURE GREASE JULY 2014.pdf | 2014-07-21 10:07 | 181K | |
![[ ]](/icons/layout.gif) | 1Enviro + Engine Oils.pdf | 2011-12-15 20:50 | 63K | |
![[ ]](/icons/layout.gif) | 1Enviro Plus 0W40 and 10W50 APRIL 2010.pdf | 2011-12-15 20:50 | 57K | |
![[ ]](/icons/layout.gif) | 1Everyday Diesel FX April 2013.pdf | 2013-04-30 12:53 | 192K | |
![[ ]](/icons/layout.gif) | 1Everyday Driving Oils JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | 1Everyday Driving Oils JAN 2011.pdf | 2011-12-15 20:50 | 229K | |
![[ ]](/icons/layout.gif) | 1Everyday Full Synthetic 5W-40 April 2011.pdf | 2011-12-02 10:17 | 93K | |
![[ ]](/icons/layout.gif) | 1Everyday Full Synthetic 10W-40 Jan 2011.pdf | 2012-09-11 16:24 | 202K | |
![[ ]](/icons/layout.gif) | 1Everyday Full Synthetic 10W-40 July 2013.pdf | 2013-09-17 10:12 | 309K | |
![[ ]](/icons/layout.gif) | 1Everyday Full Synthetic 10W-40 September 2012.pdf | 2012-09-11 12:39 | 202K | |
![[ ]](/icons/layout.gif) | 1Everyday Full Synthetic Oils OCT 2010.pdf | 2011-12-15 20:50 | 92K | |
![[ ]](/icons/layout.gif) | 1Extreme Pressure Grease.pdf | 2011-12-15 20:50 | 141K | |
![[ ]](/icons/layout.gif) | 1FD01 FLUID MAY 2015.pdf | 2015-06-30 09:11 | 185K | |
![[ ]](/icons/layout.gif) | 1FLEETGEAR 30and50, FLEETRANSC4 August 2012.pdf | 2012-08-21 10:29 | 202K | |
![[ ]](/icons/layout.gif) | 1FLEETGEAR 30and50, FLEETRANSC4 December 2012.pdf | 2012-12-07 15:16 | 201K | |
![[ ]](/icons/layout.gif) | 1FLEETGEAR 30and50, FLEETRANSC4 Oct 2011.pdf | 2011-12-20 10:59 | 152K | |
![[ ]](/icons/layout.gif) | 1FULL SYNTHETIC 5W-30 MAY 2016.pdf | 2016-05-04 12:57 | 357K | |
![[ ]](/icons/layout.gif) | 1Fleet Gear 30 and 50, Fleet-trans C4.pdf | 2011-12-15 20:50 | 193K | |
![[ ]](/icons/layout.gif) | 1Fleet Gear 30 and 50, Fleet-trans C4 JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | 1Fleet Gear 30 and 50 Fleet-trans C4 MAR 2010.pdf | 2011-12-15 20:50 | 185K | |
![[ ]](/icons/layout.gif) | 1Fleetgear 10, 30 & 50 April 2013.pdf | 2013-04-18 15:07 | 204K | |
![[ ]](/icons/layout.gif) | 1GEARBOX OIL 30 AND 40 MAY 2015.pdf | 2015-05-07 12:45 | 280K | |
![[ ]](/icons/layout.gif) | 1GEARBOX OIL 30 and 40 AUGUST 2013.pdf | 2014-08-19 14:58 | 238K | |
![[ ]](/icons/layout.gif) | 1GEARBOX OIL 30 and 40 Feb 2012.pdf | 2012-02-23 14:54 | 115K | |
![[ ]](/icons/layout.gif) | 1GEARBOX OIL 30and40Oct 2011.pdf | 2011-12-20 12:55 | 141K | |
![[ ]](/icons/layout.gif) | 1GEAR OIL 80W-90 MARCH 2015.pdf | 2015-03-31 15:43 | 249K | |
![[ ]](/icons/layout.gif) | 1GEAR OIL 85W-140 MARCH 2015.pdf | 2015-03-31 15:54 | 248K | |
![[ ]](/icons/layout.gif) | 1GEAR OIL 140 MARCH 2015.pdf | 2015-06-23 13:23 | 203K | |
![[ ]](/icons/layout.gif) | 1GEAROIL EP Oct 2011.pdf | 2011-12-15 20:50 | 146K | |
![[ ]](/icons/layout.gif) | 1GEAROIL SYN 220 Oct 2011.pdf | 2012-04-30 15:30 | 146K | |
![[ ]](/icons/layout.gif) | 1GRAPHITE GREASE MAY 2015.pdf | 2015-05-07 09:59 | 166K | |
![[ ]](/icons/layout.gif) | 1GRAPHITE GREASE Oct 2011.pdf | 2012-01-18 16:46 | 140K | |
![[ ]](/icons/layout.gif) | 1Gear Oil EP.pdf | 2011-12-15 20:50 | 48K | |
![[ ]](/icons/layout.gif) | 1Gear Oil EP JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | 1HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL MAY 2015.pdf | 2015-06-22 12:29 | 214K | |
![[ ]](/icons/layout.gif) | 1HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL NOVEMBER 2013.pdf | 2013-11-13 10:59 | 245K | |
![[ ]](/icons/layout.gif) | 1HD OIL FEB 2014.pdf | 2014-03-13 10:00 | 225K | |
![[ ]](/icons/layout.gif) | 1HD OIL Nov 2011.pdf | 2012-08-06 13:35 | 141K | |
![[ ]](/icons/layout.gif) | 1HD OIL Oct 2011.pdf | 2012-01-19 10:34 | 141K | |
![[ ]](/icons/layout.gif) | 1HD Oil.pdf | 2011-12-15 20:50 | 89K | |
![[ ]](/icons/layout.gif) | 1HDPS FLUID Oct 2011.pdf | 2012-12-18 08:59 | 142K | |
![[ ]](/icons/layout.gif) | 1HERITAGE LTM and MTH AUGUST 2013.pdf | 2013-09-10 16:06 | 227K | |
![[ ]](/icons/layout.gif) | 1HIGH TEMP WHEEL BEARING GREASE JULY 2014.pdf | 2014-07-18 16:55 | 426K | |
![[ ]](/icons/layout.gif) | 1HIGH TEMP WHEEL BEARING GREASE JUNE 2012.pdf | 2013-04-23 11:27 | 203K | |
![[ ]](/icons/layout.gif) | 1HIGH TEMP WHEEL BEARING GREASE Oct 2011.pdf | 2012-01-18 16:49 | 146K | |
![[ ]](/icons/layout.gif) | 1HPR 0 0W30 MAY 2012.pdf | 2012-06-04 13:33 | 114K | |
![[ ]](/icons/layout.gif) | 1HPR 0 June 2013.pdf | 2013-06-24 12:34 | 290K | |
![[ ]](/icons/layout.gif) | 1HPR 5 FEBRUARY 2015.pdf | 2015-02-12 10:18 | 312K | |
![[ ]](/icons/layout.gif) | 1HPR 5 FEBRUARY 2016.pdf | 2016-07-20 12:40 | 404K | |
![[ ]](/icons/layout.gif) | 1HPR 5 June 2013.pdf | 2013-06-07 16:37 | 308K | |
![[ ]](/icons/layout.gif) | 1HPR 5 MAY 2012.pdf | 2012-05-23 13:53 | 114K | |
![[ ]](/icons/layout.gif) | 1HPR 5 November 2013.pdf | 2014-09-19 15:03 | 294K | |
![[ ]](/icons/layout.gif) | 1HPR 5 Oct 2011.pdf | 2011-12-23 12:02 | 226K | |
![[ ]](/icons/layout.gif) | 1HPR 10 June 2013.pdf | 2013-06-14 15:04 | 293K | |
![[ ]](/icons/layout.gif) | 1HPR 10 Oct 2011.pdf | 2012-04-03 16:08 | 131K | |
![[ ]](/icons/layout.gif) | 1HPR 10 September 2014.pdf | 2014-11-10 12:57 | 293K | |
![[ ]](/icons/layout.gif) | 1HPR 15 June 2013.pdf | 2013-06-14 15:04 | 288K | |
![[ ]](/icons/layout.gif) | 1HPR 15 Nov 2011.pdf | 2012-04-10 10:50 | 128K | |
![[ ]](/icons/layout.gif) | 1HPR 30 DECEMBER 2015.pdf | 2015-12-07 10:35 | 377K | |
![[ ]](/icons/layout.gif) | 1HPR 30 JULY 2015.pdf | 2015-07-20 11:25 | 298K | |
![[ ]](/icons/layout.gif) | 1HPR 30 June 2013.pdf | 2013-06-07 16:38 | 239K | |
![[ ]](/icons/layout.gif) | 1HPR 30 NOVEMBER 2014.pdf | 2014-11-05 16:27 | 298K | |
![[ ]](/icons/layout.gif) | 1HPR 30 OCTOBER 2014.pdf | 2014-10-16 14:35 | 285K | |
![[ ]](/icons/layout.gif) | 1HPR 30 Oct 2011.pdf | 2012-04-10 11:10 | 123K | |
![[ ]](/icons/layout.gif) | 1HPR 30 SEPTEMBER 2014.pdf | 2014-09-19 16:39 | 285K | |
![[ ]](/icons/layout.gif) | 1HPR 40 DECEMBER 2015.pdf | 2015-12-07 10:35 | 371K | |
![[ ]](/icons/layout.gif) | 1HPR 40 JULY 2014.pdf | 2014-07-17 10:51 | 454K | |
![[ ]](/icons/layout.gif) | 1HPR 40 JUNE 2015.pdf | 2015-06-17 15:22 | 348K | |
![[ ]](/icons/layout.gif) | 1HPR 40 June 2013.pdf | 2013-06-07 16:39 | 238K | |
![[ ]](/icons/layout.gif) | 1HPR 40 MARCH 2015.pdf | 2015-06-17 14:32 | 349K | |
![[ ]](/icons/layout.gif) | 1HPR 40 MAY 2012.pdf | 2012-05-23 16:59 | 92K | |
![[ ]](/icons/layout.gif) | 1HPR 40 SEPTEMBER 2014.pdf | 2014-10-02 11:35 | 349K | |
![[ ]](/icons/layout.gif) | 1HPR 50 DECEMEBR 2015.pdf | 2015-12-22 08:39 | 385K | |
![[ ]](/icons/layout.gif) | 1HPR 50 JUNE 2015.pdf | 2015-06-17 15:17 | 374K | |
![[ ]](/icons/layout.gif) | 1HPR 50 June 2013.pdf | 2013-06-07 16:39 | 234K | |
![[ ]](/icons/layout.gif) | 1HPR 50 MAY 2012.pdf | 2012-10-23 11:11 | 91K | |
![[ ]](/icons/layout.gif) | 1HPR 50 September 2014.pdf | 2014-10-02 11:35 | 282K | |
![[ ]](/icons/layout.gif) | 1HPR DIESEL 5 AUG 2012.pdf | 2012-10-22 10:49 | 219K | |
![[ ]](/icons/layout.gif) | 1HPR DIESEL 5 April 2012.pdf | 2012-04-17 12:24 | 94K | |
![[ ]](/icons/layout.gif) | 1HPR DIESEL 5 MAY 2012.pdf | 2012-05-23 17:01 | 94K | |
![[ ]](/icons/layout.gif) | 1HPR DIESEL AUG 2012.pdf | 2012-10-22 10:56 | 216K | |
![[ ]](/icons/layout.gif) | 1HPR DIESEL August 2012.pdf | 2012-12-14 15:28 | 211K | |
![[ ]](/icons/layout.gif) | 1HPR DIESEL December 2012.pdf | 2012-12-17 09:12 | 211K | |
![[ ]](/icons/layout.gif) | 1HPR Diesel 5 June 2013.pdf | 2013-06-17 10:23 | 299K | |
![[ ]](/icons/layout.gif) | 1HPR Diesel 10 June 2013.pdf | 2013-06-17 11:19 | 289K | |
![[ ]](/icons/layout.gif) | 1HPR Diesel 15 June 2013.pdf | 2013-06-17 10:26 | 293K | |
![[ ]](/icons/layout.gif) | 1HPR Diesel June 2013.pdf | 2013-06-17 10:28 | 286K | |
![[ ]](/icons/layout.gif) | 1HPR GAS.pdf | 2011-12-15 20:50 | 87K | |
![[ ]](/icons/layout.gif) | 1HPR GAS 10.pdf | 2011-12-15 20:50 | 73K | |
![[ ]](/icons/layout.gif) | 1HPR GAS 10 April 2012.pdf | 2012-04-13 13:53 | 114K | |
![[ ]](/icons/layout.gif) | 1HPR GAS April 2012.pdf | 2012-04-13 13:53 | 113K | |
![[ ]](/icons/layout.gif) | 1HPR Gas 10 June 2013.pdf | 2013-06-24 12:34 | 288K | |
![[ ]](/icons/layout.gif) | 1HPR Gas June 2013.pdf | 2013-06-24 12:34 | 286K | |
![[ ]](/icons/layout.gif) | 1HPSO JULY 2013.pdf | 2014-10-28 12:16 | 271K | |
![[ ]](/icons/layout.gif) | 1HTO 32 68 100 DECEMBER 2015.pdf | 2015-12-09 11:41 | 213K | |
![[ ]](/icons/layout.gif) | 1HTO 32 68 100 January 2014.pdf | 2014-01-24 10:43 | 202K | |
![[ ]](/icons/layout.gif) | 1HYPOID 80W-90 MAY 2016.pdf | 2016-05-16 10:34 | 233K | |
![[ ]](/icons/layout.gif) | 1HYPOID 80W90 OCT 2011.pdf | 2014-04-29 13:12 | 200K | |
![[ ]](/icons/layout.gif) | 1HYPOID 85W-140 MAY 2016.pdf | 2016-05-16 10:35 | 233K | |
![[ ]](/icons/layout.gif) | 1HYPOID 85W140 OCT 2011.pdf | 2014-04-29 14:26 | 200K | |
![[ ]](/icons/layout.gif) | 1Heritage LTM and MTH.pdf | 2011-12-15 20:50 | 87K | |
![[ ]](/icons/layout.gif) | 1HiPer Two Stroke JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | 1INDGEAR MP90 April 2013.pdf | 2013-04-24 10:11 | 201K | |
![[ ]](/icons/layout.gif) | 1INDGREASE 100 LXEP2 December 2012.pdf | 2013-04-23 09:39 | 202K | |
![[ ]](/icons/layout.gif) | 1INDGREASE 1615WR GREASE AUGUST 2014.pdf | 2014-08-25 15:20 | 169K | |
![[ ]](/icons/layout.gif) | 1INDGREASE BM3 AUGUST 2014.pdf | 2014-08-21 17:24 | 218K | |
![[ ]](/icons/layout.gif) | 1INDGREASE BM3 Oct 2011.pdf | 2013-04-22 17:38 | 148K | |
![[ ]](/icons/layout.gif) | 1INDGREASE CXOG-05 AUGUST 2014.pdf | 2014-08-21 16:01 | 236K | |
![[ ]](/icons/layout.gif) | 1INDGREASE LCX 1100 AUGUST 2014.pdf | 2014-08-21 12:33 | 174K | |
![[ ]](/icons/layout.gif) | 1INDGREASE LITH EP 0 AUGUST 2014.pdf | 2014-08-18 09:32 | 162K | |
![[ ]](/icons/layout.gif) | 1INDGREASE LITH R3 AUGUST 2014.pdf | 2014-08-25 16:10 | 216K | |
![[ ]](/icons/layout.gif) | 1INDGREASE LITH R3 December 2012.pdf | 2013-04-22 17:25 | 200K | |
![[ ]](/icons/layout.gif) | 1INDGREASE MOLY HT AUGUST 2014.pdf | 2014-10-24 13:27 | 255K | |
![[ ]](/icons/layout.gif) | 1INDGREASE MOLY HT JUNE 2014.pdf | 2014-06-17 12:31 | 252K | |
![[ ]](/icons/layout.gif) | 1INDGREASE MOLY HT OCTOBER 2014.pdf | 2014-10-24 15:26 | 255K | |
![[ ]](/icons/layout.gif) | 1INDUS COMPRESSOL OIL 2KH SERIES June 2012.pdf | 2012-06-12 16:20 | 118K | |
![[ ]](/icons/layout.gif) | 1INDUS COMPRESSOR OIL 2KH SERIES DECEMBER 2014.pdf | 2014-12-02 12:02 | 223K | |
![[ ]](/icons/layout.gif) | 1INDUS COMPRESSOR OIL 4KH SERIES DECEMBER 2014.pdf | 2015-01-27 08:40 | 324K | |
![[ ]](/icons/layout.gif) | 1INDUS GEAR OIL EP - DECEMBER 2014.pdf | 2014-12-10 11:44 | 203K | |
![[ ]](/icons/layout.gif) | 1INDUS GEAR OIL EP August 2012.pdf | 2012-08-21 15:49 | 206K | |
![[ ]](/icons/layout.gif) | 1INDUS GEAR OIL EP MAY 2012.pdf | 2012-05-11 13:09 | 116K | |
![[ ]](/icons/layout.gif) | 1INDUS HV HYDRAULIC OIL AUGUST 2014.pdf | 2014-08-12 15:01 | 214K | |
![[ ]](/icons/layout.gif) | 1INDUS HV HYDRAULIC OIL April 2013.pdf | 2013-04-22 10:29 | 203K | |
![[ ]](/icons/layout.gif) | 1INDUS HV HYDRAULIC OIL August 2012.pdf | 2012-08-21 14:23 | 203K | |
![[ ]](/icons/layout.gif) | 1INDUS HV HYDRAULIC OIL DECEMBER 2014.pdf | 2014-12-05 13:19 | 214K | |
![[ ]](/icons/layout.gif) | 1INDUS HV HYDRAULIC OIL December 2011.pdf | 2011-12-15 20:50 | 149K | |
![[ ]](/icons/layout.gif) | 1INDUS HV HYDRAULIC OIL FEBRUARY 2014.pdf | 2014-02-18 12:02 | 214K | |
![[ ]](/icons/layout.gif) | 1INDUS HV HYDRAULIC OIL NOVEMBER 2013.pdf | 2013-11-14 16:18 | 211K | |
![[ ]](/icons/layout.gif) | 1INDUS HV HYDRAULIC OIL September 2012.pdf | 2012-10-01 13:22 | 203K | |
![[ ]](/icons/layout.gif) | 1INDUS INDGEAR B - DECEMBER 2014.pdf | 2014-12-10 13:11 | 160K | |
![[ ]](/icons/layout.gif) | 1INDUS INDGEAR B - DECEMBER 2015.pdf | 2015-12-09 13:06 | 174K | |
![[ ]](/icons/layout.gif) | 1INDUS INDGEAR B December 2012.pdf | 2012-12-10 09:41 | 201K | |
![[ ]](/icons/layout.gif) | 1INDUS MR 68 HYDRAULIC OIL NOVEMBER 2013.pdf | 2013-12-03 10:31 | 186K | |
![[ ]](/icons/layout.gif) | 1INDUS PRO HYDRAULIC OILS DEC 2011.pdf | 2012-08-06 13:37 | 148K | |
![[ ]](/icons/layout.gif) | 1INDUS PRO HYDRAULIC OILS DECEMBER 2013.pdf | 2013-12-04 16:07 | 234K | |
![[ ]](/icons/layout.gif) | 1INDUS PRO HYDRAULIC OILS DECEMBER 2014.pdf | 2014-12-15 17:02 | 234K | |
![[ ]](/icons/layout.gif) | 1INDUS PRO HYDRAULIC OILS MAY 2015.pdf | 2015-05-27 09:48 | 232K | |
![[ ]](/icons/layout.gif) | 1INDUS PRO HYDRAULIC OILS OCTOBER 2015.pdf | 2015-10-21 17:35 | 203K | |
![[ ]](/icons/layout.gif) | 1Indgrease 1615WR February 2013.pdf | 2013-04-23 10:03 | 200K | |
![[ ]](/icons/layout.gif) | 1Indgrease CXOG-05 December 2012.pdf | 2013-04-23 09:57 | 203K | |
![[ ]](/icons/layout.gif) | 1Indgrease LCX 1100 December 2012.pdf | 2013-04-23 11:50 | 200K | |
![[ ]](/icons/layout.gif) | 1Indgrease Moly HT April 2013.pdf | 2013-04-23 11:39 | 189K | |
![[ ]](/icons/layout.gif) | 1Indus HV JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | 1Indus HV March 2011.pdf | 2011-12-15 20:50 | 93K | |
![[ ]](/icons/layout.gif) | 1LDAS FLUID AUGUST 2013.pdf | 2013-10-08 15:56 | 158K | |
![[ ]](/icons/layout.gif) | 1LHM PLUS JULY 2013.pdf | 2013-08-19 12:25 | 224K | |
![[ ]](/icons/layout.gif) | 1LHM PLUS Oct 2011.pdf | 2013-02-19 10:53 | 202K | |
![[ ]](/icons/layout.gif) | 1LIMSLIP 90, 854W140, 140 Oct 2011.pdf | 2011-12-20 11:08 | 149K | |
![[ ]](/icons/layout.gif) | 1Limslip 90, 85-140 and 140.pdf | 2011-12-15 20:50 | 148K | |
![[ ]](/icons/layout.gif) | 1Limslip 90, 85W-140 and 140 April 2011.pdf | 2011-12-15 20:50 | 92K | |
![[ ]](/icons/layout.gif) | 1Limslip 90, 85W-140 and 140 JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | 1Limslip 90, 85W-140 and 140 JAN 2011.pdf | 2011-12-15 20:50 | 202K | |
![[ ]](/icons/layout.gif) | 1MARINE GEAR OIL 75W90 FEBRUARY 2015.pdf | 2015-02-13 17:08 | 232K | |
![[ ]](/icons/layout.gif) | 1MARINE GEAR OIL SS150 & SS300 DECEMBER 2014.pdf | 2014-12-12 16:45 | 290K | |
![[ ]](/icons/layout.gif) | 1MARINE OUTBOARD TWO STROKE OIL June 2012.pdf | 2012-08-28 14:25 | 217K | |
![[ ]](/icons/layout.gif) | 1MB 15 SUSPENSION FLUID APRIL 2015.pdf | 2015-06-24 17:18 | 270K | |
![[ ]](/icons/layout.gif) | 1MB 15 SUSPENSION FLUID JULY 2013.pdf | 2013-09-10 11:12 | 281K | |
![[ ]](/icons/layout.gif) | 1MC-4 V TWIN 20W-50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MAY 2016.pdf | 2016-05-13 15:45 | 366K | |
![[ ]](/icons/layout.gif) | 1MC2ST FULL SYNTHETIC TWO STROKE MOTORCYCLE OIL JULY 2013.pdf | 2014-08-27 13:10 | 307K | |
![[ ]](/icons/layout.gif) | 1MC4-ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2016.pdf | 2016-06-16 12:18 | 342K | |
![[ ]](/icons/layout.gif) | 1MC4 FULL SYNTHETIC 10W40 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-13 14:29 | 340K | |
![[ ]](/icons/layout.gif) | 1MC4 MINERAL 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-13 17:52 | 319K | |
![[ ]](/icons/layout.gif) | 1MC4 SEMI SYNTHETIC 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-13 17:41 | 325K | |
![[ ]](/icons/layout.gif) | 1MC4ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-13 17:58 | 307K | |
![[ ]](/icons/layout.gif) | 1MC4ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-13 17:57 | 335K | |
![[ ]](/icons/layout.gif) | 1MC4ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL OCTOBER 2013.pdf | 2013-12-12 16:24 | 337K | |
![[ ]](/icons/layout.gif) | 1MC4ST 10W50 SEMI SYNTHETIC FOUR STROKE MOTORCYCLE OIL JULY 2013.pdf | 2013-10-31 08:25 | 367K | |
![[ ]](/icons/layout.gif) | 1MC4ST 10W50 SEMI SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-19 16:55 | 326K | |
![[ ]](/icons/layout.gif) | 1MC4ST 15W50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-19 09:00 | 336K | |
![[ ]](/icons/layout.gif) | 1MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-01-23 14:28 | 334K | |
![[ ]](/icons/layout.gif) | 1MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JULY 2013.pdf | 2013-12-16 12:35 | 349K | |
![[ ]](/icons/layout.gif) | 1MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2015.pdf | 2015-02-23 17:24 | 294K | |
![[ ]](/icons/layout.gif) | 1MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-13 11:35 | 248K | |
![[ ]](/icons/layout.gif) | 1MC FORK OIL APRIL 2015.pdf | 2015-04-30 16:13 | 203K | |
![[ ]](/icons/layout.gif) | 1MC FORK OIL DECEMEBR 2015.pdf | 2015-12-08 15:29 | 248K | |
![[ ]](/icons/layout.gif) | 1MC FORK OIL JUNE 2015.pdf | 2015-06-30 11:30 | 232K | |
![[ ]](/icons/layout.gif) | 1MDEO RANGE (12 & 15 TBN) DECEMBER 2014.pdf | 2014-12-15 12:15 | 179K | |
![[ ]](/icons/layout.gif) | 1MILD EP GEAR OIL OCT 2011.pdf | 2011-12-20 12:57 | 144K | |
![[ ]](/icons/layout.gif) | 1MOLYGREASE EP 3 APRIL 2014.pdf | 2014-07-18 09:28 | 468K | |
![[ ]](/icons/layout.gif) | 1MONO TRUCK 30 APRIL 2014.pdf | 2014-04-16 15:18 | 172K | |
![[ ]](/icons/layout.gif) | 1MONO TRUCK 30 NOVEMBER 2013.pdf | 2013-12-16 11:13 | 169K | |
![[ ]](/icons/layout.gif) | 1MONO TRUCK 40 APRIL 2014.pdf | 2014-04-16 15:24 | 180K | |
![[ ]](/icons/layout.gif) | 1MONO TRUCK 40 NOVEMBER 2013.pdf | 2013-12-17 12:24 | 182K | |
![[ ]](/icons/layout.gif) | 1MONO TRUCK 50 APRIL 2014.pdf | 2014-04-16 15:19 | 173K | |
![[ ]](/icons/layout.gif) | 1MONO TRUCK 50 NOVEMBER 2013.pdf | 2013-12-17 12:29 | 171K | |
![[ ]](/icons/layout.gif) | 1MONO TRUCK December 2012.pdf | 2012-12-07 15:00 | 201K | |
![[ ]](/icons/layout.gif) | 1MONO TRUCK OCT 2011.pdf | 2011-12-20 12:06 | 156K | |
![[ ]](/icons/layout.gif) | 1MOTORCYCLE FORK OILS MAY 2012.pdf | 2012-10-08 09:18 | 96K | |
![[ ]](/icons/layout.gif) | 1MOTORCYCLE FORK OILS OCTOBER 2014.pdf | 2014-10-28 12:15 | 193K | |
![[ ]](/icons/layout.gif) | 1MOTORCYCLE FORK OILS SEPTEMBER 2013.pdf | 2013-09-12 12:02 | 173K | |
![[ ]](/icons/layout.gif) | 1Mild EP Gear oil JAN 2010.pdf | 2011-12-15 20:50 | 193K | |
![[ ]](/icons/layout.gif) | 1Moly 3% Grease.pdf | 2011-12-15 20:50 | 86K | |
![[ ]](/icons/layout.gif) | 1Mono Truck.pdf | 2011-12-15 20:50 | 57K | |
![[ ]](/icons/layout.gif) | 1P26 THROTTLE BODY & CARB CLEANER JANUARY 2016.pdf | 2016-01-15 11:01 | 210K | |
![[ ]](/icons/layout.gif) | 1PAS FLUID JULY 2013.pdf | 2014-05-02 14:38 | 154K | |
![[ ]](/icons/layout.gif) | 1PEN 4297 April 2013.pdf | 2013-04-23 12:34 | 200K | |
![[ ]](/icons/layout.gif) | 1PEN 4297 JULY 2013.pdf | 2014-03-31 13:10 | 204K | |
![[ ]](/icons/layout.gif) | 1PEN 4297 OCT 2011.pdf | 2012-08-16 09:44 | 141K | |
![[ ]](/icons/layout.gif) | 1PGXL COOLANT PREMIX MAY 2013.pdf | 2015-05-01 11:59 | 256K | |
![[ ]](/icons/layout.gif) | 1PGXL COOLANT PREMIX MAY 2015.pdf | 2015-06-22 12:50 | 256K | |
![[ ]](/icons/layout.gif) | 1PGXL Coolant Premix April 2013.pdf | 2013-04-19 12:20 | 191K | |
![[ ]](/icons/layout.gif) | 1PI_Gear Oil EP_PSD.pdf | 2011-12-15 20:50 | 131K | |
![[ ]](/icons/layout.gif) | 1POWER STEERING FLUID JULY 2013.pdf | 2014-03-27 17:09 | 234K | |
![[ ]](/icons/layout.gif) | 1POWER STEERING FLUID May 2013.pdf | 2013-05-20 16:40 | 265K | |
![[ ]](/icons/layout.gif) | 1PREMIUM MINERAL 10W-30 NOVEMBER 2015.pdf | 2015-11-23 15:24 | 337K | |
![[ ]](/icons/layout.gif) | 1PRO 5 5W-30 MAY 2016.pdf | 2016-06-08 12:15 | 339K | |
![[ ]](/icons/layout.gif) | 1PRO 10 10W-30 JUNE 2015.pdf | 2015-08-12 16:57 | 286K | |
![[ ]](/icons/layout.gif) | 1PRO ENGINE OILS 5 & 10 Aug 2012.pdf | 2012-08-15 14:51 | 201K | |
![[ ]](/icons/layout.gif) | 1PRO ENGINE OILS 5 10 and 20 Aug 2012.pdf | 2012-08-09 17:16 | 203K | |
![[ ]](/icons/layout.gif) | 1PRO ENGINE OILS 5 10 and 20 OCT 2011.pdf | 2011-12-20 10:39 | 156K | |
![[ ]](/icons/layout.gif) | 1PRO GEAR 80W-140 - JUNE 2014.pdf | 2014-06-19 10:11 | 186K | |
![[ ]](/icons/layout.gif) | 1PRO GEAR 80W-140 AUGUST 2013.pdf | 2013-09-25 12:00 | 185K | |
![[ ]](/icons/layout.gif) | 1PRO GEAR 85W-110 MARCH 2015.pdf | 2015-03-31 16:07 | 183K | |
![[ ]](/icons/layout.gif) | 1PRO HYDRAULIC OILS August 2012.pdf | 2012-08-21 12:41 | 201K | |
![[ ]](/icons/layout.gif) | 1PRO HYDRAULIC OILS OCT 2011.pdf | 2011-12-15 20:50 | 148K | |
![[ ]](/icons/layout.gif) | 1PRO WORKSHOP - PRO 5 JAN 2014.pdf | 2014-02-12 15:25 | 327K | |
![[ ]](/icons/layout.gif) | 1Petrol Injector Cleaner Dec 2012.pdf | 2012-12-07 14:16 | 214K | |
![[ ]](/icons/layout.gif) | 1Pro Cooling System Inhibitor.pdf | 2011-12-15 20:50 | 744K | |
![[ ]](/icons/layout.gif) | 1Pro Engine Oils.pdf | 2011-12-15 20:50 | 53K | |
![[ ]](/icons/layout.gif) | 1Pro Engine Oils AUGUST 2011.pdf | 2011-12-15 20:50 | 99K | |
![[ ]](/icons/layout.gif) | 1Pro Engine Oils DEC 2010.pdf | 2011-12-15 20:50 | 204K | |
![[ ]](/icons/layout.gif) | 1Pro Engine Oils MAR 2010.pdf | 2011-12-15 20:50 | 206K | |
![[ ]](/icons/layout.gif) | 1Pro Engine Oils SEPTEMBER 2011 (2).pdf | 2011-12-15 20:50 | 97K | |
![[ ]](/icons/layout.gif) | 1Pro Hydraulic Oil.pdf | 2011-12-15 20:50 | 85K | |
![[ ]](/icons/layout.gif) | 1Pro Hydraulic Oil JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | 1QCA GREASE MX9 AUGUST 2014.pdf | 2014-08-20 15:16 | 244K | |
![[ ]](/icons/layout.gif) | 1QCA GREASE MX9 December 2012.pdf | 2013-04-23 09:52 | 204K | |
![[ ]](/icons/layout.gif) | 1QCS GREASE MXG 0 AUGUST 2014.pdf | 2014-08-21 09:18 | 240K | |
![[ ]](/icons/layout.gif) | 1QCS Grease MXG 0 December 2012.pdf | 2013-04-23 09:54 | 204K | |
![[ ]](/icons/layout.gif) | 1RACE CASTOR OIL JULY 2012.pdf | 2012-08-30 11:01 | 201K | |
![[ ]](/icons/layout.gif) | 1RACING BRAKE FLUID Aug 2012.pdf | 2013-06-24 16:02 | 200K | |
![[ ]](/icons/layout.gif) | 1RACING BRAKE FLUID JUNE 2012.pdf | 2012-08-14 16:05 | 203K | |
![[ ]](/icons/layout.gif) | 1RADIATOR FLUSH SEPTEMBER 2013.pdf | 2013-09-18 11:17 | 269K | |
![[ ]](/icons/layout.gif) | 1ROCKSLIDE DECEMBER 2014.pdf | 2014-12-02 15:18 | 273K | |
![[ ]](/icons/layout.gif) | 1ROCKSLIDE November 2014.pdf | 2014-12-01 14:02 | 255K | |
![[ ]](/icons/layout.gif) | 1RUBBER GREASE JULY 2014.pdf | 2014-07-21 12:49 | 227K | |
![[ ]](/icons/layout.gif) | 1RUBBER GREASE OCT 2011.pdf | 2013-04-22 17:43 | 140K | |
![[ ]](/icons/layout.gif) | 1RUBBER PROTECTANT SEPTEMBER 2013.pdf | 2013-11-22 11:17 | 297K | |
![[ ]](/icons/layout.gif) | 1RUNNING IN OIL February 2013.pdf | 2013-02-07 17:32 | 200K | |
![[ ]](/icons/layout.gif) | 1RUNNING IN OIL OCT 2011.pdf | 2011-12-20 13:16 | 144K | |
![[ ]](/icons/layout.gif) | 1Radiator Inhibitor Aug 2012.pdf | 2012-10-24 17:06 | 197K | |
![[ ]](/icons/layout.gif) | 1Rapid 7 Flush.pdf | 2011-12-15 20:50 | 84K | |
![[ ]](/icons/layout.gif) | 1SEMI FLUID GREASE JULY 2014.pdf | 2014-07-15 10:37 | 430K | |
![[ ]](/icons/layout.gif) | 1SEMI FLUID GREASE OCT 2011.pdf | 2011-12-20 12:58 | 140K | |
![[ ]](/icons/layout.gif) | 1SEMI FLUID GREASE OCTOBER 2013.pdf | 2013-10-31 16:47 | 216K | |
![[ ]](/icons/layout.gif) | 1SEMI SYNTHETIC 10W-40 NOVEMBER 2015.pdf | 2015-11-23 15:31 | 338K | |
![[ ]](/icons/layout.gif) | 1SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-08-28 11:52 | 338K | |
![[ ]](/icons/layout.gif) | 1SHELSLEY ENGINE OILS August 2012.pdf | 2012-08-21 16:24 | 201K | |
![[ ]](/icons/layout.gif) | 1SHELSLEY ENGINE OILS FEBRUARY 2016.pdf | 2016-02-18 14:39 | 412K | |
![[ ]](/icons/layout.gif) | 1SHELSLEY ENGINE OILS JULY 2014.pdf | 2014-07-16 15:44 | 591K | |
![[ ]](/icons/layout.gif) | 1SHELSLEY ENGINE OILS MARCH 2014.pdf | 2014-03-05 14:13 | 409K | |
![[ ]](/icons/layout.gif) | 1SHELSLEY ENGINE OILS OCT 2011.pdf | 2011-12-09 16:22 | 146K | |
![[ ]](/icons/layout.gif) | 1SHOCKER OILS AUGUST 2013.pdf | 2014-03-31 11:03 | 277K | |
![[ ]](/icons/layout.gif) | 1SHOCKER OILS OCT 2011.pdf | 2011-12-20 13:02 | 140K | |
![[ ]](/icons/layout.gif) | 1SIN ATF.pdf | 2011-12-15 20:50 | 60K | |
![[ ]](/icons/layout.gif) | 1SIN BRAKE FLUID OCT 2011.pdf | 2012-01-19 10:30 | 149K | |
![[ ]](/icons/layout.gif) | 1SIN Comp Auto.pdf | 2011-12-15 20:50 | 70K | |
![[ ]](/icons/layout.gif) | 1SIN GEAR 75W90and80W140 OCT 2011.pdf | 2011-12-20 11:48 | 152K | |
![[ ]](/icons/layout.gif) | 1SIN Manual Trans.pdf | 2011-12-15 20:50 | 71K | |
![[ ]](/icons/layout.gif) | 1SIN RACE CASTOR OCT 2011.pdf | 2012-04-03 13:14 | 140K | |
![[ ]](/icons/layout.gif) | 1SIN Race Castor.pdf | 2012-07-18 16:09 | 66K | |
![[ ]](/icons/layout.gif) | 1SMALL ENGINE FOUR STROKE MONOGRADE 30 OCT 2011.pdf | 2012-04-18 13:55 | 95K | |
![[ ]](/icons/layout.gif) | 1SMALL ENGINE FOUR STROKE MULTIGRADE 10W-30 MARCH 2015.pdf | 2015-08-12 09:32 | 207K | |
![[ ]](/icons/layout.gif) | 1SMALL ENGINE FOUR STROKE OIL 10W-30 APRIL 2012.pdf | 2012-04-19 13:57 | 117K | |
![[ ]](/icons/layout.gif) | 1SMALL ENGINE FOUR STROKE OIL 10W-30 August 2014.pdf | 2014-08-15 13:04 | 185K | |
![[ ]](/icons/layout.gif) | 1SMALL ENGINE FOUR STROKE OIL 10W-30 SEPTEMBER 2014.pdf | 2014-10-14 15:29 | 185K | |
![[ ]](/icons/layout.gif) | 1SMALL ENGINE FOUR STROKE OIL 20W-50 APRIL 2012.pdf | 2012-10-26 14:41 | 96K | |
![[ ]](/icons/layout.gif) | 1SMALL ENGINE FOUR STROKE OILS 10W30 and 20W50 OCT 2011.pdf | 2011-12-20 12:20 | 161K | |
![[ ]](/icons/layout.gif) | 1SU DASHPOTandSU DAMPER OCT 2011.pdf | 2011-12-20 13:06 | 141K | |
![[ ]](/icons/layout.gif) | 1SYNMARINE OB TS OCT 2011.pdf | 2011-12-20 12:22 | 152K | |
![[ ]](/icons/layout.gif) | 1Shelsley Engine Oils.pdf | 2011-12-15 20:50 | 43K | |
![[ ]](/icons/layout.gif) | 1Shelsley Engine Oils JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | 1Small Engine Four Stroke 10W-30 and 20W-50.pdf | 2011-12-15 20:50 | 54K | |
![[ ]](/icons/layout.gif) | 1Small Engine Four Stroke 10W-30 and 20W-50 MAR 2010.pdf | 2011-12-15 20:50 | 198K | |
![[ ]](/icons/layout.gif) | 1Small Engine Four Stroke 10W-30 and 20W-50 MAR 2011.pdf | 2012-08-08 07:51 | 100K | |
![[ ]](/icons/layout.gif) | 1TRAC TRANS AND HYD OIL NOVEMBER 2013.pdf | 2013-12-06 15:14 | 249K | |
![[ ]](/icons/layout.gif) | 1TRANS GEAR 75W-90 August 2012.pdf | 2012-09-03 16:29 | 207K | |
![[ ]](/icons/layout.gif) | 1TRANS GEAR 75W-90 MARCH 2015.pdf | 2015-03-31 16:05 | 250K | |
![[ ]](/icons/layout.gif) | 1TRANSOIL 90 140 250 AUGUST 2013.pdf | 2013-08-28 11:59 | 237K | |
![[ ]](/icons/layout.gif) | 1TRANSOIL 90 140 250 MAY 2015.pdf | 2015-05-07 13:11 | 292K | |
![[ ]](/icons/layout.gif) | 1TRANSOIL 90 140 250 OCT 2011.pdf | 2011-12-09 16:55 | 144K | |
![[ ]](/icons/layout.gif) | 1TRANSOIL 90 140 250 OCTOBER 2013.pdf | 2013-10-18 12:33 | 240K | |
![[ ]](/icons/layout.gif) | 1TRANSOIL 90 140 250 OCTOBER 2015.pdf | 2015-10-05 14:59 | 292K | |
![[ ]](/icons/layout.gif) | 1Transoil 90 140 250 JAN 2010.pdf | 2011-12-15 20:50 | 192K | |
![[ ]](/icons/layout.gif) | 1UNIVERSAL FARM OIL NOV 2013.pdf | 2013-11-21 14:34 | 219K | |
![[ ]](/icons/layout.gif) | 1UNIVERSAL FARM OIL OCT 2011.pdf | 2012-08-27 15:07 | 156K | |
![[ ]](/icons/layout.gif) | 1Universal Coolant Top Up July 2013.pdf | 2013-12-11 17:03 | 340K | |
![[ ]](/icons/layout.gif) | 1VALVE SHIELD APRIL 2015.pdf | 2015-05-08 09:15 | 298K | |
![[ ]](/icons/layout.gif) | 1VALVESHIELD FEBRUARY 2015.pdf | 2015-04-01 12:26 | 281K | |
![[ ]](/icons/layout.gif) | 1VALVESHIELD OCT 2011.pdf | 2012-01-18 16:58 | 149K | |
![[ ]](/icons/layout.gif) | 1VANTAGE FULL SYNTHETIC 10W-40 JANUARY 2016.pdf | 2016-03-31 16:30 | 331K | |
![[ ]](/icons/layout.gif) | 1Valveshield.pdf | 2011-12-15 20:50 | 656K | |
![[ ]](/icons/layout.gif) | 1WATER PUMP GREASE JULY 2014.pdf | 2014-07-25 14:34 | 275K | |
![[ ]](/icons/layout.gif) | 1WATER PUMP GREASE OCT 2011.pdf | 2013-04-23 10:08 | 140K | |
![[ ]](/icons/layout.gif) | 1WHEEL RIM CLEANER SEPTEMBER 2013.pdf | 2013-10-17 09:21 | 267K | |
![[ ]](/icons/layout.gif) | 2ACT GREASE XEP2 December 2012.pdf | 2013-04-23 11:40 | 204K | |
![[ ]](/icons/layout.gif) | 2ANTI FREEZE ANTI BOIL PREMIX BLUE April 2013.pdf | 2013-09-27 10:52 | 204K | |
![[ ]](/icons/layout.gif) | 2ATF FS FULL SYNTHETIC MULTI VEHICLE AUTO TRANS Feb 2012.pdf | 2012-05-03 14:32 | 119K | |
![[ ]](/icons/layout.gif) | 2ATF FS JUNE 2013.pdf | 2014-01-21 14:27 | 287K | |
![[ ]](/icons/layout.gif) | 2BRAKE FLUID DOT 3 APRIL 2014.pdf | 2014-04-11 15:26 | 226K | |
![[ ]](/icons/layout.gif) | 2BRAKE FLUID DOT 3 JULY 2013.pdf | 2013-07-12 16:56 | 224K | |
![[ ]](/icons/layout.gif) | 2BRAKE FLUID RACING NOVEMBER 2013.pdf | 2014-02-24 15:38 | 209K | |
![[ ]](/icons/layout.gif) | 2BRAKE FLUID SUPER DOT 4 APRIL 2014.pdf | 2014-04-11 15:29 | 227K | |
![[ ]](/icons/layout.gif) | 2BRAKE FLUID SUPER DOT 4 JULY 2013.pdf | 2013-07-12 16:44 | 226K | |
![[ ]](/icons/layout.gif) | 2Bentone HD Grease December 2012.pdf | 2013-04-23 11:59 | 201K | |
![[ ]](/icons/layout.gif) | 2CAM ASSEMBLY LUBE AUGUST 2014.pdf | 2014-08-28 12:55 | 178K | |
![[ ]](/icons/layout.gif) | 2CAM ASSEMBLY LUBE Oct 2011.pdf | 2013-04-22 17:47 | 140K | |
![[ ]](/icons/layout.gif) | 2CHAINSAW BAR OIL JULY 2014.pdf | 2014-07-31 09:22 | 226K | |
![[ ]](/icons/layout.gif) | 2CHAINSAW BAR OIL Oct 2011.pdf | 2012-04-18 12:52 | 114K | |
![[ ]](/icons/layout.gif) | 2CLASSIC CAR COOLANT MAY 2015.pdf | 2015-06-22 13:03 | 303K | |
![[ ]](/icons/layout.gif) | 2CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-10-31 14:24 | 329K | |
![[ ]](/icons/layout.gif) | 2CLASSIC ENGINE OILS FEBRUARY 2016.pdf | 2016-02-17 12:39 | 367K | |
![[ ]](/icons/layout.gif) | 2CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 15:06 | 447K | |
![[ ]](/icons/layout.gif) | 2CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-05 15:23 | 329K | |
![[ ]](/icons/layout.gif) | 2CLASSIC ENGINE OILS Oct 2011.pdf | 2011-12-09 16:24 | 145K | |
![[ ]](/icons/layout.gif) | 2CLASSIC MINI 20W-50 MAY 2015.pdf | 2015-05-07 12:10 | 318K | |
![[ ]](/icons/layout.gif) | 2CLASSIC TRIUMPH MAY 2015.pdf | 2015-05-07 12:33 | 303K | |
![[ ]](/icons/layout.gif) | 2COPPER EZE AUGUST 2014.pdf | 2014-08-28 13:12 | 212K | |
![[ ]](/icons/layout.gif) | 2COPPER EZE December 2012.pdf | 2013-04-23 11:57 | 185K | |
![[ ]](/icons/layout.gif) | 2COPPER EZE FEBRUARY 2014.pdf | 2014-02-05 16:11 | 199K | |
![[ ]](/icons/layout.gif) | 2COPPER EZE MAY 2013.pdf | 2013-05-10 15:04 | 185K | |
![[ ]](/icons/layout.gif) | 2Classic Engine Oils.pdf | 2011-12-15 20:50 | 44K | |
![[ ]](/icons/layout.gif) | 2Classic Mini Oil July 2013.pdf | 2013-11-27 09:09 | 268K | |
![[ ]](/icons/layout.gif) | 2DIESEL HD 15W-40 JUNE 2014.pdf | 2014-06-16 13:00 | 365K | |
![[ ]](/icons/layout.gif) | 2DIESEL INJECTOR CLEANER - FEBRUARY 2015.pdf | 2015-02-17 12:11 | 180K | |
![[ ]](/icons/layout.gif) | 2DPF CLEANER APRIL 2015.pdf | 2015-10-26 16:21 | 591K | |
![[ ]](/icons/layout.gif) | 2DPF CLEANER JANUARY 2014.pdf | 2014-03-26 14:57 | 562K | |
![[ ]](/icons/layout.gif) | 2Diesel FX April 2013.pdf | 2013-05-01 08:32 | 192K | |
![[ ]](/icons/layout.gif) | 2Diesel FX MAR 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | 2ENDURO MARCH 2014.pdf | 2014-03-13 09:47 | 253K | |
![[ ]](/icons/layout.gif) | 2ENDURO Oct 2011.pdf | 2012-01-19 10:35 | 142K | |
![[ ]](/icons/layout.gif) | 2ENVIRO+ 0W-20 MAY 2015.pdf | 2015-05-05 15:29 | 399K | |
![[ ]](/icons/layout.gif) | 2ENVIRO+ 5W-20 JANUARY 2015.pdf | 2015-02-12 08:51 | 325K | |
![[ ]](/icons/layout.gif) | 2ENVIRO+ 5W-20 JUNE 2013.pdf | 2013-11-21 14:43 | 279K | |
![[ ]](/icons/layout.gif) | 2ENVIRO+ 5W-30 JUNE 2013.pdf | 2013-08-06 09:52 | 309K | |
![[ ]](/icons/layout.gif) | 2ENVIRO+ 5W-40 Nov 2012.pdf | 2012-11-16 12:06 | 218K | |
![[ ]](/icons/layout.gif) | 2ENVIRO+ 10W-40 JULY 2014.pdf | 2014-10-10 14:26 | 287K | |
![[ ]](/icons/layout.gif) | 2ENVIRO+ 10W-40 MAY 2014.pdf | 2014-05-30 12:51 | 284K | |
![[ ]](/icons/layout.gif) | 2ENVIRO+ GF-5 JUNE 2013.pdf | 2013-10-02 16:09 | 327K | |
![[ ]](/icons/layout.gif) | 2ENVIRO PLUS 10W-40 MARCH 2015.pdf | 2015-03-26 10:29 | 287K | |
![[ ]](/icons/layout.gif) | 2EVERYDAY DRIVING OILS Oct 2011.pdf | 2011-12-20 10:20 | 149K | |
![[ ]](/icons/layout.gif) | 2EVERYDAY PLUS 10W-40 APRIL 2015.pdf | 2015-04-28 13:02 | 261K | |
![[ ]](/icons/layout.gif) | 2Enviro + Engine Oils.pdf | 2011-12-15 20:50 | 63K | |
![[ ]](/icons/layout.gif) | 2Everyday Diesel FX April 2013.pdf | 2013-05-01 08:32 | 192K | |
![[ ]](/icons/layout.gif) | 2Everyday Driving Oils JAN 2011.pdf | 2011-12-15 20:50 | 229K | |
![[ ]](/icons/layout.gif) | 2Everyday Full Synthetic 5W-40 April 2011.pdf | 2012-01-18 15:52 | 93K | |
![[ ]](/icons/layout.gif) | 2Everyday Full Synthetic 10W-40 July 2013.pdf | 2013-09-17 10:12 | 309K | |
![[ ]](/icons/layout.gif) | 2Everyday Full Synthetic 10W-40 September 2012.pdf | 2012-09-11 12:48 | 202K | |
![[ ]](/icons/layout.gif) | 2Extreme Pressure Grease.pdf | 2011-12-15 20:50 | 141K | |
![[ ]](/icons/layout.gif) | 2FLEETGEAR 30and50, FLEETRANSC4 Oct 2011.pdf | 2011-12-20 11:58 | 152K | |
![[ ]](/icons/layout.gif) | 2FULL SYNTHETIC 5W-30 MAY 2016.pdf | 2016-05-04 14:10 | 357K | |
![[ ]](/icons/layout.gif) | 2Fleet Gear 30 and 50, Fleet-trans C4.pdf | 2011-12-15 20:50 | 193K | |
![[ ]](/icons/layout.gif) | 2Fleet Gear 30 and 50, Fleet-trans C4 JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | 2Fleetgear 10, 30 & 50 April 2013.pdf | 2013-11-27 08:56 | 204K | |
![[ ]](/icons/layout.gif) | 2GEARBOX OIL 30 AND 40 MAY 2015.pdf | 2015-05-07 12:46 | 280K | |
![[ ]](/icons/layout.gif) | 2GEARBOX OIL 30 and 40 AUGUST 2013.pdf | 2014-08-19 14:59 | 238K | |
![[ ]](/icons/layout.gif) | 2GEARBOX OIL 30 and 40 Feb 2012.pdf | 2012-02-23 14:54 | 115K | |
![[ ]](/icons/layout.gif) | 2GEARBOX OIL 30and40Oct 2011.pdf | 2011-12-20 12:56 | 141K | |
![[ ]](/icons/layout.gif) | 2GEAR OIL 80W-90 MARCH 2015.pdf | 2015-03-31 15:51 | 249K | |
![[ ]](/icons/layout.gif) | 2GEAROIL EP Oct 2011.pdf | 2011-12-15 20:50 | 146K | |
![[ ]](/icons/layout.gif) | 2GRAPHITE GREASE Oct 2011.pdf | 2013-04-22 17:44 | 140K | |
![[ ]](/icons/layout.gif) | 2Gear Oil EP.pdf | 2011-12-15 20:50 | 48K | |
![[ ]](/icons/layout.gif) | 2Gear Oil EP JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | 2HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL MAY 2015.pdf | 2015-06-22 12:29 | 214K | |
![[ ]](/icons/layout.gif) | 2HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL NOVEMBER 2013.pdf | 2013-11-13 10:59 | 245K | |
![[ ]](/icons/layout.gif) | 2HD OIL FEB 2014.pdf | 2014-03-20 12:31 | 281K | |
![[ ]](/icons/layout.gif) | 2HERITAGE LTM and MTH AUGUST 2013.pdf | 2013-09-12 10:24 | 227K | |
![[ ]](/icons/layout.gif) | 2HIGH TEMP WHEEL BEARING GREASE JULY 2014.pdf | 2014-07-18 16:56 | 426K | |
![[ ]](/icons/layout.gif) | 2HIGH TEMP WHEEL BEARING GREASE JUNE 2012.pdf | 2013-04-23 11:29 | 203K | |
![[ ]](/icons/layout.gif) | 2HPR 0 June 2013.pdf | 2013-07-16 16:12 | 290K | |
![[ ]](/icons/layout.gif) | 2HPR 5 FEBRUARY 2015.pdf | 2015-02-12 10:21 | 308K | |
![[ ]](/icons/layout.gif) | 2HPR 5 June 2013.pdf | 2013-06-07 16:37 | 308K | |
![[ ]](/icons/layout.gif) | 2HPR 10 June 2013.pdf | 2013-06-24 12:31 | 291K | |
![[ ]](/icons/layout.gif) | 2HPR 10 Oct 2011.pdf | 2012-04-10 10:54 | 129K | |
![[ ]](/icons/layout.gif) | 2HPR 15 June 2013.pdf | 2013-06-24 12:31 | 288K | |
![[ ]](/icons/layout.gif) | 2HPR 30 June 2013.pdf | 2013-06-07 16:38 | 239K | |
![[ ]](/icons/layout.gif) | 2HPR 30 NOVEMBER 2014.pdf | 2014-11-05 16:28 | 298K | |
![[ ]](/icons/layout.gif) | 2HPR 30 SEPTEMBER 2014.pdf | 2014-10-02 11:34 | 285K | |
![[ ]](/icons/layout.gif) | 2HPR 40 DECEMBER 2015.pdf | 2015-12-22 08:31 | 371K | |
![[ ]](/icons/layout.gif) | 2HPR 40 JUNE 2015.pdf | 2015-10-14 09:55 | 348K | |
![[ ]](/icons/layout.gif) | 2HPR 40 June 2013.pdf | 2013-06-07 16:39 | 238K | |
![[ ]](/icons/layout.gif) | 2HPR 40 MARCH 2015.pdf | 2015-06-17 14:32 | 349K | |
![[ ]](/icons/layout.gif) | 2HPR 40 MAY 2012.pdf | 2012-10-23 11:09 | 92K | |
![[ ]](/icons/layout.gif) | 2HPR 50 DECEMEBR 2015.pdf | 2015-12-22 08:40 | 385K | |
![[ ]](/icons/layout.gif) | 2HPR 50 June 2013.pdf | 2013-06-07 16:40 | 234K | |
![[ ]](/icons/layout.gif) | 2HPR 50 September 2014.pdf | 2014-10-02 11:35 | 282K | |
![[ ]](/icons/layout.gif) | 2HPR DIESEL August 2012.pdf | 2012-12-14 15:36 | 211K | |
![[ ]](/icons/layout.gif) | 2HPR Diesel 5 June 2013.pdf | 2013-06-24 12:33 | 299K | |
![[ ]](/icons/layout.gif) | 2HPR Diesel 10 June 2013.pdf | 2013-06-24 12:38 | 289K | |
![[ ]](/icons/layout.gif) | 2HPR Diesel 15 June 2013.pdf | 2013-06-24 12:33 | 293K | |
![[ ]](/icons/layout.gif) | 2HPR Diesel June 2013.pdf | 2013-06-24 12:33 | 286K | |
![[ ]](/icons/layout.gif) | 2HPR GAS.pdf | 2012-02-14 10:25 | 72K | |
![[ ]](/icons/layout.gif) | 2HPR GAS 10 April 2012.pdf | 2012-04-13 15:19 | 114K | |
![[ ]](/icons/layout.gif) | 2HPR GAS April 2012.pdf | 2012-04-13 15:18 | 113K | |
![[ ]](/icons/layout.gif) | 2HPR Gas 10 June 2013.pdf | 2013-06-24 12:41 | 288K | |
![[ ]](/icons/layout.gif) | 2HPR Gas June 2013.pdf | 2013-06-24 12:41 | 286K | |
![[ ]](/icons/layout.gif) | 2HTO 32 68 100 January 2014.pdf | 2015-08-21 08:29 | 202K | |
![[ ]](/icons/layout.gif) | 2Heritage LTM and MTH.pdf | 2011-12-15 20:50 | 87K | |
![[ ]](/icons/layout.gif) | 2INDGEAR MP90 April 2013.pdf | 2014-12-10 16:00 | 201K | |
![[ ]](/icons/layout.gif) | 2INDGREASE 100 LXEP2 December 2012.pdf | 2013-04-23 11:32 | 202K | |
![[ ]](/icons/layout.gif) | 2INDGREASE BM3 Oct 2011.pdf | 2013-04-23 09:58 | 148K | |
![[ ]](/icons/layout.gif) | 2INDGREASE LITH EP 0 AUGUST 2014.pdf | 2014-08-18 11:05 | 162K | |
![[ ]](/icons/layout.gif) | 2INDGREASE MOLY HT JUNE 2014.pdf | 2014-06-17 12:52 | 252K | |
![[ ]](/icons/layout.gif) | 2INDUS COMPRESSOL OIL 2KH SERIES June 2012.pdf | 2012-06-12 16:20 | 118K | |
![[ ]](/icons/layout.gif) | 2INDUS GEAR OIL EP - DECEMBER 2014.pdf | 2014-12-10 11:44 | 203K | |
![[ ]](/icons/layout.gif) | 2INDUS GEAR OIL EP August 2012.pdf | 2012-08-21 15:50 | 206K | |
![[ ]](/icons/layout.gif) | 2INDUS GEAR OIL EP MAY 2012.pdf | 2012-05-11 13:10 | 116K | |
![[ ]](/icons/layout.gif) | 2INDUS HV HYDRAULIC OIL AUGUST 2014.pdf | 2014-08-12 15:02 | 214K | |
![[ ]](/icons/layout.gif) | 2INDUS HV HYDRAULIC OIL April 2013.pdf | 2013-04-22 11:31 | 208K | |
![[ ]](/icons/layout.gif) | 2INDUS HV HYDRAULIC OIL August 2012.pdf | 2012-08-21 15:49 | 203K | |
![[ ]](/icons/layout.gif) | 2INDUS HV HYDRAULIC OIL DECEMBER 2014.pdf | 2014-12-05 13:20 | 214K | |
![[ ]](/icons/layout.gif) | 2INDUS HV HYDRAULIC OIL FEBRUARY 2014.pdf | 2014-02-18 12:03 | 214K | |
![[ ]](/icons/layout.gif) | 2INDUS HV HYDRAULIC OIL NOVEMBER 2013.pdf | 2013-11-14 16:28 | 211K | |
![[ ]](/icons/layout.gif) | 2INDUS PRO HYDRAULIC OILS DECEMBER 2013.pdf | 2013-12-04 16:07 | 234K | |
![[ ]](/icons/layout.gif) | 2INDUS PRO HYDRAULIC OILS DECEMBER 2014.pdf | 2014-12-15 17:03 | 234K | |
![[ ]](/icons/layout.gif) | 2INDUS PRO HYDRAULIC OILS MAY 2015.pdf | 2015-05-27 09:49 | 232K | |
![[ ]](/icons/layout.gif) | 2INDUS PRO HYDRAULIC OILS OCTOBER 2015.pdf | 2015-10-21 17:35 | 203K | |
![[ ]](/icons/layout.gif) | 2Indgrease 1615WR February 2013.pdf | 2013-04-23 12:00 | 200K | |
![[ ]](/icons/layout.gif) | 2Indgrease CXOG-05 December 2012.pdf | 2013-04-23 11:53 | 203K | |
![[ ]](/icons/layout.gif) | 2LDAS FLUID AUGUST 2013.pdf | 2014-05-02 14:33 | 158K | |
![[ ]](/icons/layout.gif) | 2LHM PLUS JULY 2013.pdf | 2013-08-30 13:20 | 224K | |
![[ ]](/icons/layout.gif) | 2LIMSLIP 90, 854W140, 140 Oct 2011.pdf | 2011-12-20 11:09 | 149K | |
![[ ]](/icons/layout.gif) | 2Limslip 90, 85-140 and 140.pdf | 2011-12-15 20:50 | 148K | |
![[ ]](/icons/layout.gif) | 2MB 15 SUSPENSION FLUID APRIL 2015.pdf | 2015-06-24 17:35 | 270K | |
![[ ]](/icons/layout.gif) | 2MB 15 SUSPENSION FLUID JULY 2013.pdf | 2013-10-25 10:07 | 280K | |
![[ ]](/icons/layout.gif) | 2MC-4 V TWIN 20W-50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MAY 2016.pdf | 2016-06-16 12:11 | 366K | |
![[ ]](/icons/layout.gif) | 2MC4 FULL SYNTHETIC 10W40 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-13 17:56 | 340K | |
![[ ]](/icons/layout.gif) | 2MC4 MINERAL 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-17 17:16 | 319K | |
![[ ]](/icons/layout.gif) | 2MC4 SEMI SYNTHETIC 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-13 17:53 | 325K | |
![[ ]](/icons/layout.gif) | 2MC4ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-19 08:44 | 307K | |
![[ ]](/icons/layout.gif) | 2MC4ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-19 08:55 | 336K | |
![[ ]](/icons/layout.gif) | 2MC4ST 10W50 SEMI SYNTHETIC FOUR STROKE MOTORCYCLE OIL JULY 2013.pdf | 2013-10-31 08:31 | 367K | |
![[ ]](/icons/layout.gif) | 2MC4ST 10W50 SEMI SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-20 09:06 | 326K | |
![[ ]](/icons/layout.gif) | 2MC4ST 15W50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-20 09:08 | 336K | |
![[ ]](/icons/layout.gif) | 2MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-01-23 14:31 | 324K | |
![[ ]](/icons/layout.gif) | 2MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JULY 2013.pdf | 2013-12-17 11:02 | 349K | |
![[ ]](/icons/layout.gif) | 2MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-13 15:26 | 302K | |
![[ ]](/icons/layout.gif) | 2MDEO RANGE (12 & 15 TBN) DECEMBER 2014.pdf | 2014-12-15 12:20 | 179K | |
![[ ]](/icons/layout.gif) | 2MOLYGREASE EP 3 APRIL 2014.pdf | 2014-07-18 09:29 | 468K | |
![[ ]](/icons/layout.gif) | 2MONO TRUCK 30 NOVEMBER 2013.pdf | 2013-12-17 12:19 | 169K | |
![[ ]](/icons/layout.gif) | 2MONO TRUCK 40 NOVEMBER 2013.pdf | 2013-12-19 15:08 | 181K | |
![[ ]](/icons/layout.gif) | 2MONO TRUCK 50 NOVEMBER 2013.pdf | 2013-12-23 11:26 | 171K | |
![[ ]](/icons/layout.gif) | 2MONO TRUCK OCT 2011.pdf | 2011-12-20 12:07 | 156K | |
![[ ]](/icons/layout.gif) | 2MOTORCYCLE FORK OILS OCTOBER 2014.pdf | 2014-10-28 12:15 | 193K | |
![[ ]](/icons/layout.gif) | 2Moly 3% Grease.pdf | 2011-12-15 20:50 | 86K | |
![[ ]](/icons/layout.gif) | 2Mono Truck.pdf | 2011-12-15 20:50 | 57K | |
![[ ]](/icons/layout.gif) | 2P26 THROTTLE BODY & CARB CLEANER JANUARY 2016.pdf | 2016-03-03 08:46 | 238K | |
![[ ]](/icons/layout.gif) | 2PEN 4297 JULY 2013.pdf | 2014-03-31 13:10 | 204K | |
![[ ]](/icons/layout.gif) | 2PGXL COOLANT PREMIX MAY 2015.pdf | 2015-06-22 12:52 | 256K | |
![[ ]](/icons/layout.gif) | 2PGXL Coolant Premix April 2013.pdf | 2013-04-19 12:26 | 191K | |
![[ ]](/icons/layout.gif) | 2PI_Gear Oil EP_PSD.pdf | 2011-12-15 20:50 | 131K | |
![[ ]](/icons/layout.gif) | 2PRO ENGINE OILS 5 & 10 Aug 2012.pdf | 2012-08-15 14:52 | 201K | |
![[ ]](/icons/layout.gif) | 2PRO ENGINE OILS 5 10 and 20 OCT 2011.pdf | 2011-12-20 10:41 | 156K | |
![[ ]](/icons/layout.gif) | 2PRO GEAR 80W-140 - JUNE 2014.pdf | 2014-06-19 10:12 | 186K | |
![[ ]](/icons/layout.gif) | 2PRO GEAR 80W-140 AUGUST 2013.pdf | 2013-09-25 12:01 | 185K | |
![[ ]](/icons/layout.gif) | 2PRO HYDRAULIC OILS August 2012.pdf | 2012-08-30 12:07 | 203K | |
![[ ]](/icons/layout.gif) | 2Petrol Injector Cleaner Dec 2012.pdf | 2013-01-21 10:36 | 247K | |
![[ ]](/icons/layout.gif) | 2Pro Cooling System Inhibitor.pdf | 2011-12-15 20:50 | 85K | |
![[ ]](/icons/layout.gif) | 2Pro Engine Oils.pdf | 2011-12-15 20:50 | 53K | |
![[ ]](/icons/layout.gif) | 2Pro Engine Oils AUGUST 2011.pdf | 2011-12-15 20:50 | 99K | |
![[ ]](/icons/layout.gif) | 2Pro Engine Oils DEC 2010.pdf | 2011-12-15 20:50 | 204K | |
![[ ]](/icons/layout.gif) | 2Pro Engine Oils MAR 2010.pdf | 2011-12-15 20:50 | 206K | |
![[ ]](/icons/layout.gif) | 2Pro Engine Oils SEPTEMBER 2011 (2).pdf | 2011-12-15 20:50 | 97K | |
![[ ]](/icons/layout.gif) | 2Pro Hydraulic Oil.pdf | 2011-12-15 20:50 | 85K | |
![[ ]](/icons/layout.gif) | 2Pro Hydraulic Oil JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | 2QCA GREASE MX9 December 2012.pdf | 2013-04-23 11:43 | 204K | |
![[ ]](/icons/layout.gif) | 2QCS Grease MXG 0 December 2012.pdf | 2013-04-23 11:46 | 204K | |
![[ ]](/icons/layout.gif) | 2RACE CASTOR OIL JULY 2012.pdf | 2012-09-18 09:48 | 201K | |
![[ ]](/icons/layout.gif) | 2RADIATOR FLUSH SEPTEMBER 2013.pdf | 2013-09-18 11:18 | 269K | |
![[ ]](/icons/layout.gif) | 2ROCKSLIDE November 2014.pdf | 2014-12-01 14:02 | 255K | |
![[ ]](/icons/layout.gif) | 2RUBBER GREASE JULY 2014.pdf | 2014-07-21 12:52 | 227K | |
![[ ]](/icons/layout.gif) | 2RUBBER GREASE OCT 2011.pdf | 2013-04-23 10:04 | 140K | |
![[ ]](/icons/layout.gif) | 2RUNNING IN OIL OCT 2011.pdf | 2012-01-19 10:32 | 144K | |
![[ ]](/icons/layout.gif) | 2Radiator Inhibitor Aug 2012.pdf | 2012-10-24 17:06 | 197K | |
![[ ]](/icons/layout.gif) | 2SEMI FLUID GREASE JULY 2014.pdf | 2014-07-15 10:38 | 430K | |
![[ ]](/icons/layout.gif) | 2SEMI FLUID GREASE OCT 2011.pdf | 2012-01-18 16:52 | 140K | |
![[ ]](/icons/layout.gif) | 2SEMI FLUID GREASE OCTOBER 2013.pdf | 2013-10-31 16:48 | 216K | |
![[ ]](/icons/layout.gif) | 2SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-09-12 10:26 | 338K | |
![[ ]](/icons/layout.gif) | 2SHELSLEY ENGINE OILS FEBRUARY 2016.pdf | 2016-02-19 13:48 | 412K | |
![[ ]](/icons/layout.gif) | 2SHELSLEY ENGINE OILS JULY 2014.pdf | 2014-07-16 15:47 | 591K | |
![[ ]](/icons/layout.gif) | 2SHELSLEY ENGINE OILS MARCH 2014.pdf | 2014-03-05 14:14 | 409K | |
![[ ]](/icons/layout.gif) | 2SHELSLEY ENGINE OILS OCT 2011.pdf | 2011-12-09 16:22 | 146K | |
![[ ]](/icons/layout.gif) | 2SHOCKER OILS AUGUST 2013.pdf | 2014-03-31 11:03 | 277K | |
![[ ]](/icons/layout.gif) | 2SHOCKER OILS OCT 2011.pdf | 2011-12-20 13:03 | 140K | |
![[ ]](/icons/layout.gif) | 2SIN Manual Trans.pdf | 2011-12-15 20:50 | 49K | |
![[ ]](/icons/layout.gif) | 2SIN RACE CASTOR OCT 2011.pdf | 2012-04-03 13:28 | 140K | |
![[ ]](/icons/layout.gif) | 2SMALL ENGINE FOUR STROKE MONOGRADE 30 OCT 2011.pdf | 2012-08-08 07:53 | 153K | |
![[ ]](/icons/layout.gif) | 2SMALL ENGINE FOUR STROKE OIL 10W-30 APRIL 2012.pdf | 2012-10-26 14:40 | 117K | |
![[ ]](/icons/layout.gif) | 2SYNMARINE OB TS OCT 2011.pdf | 2011-12-20 12:22 | 152K | |
![[ ]](/icons/layout.gif) | 2Shelsley Engine Oils.pdf | 2011-12-15 20:50 | 43K | |
![[ ]](/icons/layout.gif) | 2Small Engine Four Stroke 10W-30 and 20W-50.pdf | 2011-12-15 20:50 | 54K | |
![[ ]](/icons/layout.gif) | 2TRAC TRANS AND HYD OIL NOVEMBER 2013.pdf | 2013-12-09 14:58 | 248K | |
![[ ]](/icons/layout.gif) | 2TRANSOIL 90 140 250 OCT 2011.pdf | 2011-12-20 13:07 | 144K | |
![[ ]](/icons/layout.gif) | 2TRANSOIL 90 140 250 OCTOBER 2013.pdf | 2013-12-18 09:54 | 237K | |
![[ ]](/icons/layout.gif) | 2UNIVERSAL FARM OIL NOV 2013.pdf | 2013-11-28 13:24 | 218K | |
![[ ]](/icons/layout.gif) | 2VALVE SHIELD APRIL 2015.pdf | 2015-06-23 16:12 | 299K | |
![[ ]](/icons/layout.gif) | 2VALVESHIELD FEBRUARY 2015.pdf | 2015-04-01 14:49 | 281K | |
![[ ]](/icons/layout.gif) | 2Valveshield.pdf | 2011-12-15 20:50 | 46K | |
![[ ]](/icons/layout.gif) | 2WATER PUMP GREASE JULY 2014.pdf | 2014-07-25 14:37 | 275K | |
![[ ]](/icons/layout.gif) | 2WATER PUMP GREASE OCT 2011.pdf | 2013-04-23 12:08 | 140K | |
![[ ]](/icons/layout.gif) | 3ACT GREASE XEP2 December 2012.pdf | 2013-04-23 11:41 | 204K | |
![[ ]](/icons/layout.gif) | 3BRAKE FLUID DOT 3 APRIL 2014.pdf | 2014-04-16 10:37 | 227K | |
![[ ]](/icons/layout.gif) | 3BRAKE FLUID DOT 3 JULY 2013.pdf | 2013-11-22 10:05 | 224K | |
![[ ]](/icons/layout.gif) | 3BRAKE FLUID SUPER DOT 4 APRIL 2014.pdf | 2014-04-11 15:31 | 227K | |
![[ ]](/icons/layout.gif) | 3BRAKE FLUID SUPER DOT 4 JULY 2013.pdf | 2013-11-22 09:59 | 226K | |
![[ ]](/icons/layout.gif) | 3CAM ASSEMBLY LUBE AUGUST 2014.pdf | 2014-09-02 11:30 | 178K | |
![[ ]](/icons/layout.gif) | 3CAM ASSEMBLY LUBE Oct 2011.pdf | 2013-04-23 10:12 | 140K | |
![[ ]](/icons/layout.gif) | 3CHAINSAW BAR OIL JULY 2014.pdf | 2014-07-31 09:22 | 226K | |
![[ ]](/icons/layout.gif) | 3CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-10-31 14:25 | 329K | |
![[ ]](/icons/layout.gif) | 3CLASSIC ENGINE OILS FEBRUARY 2016.pdf | 2016-02-17 12:40 | 367K | |
![[ ]](/icons/layout.gif) | 3CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 15:06 | 447K | |
![[ ]](/icons/layout.gif) | 3CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-05 15:23 | 329K | |
![[ ]](/icons/layout.gif) | 3CLASSIC ENGINE OILS Oct 2011.pdf | 2011-12-20 12:53 | 145K | |
![[ ]](/icons/layout.gif) | 3COPPER EZE AUGUST 2014.pdf | 2014-08-28 13:13 | 212K | |
![[ ]](/icons/layout.gif) | 3COPPER EZE FEBRUARY 2014.pdf | 2014-02-06 14:00 | 199K | |
![[ ]](/icons/layout.gif) | 3COPPER EZE MAY 2013.pdf | 2013-05-10 15:04 | 185K | |
![[ ]](/icons/layout.gif) | 3DIESEL HD 15W-40 JUNE 2014.pdf | 2014-06-16 13:01 | 365K | |
![[ ]](/icons/layout.gif) | 3DPF CLEANER JANUARY 2014.pdf | 2014-03-31 14:46 | 519K | |
![[ ]](/icons/layout.gif) | 3ENDURO MARCH 2014.pdf | 2014-03-13 09:47 | 253K | |
![[ ]](/icons/layout.gif) | 3ENDURO Oct 2011.pdf | 2013-04-05 17:44 | 142K | |
![[ ]](/icons/layout.gif) | 3ENVIRO+ 0W-20 MAY 2015.pdf | 2015-06-17 16:21 | 399K | |
![[ ]](/icons/layout.gif) | 3ENVIRO+ GF-5 JUNE 2013.pdf | 2013-10-16 11:59 | 322K | |
![[ ]](/icons/layout.gif) | 3EVERYDAY DRIVING OILS Oct 2011.pdf | 2011-12-20 10:21 | 149K | |
![[ ]](/icons/layout.gif) | 3Enviro + Engine Oils.pdf | 2011-12-15 20:50 | 63K | |
![[ ]](/icons/layout.gif) | 3Everyday Driving Oils JAN 2011.pdf | 2011-12-15 20:50 | 229K | |
![[ ]](/icons/layout.gif) | 3Everyday Full Synthetic 10W-40 July 2013.pdf | 2013-09-17 15:24 | 309K | |
![[ ]](/icons/layout.gif) | 3Everyday Full Synthetic 10W-40 September 2012.pdf | 2012-09-12 10:37 | 202K | |
![[ ]](/icons/layout.gif) | 3Extreme Pressure Grease.pdf | 2011-12-15 20:50 | 45K | |
![[ ]](/icons/layout.gif) | 3FLEETGEAR 30and50, FLEETRANSC4 Oct 2011.pdf | 2011-12-20 12:00 | 152K | |
![[ ]](/icons/layout.gif) | 3Fleet Gear 30 and 50, Fleet-trans C4 JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | 3Fleetgear 10, 30 & 50 April 2013.pdf | 2013-11-27 08:57 | 204K | |
![[ ]](/icons/layout.gif) | 3GEAROIL EP Oct 2011.pdf | 2011-12-15 20:50 | 146K | |
![[ ]](/icons/layout.gif) | 3GRAPHITE GREASE Oct 2011.pdf | 2013-04-22 17:46 | 140K | |
![[ ]](/icons/layout.gif) | 3Gear Oil EP.pdf | 2011-12-15 20:50 | 48K | |
![[ ]](/icons/layout.gif) | 3Gear Oil EP JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | 3HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL MAY 2015.pdf | 2015-06-22 12:43 | 214K | |
![[ ]](/icons/layout.gif) | 3HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL NOVEMBER 2013.pdf | 2013-11-13 11:57 | 307K | |
![[ ]](/icons/layout.gif) | 3HD OIL FEB 2014.pdf | 2014-03-20 12:34 | 281K | |
![[ ]](/icons/layout.gif) | 3HERITAGE LTM and MTH AUGUST 2013.pdf | 2013-09-12 10:25 | 227K | |
![[ ]](/icons/layout.gif) | 3HIGH TEMP WHEEL BEARING GREASE JULY 2014.pdf | 2014-07-18 16:59 | 426K | |
![[ ]](/icons/layout.gif) | 3HIGH TEMP WHEEL BEARING GREASE JUNE 2012.pdf | 2013-04-23 11:30 | 203K | |
![[ ]](/icons/layout.gif) | 3HPR 0 June 2013.pdf | 2013-08-01 15:32 | 290K | |
![[ ]](/icons/layout.gif) | 3HPR 5 June 2013.pdf | 2013-06-14 15:03 | 294K | |
![[ ]](/icons/layout.gif) | 3HPR 30 June 2013.pdf | 2013-06-14 15:05 | 285K | |
![[ ]](/icons/layout.gif) | 3HPR 40 DECEMBER 2015.pdf | 2015-12-22 08:46 | 371K | |
![[ ]](/icons/layout.gif) | 3HPR 40 JUNE 2015.pdf | 2015-10-14 09:56 | 348K | |
![[ ]](/icons/layout.gif) | 3HPR 40 June 2013.pdf | 2013-06-14 15:06 | 284K | |
![[ ]](/icons/layout.gif) | 3HPR 40 MARCH 2015.pdf | 2015-06-17 14:33 | 349K | |
![[ ]](/icons/layout.gif) | 3HPR 50 June 2013.pdf | 2013-06-14 15:06 | 283K | |
![[ ]](/icons/layout.gif) | 3HPR DIESEL August 2012.pdf | 2012-12-14 16:00 | 211K | |
![[ ]](/icons/layout.gif) | 3HPR Diesel 5 June 2013.pdf | 2013-06-24 12:39 | 299K | |
![[ ]](/icons/layout.gif) | 3HPR Diesel 10 June 2013.pdf | 2013-06-24 12:40 | 289K | |
![[ ]](/icons/layout.gif) | 3HPR Diesel 15 June 2013.pdf | 2013-06-24 12:39 | 293K | |
![[ ]](/icons/layout.gif) | 3HPR Diesel June 2013.pdf | 2013-06-24 12:38 | 286K | |
![[ ]](/icons/layout.gif) | 3HPR Gas June 2013.pdf | 2013-07-03 17:17 | 286K | |
![[ ]](/icons/layout.gif) | 3Heritage LTM and MTH.pdf | 2011-12-15 20:50 | 87K | |
![[ ]](/icons/layout.gif) | 3INDGREASE 100 LXEP2 December 2012.pdf | 2013-04-23 11:34 | 202K | |
![[ ]](/icons/layout.gif) | 3INDGREASE BM3 Oct 2011.pdf | 2013-04-23 11:55 | 148K | |
![[ ]](/icons/layout.gif) | 3INDGREASE MOLY HT JUNE 2014.pdf | 2014-06-17 12:55 | 252K | |
![[ ]](/icons/layout.gif) | 3INDUS COMPRESSOL OIL 2KH SERIES June 2012.pdf | 2012-06-12 16:27 | 118K | |
![[ ]](/icons/layout.gif) | 3INDUS GEAR OIL EP - DECEMBER 2014.pdf | 2014-12-10 11:45 | 203K | |
![[ ]](/icons/layout.gif) | 3INDUS GEAR OIL EP August 2012.pdf | 2012-08-31 08:55 | 206K | |
![[ ]](/icons/layout.gif) | 3INDUS GEAR OIL EP MAY 2012.pdf | 2012-05-11 13:10 | 116K | |
![[ ]](/icons/layout.gif) | 3INDUS HV HYDRAULIC OIL AUGUST 2014.pdf | 2014-08-12 15:04 | 214K | |
![[ ]](/icons/layout.gif) | 3INDUS HV HYDRAULIC OIL April 2013.pdf | 2013-04-22 11:31 | 208K | |
![[ ]](/icons/layout.gif) | 3INDUS HV HYDRAULIC OIL August 2012.pdf | 2012-08-21 15:51 | 203K | |
![[ ]](/icons/layout.gif) | 3INDUS HV HYDRAULIC OIL DECEMBER 2014.pdf | 2014-12-05 13:21 | 214K | |
![[ ]](/icons/layout.gif) | 3INDUS HV HYDRAULIC OIL FEBRUARY 2014.pdf | 2014-04-08 10:06 | 211K | |
![[ ]](/icons/layout.gif) | 3INDUS HV HYDRAULIC OIL NOVEMBER 2013.pdf | 2013-11-27 09:00 | 212K | |
![[ ]](/icons/layout.gif) | 3INDUS PRO HYDRAULIC OILS DECEMBER 2013.pdf | 2013-12-04 16:08 | 234K | |
![[ ]](/icons/layout.gif) | 3INDUS PRO HYDRAULIC OILS MAY 2015.pdf | 2015-05-27 09:49 | 232K | |
![[ ]](/icons/layout.gif) | 3INDUS PRO HYDRAULIC OILS OCTOBER 2015.pdf | 2015-10-21 17:36 | 203K | |
![[ ]](/icons/layout.gif) | 3Indgrease 1615WR February 2013.pdf | 2013-04-23 12:03 | 200K | |
![[ ]](/icons/layout.gif) | 3LHM PLUS JULY 2013.pdf | 2013-10-08 15:59 | 219K | |
![[ ]](/icons/layout.gif) | 3Limslip 90, 85-140 and 140.pdf | 2011-12-15 20:50 | 52K | |
![[ ]](/icons/layout.gif) | 3MC4 FULL SYNTHETIC 10W40 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-19 09:12 | 338K | |
![[ ]](/icons/layout.gif) | 3MC4 MINERAL 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-19 10:30 | 319K | |
![[ ]](/icons/layout.gif) | 3MC4 SEMI SYNTHETIC 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-13 18:14 | 325K | |
![[ ]](/icons/layout.gif) | 3MC4ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-20 09:08 | 307K | |
![[ ]](/icons/layout.gif) | 3MC4ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-20 09:06 | 336K | |
![[ ]](/icons/layout.gif) | 3MC4ST 10W50 SEMI SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-20 11:19 | 326K | |
![[ ]](/icons/layout.gif) | 3MC4ST 15W50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-20 11:21 | 336K | |
![[ ]](/icons/layout.gif) | 3MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-01-23 14:32 | 324K | |
![[ ]](/icons/layout.gif) | 3MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-13 15:27 | 302K | |
![[ ]](/icons/layout.gif) | 3MOLYGREASE EP 3 APRIL 2014.pdf | 2014-07-18 09:37 | 468K | |
![[ ]](/icons/layout.gif) | 3MONO TRUCK 40 NOVEMBER 2013.pdf | 2013-12-19 15:08 | 181K | |
![[ ]](/icons/layout.gif) | 3MONO TRUCK 50 NOVEMBER 2013.pdf | 2014-02-27 16:29 | 170K | |
![[ ]](/icons/layout.gif) | 3Moly 3% Grease.pdf | 2011-12-15 20:50 | 86K | |
![[ ]](/icons/layout.gif) | 3PEN 4297 JULY 2013.pdf | 2014-03-31 13:13 | 204K | |
![[ ]](/icons/layout.gif) | 3PGXL Coolant Premix April 2013.pdf | 2013-04-24 11:43 | 191K | |
![[ ]](/icons/layout.gif) | 3PRO ENGINE OILS 5 & 10 Aug 2012.pdf | 2012-08-15 15:06 | 201K | |
![[ ]](/icons/layout.gif) | 3PRO ENGINE OILS 5 10 and 20 OCT 2011.pdf | 2011-12-20 10:42 | 156K | |
![[ ]](/icons/layout.gif) | 3PRO GEAR 80W-140 AUGUST 2013.pdf | 2014-01-21 14:20 | 185K | |
![[ ]](/icons/layout.gif) | 3PRO HYDRAULIC OILS August 2012.pdf | 2012-08-30 12:07 | 203K | |
![[ ]](/icons/layout.gif) | 3Petrol Injector Cleaner Dec 2012.pdf | 2013-01-29 16:02 | 247K | |
![[ ]](/icons/layout.gif) | 3Pro Engine Oils.pdf | 2011-12-15 20:50 | 53K | |
![[ ]](/icons/layout.gif) | 3Pro Engine Oils AUGUST 2011.pdf | 2011-12-15 20:50 | 99K | |
![[ ]](/icons/layout.gif) | 3Pro Engine Oils DEC 2010.pdf | 2011-12-15 20:50 | 204K | |
![[ ]](/icons/layout.gif) | 3Pro Engine Oils MAR 2010.pdf | 2011-12-15 20:50 | 206K | |
![[ ]](/icons/layout.gif) | 3Pro Engine Oils SEPTEMBER 2011 (2).pdf | 2011-12-15 20:50 | 97K | |
![[ ]](/icons/layout.gif) | 3Pro Hydraulic Oil.pdf | 2011-12-15 20:50 | 43K | |
![[ ]](/icons/layout.gif) | 3QCA GREASE MX9 December 2012.pdf | 2013-04-23 11:44 | 204K | |
![[ ]](/icons/layout.gif) | 3QCS Grease MXG 0 December 2012.pdf | 2013-04-23 11:49 | 204K | |
![[ ]](/icons/layout.gif) | 3RADIATOR FLUSH SEPTEMBER 2013.pdf | 2013-11-26 16:41 | 269K | |
![[ ]](/icons/layout.gif) | 3RUBBER GREASE JULY 2014.pdf | 2014-07-21 13:07 | 227K | |
![[ ]](/icons/layout.gif) | 3RUBBER GREASE OCT 2011.pdf | 2013-04-23 12:04 | 140K | |
![[ ]](/icons/layout.gif) | 3RUNNING IN OIL OCT 2011.pdf | 2012-06-05 11:36 | 144K | |
![[ ]](/icons/layout.gif) | 3SEMI FLUID GREASE JULY 2014.pdf | 2014-07-15 10:38 | 430K | |
![[ ]](/icons/layout.gif) | 3SEMI FLUID GREASE OCT 2011.pdf | 2013-04-23 10:06 | 140K | |
![[ ]](/icons/layout.gif) | 3SEMI FLUID GREASE OCTOBER 2013.pdf | 2013-10-31 16:49 | 216K | |
![[ ]](/icons/layout.gif) | 3SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-09-12 10:27 | 338K | |
![[ ]](/icons/layout.gif) | 3SHELSLEY ENGINE OILS FEBRUARY 2016.pdf | 2016-02-19 13:50 | 412K | |
![[ ]](/icons/layout.gif) | 3SHELSLEY ENGINE OILS JULY 2014.pdf | 2014-07-16 15:49 | 591K | |
![[ ]](/icons/layout.gif) | 3SHELSLEY ENGINE OILS MARCH 2014.pdf | 2014-03-05 14:15 | 409K | |
![[ ]](/icons/layout.gif) | 3SHELSLEY ENGINE OILS OCT 2011.pdf | 2011-12-20 13:01 | 146K | |
![[ ]](/icons/layout.gif) | 3SYNMARINE OB TS OCT 2011.pdf | 2011-12-20 14:12 | 152K | |
![[ ]](/icons/layout.gif) | 3Small Engine Four Stroke 10W-30 and 20W-50.pdf | 2011-12-15 20:50 | 54K | |
![[ ]](/icons/layout.gif) | 3TRAC TRANS AND HYD OIL NOVEMBER 2013.pdf | 2013-12-10 09:06 | 248K | |
![[ ]](/icons/layout.gif) | 3TRANSOIL 90 140 250 OCT 2011.pdf | 2011-12-20 13:08 | 144K | |
![[ ]](/icons/layout.gif) | 3TRANSOIL 90 140 250 OCTOBER 2013.pdf | 2013-12-18 09:54 | 237K | |
![[ ]](/icons/layout.gif) | 3UNIVERSAL FARM OIL NOV 2013.pdf | 2013-11-28 13:25 | 218K | |
![[ ]](/icons/layout.gif) | 3VALVESHIELD FEBRUARY 2015.pdf | 2015-04-01 14:50 | 281K | |
![[ ]](/icons/layout.gif) | 3Valveshield.pdf | 2011-12-15 20:50 | 47K | |
![[ ]](/icons/layout.gif) | 3WATER PUMP GREASE JULY 2014.pdf | 2014-07-25 14:39 | 275K | |
![[ ]](/icons/layout.gif) | 3WATER PUMP GREASE OCT 2011.pdf | 2013-04-23 12:10 | 140K | |
![[ ]](/icons/layout.gif) | 3 YEAR STANDARD DRAIN ANTI FREEZE ANTI BOIL April 2013.pdf | 2013-04-12 10:06 | 202K | |
![[ ]](/icons/layout.gif) | 3 YEAR STANDARD DRAIN ANTI FREEZE ANTI BOIL Aug 2012.pdf | 2012-08-27 14:15 | 203K | |
![[ ]](/icons/layout.gif) | 3 YEAR STANDARD DRAIN ANTI FREEZE ANTI BOIL DEC 2012.pdf | 2012-12-20 08:39 | 200K | |
![[ ]](/icons/layout.gif) | 3 YEAR STANDARD DRAIN ANTI FREEZE ANTI BOIL July 2012.pdf | 2012-07-27 09:08 | 202K | |
![[ ]](/icons/layout.gif) | 3 YEAR STANDARD DRAIN ANTI FREEZE ANTI BOIL March 2012.pdf | 2012-03-21 13:29 | 115K | |
![[ ]](/icons/layout.gif) | 3 YEAR STANDARD DRAIN ANTI FREEZE ANTI BOIL NOV 2011.pdf | 2011-12-15 20:50 | 149K | |
![[ ]](/icons/layout.gif) | 3 YEAR STANDARD DRAIN ANTI FREEZE ANTI BOIL NOVEMBER 2013.pdf | 2013-11-13 13:13 | 192K | |
![[ ]](/icons/layout.gif) | 4BRAKE FLUID DOT 3 JULY 2013.pdf | 2014-02-24 12:41 | 224K | |
![[ ]](/icons/layout.gif) | 4BRAKE FLUID SUPER DOT 4 APRIL 2014.pdf | 2014-04-11 15:31 | 227K | |
![[ ]](/icons/layout.gif) | 4BRAKE FLUID SUPER DOT 4 JULY 2013.pdf | 2014-02-24 12:38 | 226K | |
![[ ]](/icons/layout.gif) | 4CAM ASSEMBLY LUBE AUGUST 2014.pdf | 2014-09-02 11:31 | 178K | |
![[ ]](/icons/layout.gif) | 4CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-10-31 14:25 | 329K | |
![[ ]](/icons/layout.gif) | 4CLASSIC ENGINE OILS FEBRUARY 2016.pdf | 2016-02-17 12:41 | 367K | |
![[ ]](/icons/layout.gif) | 4CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 15:07 | 447K | |
![[ ]](/icons/layout.gif) | 4CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-05 15:24 | 329K | |
![[ ]](/icons/layout.gif) | 4COPPER EZE AUGUST 2014.pdf | 2014-08-28 13:15 | 212K | |
![[ ]](/icons/layout.gif) | 4COPPER EZE FEBRUARY 2014.pdf | 2014-02-06 14:04 | 199K | |
![[ ]](/icons/layout.gif) | 4COPPER EZE MAY 2013.pdf | 2013-05-10 15:05 | 185K | |
![[ ]](/icons/layout.gif) | 4DIESEL HD 15W-40 JUNE 2014.pdf | 2014-06-16 13:01 | 365K | |
![[ ]](/icons/layout.gif) | 4DPF CLEANER JANUARY 2014.pdf | 2014-03-31 15:04 | 519K | |
![[ ]](/icons/layout.gif) | 4ENDURO MARCH 2014.pdf | 2014-03-13 09:48 | 253K | |
![[ ]](/icons/layout.gif) | 4ENDURO Oct 2011.pdf | 2013-09-23 15:09 | 142K | |
![[ ]](/icons/layout.gif) | 4ENVIRO+ 0W-20 MAY 2015.pdf | 2015-06-17 16:43 | 500K | |
![[ ]](/icons/layout.gif) | 4EVERYDAY DRIVING OILS Oct 2011.pdf | 2011-12-20 10:28 | 149K | |
![[ ]](/icons/layout.gif) | 4Everyday Full Synthetic 10W-40 July 2013.pdf | 2013-09-17 15:24 | 309K | |
![[ ]](/icons/layout.gif) | 4Everyday Full Synthetic 10W-40 September 2012.pdf | 2012-09-18 17:08 | 202K | |
![[ ]](/icons/layout.gif) | 4FLEETGEAR 30and50, FLEETRANSC4 Oct 2011.pdf | 2011-12-20 12:01 | 152K | |
![[ ]](/icons/layout.gif) | 4Fleetgear 10, 30 & 50 April 2013.pdf | 2013-11-27 08:57 | 204K | |
![[ ]](/icons/layout.gif) | 4GEAROIL EP Oct 2011.pdf | 2011-12-15 20:50 | 146K | |
![[ ]](/icons/layout.gif) | 4GRAPHITE GREASE Oct 2011.pdf | 2013-04-23 10:07 | 140K | |
![[ ]](/icons/layout.gif) | 4Gear Oil EP.pdf | 2011-12-15 20:50 | 48K | |
![[ ]](/icons/layout.gif) | 4Gear Oil EP JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | 4HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL MAY 2015.pdf | 2015-06-22 12:43 | 214K | |
![[ ]](/icons/layout.gif) | 4HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL NOVEMBER 2013.pdf | 2013-11-13 11:58 | 307K | |
![[ ]](/icons/layout.gif) | 4HD OIL FEB 2014.pdf | 2014-04-03 12:07 | 281K | |
![[ ]](/icons/layout.gif) | 4HERITAGE LTM and MTH AUGUST 2013.pdf | 2013-09-12 12:57 | 227K | |
![[ ]](/icons/layout.gif) | 4HIGH TEMP WHEEL BEARING GREASE JULY 2014.pdf | 2014-07-18 17:02 | 426K | |
![[ ]](/icons/layout.gif) | 4HIGH TEMP WHEEL BEARING GREASE JUNE 2012.pdf | 2014-03-28 09:56 | 203K | |
![[ ]](/icons/layout.gif) | 4HPR 0 June 2013.pdf | 2013-09-17 14:29 | 290K | |
![[ ]](/icons/layout.gif) | 4HPR 5 June 2013.pdf | 2013-06-14 15:03 | 294K | |
![[ ]](/icons/layout.gif) | 4HPR 30 June 2013.pdf | 2013-06-14 15:05 | 285K | |
![[ ]](/icons/layout.gif) | 4HPR 40 DECEMBER 2015.pdf | 2015-12-22 08:47 | 371K | |
![[ ]](/icons/layout.gif) | 4HPR 40 JUNE 2015.pdf | 2015-10-14 09:56 | 348K | |
![[ ]](/icons/layout.gif) | 4HPR 40 June 2013.pdf | 2013-06-14 15:06 | 284K | |
![[ ]](/icons/layout.gif) | 4HPR 50 June 2013.pdf | 2013-06-14 15:07 | 283K | |
![[ ]](/icons/layout.gif) | 4HPR DIESEL August 2012.pdf | 2012-12-14 17:30 | 211K | |
![[ ]](/icons/layout.gif) | 4HPR Diesel 5 June 2013.pdf | 2013-06-24 12:40 | 299K | |
![[ ]](/icons/layout.gif) | 4HPR Diesel 10 June 2013.pdf | 2013-06-24 12:44 | 289K | |
![[ ]](/icons/layout.gif) | 4HPR Diesel 15 June 2013.pdf | 2013-06-24 12:42 | 293K | |
![[ ]](/icons/layout.gif) | 4HPR Diesel June 2013.pdf | 2013-06-24 12:42 | 286K | |
![[ ]](/icons/layout.gif) | 4HPR Gas June 2013.pdf | 2013-07-03 17:18 | 286K | |
![[ ]](/icons/layout.gif) | 4Heritage LTM and MTH.pdf | 2011-12-15 20:50 | 87K | |
![[ ]](/icons/layout.gif) | 4INDGREASE MOLY HT JUNE 2014.pdf | 2014-06-19 12:12 | 252K | |
![[ ]](/icons/layout.gif) | 4INDUS GEAR OIL EP - DECEMBER 2014.pdf | 2014-12-10 11:46 | 203K | |
![[ ]](/icons/layout.gif) | 4INDUS GEAR OIL EP August 2012.pdf | 2012-09-26 11:20 | 206K | |
![[ ]](/icons/layout.gif) | 4INDUS GEAR OIL EP MAY 2012.pdf | 2012-05-11 13:11 | 116K | |
![[ ]](/icons/layout.gif) | 4INDUS HV HYDRAULIC OIL AUGUST 2014.pdf | 2014-08-12 15:05 | 214K | |
![[ ]](/icons/layout.gif) | 4INDUS HV HYDRAULIC OIL April 2013.pdf | 2013-04-22 11:32 | 208K | |
![[ ]](/icons/layout.gif) | 4INDUS HV HYDRAULIC OIL FEBRUARY 2014.pdf | 2014-04-08 10:34 | 211K | |
![[ ]](/icons/layout.gif) | 4INDUS HV HYDRAULIC OIL NOVEMBER 2013.pdf | 2013-11-27 09:00 | 212K | |
![[ ]](/icons/layout.gif) | 4INDUS PRO HYDRAULIC OILS DECEMBER 2013.pdf | 2013-12-04 16:09 | 234K | |
![[ ]](/icons/layout.gif) | 4INDUS PRO HYDRAULIC OILS MAY 2015.pdf | 2015-06-15 11:12 | 232K | |
![[ ]](/icons/layout.gif) | 4LHM PLUS JULY 2013.pdf | 2013-11-22 09:10 | 220K | |
![[ ]](/icons/layout.gif) | 4Limslip 90, 85-140 and 140.pdf | 2011-12-15 20:50 | 52K | |
![[ ]](/icons/layout.gif) | 4MC4 FULL SYNTHETIC 10W40 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-19 09:19 | 338K | |
![[ ]](/icons/layout.gif) | 4MC4 MINERAL 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-20 09:10 | 319K | |
![[ ]](/icons/layout.gif) | 4MC4 SEMI SYNTHETIC 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-17 17:07 | 325K | |
![[ ]](/icons/layout.gif) | 4MC4ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-20 11:16 | 307K | |
![[ ]](/icons/layout.gif) | 4MC4ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-20 11:16 | 335K | |
![[ ]](/icons/layout.gif) | 4MC4ST 10W50 SEMI SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-27 16:02 | 346K | |
![[ ]](/icons/layout.gif) | 4MC4ST 15W50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-27 15:47 | 323K | |
![[ ]](/icons/layout.gif) | 4MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-01-23 14:32 | 324K | |
![[ ]](/icons/layout.gif) | 4MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-13 15:28 | 302K | |
![[ ]](/icons/layout.gif) | 4MOLYGREASE EP 3 APRIL 2014.pdf | 2014-07-21 09:54 | 250K | |
![[ ]](/icons/layout.gif) | 4MONO TRUCK 40 NOVEMBER 2013.pdf | 2013-12-19 15:09 | 181K | |
![[ ]](/icons/layout.gif) | 4MONO TRUCK 50 NOVEMBER 2013.pdf | 2014-02-27 16:29 | 170K | |
![[ ]](/icons/layout.gif) | 4PRO ENGINE OILS 5 & 10 Aug 2012.pdf | 2012-08-15 15:06 | 201K | |
![[ ]](/icons/layout.gif) | 4PRO HYDRAULIC OILS August 2012.pdf | 2012-08-30 12:07 | 203K | |
![[ ]](/icons/layout.gif) | 4Pro Engine Oils.pdf | 2011-12-15 20:50 | 53K | |
![[ ]](/icons/layout.gif) | 4Pro Engine Oils DEC 2010.pdf | 2011-12-15 20:50 | 204K | |
![[ ]](/icons/layout.gif) | 4Pro Engine Oils MAR 2010.pdf | 2011-12-15 20:50 | 206K | |
![[ ]](/icons/layout.gif) | 4Pro Engine Oils SEPTEMBER 2011 (2).pdf | 2011-12-20 10:37 | 98K | |
![[ ]](/icons/layout.gif) | 4Pro Hydraulic Oil.pdf | 2011-12-15 20:50 | 43K | |
![[ ]](/icons/layout.gif) | 4RADIATOR FLUSH SEPTEMBER 2013.pdf | 2013-11-26 16:42 | 269K | |
![[ ]](/icons/layout.gif) | 4RUBBER GREASE OCT 2011.pdf | 2013-04-23 12:05 | 140K | |
![[ ]](/icons/layout.gif) | 4RUNNING IN OIL OCT 2011.pdf | 2012-06-05 11:38 | 144K | |
![[ ]](/icons/layout.gif) | 4SEMI FLUID GREASE OCT 2011.pdf | 2013-04-23 12:06 | 140K | |
![[ ]](/icons/layout.gif) | 4SEMI FLUID GREASE OCTOBER 2013.pdf | 2013-12-02 11:33 | 216K | |
![[ ]](/icons/layout.gif) | 4SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-09-24 09:48 | 337K | |
![[ ]](/icons/layout.gif) | 4SHELSLEY ENGINE OILS FEBRUARY 2016.pdf | 2016-02-19 13:53 | 412K | |
![[ ]](/icons/layout.gif) | 4SHELSLEY ENGINE OILS JULY 2014.pdf | 2014-07-16 15:50 | 591K | |
![[ ]](/icons/layout.gif) | 4SHELSLEY ENGINE OILS MARCH 2014.pdf | 2014-03-05 14:15 | 409K | |
![[ ]](/icons/layout.gif) | 4SHELSLEY ENGINE OILS OCT 2011.pdf | 2011-12-20 13:01 | 146K | |
![[ ]](/icons/layout.gif) | 4TRAC TRANS AND HYD OIL NOVEMBER 2013.pdf | 2013-12-17 12:52 | 248K | |
![[ ]](/icons/layout.gif) | 4TRANSOIL 90 140 250 OCT 2011.pdf | 2011-12-20 13:09 | 144K | |
![[ ]](/icons/layout.gif) | 4TRANSOIL 90 140 250 OCTOBER 2013.pdf | 2013-12-18 09:54 | 237K | |
![[ ]](/icons/layout.gif) | 4UNIVERSAL FARM OIL NOV 2013.pdf | 2013-12-06 15:07 | 219K | |
![[ ]](/icons/layout.gif) | 4VALVESHIELD FEBRUARY 2015.pdf | 2015-04-01 14:52 | 281K | |
![[ ]](/icons/layout.gif) | 4 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL April 2013.pdf | 2013-04-17 14:10 | 220K | |
![[ ]](/icons/layout.gif) | 4 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL Aug 2012.pdf | 2012-08-27 14:16 | 207K | |
![[ ]](/icons/layout.gif) | 4 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL August 2012.pdf | 2012-08-30 16:24 | 205K | |
![[ ]](/icons/layout.gif) | 4 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL December 2012.pdf | 2012-12-07 12:39 | 213K | |
![[ ]](/icons/layout.gif) | 4 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL FEBRUARY 2014.pdf | 2014-02-24 16:05 | 395K | |
![[ ]](/icons/layout.gif) | 4 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL Feb 2012.pdf | 2012-02-14 09:41 | 154K | |
![[ ]](/icons/layout.gif) | 4 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL JULY 2013.pdf | 2013-07-22 13:07 | 397K | |
![[ ]](/icons/layout.gif) | 4 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL January 2013.pdf | 2013-01-10 17:46 | 214K | |
![[ ]](/icons/layout.gif) | 4 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL July 2012.pdf | 2012-07-23 15:24 | 206K | |
![[ ]](/icons/layout.gif) | 4 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL March 2012.pdf | 2012-03-21 13:49 | 119K | |
![[ ]](/icons/layout.gif) | 4 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL Oct 2011.pdf | 2011-12-15 20:50 | 153K | |
![[ ]](/icons/layout.gif) | 4 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-09-07 12:25 | 215K | |
![[ ]](/icons/layout.gif) | 5BRAKE FLUID DOT 3 JULY 2013.pdf | 2014-02-24 15:04 | 224K | |
![[ ]](/icons/layout.gif) | 5BRAKE FLUID SUPER DOT 4 APRIL 2014.pdf | 2014-04-15 16:43 | 226K | |
![[ ]](/icons/layout.gif) | 5BRAKE FLUID SUPER DOT 4 JULY 2013.pdf | 2014-02-24 15:27 | 226K | |
![[ ]](/icons/layout.gif) | 5CAM ASSEMBLY LUBE AUGUST 2014.pdf | 2014-09-02 11:38 | 178K | |
![[ ]](/icons/layout.gif) | 5CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-11-11 15:42 | 329K | |
![[ ]](/icons/layout.gif) | 5CLASSIC ENGINE OILS FEBRUARY 2016.pdf | 2016-02-17 12:42 | 367K | |
![[ ]](/icons/layout.gif) | 5CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 15:08 | 447K | |
![[ ]](/icons/layout.gif) | 5CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-05 15:24 | 329K | |
![[ ]](/icons/layout.gif) | 5COPPER EZE MAY 2013.pdf | 2013-05-10 15:06 | 185K | |
![[ ]](/icons/layout.gif) | 5DPF CLEANER JANUARY 2014.pdf | 2014-04-02 16:33 | 519K | |
![[ ]](/icons/layout.gif) | 5ENDURO MARCH 2014.pdf | 2014-03-19 12:58 | 280K | |
![[ ]](/icons/layout.gif) | 5ENDURO Oct 2011.pdf | 2013-09-23 15:13 | 142K | |
![[ ]](/icons/layout.gif) | 5Everyday Full Synthetic 10W-40 July 2013.pdf | 2013-09-17 17:06 | 309K | |
![[ ]](/icons/layout.gif) | 5Everyday Full Synthetic 10W-40 September 2012.pdf | 2012-09-18 17:09 | 202K | |
![[ ]](/icons/layout.gif) | 5Fleetgear 10, 30 & 50 April 2013.pdf | 2013-11-27 08:58 | 204K | |
![[ ]](/icons/layout.gif) | 5GEAROIL EP Oct 2011.pdf | 2011-12-09 16:33 | 146K | |
![[ ]](/icons/layout.gif) | 5GRAPHITE GREASE Oct 2011.pdf | 2013-04-23 12:08 | 140K | |
![[ ]](/icons/layout.gif) | 5Gear Oil EP.pdf | 2011-12-15 20:50 | 48K | |
![[ ]](/icons/layout.gif) | 5HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL NOVEMBER 2013.pdf | 2013-11-13 11:59 | 307K | |
![[ ]](/icons/layout.gif) | 5HD OIL FEB 2014.pdf | 2014-04-03 12:08 | 281K | |
![[ ]](/icons/layout.gif) | 5HIGH TEMP WHEEL BEARING GREASE JULY 2014.pdf | 2014-07-21 09:49 | 190K | |
![[ ]](/icons/layout.gif) | 5HPR 0 June 2013.pdf | 2013-11-25 12:30 | 290K | |
![[ ]](/icons/layout.gif) | 5HPR 5 June 2013.pdf | 2013-06-24 12:31 | 294K | |
![[ ]](/icons/layout.gif) | 5HPR 30 June 2013.pdf | 2013-06-14 15:05 | 285K | |
![[ ]](/icons/layout.gif) | 5HPR 40 June 2013.pdf | 2013-06-24 12:32 | 283K | |
![[ ]](/icons/layout.gif) | 5HPR 50 June 2013.pdf | 2013-06-24 12:32 | 282K | |
![[ ]](/icons/layout.gif) | 5HPR Diesel 5 June 2013.pdf | 2013-08-07 16:42 | 299K | |
![[ ]](/icons/layout.gif) | 5HPR Diesel 10 June 2013.pdf | 2014-08-19 13:26 | 289K | |
![[ ]](/icons/layout.gif) | 5HPR Diesel 15 June 2013.pdf | 2014-10-29 07:37 | 293K | |
![[ ]](/icons/layout.gif) | 5HPR Diesel June 2013.pdf | 2013-06-28 10:36 | 286K | |
![[ ]](/icons/layout.gif) | 5HPR Gas June 2013.pdf | 2013-07-03 17:20 | 286K | |
![[ ]](/icons/layout.gif) | 5INDGREASE MOLY HT JUNE 2014.pdf | 2014-06-19 12:12 | 252K | |
![[ ]](/icons/layout.gif) | 5INDUS GEAR OIL EP - DECEMBER 2014.pdf | 2014-12-10 12:08 | 203K | |
![[ ]](/icons/layout.gif) | 5INDUS GEAR OIL EP MAY 2012.pdf | 2012-09-26 11:18 | 116K | |
![[ ]](/icons/layout.gif) | 5INDUS HV HYDRAULIC OIL AUGUST 2014.pdf | 2014-08-12 15:05 | 214K | |
![[ ]](/icons/layout.gif) | 5INDUS HV HYDRAULIC OIL April 2013.pdf | 2013-04-22 11:47 | 208K | |
![[ ]](/icons/layout.gif) | 5INDUS HV HYDRAULIC OIL FEBRUARY 2014.pdf | 2014-04-08 10:34 | 211K | |
![[ ]](/icons/layout.gif) | 5INDUS HV HYDRAULIC OIL NOVEMBER 2013.pdf | 2013-11-27 09:01 | 212K | |
![[ ]](/icons/layout.gif) | 5INDUS PRO HYDRAULIC OILS DECEMBER 2013.pdf | 2013-12-04 16:09 | 234K | |
![[ ]](/icons/layout.gif) | 5INDUS PRO HYDRAULIC OILS MAY 2015.pdf | 2015-06-15 11:13 | 232K | |
![[ ]](/icons/layout.gif) | 5LHM PLUS JULY 2013.pdf | 2013-12-16 11:05 | 220K | |
![[ ]](/icons/layout.gif) | 5Limslip 90, 85-140 and 140.pdf | 2011-12-15 20:50 | 52K | |
![[ ]](/icons/layout.gif) | 5MC4 FULL SYNTHETIC 10W40 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-20 09:11 | 338K | |
![[ ]](/icons/layout.gif) | 5MC4 MINERAL 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-20 11:46 | 319K | |
![[ ]](/icons/layout.gif) | 5MC4 SEMI SYNTHETIC 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-19 10:13 | 326K | |
![[ ]](/icons/layout.gif) | 5MC4ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-20 11:21 | 307K | |
![[ ]](/icons/layout.gif) | 5MC4ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-27 15:44 | 324K | |
![[ ]](/icons/layout.gif) | 5MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-13 18:09 | 324K | |
![[ ]](/icons/layout.gif) | 5MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-17 17:23 | 304K | |
![[ ]](/icons/layout.gif) | 5MOLYGREASE EP 3 APRIL 2014.pdf | 2014-07-21 09:55 | 250K | |
![[ ]](/icons/layout.gif) | 5PRO ENGINE OILS 5 & 10 Aug 2012.pdf | 2012-08-15 15:49 | 202K | |
![[ ]](/icons/layout.gif) | 5PRO HYDRAULIC OILS August 2012.pdf | 2012-08-30 12:11 | 201K | |
![[ ]](/icons/layout.gif) | 5Pro Hydraulic Oil.pdf | 2011-12-15 20:50 | 43K | |
![[ ]](/icons/layout.gif) | 5RUNNING IN OIL OCT 2011.pdf | 2012-06-05 11:39 | 144K | |
![[ ]](/icons/layout.gif) | 5SEMI FLUID GREASE OCTOBER 2013.pdf | 2014-02-06 14:50 | 216K | |
![[ ]](/icons/layout.gif) | 5SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-09-24 09:48 | 337K | |
![[ ]](/icons/layout.gif) | 5SHELSLEY ENGINE OILS FEBRUARY 2016.pdf | 2016-02-19 13:55 | 412K | |
![[ ]](/icons/layout.gif) | 5SHELSLEY ENGINE OILS JULY 2014.pdf | 2014-07-16 15:55 | 591K | |
![[ ]](/icons/layout.gif) | 5SHELSLEY ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:33 | 408K | |
![[ ]](/icons/layout.gif) | 5SHELSLEY ENGINE OILS OCT 2011.pdf | 2011-12-20 13:01 | 146K | |
![[ ]](/icons/layout.gif) | 5TRAC TRANS AND HYD OIL NOVEMBER 2013.pdf | 2013-12-18 15:01 | 237K | |
![[ ]](/icons/layout.gif) | 5UNIVERSAL FARM OIL NOV 2013.pdf | 2013-12-06 16:08 | 219K | |
![[ ]](/icons/layout.gif) | 5 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL April 2013.pdf | 2013-04-17 14:11 | 203K | |
![[ ]](/icons/layout.gif) | 5 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL Aug 2012.pdf | 2012-08-27 14:16 | 197K | |
![[ ]](/icons/layout.gif) | 5 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL August 2012.pdf | 2012-08-30 16:35 | 193K | |
![[ ]](/icons/layout.gif) | 5 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL Feb 2012.pdf | 2012-02-14 09:42 | 146K | |
![[ ]](/icons/layout.gif) | 5 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL January 2013.pdf | 2013-01-10 17:58 | 195K | |
![[ ]](/icons/layout.gif) | 5 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL July 2012.pdf | 2012-07-23 15:24 | 194K | |
![[ ]](/icons/layout.gif) | 5 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL March 2012.pdf | 2012-02-17 15:55 | 193K | |
![[ ]](/icons/layout.gif) | 5 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL Oct 2011.pdf | 2011-12-15 20:50 | 146K | |
![[ ]](/icons/layout.gif) | 5 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL September 2012.pdf | 2012-09-07 12:26 | 195K | |
![[ ]](/icons/layout.gif) | 6BRAKE FLUID SUPER DOT 4 APRIL 2014.pdf | 2014-04-15 16:44 | 226K | |
![[ ]](/icons/layout.gif) | 6CAM ASSEMBLY LUBE AUGUST 2014.pdf | 2014-09-02 11:39 | 178K | |
![[ ]](/icons/layout.gif) | 6CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-11-11 15:42 | 329K | |
![[ ]](/icons/layout.gif) | 6CLASSIC ENGINE OILS FEBRUARY 2016.pdf | 2016-02-17 12:43 | 367K | |
![[ ]](/icons/layout.gif) | 6CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 15:10 | 447K | |
![[ ]](/icons/layout.gif) | 6CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-05 15:25 | 329K | |
![[ ]](/icons/layout.gif) | 6COPPER EZE MAY 2013.pdf | 2013-05-10 16:12 | 222K | |
![[ ]](/icons/layout.gif) | 6DPF CLEANER JANUARY 2014.pdf | 2014-04-15 16:54 | 519K | |
![[ ]](/icons/layout.gif) | 6ENDURO MARCH 2014.pdf | 2014-03-19 12:59 | 280K | |
![[ ]](/icons/layout.gif) | 6Everyday Full Synthetic 10W-40 July 2013.pdf | 2013-09-17 17:06 | 309K | |
![[ ]](/icons/layout.gif) | 6GEAROIL EP Oct 2011.pdf | 2011-12-09 16:34 | 146K | |
![[ ]](/icons/layout.gif) | 6HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL NOVEMBER 2013.pdf | 2013-11-13 12:03 | 307K | |
![[ ]](/icons/layout.gif) | 6HD OIL FEB 2014.pdf | 2014-04-03 12:08 | 281K | |
![[ ]](/icons/layout.gif) | 6HIGH TEMP WHEEL BEARING GREASE JULY 2014.pdf | 2014-07-21 09:49 | 190K | |
![[ ]](/icons/layout.gif) | 6HPR 5 June 2013.pdf | 2013-06-24 12:41 | 294K | |
![[ ]](/icons/layout.gif) | 6HPR 30 June 2013.pdf | 2013-06-24 12:32 | 284K | |
![[ ]](/icons/layout.gif) | 6HPR 40 June 2013.pdf | 2013-06-24 12:45 | 283K | |
![[ ]](/icons/layout.gif) | 6HPR 50 June 2013.pdf | 2013-06-24 12:46 | 282K | |
![[ ]](/icons/layout.gif) | 6HPR Diesel 5 June 2013.pdf | 2013-08-07 16:42 | 299K | |
![[ ]](/icons/layout.gif) | 6HPR Diesel 10 June 2013.pdf | 2014-08-19 13:28 | 289K | |
![[ ]](/icons/layout.gif) | 6HPR Diesel 15 June 2013.pdf | 2014-10-29 07:39 | 293K | |
![[ ]](/icons/layout.gif) | 6HPR Diesel June 2013.pdf | 2013-06-28 10:36 | 286K | |
![[ ]](/icons/layout.gif) | 6HPR Gas June 2013.pdf | 2013-07-03 17:20 | 286K | |
![[ ]](/icons/layout.gif) | 6INDGREASE MOLY HT JUNE 2014.pdf | 2014-06-19 12:13 | 252K | |
![[ ]](/icons/layout.gif) | 6INDUS GEAR OIL EP - DECEMBER 2014.pdf | 2014-12-10 12:09 | 203K | |
![[ ]](/icons/layout.gif) | 6INDUS HV HYDRAULIC OIL AUGUST 2014.pdf | 2014-08-12 15:06 | 214K | |
![[ ]](/icons/layout.gif) | 6INDUS HV HYDRAULIC OIL April 2013.pdf | 2013-04-22 11:48 | 208K | |
![[ ]](/icons/layout.gif) | 6INDUS HV HYDRAULIC OIL FEBRUARY 2014.pdf | 2014-04-08 10:35 | 211K | |
![[ ]](/icons/layout.gif) | 6INDUS HV HYDRAULIC OIL NOVEMBER 2013.pdf | 2013-12-04 16:50 | 212K | |
![[ ]](/icons/layout.gif) | 6INDUS PRO HYDRAULIC OILS DECEMBER 2013.pdf | 2013-12-04 16:10 | 234K | |
![[ ]](/icons/layout.gif) | 6INDUS PRO HYDRAULIC OILS MAY 2015.pdf | 2015-06-15 11:14 | 232K | |
![[ ]](/icons/layout.gif) | 6MC4 FULL SYNTHETIC 10W40 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-20 11:47 | 338K | |
![[ ]](/icons/layout.gif) | 6MC4 MINERAL 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-20 12:57 | 320K | |
![[ ]](/icons/layout.gif) | 6MC4 SEMI SYNTHETIC 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-20 09:10 | 326K | |
![[ ]](/icons/layout.gif) | 6MC4ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-27 15:41 | 316K | |
![[ ]](/icons/layout.gif) | 6MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-13 18:10 | 324K | |
![[ ]](/icons/layout.gif) | 6MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-19 11:50 | 304K | |
![[ ]](/icons/layout.gif) | 6MOLYGREASE EP 3 APRIL 2014.pdf | 2014-07-21 09:55 | 250K | |
![[ ]](/icons/layout.gif) | 6PRO ENGINE OILS 5 & 10 Aug 2012.pdf | 2012-08-15 15:52 | 202K | |
![[ ]](/icons/layout.gif) | 6PRO HYDRAULIC OILS August 2012.pdf | 2012-08-30 12:11 | 201K | |
![[ ]](/icons/layout.gif) | 6SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-09-24 09:49 | 337K | |
![[ ]](/icons/layout.gif) | 6SHELSLEY ENGINE OILS FEBRUARY 2016.pdf | 2016-02-19 13:56 | 412K | |
![[ ]](/icons/layout.gif) | 6SHELSLEY ENGINE OILS JULY 2014.pdf | 2014-07-16 16:00 | 591K | |
![[ ]](/icons/layout.gif) | 6SHELSLEY ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:34 | 408K | |
![[ ]](/icons/layout.gif) | 6UNIVERSAL FARM OIL NOV 2013.pdf | 2013-12-18 15:10 | 219K | |
![[ ]](/icons/layout.gif) | 6 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL JULY 2013.pdf | 2013-09-04 17:06 | 376K | |
![[ ]](/icons/layout.gif) | 7BRAKE FLUID SUPER DOT 4 APRIL 2014.pdf | 2014-04-15 16:45 | 226K | |
![[ ]](/icons/layout.gif) | 7CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-11-11 15:42 | 329K | |
![[ ]](/icons/layout.gif) | 7CLASSIC ENGINE OILS FEBRUARY 2016.pdf | 2016-02-18 13:56 | 367K | |
![[ ]](/icons/layout.gif) | 7CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 15:11 | 447K | |
![[ ]](/icons/layout.gif) | 7CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-05 15:26 | 329K | |
![[ ]](/icons/layout.gif) | 7COPPER EZE MAY 2013.pdf | 2013-05-10 16:12 | 222K | |
![[ ]](/icons/layout.gif) | 7ENDURO MARCH 2014.pdf | 2014-03-20 12:05 | 280K | |
![[ ]](/icons/layout.gif) | 7Everyday Full Synthetic 10W-40 July 2013.pdf | 2013-09-19 11:44 | 309K | |
![[ ]](/icons/layout.gif) | 7GEAROIL EP Oct 2011.pdf | 2011-12-09 16:40 | 146K | |
![[ ]](/icons/layout.gif) | 7HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL NOVEMBER 2013.pdf | 2013-11-18 11:06 | 307K | |
![[ ]](/icons/layout.gif) | 7HIGH TEMP WHEEL BEARING GREASE JULY 2014.pdf | 2014-07-21 09:50 | 190K | |
![[ ]](/icons/layout.gif) | 7HPR 5 June 2013.pdf | 2013-07-22 16:03 | 294K | |
![[ ]](/icons/layout.gif) | 7HPR 30 June 2013.pdf | 2013-06-24 12:45 | 284K | |
![[ ]](/icons/layout.gif) | 7HPR 40 June 2013.pdf | 2013-09-10 16:04 | 283K | |
![[ ]](/icons/layout.gif) | 7HPR 50 June 2013.pdf | 2013-06-26 15:15 | 281K | |
![[ ]](/icons/layout.gif) | 7HPR Diesel 5 June 2013.pdf | 2013-08-07 16:43 | 299K | |
![[ ]](/icons/layout.gif) | 7HPR Diesel 10 June 2013.pdf | 2014-08-19 13:28 | 289K | |
![[ ]](/icons/layout.gif) | 7HPR Diesel June 2013.pdf | 2013-06-28 10:36 | 286K | |
![[ ]](/icons/layout.gif) | 7INDUS HV HYDRAULIC OIL April 2013.pdf | 2013-04-22 11:51 | 208K | |
![[ ]](/icons/layout.gif) | 7INDUS HV HYDRAULIC OIL FEBRUARY 2014.pdf | 2014-04-08 10:35 | 211K | |
![[ ]](/icons/layout.gif) | 7INDUS HV HYDRAULIC OIL NOVEMBER 2013.pdf | 2013-12-04 17:19 | 212K | |
![[ ]](/icons/layout.gif) | 7INDUS PRO HYDRAULIC OILS MAY 2015.pdf | 2015-06-15 11:14 | 232K | |
![[ ]](/icons/layout.gif) | 7MC4 FULL SYNTHETIC 10W40 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-27 15:27 | 338K | |
![[ ]](/icons/layout.gif) | 7MC4 MINERAL 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-27 15:22 | 320K | |
![[ ]](/icons/layout.gif) | 7MC4 SEMI SYNTHETIC 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-20 11:26 | 326K | |
![[ ]](/icons/layout.gif) | 7MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-19 10:43 | 325K | |
![[ ]](/icons/layout.gif) | 7MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-19 11:51 | 304K | |
![[ ]](/icons/layout.gif) | 7MOLYGREASE EP 3 APRIL 2014.pdf | 2014-07-21 09:55 | 250K | |
![[ ]](/icons/layout.gif) | 7PRO HYDRAULIC OILS August 2012.pdf | 2012-08-30 12:12 | 201K | |
![[ ]](/icons/layout.gif) | 7SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-12-09 14:41 | 338K | |
![[ ]](/icons/layout.gif) | 7SHELSLEY ENGINE OILS FEBRUARY 2016.pdf | 2016-02-19 13:57 | 412K | |
![[ ]](/icons/layout.gif) | 7SHELSLEY ENGINE OILS JULY 2014.pdf | 2014-07-16 16:01 | 591K | |
![[ ]](/icons/layout.gif) | 7SHELSLEY ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:34 | 408K | |
![[ ]](/icons/layout.gif) | 7UNIVERSAL FARM OIL NOV 2013.pdf | 2013-12-18 15:15 | 267K | |
![[ ]](/icons/layout.gif) | 7 YEAR 450,000KM BLUE COOLANT - AUGUST 2016.pdf | 2016-08-16 11:44 | 458K | |
![[ ]](/icons/layout.gif) | 7 YEAR 450,000KM BLUE COOLANT - FEBRUARY 2015.pdf | 2015-03-19 15:04 | 368K | |
![[ ]](/icons/layout.gif) | 7 YEAR 450,000KM BLUE COOLANT - MAY 2016.pdf | 2016-05-11 16:27 | 457K | |
![[ ]](/icons/layout.gif) | 7 YEAR 450,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-03-19 16:23 | 361K | |
![[ ]](/icons/layout.gif) | 8BRAKE FLUID SUPER DOT 4 APRIL 2014.pdf | 2014-04-16 10:32 | 229K | |
![[ ]](/icons/layout.gif) | 8CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-12-09 14:25 | 329K | |
![[ ]](/icons/layout.gif) | 8CLASSIC ENGINE OILS FEBRUARY 2016.pdf | 2016-02-19 13:38 | 367K | |
![[ ]](/icons/layout.gif) | 8CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 15:11 | 447K | |
![[ ]](/icons/layout.gif) | 8CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:37 | 329K | |
![[ ]](/icons/layout.gif) | 8COPPER EZE MAY 2013.pdf | 2013-05-10 16:13 | 222K | |
![[ ]](/icons/layout.gif) | 8ENDURO MARCH 2014.pdf | 2014-03-20 12:06 | 280K | |
![[ ]](/icons/layout.gif) | 8Everyday Full Synthetic 10W-40 July 2013.pdf | 2013-09-19 11:45 | 309K | |
![[ ]](/icons/layout.gif) | 8HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL NOVEMBER 2013.pdf | 2013-11-18 11:07 | 307K | |
![[ ]](/icons/layout.gif) | 8HIGH TEMP WHEEL BEARING GREASE JULY 2014.pdf | 2014-07-21 09:50 | 190K | |
![[ ]](/icons/layout.gif) | 8HPR 5 June 2013.pdf | 2013-07-22 16:04 | 294K | |
![[ ]](/icons/layout.gif) | 8HPR 30 June 2013.pdf | 2013-12-17 10:36 | 284K | |
![[ ]](/icons/layout.gif) | 8HPR 50 June 2013.pdf | 2013-06-26 15:17 | 281K | |
![[ ]](/icons/layout.gif) | 8HPR Diesel 5 June 2013.pdf | 2013-11-21 08:19 | 299K | |
![[ ]](/icons/layout.gif) | 8HPR Diesel June 2013.pdf | 2013-06-28 11:45 | 286K | |
![[ ]](/icons/layout.gif) | 8INDUS HV HYDRAULIC OIL April 2013.pdf | 2013-04-24 10:13 | 210K | |
![[ ]](/icons/layout.gif) | 8INDUS HV HYDRAULIC OIL FEBRUARY 2014.pdf | 2014-04-08 10:35 | 211K | |
![[ ]](/icons/layout.gif) | 8INDUS PRO HYDRAULIC OILS MAY 2015.pdf | 2015-06-15 11:14 | 232K | |
![[ ]](/icons/layout.gif) | 8MC4 FULL SYNTHETIC 10W40 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-27 15:50 | 348K | |
![[ ]](/icons/layout.gif) | 8MC4 MINERAL 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-28 15:41 | 320K | |
![[ ]](/icons/layout.gif) | 8MC4 SEMI SYNTHETIC 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-20 11:45 | 326K | |
![[ ]](/icons/layout.gif) | 8MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-19 10:45 | 325K | |
![[ ]](/icons/layout.gif) | 8MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-19 11:51 | 304K | |
![[ ]](/icons/layout.gif) | 8MOLYGREASE EP 3 APRIL 2014.pdf | 2014-07-21 09:57 | 250K | |
![[ ]](/icons/layout.gif) | 8PRO HYDRAULIC OILS August 2012.pdf | 2012-08-30 12:17 | 201K | |
![[ ]](/icons/layout.gif) | 8SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-12-09 14:43 | 338K | |
![[ ]](/icons/layout.gif) | 8SHELSLEY ENGINE OILS JULY 2014.pdf | 2014-07-16 16:12 | 591K | |
![[ ]](/icons/layout.gif) | 8SHELSLEY ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:34 | 408K | |
![[ ]](/icons/layout.gif) | 8UNIVERSAL FARM OIL NOV 2013.pdf | 2013-12-18 15:16 | 267K | |
![[ ]](/icons/layout.gif) | 8 YEAR 500,000KM RED COOLANT - AUGUST 2016.pdf | 2016-08-16 12:47 | 402K | |
![[ ]](/icons/layout.gif) | 8 YEAR 500,000KM RED COOLANT - FEBRUARY 2015.pdf | 2015-03-19 15:26 | 305K | |
![[ ]](/icons/layout.gif) | 9BRAKE FLUID SUPER DOT 4 APRIL 2014.pdf | 2014-04-16 13:42 | 227K | |
![[ ]](/icons/layout.gif) | 9CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-12-09 14:26 | 329K | |
![[ ]](/icons/layout.gif) | 9CLASSIC ENGINE OILS FEBRUARY 2016.pdf | 2016-02-19 13:46 | 367K | |
![[ ]](/icons/layout.gif) | 9CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 15:12 | 447K | |
![[ ]](/icons/layout.gif) | 9CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:38 | 329K | |
![[ ]](/icons/layout.gif) | 9COPPER EZE MAY 2013.pdf | 2013-05-10 16:14 | 222K | |
![[ ]](/icons/layout.gif) | 9ENDURO MARCH 2014.pdf | 2014-07-03 08:21 | 280K | |
![[ ]](/icons/layout.gif) | 9HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL NOVEMBER 2013.pdf | 2013-11-27 13:04 | 308K | |
![[ ]](/icons/layout.gif) | 9HIGH TEMP WHEEL BEARING GREASE JULY 2014.pdf | 2014-07-21 09:50 | 190K | |
![[ ]](/icons/layout.gif) | 9HPR 50 June 2013.pdf | 2013-06-26 15:17 | 281K | |
![[ ]](/icons/layout.gif) | 9HPR Diesel 5 June 2013.pdf | 2013-11-21 08:20 | 299K | |
![[ ]](/icons/layout.gif) | 9HPR Diesel June 2013.pdf | 2013-06-28 11:45 | 286K | |
![[ ]](/icons/layout.gif) | 9INDUS HV HYDRAULIC OIL April 2013.pdf | 2013-04-24 10:14 | 210K | |
![[ ]](/icons/layout.gif) | 9INDUS HV HYDRAULIC OIL FEBRUARY 2014.pdf | 2014-04-08 10:36 | 211K | |
![[ ]](/icons/layout.gif) | 9MC4 FULL SYNTHETIC 10W40 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-27 16:43 | 349K | |
![[ ]](/icons/layout.gif) | 9MC4 MINERAL 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-04-01 15:53 | 320K | |
![[ ]](/icons/layout.gif) | 9MC4 SEMI SYNTHETIC 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-03-27 15:29 | 326K | |
![[ ]](/icons/layout.gif) | 9MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-19 10:57 | 325K | |
![[ ]](/icons/layout.gif) | 9MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-20 09:07 | 304K | |
![[ ]](/icons/layout.gif) | 9MOLYGREASE EP 3 APRIL 2014.pdf | 2014-07-21 09:58 | 250K | |
![[ ]](/icons/layout.gif) | 9PRO HYDRAULIC OILS August 2012.pdf | 2012-08-30 12:17 | 201K | |
![[ ]](/icons/layout.gif) | 9SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-12-09 14:44 | 338K | |
![[ ]](/icons/layout.gif) | 9SHELSLEY ENGINE OILS JULY 2014.pdf | 2014-07-16 16:17 | 591K | |
![[ ]](/icons/layout.gif) | 9SHELSLEY ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:35 | 408K | |
![[ ]](/icons/layout.gif) | 9UNIVERSAL FARM OIL NOV 2013.pdf | 2013-12-18 15:19 | 267K | |
![[ ]](/icons/layout.gif) | 10BRAKE FLUID SUPER DOT 4 APRIL 2014.pdf | 2014-04-16 13:43 | 227K | |
![[ ]](/icons/layout.gif) | 10CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-12-09 14:27 | 329K | |
![[ ]](/icons/layout.gif) | 10CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 15:13 | 447K | |
![[ ]](/icons/layout.gif) | 10CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:38 | 329K | |
![[ ]](/icons/layout.gif) | 10COPPER EZE MAY 2013.pdf | 2013-05-10 16:14 | 222K | |
![[ ]](/icons/layout.gif) | 10HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL NOVEMBER 2013.pdf | 2013-11-27 13:04 | 308K | |
![[ ]](/icons/layout.gif) | 10HIGH TEMP WHEEL BEARING GREASE JULY 2014.pdf | 2014-07-21 09:52 | 190K | |
![[ ]](/icons/layout.gif) | 10HPR Diesel 5 June 2013.pdf | 2013-11-21 08:20 | 299K | |
![[ ]](/icons/layout.gif) | 10HPR Diesel June 2013.pdf | 2013-06-28 11:46 | 286K | |
![[ ]](/icons/layout.gif) | 10INDUS HV HYDRAULIC OIL April 2013.pdf | 2013-04-24 10:14 | 210K | |
![[ ]](/icons/layout.gif) | 10INDUS HV HYDRAULIC OIL FEBRUARY 2014.pdf | 2014-04-08 10:36 | 211K | |
![[ ]](/icons/layout.gif) | 10MC4 FULL SYNTHETIC 10W40 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-12-22 09:43 | 351K | |
![[ ]](/icons/layout.gif) | 10MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-19 10:57 | 325K | |
![[ ]](/icons/layout.gif) | 10MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-20 09:09 | 304K | |
![[ ]](/icons/layout.gif) | 10MOLYGREASE EP 3 APRIL 2014.pdf | 2015-03-03 09:59 | 249K | |
![[ ]](/icons/layout.gif) | 10MOTORCYCLE FORK OILS MAY 2012.pdf | 2012-09-14 16:13 | 96K | |
![[ ]](/icons/layout.gif) | 10PRO HYDRAULIC OILS August 2012.pdf | 2012-08-30 12:17 | 201K | |
![[ ]](/icons/layout.gif) | 10SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-12-10 09:09 | 338K | |
![[ ]](/icons/layout.gif) | 10SHELSLEY ENGINE OILS JULY 2014.pdf | 2014-07-16 16:18 | 591K | |
![[ ]](/icons/layout.gif) | 10SHELSLEY ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:35 | 408K | |
![[ ]](/icons/layout.gif) | 10SIN Race Castor.pdf | 2012-01-12 16:57 | 66K | |
![[ ]](/icons/layout.gif) | 10 TENTHS CHAIN CLEANER AEROSOL DECEMBER 2015.pdf | 2016-09-21 16:22 | 239K | |
![[ ]](/icons/layout.gif) | 10 TENTHS CHAIN LUBE RACE DECEMBER 2015.pdf | 2015-12-22 16:49 | 259K | |
![[ ]](/icons/layout.gif) | 10 TENTHS FOAM FILTER CLEANER SEPTEMBER 2016.pdf | 2016-09-21 11:03 | 375K | |
![[ ]](/icons/layout.gif) | 10 TENTHS FOAM FILTER OIL AEROSOL DECEMBER 2015.pdf | 2015-12-23 09:40 | 300K | |
![[ ]](/icons/layout.gif) | 10 TENTHS FOAM FILTER OIL OCTOBER 2016.pdf | 2016-10-17 15:06 | 351K | |
![[ ]](/icons/layout.gif) | 10 TENTHS KO2ST FULL SYNTHETIC TWO STROKE OIL MARCH 2015.pdf | 2015-04-20 09:39 | 274K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 0 APRIL 2014.pdf | 2014-04-04 08:50 | 256K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 0 AUG 2012.pdf | 2012-08-09 07:42 | 235K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 0 JUNE 2013.pdf | 2013-06-06 10:43 | 308K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 0 MAR 2012.pdf | 2012-03-26 12:55 | 128K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 0 Nov 2012.pdf | 2012-11-13 12:26 | 217K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 0 SEPTEMBER 2013.pdf | 2013-09-20 16:55 | 259K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 0 SEPTEMBER 2014.pdf | 2014-10-02 14:12 | 235K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 5 APRIL 2014.pdf | 2014-04-04 08:55 | 257K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 5 AUG 2012.pdf | 2012-08-09 07:49 | 235K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 5 JUNE 2013.pdf | 2013-06-06 10:45 | 309K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 5 MAR 2012.pdf | 2012-03-26 13:25 | 130K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 5 Nov 2012.pdf | 2012-11-13 12:31 | 216K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 5 SEPTEMBER 2013.pdf | 2013-09-20 16:57 | 261K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 5 SEPTEMBER 2014.pdf | 2014-10-02 14:32 | 234K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 10 APRIL 2014.pdf | 2014-04-04 08:59 | 259K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 10 AUG 2012.pdf | 2012-08-09 08:05 | 234K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-06-06 10:48 | 309K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 10 MAR 2012.pdf | 2012-03-26 13:42 | 129K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 10 Nov 2012.pdf | 2012-11-16 11:48 | 216K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 10 SEPTEMBER 2013.pdf | 2013-09-20 16:58 | 260K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM 10 SEPTEMBER 2014.pdf | 2014-10-02 14:43 | 233K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM FULL SYNTHETIC 0W-40 DECEMBER 2015.pdf | 2015-12-08 08:20 | 377K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM FULL SYNTHETIC 0W-40 MARCH 2015.pdf | 2015-03-24 10:49 | 235K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM FULL SYNTHETIC 0W-40 MAY 2015.pdf | 2015-05-04 12:49 | 297K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM FULL SYNTHETIC 0W-40 NOVEMBER 2016.pdf | 2016-11-29 15:37 | 378K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM FULL SYNTHETIC 5W-50 DECEMBER 2015.pdf | 2015-12-08 08:21 | 378K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM FULL SYNTHETIC 5W-50 MARCH 2015.pdf | 2015-03-24 10:50 | 234K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM FULL SYNTHETIC 5W-50 MAY 2015.pdf | 2015-05-04 12:50 | 296K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM FULL SYNTHETIC 5W-50 NOVEMBER 2016.pdf | 2016-11-10 11:16 | 378K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM FULL SYNTHETIC 10W-60 DECEMBER 2015.pdf | 2015-12-08 08:21 | 377K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM FULL SYNTHETIC 10W-60 MARCH 2015.pdf | 2015-03-24 10:50 | 233K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM FULL SYNTHETIC 10W-60 MAY 2015.pdf | 2015-05-04 12:50 | 293K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM FULL SYNTHETIC 10W-60 NOVEMBER 2016.pdf | 2016-11-10 16:58 | 377K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM FULL SYNTHETIC OILS OCT 2011.pdf | 2011-12-15 20:50 | 214K | |
![[ ]](/icons/layout.gif) | 10 TENTHS PREMIUM OILS FEB 2012.pdf | 2012-02-14 09:58 | 214K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACE CASTOR OIL DECEMBER 2013.pdf | 2013-12-13 15:34 | 227K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACE CASTOR OIL DECEMBER 2016.pdf | 2016-12-15 11:08 | 238K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACE CASTOR OIL JANUARY 2015.pdf | 2015-01-12 10:52 | 230K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACE CASTOR OIL JUNE 2014.pdf | 2014-06-02 12:58 | 228K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACE CASTOR OIL OCTOBER 2014.pdf | 2014-10-10 10:43 | 230K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACE CASTOR OIL SEPTEMBER 2013.pdf | 2013-09-19 12:04 | 227K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACE CHAIN LUBE DECEMBER 2015.pdf | 2015-12-22 15:00 | 233K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACE COOLANT INHIBITOR AUG 2012.pdf | 2012-08-31 09:25 | 206K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACE COOLANT INHIBITOR AUGUST 2016.pdf | 2016-08-11 12:45 | 260K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACE COOLANT INHIBITOR FEBRUARY 2017.pdf | 2017-02-16 11:10 | 259K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACE COOLANT INHIBITOR MAY 2015.pdf | 2015-05-01 14:42 | 220K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACE COOLANT INHIBITOR NOVEMBER 2013.pdf | 2013-11-15 16:14 | 218K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACE COOLANT INHIBITOR NOVEMBER 2015.pdf | 2015-11-19 09:54 | 240K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING 0W-20 DECEMBER 2015.pdf | 2015-12-08 11:21 | 397K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING 0W-20 MARCH 2015.pdf | 2015-03-24 11:22 | 234K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING 0W-20 MAY 2015.pdf | 2015-05-06 14:34 | 343K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING 5W-30 DECEMBER 2015.pdf | 2015-12-08 11:31 | 409K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING 5W-30 MARCH 2015.pdf | 2015-03-24 11:22 | 257K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING 5W-30 MAY 2015.pdf | 2015-05-06 14:35 | 344K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING 10W-40 DECEMBER 2015.pdf | 2015-12-08 11:50 | 368K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING 10W-40 MARCH 2015.pdf | 2015-03-24 11:23 | 256K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING 10W-40 MAY 2015.pdf | 2015-05-06 14:35 | 344K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING 15W-50 DECEMBER 2015.pdf | 2015-12-08 12:00 | 384K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING 15W-50 MARCH 2015.pdf | 2015-03-24 11:24 | 278K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING 15W-50 MAY 2015.pdf | 2015-05-06 14:36 | 374K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING 20W-60 DECEMBER 2015.pdf | 2015-12-08 12:15 | 388K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING 20W-60 MARCH 2015.pdf | 2015-03-24 11:24 | 259K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING 20W-60 MAY 2015.pdf | 2015-05-06 14:37 | 367K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING 20W-60 NOVEMBER 2016.pdf | 2016-11-10 16:00 | 388K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 0 AUG 2012.pdf | 2012-08-09 08:07 | 250K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 0 JANUARY 2015.pdf | 2015-01-21 15:07 | 234K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 0 JULY 2014.pdf | 2014-07-18 11:32 | 475K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 0 JUNE 2013.pdf | 2013-06-04 16:35 | 246K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 0 MAR 2012.pdf | 2012-03-26 14:01 | 137K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 0 MARCH 2014.pdf | 2014-03-31 10:49 | 257K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 0 Nov 2012.pdf | 2012-11-13 09:31 | 246K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 0 SEPTEMBER 2013.pdf | 2013-09-20 16:39 | 257K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 5 APRIL 2014.pdf | 2014-04-04 09:22 | 257K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 5 AUG 2012.pdf | 2012-08-07 09:35 | 249K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 5 JULY 2014.pdf | 2014-07-18 11:34 | 475K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 5 JUNE 2013.pdf | 2013-06-04 16:36 | 251K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 5 MAR 2012.pdf | 2012-03-26 15:10 | 137K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 5 NOV 2012.pdf | 2012-11-16 10:20 | 251K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 5 SEPTEMBER 2013.pdf | 2013-09-20 16:39 | 259K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 10 APRIL 2014.pdf | 2014-04-03 17:05 | 256K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 10 AUG 2012.pdf | 2012-08-09 08:11 | 252K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 10 JULY 2014.pdf | 2014-07-18 11:34 | 431K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 10 JUNE 2013.pdf | 2013-06-04 16:36 | 305K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 10 MAR 2012.pdf | 2012-03-26 16:30 | 137K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 10 NOV 2012.pdf | 2012-11-16 10:21 | 253K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 10 SEPTEMBER 2013.pdf | 2013-09-20 16:08 | 259K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 15 APRIL 2014.pdf | 2014-04-03 17:02 | 278K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 15 AUG 2012.pdf | 2012-08-09 08:12 | 251K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 15 JULY 2014.pdf | 2014-07-18 11:34 | 452K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 15 JUNE 2013.pdf | 2013-06-04 16:36 | 301K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 15 MAR 2012.pdf | 2012-03-26 17:33 | 137K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 15 NOV 2012.pdf | 2012-11-16 10:21 | 252K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 15 SEPTEMBER 2013.pdf | 2013-09-20 16:24 | 278K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 20 APRIL 2014.pdf | 2014-04-03 17:11 | 276K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 20 AUG 2012.pdf | 2012-08-09 08:14 | 251K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 20 December 2012.pdf | 2012-12-05 17:17 | 249K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 20 JANUARY 2015.pdf | 2015-01-21 15:16 | 256K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 20 JULY 2014.pdf | 2014-07-18 11:35 | 448K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 20 JUNE 2013.pdf | 2013-06-04 16:36 | 234K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 20 MAR 2012.pdf | 2012-03-27 14:01 | 137K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 20 NOV 2012.pdf | 2012-11-16 10:21 | 252K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OIL 20 SEPTEMBER 2013.pdf | 2013-09-20 16:26 | 280K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OILS FEB 2012.pdf | 2012-02-14 09:43 | 245K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RACING OILS NOV 2011.pdf | 2011-12-15 20:50 | 241K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RUNNING IN OIL APRIL 2014.pdf | 2014-04-04 08:37 | 169K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RUNNING IN OIL APRIL 2017.pdf | 2017-04-24 08:36 | 419K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RUNNING IN OIL FEBRUARY 2016.pdf | 2016-02-23 11:40 | 335K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RUNNING IN OIL JANUARY 2015.pdf | 2015-01-27 16:02 | 180K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RUNNING IN OIL JUNE 2013.pdf | 2013-06-17 17:37 | 175K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RUNNING IN OIL MAY 2015.pdf | 2015-05-04 09:24 | 191K | |
![[ ]](/icons/layout.gif) | 10 TENTHS RUNNING IN OIL OCTOBER 2014.pdf | 2014-10-08 11:17 | 178K | |
![[ ]](/icons/layout.gif) | 10 Tenths Premium Full Synthetic 0W-50 REV 0.0 1011.pdf | 2011-12-23 12:04 | 84K | |
![[ ]](/icons/layout.gif) | 11BRAKE FLUID SUPER DOT 4 APRIL 2014.pdf | 2014-04-16 13:43 | 227K | |
![[ ]](/icons/layout.gif) | 11CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-12-16 11:58 | 329K | |
![[ ]](/icons/layout.gif) | 11CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 16:46 | 447K | |
![[ ]](/icons/layout.gif) | 11CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:39 | 329K | |
![[ ]](/icons/layout.gif) | 11HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL NOVEMBER 2013.pdf | 2013-11-27 13:05 | 308K | |
![[ ]](/icons/layout.gif) | 11HIGH TEMP WHEEL BEARING GREASE JULY 2014.pdf | 2014-07-21 09:52 | 190K | |
![[ ]](/icons/layout.gif) | 11HPR Diesel 5 June 2013.pdf | 2013-11-21 08:24 | 299K | |
![[ ]](/icons/layout.gif) | 11INDUS HV HYDRAULIC OIL April 2013.pdf | 2013-04-24 10:15 | 210K | |
![[ ]](/icons/layout.gif) | 11INDUS HV HYDRAULIC OIL FEBRUARY 2014.pdf | 2014-04-08 10:37 | 211K | |
![[ ]](/icons/layout.gif) | 11MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-19 11:02 | 325K | |
![[ ]](/icons/layout.gif) | 11MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-20 09:12 | 304K | |
![[ ]](/icons/layout.gif) | 11PRO HYDRAULIC OILS August 2012.pdf | 2012-08-31 09:49 | 201K | |
![[ ]](/icons/layout.gif) | 11SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-12-10 09:12 | 338K | |
![[ ]](/icons/layout.gif) | 11SHELSLEY ENGINE OILS JULY 2014.pdf | 2014-07-16 16:19 | 591K | |
![[ ]](/icons/layout.gif) | 11SHELSLEY ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:36 | 408K | |
![[ ]](/icons/layout.gif) | 12CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-12-17 10:45 | 329K | |
![[ ]](/icons/layout.gif) | 12CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 16:47 | 447K | |
![[ ]](/icons/layout.gif) | 12CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:39 | 329K | |
![[ ]](/icons/layout.gif) | 12HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL NOVEMBER 2013.pdf | 2014-02-24 17:15 | 307K | |
![[ ]](/icons/layout.gif) | 12HIGH TEMP WHEEL BEARING GREASE JULY 2014.pdf | 2015-03-04 13:28 | 190K | |
![[ ]](/icons/layout.gif) | 12HPR Diesel 5 June 2013.pdf | 2013-11-21 08:25 | 299K | |
![[ ]](/icons/layout.gif) | 12INDUS HV HYDRAULIC OIL April 2013.pdf | 2013-05-01 10:46 | 210K | |
![[ ]](/icons/layout.gif) | 12MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-20 09:08 | 325K | |
![[ ]](/icons/layout.gif) | 12MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-20 09:13 | 304K | |
![[ ]](/icons/layout.gif) | 12PRO HYDRAULIC OILS August 2012.pdf | 2013-10-22 09:20 | 201K | |
![[ ]](/icons/layout.gif) | 12SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-12-10 09:14 | 338K | |
![[ ]](/icons/layout.gif) | 12SHELSLEY ENGINE OILS JULY 2014.pdf | 2014-07-17 12:57 | 591K | |
![[ ]](/icons/layout.gif) | 12SHELSLEY ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:36 | 408K | |
![[ ]](/icons/layout.gif) | 13CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-12-17 10:47 | 329K | |
![[ ]](/icons/layout.gif) | 13CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 16:47 | 447K | |
![[ ]](/icons/layout.gif) | 13CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:39 | 329K | |
![[ ]](/icons/layout.gif) | 13HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL NOVEMBER 2013.pdf | 2014-02-24 17:15 | 307K | |
![[ ]](/icons/layout.gif) | 13HPR Diesel 5 June 2013.pdf | 2013-11-21 08:25 | 299K | |
![[ ]](/icons/layout.gif) | 13INDUS HV HYDRAULIC OIL April 2013.pdf | 2013-05-01 10:49 | 210K | |
![[ ]](/icons/layout.gif) | 13MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-20 09:09 | 325K | |
![[ ]](/icons/layout.gif) | 13MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-20 11:20 | 304K | |
![[ ]](/icons/layout.gif) | 13SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-12-10 11:02 | 338K | |
![[ ]](/icons/layout.gif) | 13SHELSLEY ENGINE OILS JULY 2014.pdf | 2014-07-17 14:42 | 591K | |
![[ ]](/icons/layout.gif) | 13SHELSLEY ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:36 | 408K | |
![[ ]](/icons/layout.gif) | 13 YEAR STANDARD DRAIN ANTI FREEZE ANTI BOIL Aug 2012.pdf | 2012-08-30 17:07 | 201K | |
![[ ]](/icons/layout.gif) | 14CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-12-17 10:50 | 329K | |
![[ ]](/icons/layout.gif) | 14CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 16:48 | 447K | |
![[ ]](/icons/layout.gif) | 14CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:40 | 329K | |
![[ ]](/icons/layout.gif) | 14INDUS HV HYDRAULIC OIL April 2013.pdf | 2013-05-01 10:49 | 210K | |
![[ ]](/icons/layout.gif) | 14MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-20 09:11 | 325K | |
![[ ]](/icons/layout.gif) | 14MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-20 11:24 | 304K | |
![[ ]](/icons/layout.gif) | 14SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-12-10 11:02 | 338K | |
![[ ]](/icons/layout.gif) | 14SHELSLEY ENGINE OILS MARCH 2014.pdf | 2014-07-14 10:10 | 408K | |
![[ ]](/icons/layout.gif) | 14 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL April 2013.pdf | 2013-04-26 09:23 | 220K | |
![[ ]](/icons/layout.gif) | 14 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL Aug 2012.pdf | 2012-08-27 14:20 | 207K | |
![[ ]](/icons/layout.gif) | 14 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL FEBRUARY 2014.pdf | 2014-02-24 16:20 | 395K | |
![[ ]](/icons/layout.gif) | 14 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL Feb 2012.pdf | 2012-02-17 15:52 | 205K | |
![[ ]](/icons/layout.gif) | 14 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL JULY 2013.pdf | 2013-07-22 13:23 | 397K | |
![[ ]](/icons/layout.gif) | 14 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL March 2012.pdf | 2012-03-22 10:59 | 119K | |
![[ ]](/icons/layout.gif) | 14 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL Oct 2011.pdf | 2012-02-01 16:57 | 153K | |
![[ ]](/icons/layout.gif) | 14 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-09-13 12:57 | 215K | |
![[ ]](/icons/layout.gif) | 15CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-12-17 12:38 | 329K | |
![[ ]](/icons/layout.gif) | 15CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 16:48 | 447K | |
![[ ]](/icons/layout.gif) | 15CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:40 | 329K | |
![[ ]](/icons/layout.gif) | 15INDUS HV HYDRAULIC OIL April 2013.pdf | 2013-05-01 10:49 | 210K | |
![[ ]](/icons/layout.gif) | 15MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-20 09:45 | 326K | |
![[ ]](/icons/layout.gif) | 15MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-20 11:49 | 304K | |
![[ ]](/icons/layout.gif) | 15SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-12-16 11:32 | 338K | |
![[ ]](/icons/layout.gif) | 15SHELSLEY ENGINE OILS MARCH 2014.pdf | 2014-07-14 14:40 | 408K | |
![[ ]](/icons/layout.gif) | 15 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL April 2013.pdf | 2013-04-26 09:21 | 203K | |
![[ ]](/icons/layout.gif) | 15 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL August 2012.pdf | 2012-08-30 16:39 | 192K | |
![[ ]](/icons/layout.gif) | 15 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL March 2012.pdf | 2012-02-17 15:56 | 193K | |
![[ ]](/icons/layout.gif) | 15 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL Oct 2011.pdf | 2012-02-01 16:56 | 146K | |
![[ ]](/icons/layout.gif) | 15 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL September 2012.pdf | 2012-09-13 12:47 | 195K | |
![[ ]](/icons/layout.gif) | 16CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-12-17 12:43 | 329K | |
![[ ]](/icons/layout.gif) | 16CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 16:49 | 447K | |
![[ ]](/icons/layout.gif) | 16CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:41 | 329K | |
![[ ]](/icons/layout.gif) | 16MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-20 09:45 | 326K | |
![[ ]](/icons/layout.gif) | 16SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-12-16 11:36 | 338K | |
![[ ]](/icons/layout.gif) | 16 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL JULY 2013.pdf | 2013-09-09 16:13 | 376K | |
![[ ]](/icons/layout.gif) | 17CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-12-23 10:47 | 329K | |
![[ ]](/icons/layout.gif) | 17CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 16:49 | 447K | |
![[ ]](/icons/layout.gif) | 17CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:41 | 329K | |
![[ ]](/icons/layout.gif) | 17MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-20 09:46 | 326K | |
![[ ]](/icons/layout.gif) | 17SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-12-16 11:43 | 338K | |
![[ ]](/icons/layout.gif) | 17 YEAR 450,000KM BLUE COOLANT - FEBRUARY 2015.pdf | 2015-04-14 16:36 | 457K | |
![[ ]](/icons/layout.gif) | 17 YEAR 450,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-04-14 16:39 | 484K | |
![[ ]](/icons/layout.gif) | 18CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-12-23 10:52 | 329K | |
![[ ]](/icons/layout.gif) | 18CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 16:50 | 447K | |
![[ ]](/icons/layout.gif) | 18CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:42 | 329K | |
![[ ]](/icons/layout.gif) | 18MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-20 11:22 | 326K | |
![[ ]](/icons/layout.gif) | 18 YEAR 500,000KM RED COOLANT - FEBRUARY 2015.pdf | 2015-04-14 16:38 | 401K | |
![[ ]](/icons/layout.gif) | 19CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-12-23 10:55 | 329K | |
![[ ]](/icons/layout.gif) | 19CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 16:50 | 447K | |
![[ ]](/icons/layout.gif) | 19CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-17 10:42 | 329K | |
![[ ]](/icons/layout.gif) | 19MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-20 11:23 | 326K | |
![[ ]](/icons/layout.gif) | 20CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 16:51 | 447K | |
![[ ]](/icons/layout.gif) | 20CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-25 09:07 | 329K | |
![[ ]](/icons/layout.gif) | 20MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-20 11:48 | 326K | |
![[ ]](/icons/layout.gif) | 21CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 16:51 | 447K | |
![[ ]](/icons/layout.gif) | 21CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-04-10 17:02 | 329K | |
![[ ]](/icons/layout.gif) | 21MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-27 15:58 | 363K | |
![[ ]](/icons/layout.gif) | 22CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 16:52 | 447K | |
![[ ]](/icons/layout.gif) | 22CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-04-10 17:02 | 329K | |
![[ ]](/icons/layout.gif) | 22MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-27 15:58 | 363K | |
![[ ]](/icons/layout.gif) | 23CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-14 10:22 | 447K | |
![[ ]](/icons/layout.gif) | 23CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-04-10 17:03 | 329K | |
![[ ]](/icons/layout.gif) | 23MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-03-27 15:59 | 363K | |
![[ ]](/icons/layout.gif) | 23 YEAR STANDARD DRAIN ANTI FREEZE ANTI BOIL Aug 2012.pdf | 2012-11-01 16:57 | 201K | |
![[ ]](/icons/layout.gif) | 24CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-14 14:44 | 447K | |
![[ ]](/icons/layout.gif) | 24CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-04-10 17:03 | 329K | |
![[ ]](/icons/layout.gif) | 24 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL Aug 2012.pdf | 2012-08-27 14:21 | 207K | |
![[ ]](/icons/layout.gif) | 24 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL FEBRUARY 2014.pdf | 2014-02-24 16:22 | 395K | |
![[ ]](/icons/layout.gif) | 24 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL Feb 2012.pdf | 2012-02-17 15:53 | 205K | |
![[ ]](/icons/layout.gif) | 24 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL JULY 2013.pdf | 2013-07-22 13:25 | 397K | |
![[ ]](/icons/layout.gif) | 24 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL March 2012.pdf | 2012-03-22 11:01 | 119K | |
![[ ]](/icons/layout.gif) | 24 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-09-13 12:57 | 215K | |
![[ ]](/icons/layout.gif) | 25CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-16 15:45 | 447K | |
![[ ]](/icons/layout.gif) | 25CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-04-10 17:04 | 329K | |
![[ ]](/icons/layout.gif) | 25 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL August 2012.pdf | 2012-08-30 16:39 | 192K | |
![[ ]](/icons/layout.gif) | 25 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL March 2012.pdf | 2012-03-21 13:50 | 114K | |
![[ ]](/icons/layout.gif) | 25 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL September 2012.pdf | 2012-09-13 12:50 | 195K | |
![[ ]](/icons/layout.gif) | 26CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-16 15:46 | 447K | |
![[ ]](/icons/layout.gif) | 26CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-04-10 17:04 | 329K | |
![[ ]](/icons/layout.gif) | 26 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL JULY 2013.pdf | 2013-09-12 11:44 | 376K | |
![[ ]](/icons/layout.gif) | 27CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-16 15:46 | 447K | |
![[ ]](/icons/layout.gif) | 27CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-04-10 17:04 | 329K | |
![[ ]](/icons/layout.gif) | 27 YEAR 450,000KM BLUE COOLANT - FEBRUARY 2015.pdf | 2015-04-14 16:38 | 457K | |
![[ ]](/icons/layout.gif) | 27 YEAR 450,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-04-14 16:39 | 484K | |
![[ ]](/icons/layout.gif) | 28CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-16 15:51 | 447K | |
![[ ]](/icons/layout.gif) | 28CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-04-10 17:05 | 329K | |
![[ ]](/icons/layout.gif) | 28 YEAR 500,000KM RED COOLANT - FEBRUARY 2015.pdf | 2015-04-14 16:38 | 401K | |
![[ ]](/icons/layout.gif) | 29CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-16 15:52 | 447K | |
![[ ]](/icons/layout.gif) | 29CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-04-10 17:05 | 329K | |
![[ ]](/icons/layout.gif) | 30CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-16 15:53 | 447K | |
![[ ]](/icons/layout.gif) | 30CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-04-10 17:06 | 329K | |
![[ ]](/icons/layout.gif) | 31CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-16 15:54 | 447K | |
![[ ]](/icons/layout.gif) | 31CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-04-10 17:06 | 329K | |
![[ ]](/icons/layout.gif) | 32CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-16 16:02 | 447K | |
![[ ]](/icons/layout.gif) | 32CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-04-10 17:07 | 329K | |
![[ ]](/icons/layout.gif) | 33CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-16 16:10 | 447K | |
![[ ]](/icons/layout.gif) | 33CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-04-10 17:07 | 329K | |
![[ ]](/icons/layout.gif) | 33 YEAR STANDARD DRAIN ANTI FREEZE ANTI BOIL Aug 2012.pdf | 2012-12-19 16:28 | 200K | |
![[ ]](/icons/layout.gif) | 34CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-16 16:11 | 447K | |
![[ ]](/icons/layout.gif) | 34CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-04-10 17:07 | 329K | |
![[ ]](/icons/layout.gif) | 34 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL FEBRUARY 2014.pdf | 2014-03-05 16:30 | 395K | |
![[ ]](/icons/layout.gif) | 34 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL JULY 2013.pdf | 2013-08-07 16:31 | 397K | |
![[ ]](/icons/layout.gif) | 34 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-09-13 16:49 | 215K | |
![[ ]](/icons/layout.gif) | 35CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-16 16:13 | 447K | |
![[ ]](/icons/layout.gif) | 35CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-04-10 17:08 | 329K | |
![[ ]](/icons/layout.gif) | 35 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL March 2012.pdf | 2012-03-21 13:50 | 114K | |
![[ ]](/icons/layout.gif) | 35 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL September 2012.pdf | 2012-09-17 16:57 | 196K | |
![[ ]](/icons/layout.gif) | 36CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-16 16:14 | 447K | |
![[ ]](/icons/layout.gif) | 36CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-07-11 15:09 | 329K | |
![[ ]](/icons/layout.gif) | 36 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL JULY 2013.pdf | 2013-09-13 16:06 | 376K | |
![[ ]](/icons/layout.gif) | 37CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-16 16:15 | 447K | |
![[ ]](/icons/layout.gif) | 37 YEAR 450,000KM BLUE COOLANT - FEBRUARY 2015.pdf | 2015-04-21 11:59 | 457K | |
![[ ]](/icons/layout.gif) | 37 YEAR 450,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-04-21 12:00 | 483K | |
![[ ]](/icons/layout.gif) | 38CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-16 16:19 | 447K | |
![[ ]](/icons/layout.gif) | 38 YEAR 500,000KM RED COOLANT - FEBRUARY 2015.pdf | 2015-05-22 09:23 | 401K | |
![[ ]](/icons/layout.gif) | 39CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-16 16:20 | 447K | |
![[ ]](/icons/layout.gif) | 40CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-17 13:13 | 447K | |
![[ ]](/icons/layout.gif) | 41CLASSIC ENGINE OILS JULY 2014.pdf | 2015-05-06 15:38 | 333K | |
![[ ]](/icons/layout.gif) | 42CLASSIC ENGINE OILS JULY 2014.pdf | 2015-05-06 15:40 | 333K | |
![[ ]](/icons/layout.gif) | 43CLASSIC ENGINE OILS JULY 2014.pdf | 2015-05-06 15:41 | 333K | |
![[ ]](/icons/layout.gif) | 44CLASSIC ENGINE OILS JULY 2014.pdf | 2015-05-06 15:44 | 333K | |
![[ ]](/icons/layout.gif) | 44 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL FEBRUARY 2014.pdf | 2014-03-05 16:30 | 395K | |
![[ ]](/icons/layout.gif) | 44 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL JULY 2013.pdf | 2013-08-07 16:32 | 397K | |
![[ ]](/icons/layout.gif) | 44 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-09-13 16:50 | 215K | |
![[ ]](/icons/layout.gif) | 45CLASSIC ENGINE OILS JULY 2014.pdf | 2015-05-06 15:44 | 333K | |
![[ ]](/icons/layout.gif) | 45 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL September 2012.pdf | 2012-09-17 16:58 | 196K | |
![[ ]](/icons/layout.gif) | 46CLASSIC ENGINE OILS JULY 2014.pdf | 2015-05-06 15:45 | 333K | |
![[ ]](/icons/layout.gif) | 46 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL JULY 2013.pdf | 2013-09-13 16:06 | 376K | |
![[ ]](/icons/layout.gif) | 47 YEAR 450,000KM BLUE COOLANT - FEBRUARY 2015.pdf | 2015-04-21 12:00 | 457K | |
![[ ]](/icons/layout.gif) | 47 YEAR 450,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-04-21 12:00 | 483K | |
![[ ]](/icons/layout.gif) | 48 YEAR 500,000KM RED COOLANT - FEBRUARY 2015.pdf | 2015-05-22 09:24 | 401K | |
![[ ]](/icons/layout.gif) | 54 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL FEBRUARY 2014.pdf | 2014-03-05 16:32 | 395K | |
![[ ]](/icons/layout.gif) | 54 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL JULY 2013.pdf | 2013-08-19 15:28 | 397K | |
![[ ]](/icons/layout.gif) | 54 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-09-13 16:52 | 215K | |
![[ ]](/icons/layout.gif) | 55 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL September 2012.pdf | 2012-09-18 11:07 | 196K | |
![[ ]](/icons/layout.gif) | 56 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL JULY 2013.pdf | 2013-09-13 16:08 | 376K | |
![[ ]](/icons/layout.gif) | 57 YEAR 450,000KM BLUE COOLANT - FEBRUARY 2015.pdf | 2015-06-22 10:31 | 457K | |
![[ ]](/icons/layout.gif) | 57 YEAR 450,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-06-22 10:15 | 483K | |
![[ ]](/icons/layout.gif) | 58 YEAR 500,000KM RED COOLANT - FEBRUARY 2015.pdf | 2015-06-22 10:09 | 402K | |
![[ ]](/icons/layout.gif) | 64 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL FEBRUARY 2014.pdf | 2014-03-05 16:33 | 395K | |
![[ ]](/icons/layout.gif) | 64 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL JULY 2013.pdf | 2013-08-19 15:28 | 397K | |
![[ ]](/icons/layout.gif) | 64 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-09-13 16:52 | 215K | |
![[ ]](/icons/layout.gif) | 65 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL September 2012.pdf | 2012-09-18 11:08 | 196K | |
![[ ]](/icons/layout.gif) | 66 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL JULY 2013.pdf | 2013-09-13 16:15 | 376K | |
![[ ]](/icons/layout.gif) | 67 YEAR 450,000KM BLUE COOLANT - FEBRUARY 2015.pdf | 2015-06-22 10:31 | 457K | |
![[ ]](/icons/layout.gif) | 67 YEAR 450,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-06-22 10:15 | 483K | |
![[ ]](/icons/layout.gif) | 68 YEAR 500,000KM RED COOLANT - FEBRUARY 2015.pdf | 2015-06-22 10:09 | 402K | |
![[ ]](/icons/layout.gif) | 74 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL JULY 2013.pdf | 2013-08-19 15:29 | 397K | |
![[ ]](/icons/layout.gif) | 74 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-09-17 16:57 | 215K | |
![[ ]](/icons/layout.gif) | 75 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL September 2012.pdf | 2012-09-18 11:09 | 196K | |
![[ ]](/icons/layout.gif) | 76 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL JULY 2013.pdf | 2013-10-22 17:35 | 376K | |
![[ ]](/icons/layout.gif) | 77 YEAR 450,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-06-22 10:43 | 483K | |
![[ ]](/icons/layout.gif) | 78 YEAR 500,000KM RED COOLANT - FEBRUARY 2015.pdf | 2015-06-22 10:42 | 402K | |
![[ ]](/icons/layout.gif) | 84 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL JULY 2013.pdf | 2013-08-19 15:29 | 397K | |
![[ ]](/icons/layout.gif) | 84 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-09-17 16:57 | 215K | |
![[ ]](/icons/layout.gif) | 85 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL September 2012.pdf | 2012-09-18 11:09 | 196K | |
![[ ]](/icons/layout.gif) | 86 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL JULY 2013.pdf | 2013-10-22 17:35 | 376K | |
![[ ]](/icons/layout.gif) | 87 YEAR 450,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-06-22 10:44 | 483K | |
![[ ]](/icons/layout.gif) | 88 YEAR 500,000KM RED COOLANT - FEBRUARY 2015.pdf | 2015-06-22 10:43 | 402K | |
![[ ]](/icons/layout.gif) | 94 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-09-18 11:08 | 215K | |
![[ ]](/icons/layout.gif) | 95 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL September 2012.pdf | 2012-09-20 15:14 | 196K | |
![[ ]](/icons/layout.gif) | 96 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL JULY 2013.pdf | 2013-10-22 17:36 | 376K | |
![[ ]](/icons/layout.gif) | 104 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-09-18 11:09 | 215K | |
![[ ]](/icons/layout.gif) | 105 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL September 2012.pdf | 2012-09-20 15:14 | 196K | |
![[ ]](/icons/layout.gif) | 106 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL JULY 2013.pdf | 2013-10-22 17:36 | 376K | |
![[ ]](/icons/layout.gif) | 110 TENTHS CHAIN CLEANER AEROSOL DECEMBER 2015.pdf | 2016-01-15 10:22 | 239K | |
![[ ]](/icons/layout.gif) | 110 TENTHS PREMIUM 0 APRIL 2014.pdf | 2014-04-04 08:51 | 256K | |
![[ ]](/icons/layout.gif) | 110 TENTHS PREMIUM 0 JUNE 2013.pdf | 2013-06-06 10:44 | 308K | |
![[ ]](/icons/layout.gif) | 110 TENTHS PREMIUM 0 Nov 2012.pdf | 2012-11-16 11:48 | 217K | |
![[ ]](/icons/layout.gif) | 110 TENTHS PREMIUM 0 SEPTEMBER 2013.pdf | 2013-09-20 16:56 | 259K | |
![[ ]](/icons/layout.gif) | 110 TENTHS PREMIUM 0 SEPTEMBER 2014.pdf | 2015-01-27 15:30 | 235K | |
![[ ]](/icons/layout.gif) | 110 TENTHS PREMIUM 5 APRIL 2014.pdf | 2014-06-20 08:41 | 257K | |
![[ ]](/icons/layout.gif) | 110 TENTHS PREMIUM 5 JUNE 2013.pdf | 2013-06-13 09:26 | 261K | |
![[ ]](/icons/layout.gif) | 110 TENTHS PREMIUM 5 SEPTEMBER 2013.pdf | 2013-12-12 17:03 | 259K | |
![[ ]](/icons/layout.gif) | 110 TENTHS PREMIUM 5 SEPTEMBER 2014.pdf | 2015-02-26 12:57 | 234K | |
![[ ]](/icons/layout.gif) | 110 TENTHS PREMIUM 10 APRIL 2014.pdf | 2014-04-04 09:00 | 259K | |
![[ ]](/icons/layout.gif) | 110 TENTHS PREMIUM 10 AUG 2012.pdf | 2012-10-22 12:24 | 234K | |
![[ ]](/icons/layout.gif) | 110 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-06-06 10:48 | 309K | |
![[ ]](/icons/layout.gif) | 110 TENTHS PREMIUM 10 Nov 2012.pdf | 2012-11-16 11:52 | 216K | |
![[ ]](/icons/layout.gif) | 110 TENTHS PREMIUM 10 SEPTEMBER 2013.pdf | 2013-09-20 17:00 | 260K | |
![[ ]](/icons/layout.gif) | 110 TENTHS PREMIUM 10 SEPTEMBER 2014.pdf | 2014-11-11 11:34 | 233K | |
![[ ]](/icons/layout.gif) | 110 TENTHS PREMIUM FULL SYNTHETIC OILS OCT 2011.pdf | 2011-12-15 20:50 | 214K | |
![[ ]](/icons/layout.gif) | 110 TENTHS PREMIUM OILS FEB 2012.pdf | 2012-02-14 09:59 | 214K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACE CASTOR OIL DECEMBER 2013.pdf | 2013-12-16 14:13 | 227K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACE CASTOR OIL JUNE 2014.pdf | 2014-06-02 13:19 | 228K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACE CASTOR OIL OCTOBER 2014.pdf | 2014-10-10 10:45 | 230K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACE CASTOR OIL SEPTEMBER 2013.pdf | 2013-09-19 12:05 | 227K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACE COOLANT INHIBITOR MAY 2015.pdf | 2015-05-06 12:08 | 239K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACE COOLANT INHIBITOR NOVEMBER 2013.pdf | 2013-12-11 17:19 | 218K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING 5W-30 DECEMBER 2015.pdf | 2015-12-08 12:09 | 409K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING 10W-40 DECEMBER 2015.pdf | 2015-12-08 12:10 | 368K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING OIL 0 JUNE 2013.pdf | 2013-06-12 09:06 | 245K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING OIL 0 Nov 2012.pdf | 2012-11-16 10:22 | 249K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING OIL 0 SEPTEMBER 2013.pdf | 2014-02-24 17:16 | 258K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING OIL 5 AUG 2012.pdf | 2012-08-17 14:47 | 250K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING OIL 5 JUNE 2013.pdf | 2013-06-12 08:56 | 251K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING OIL 5 SEPTEMBER 2013.pdf | 2014-02-24 17:16 | 260K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING OIL 10 AUG 2012.pdf | 2012-10-22 12:33 | 252K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING OIL 10 JULY 2014.pdf | 2014-07-18 12:03 | 431K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING OIL 10 JUNE 2013.pdf | 2013-06-12 08:59 | 305K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING OIL 10 SEPTEMBER 2013.pdf | 2013-09-20 16:22 | 258K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING OIL 15 JULY 2014.pdf | 2014-07-18 12:03 | 452K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING OIL 15 JUNE 2013.pdf | 2013-06-12 09:02 | 300K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING OIL 15 SEPTEMBER 2013.pdf | 2013-12-12 16:59 | 279K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING OIL 20 JULY 2014.pdf | 2014-07-18 12:04 | 448K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING OIL 20 JUNE 2013.pdf | 2013-06-12 09:04 | 234K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING OIL 20 SEPTEMBER 2013.pdf | 2013-12-03 10:57 | 279K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING OILS FEB 2012.pdf | 2012-02-14 09:57 | 245K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RACING OILS NOV 2011.pdf | 2011-12-15 20:50 | 241K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RUNNING IN OIL APRIL 2014.pdf | 2014-04-04 08:38 | 169K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RUNNING IN OIL JUNE 2013.pdf | 2013-06-17 17:39 | 175K | |
![[ ]](/icons/layout.gif) | 110 TENTHS RUNNING IN OIL OCTOBER 2014.pdf | 2014-10-08 11:19 | 178K | |
![[ ]](/icons/layout.gif) | 114 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-09-18 11:10 | 215K | |
![[ ]](/icons/layout.gif) | 115 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL September 2012.pdf | 2012-09-20 16:23 | 196K | |
![[ ]](/icons/layout.gif) | 124 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-09-20 14:03 | 215K | |
![[ ]](/icons/layout.gif) | 125 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL September 2012.pdf | 2012-09-20 16:23 | 196K | |
![[ ]](/icons/layout.gif) | 134 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-09-20 14:03 | 215K | |
![[ ]](/icons/layout.gif) | 135 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL September 2012.pdf | 2012-11-01 16:56 | 196K | |
![[ ]](/icons/layout.gif) | 144 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-09-20 17:01 | 215K | |
![[ ]](/icons/layout.gif) | 145 YEAR EXTENDED DRAIN ANTI FREEZE ANTI BOIL September 2012.pdf | 2012-11-01 16:57 | 196K | |
![[ ]](/icons/layout.gif) | 154 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-09-20 17:01 | 215K | |
![[ ]](/icons/layout.gif) | 164 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-11-01 16:56 | 215K | |
![[ ]](/icons/layout.gif) | 174 YEAR LONG DRAIN ANTIFREEZE ANTI BOIL September 2012.pdf | 2012-11-01 16:56 | 215K | |
![[ ]](/icons/layout.gif) | 210 TENTHS PREMIUM 0 JUNE 2013.pdf | 2013-06-13 09:25 | 260K | |
![[ ]](/icons/layout.gif) | 210 TENTHS PREMIUM 0 SEPTEMBER 2013.pdf | 2013-12-12 17:02 | 259K | |
![[ ]](/icons/layout.gif) | 210 TENTHS PREMIUM 0 SEPTEMBER 2014.pdf | 2015-02-26 12:56 | 235K | |
![[ ]](/icons/layout.gif) | 210 TENTHS PREMIUM 5 APRIL 2014.pdf | 2014-06-20 08:41 | 257K | |
![[ ]](/icons/layout.gif) | 210 TENTHS PREMIUM 5 JUNE 2013.pdf | 2013-06-13 11:02 | 260K | |
![[ ]](/icons/layout.gif) | 210 TENTHS PREMIUM 5 SEPTEMBER 2013.pdf | 2013-12-13 08:29 | 259K | |
![[ ]](/icons/layout.gif) | 210 TENTHS PREMIUM 10 APRIL 2014.pdf | 2014-06-20 08:54 | 259K | |
![[ ]](/icons/layout.gif) | 210 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-06-13 09:40 | 261K | |
![[ ]](/icons/layout.gif) | 210 TENTHS PREMIUM 10 Nov 2012.pdf | 2012-11-16 11:57 | 216K | |
![[ ]](/icons/layout.gif) | 210 TENTHS PREMIUM 10 SEPTEMBER 2013.pdf | 2013-12-12 17:04 | 260K | |
![[ ]](/icons/layout.gif) | 210 TENTHS PREMIUM 10 SEPTEMBER 2014.pdf | 2014-11-11 11:34 | 233K | |
![[ ]](/icons/layout.gif) | 210 TENTHS PREMIUM FULL SYNTHETIC OILS OCT 2011.pdf | 2011-12-23 12:07 | 214K | |
![[ ]](/icons/layout.gif) | 210 TENTHS RACE CASTOR OIL DECEMBER 2013.pdf | 2013-12-16 14:15 | 227K | |
![[ ]](/icons/layout.gif) | 210 TENTHS RACE CASTOR OIL JUNE 2014.pdf | 2014-06-02 13:22 | 228K | |
![[ ]](/icons/layout.gif) | 210 TENTHS RACE CASTOR OIL OCTOBER 2014.pdf | 2014-10-10 10:46 | 230K | |
![[ ]](/icons/layout.gif) | 210 TENTHS RACE CASTOR OIL SEPTEMBER 2013.pdf | 2013-12-02 16:38 | 228K | |
![[ ]](/icons/layout.gif) | 210 TENTHS RACE COOLANT INHIBITOR MAY 2015.pdf | 2015-06-22 11:33 | 239K | |
![[ ]](/icons/layout.gif) | 210 TENTHS RACING OIL 0 JUNE 2013.pdf | 2013-06-13 09:23 | 194K | |
![[ ]](/icons/layout.gif) | 210 TENTHS RACING OIL 5 JUNE 2013.pdf | 2013-06-12 09:07 | 250K | |
![[ ]](/icons/layout.gif) | 210 TENTHS RACING OIL 10 JULY 2014.pdf | 2014-07-18 12:04 | 431K | |
![[ ]](/icons/layout.gif) | 210 TENTHS RACING OIL 10 JUNE 2013.pdf | 2013-06-13 09:24 | 257K | |
![[ ]](/icons/layout.gif) | 210 TENTHS RACING OIL 10 SEPTEMBER 2013.pdf | 2013-09-20 16:23 | 258K | |
![[ ]](/icons/layout.gif) | 210 TENTHS RACING OIL 15 JULY 2014.pdf | 2014-07-18 12:05 | 452K | |
![[ ]](/icons/layout.gif) | 210 TENTHS RACING OIL 15 JUNE 2013.pdf | 2013-06-13 09:24 | 287K | |
![[ ]](/icons/layout.gif) | 210 TENTHS RACING OIL 15 SEPTEMBER 2013.pdf | 2014-02-11 08:44 | 279K | |
![[ ]](/icons/layout.gif) | 210 TENTHS RACING OIL 20 JULY 2014.pdf | 2014-07-18 12:05 | 448K | |
![[ ]](/icons/layout.gif) | 210 TENTHS RACING OIL 20 JUNE 2013.pdf | 2013-06-13 09:24 | 221K | |
![[ ]](/icons/layout.gif) | 210 TENTHS RACING OIL 20 SEPTEMBER 2013.pdf | 2013-12-03 10:57 | 279K | |
![[ ]](/icons/layout.gif) | 210 TENTHS RACING OILS FEB 2012.pdf | 2012-02-14 09:57 | 245K | |
![[ ]](/icons/layout.gif) | 210 TENTHS RACING OILS NOV 2011.pdf | 2011-12-15 20:50 | 241K | |
![[ ]](/icons/layout.gif) | 310 TENTHS PREMIUM 0 JUNE 2013.pdf | 2013-06-13 11:02 | 260K | |
![[ ]](/icons/layout.gif) | 310 TENTHS PREMIUM 0 SEPTEMBER 2013.pdf | 2013-12-12 17:07 | 259K | |
![[ ]](/icons/layout.gif) | 310 TENTHS PREMIUM 5 JUNE 2013.pdf | 2013-06-17 15:01 | 261K | |
![[ ]](/icons/layout.gif) | 310 TENTHS PREMIUM 5 SEPTEMBER 2013.pdf | 2014-02-24 17:18 | 259K | |
![[ ]](/icons/layout.gif) | 310 TENTHS PREMIUM 10 APRIL 2014.pdf | 2014-06-20 08:54 | 259K | |
![[ ]](/icons/layout.gif) | 310 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-06-13 11:02 | 261K | |
![[ ]](/icons/layout.gif) | 310 TENTHS PREMIUM 10 SEPTEMBER 2013.pdf | 2013-12-12 17:10 | 260K | |
![[ ]](/icons/layout.gif) | 310 TENTHS PREMIUM 10 SEPTEMBER 2014.pdf | 2015-02-26 12:59 | 233K | |
![[ ]](/icons/layout.gif) | 310 TENTHS RACE CASTOR OIL DECEMBER 2013.pdf | 2013-12-16 14:21 | 227K | |
![[ ]](/icons/layout.gif) | 310 TENTHS RACE CASTOR OIL JUNE 2014.pdf | 2014-06-02 13:23 | 228K | |
![[ ]](/icons/layout.gif) | 310 TENTHS RACE CASTOR OIL OCTOBER 2014.pdf | 2014-10-10 10:47 | 230K | |
![[ ]](/icons/layout.gif) | 310 TENTHS RACE CASTOR OIL SEPTEMBER 2013.pdf | 2013-12-03 16:54 | 225K | |
![[ ]](/icons/layout.gif) | 310 TENTHS RACING OIL 0 JUNE 2013.pdf | 2013-06-13 11:01 | 193K | |
![[ ]](/icons/layout.gif) | 310 TENTHS RACING OIL 5 JUNE 2013.pdf | 2013-06-13 09:23 | 198K | |
![[ ]](/icons/layout.gif) | 310 TENTHS RACING OIL 10 JUNE 2013.pdf | 2013-06-13 11:01 | 257K | |
![[ ]](/icons/layout.gif) | 310 TENTHS RACING OIL 10 SEPTEMBER 2013.pdf | 2013-12-12 16:58 | 258K | |
![[ ]](/icons/layout.gif) | 310 TENTHS RACING OIL 15 JUNE 2013.pdf | 2013-06-13 11:01 | 286K | |
![[ ]](/icons/layout.gif) | 310 TENTHS RACING OIL 15 SEPTEMBER 2013.pdf | 2014-02-24 17:17 | 279K | |
![[ ]](/icons/layout.gif) | 310 TENTHS RACING OIL 20 JUNE 2013.pdf | 2013-06-13 11:02 | 219K | |
![[ ]](/icons/layout.gif) | 310 TENTHS RACING OIL 20 SEPTEMBER 2013.pdf | 2013-12-12 17:00 | 280K | |
![[ ]](/icons/layout.gif) | 310 TENTHS RACING OILS FEB 2012.pdf | 2012-02-14 09:58 | 245K | |
![[ ]](/icons/layout.gif) | 310 TENTHS RACING OILS NOV 2011.pdf | 2011-12-15 20:50 | 241K | |
![[ ]](/icons/layout.gif) | 350,000KM GREEN COOLANT - AUGUST 2016.pdf | 2016-08-15 14:53 | 437K | |
![[ ]](/icons/layout.gif) | 350,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-03-19 17:17 | 356K | |
![[ ]](/icons/layout.gif) | 350,000KM GREEN COOLANT - SEPTEMBER 2016.pdf | 2016-08-19 09:16 | 437K | |
![[ ]](/icons/layout.gif) | 410 TENTHS PREMIUM 0 JUNE 2013.pdf | 2013-06-17 14:54 | 261K | |
![[ ]](/icons/layout.gif) | 410 TENTHS PREMIUM 0 SEPTEMBER 2013.pdf | 2013-12-13 08:28 | 259K | |
![[ ]](/icons/layout.gif) | 410 TENTHS PREMIUM 5 JUNE 2013.pdf | 2013-06-17 15:01 | 261K | |
![[ ]](/icons/layout.gif) | 410 TENTHS PREMIUM 5 SEPTEMBER 2013.pdf | 2014-02-24 17:21 | 259K | |
![[ ]](/icons/layout.gif) | 410 TENTHS PREMIUM 10 APRIL 2014.pdf | 2014-06-20 08:54 | 259K | |
![[ ]](/icons/layout.gif) | 410 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-06-17 15:02 | 262K | |
![[ ]](/icons/layout.gif) | 410 TENTHS PREMIUM 10 SEPTEMBER 2013.pdf | 2013-12-13 08:29 | 260K | |
![[ ]](/icons/layout.gif) | 410 TENTHS RACE CASTOR OIL DECEMBER 2013.pdf | 2013-12-16 15:11 | 227K | |
![[ ]](/icons/layout.gif) | 410 TENTHS RACE CASTOR OIL JUNE 2014.pdf | 2014-06-02 13:23 | 228K | |
![[ ]](/icons/layout.gif) | 410 TENTHS RACE CASTOR OIL OCTOBER 2014.pdf | 2014-10-10 10:51 | 230K | |
![[ ]](/icons/layout.gif) | 410 TENTHS RACE CASTOR OIL SEPTEMBER 2013.pdf | 2013-12-03 16:54 | 225K | |
![[ ]](/icons/layout.gif) | 410 TENTHS RACING OIL 0 JUNE 2013.pdf | 2013-06-17 17:01 | 204K | |
![[ ]](/icons/layout.gif) | 410 TENTHS RACING OIL 5 JUNE 2013.pdf | 2013-06-13 11:01 | 197K | |
![[ ]](/icons/layout.gif) | 410 TENTHS RACING OIL 10 JUNE 2013.pdf | 2013-06-17 17:02 | 260K | |
![[ ]](/icons/layout.gif) | 410 TENTHS RACING OIL 10 SEPTEMBER 2013.pdf | 2013-12-13 08:26 | 258K | |
![[ ]](/icons/layout.gif) | 410 TENTHS RACING OIL 15 JUNE 2013.pdf | 2013-06-17 17:03 | 289K | |
![[ ]](/icons/layout.gif) | 410 TENTHS RACING OIL 15 SEPTEMBER 2013.pdf | 2014-02-24 17:22 | 279K | |
![[ ]](/icons/layout.gif) | 410 TENTHS RACING OIL 20 JUNE 2013.pdf | 2013-06-17 17:04 | 284K | |
![[ ]](/icons/layout.gif) | 410 TENTHS RACING OIL 20 SEPTEMBER 2013.pdf | 2013-12-13 08:27 | 280K | |
![[ ]](/icons/layout.gif) | 410 TENTHS RACING OILS NOV 2011.pdf | 2011-12-07 10:39 | 241K | |
![[ ]](/icons/layout.gif) | 510 TENTHS PREMIUM 0 JUNE 2013.pdf | 2013-06-17 14:54 | 261K | |
![[ ]](/icons/layout.gif) | 510 TENTHS PREMIUM 0 SEPTEMBER 2013.pdf | 2014-02-24 17:18 | 259K | |
![[ ]](/icons/layout.gif) | 510 TENTHS PREMIUM 5 JUNE 2013.pdf | 2013-06-17 15:01 | 261K | |
![[ ]](/icons/layout.gif) | 510 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-06-17 15:02 | 262K | |
![[ ]](/icons/layout.gif) | 510 TENTHS PREMIUM 10 SEPTEMBER 2013.pdf | 2014-02-18 10:48 | 260K | |
![[ ]](/icons/layout.gif) | 510 TENTHS RACING OIL 0 JUNE 2013.pdf | 2013-06-24 12:35 | 266K | |
![[ ]](/icons/layout.gif) | 510 TENTHS RACING OIL 5 JUNE 2013.pdf | 2013-06-17 17:01 | 200K | |
![[ ]](/icons/layout.gif) | 510 TENTHS RACING OIL 10 JUNE 2013.pdf | 2013-06-17 17:03 | 260K | |
![[ ]](/icons/layout.gif) | 510 TENTHS RACING OIL 10 SEPTEMBER 2013.pdf | 2013-12-13 08:27 | 258K | |
![[ ]](/icons/layout.gif) | 510 TENTHS RACING OIL 15 JUNE 2013.pdf | 2013-06-17 17:04 | 289K | |
![[ ]](/icons/layout.gif) | 510 TENTHS RACING OIL 20 JUNE 2013.pdf | 2013-06-17 17:04 | 284K | |
![[ ]](/icons/layout.gif) | 510 TENTHS RACING OIL 20 SEPTEMBER 2013.pdf | 2014-02-24 17:18 | 280K | |
![[ ]](/icons/layout.gif) | 510 TENTHS RACING OILS NOV 2011.pdf | 2011-12-07 10:40 | 241K | |
![[ ]](/icons/layout.gif) | 610 TENTHS PREMIUM 0 JUNE 2013.pdf | 2013-06-17 15:00 | 261K | |
![[ ]](/icons/layout.gif) | 610 TENTHS PREMIUM 0 SEPTEMBER 2013.pdf | 2014-02-24 17:19 | 259K | |
![[ ]](/icons/layout.gif) | 610 TENTHS PREMIUM 5 JUNE 2013.pdf | 2013-06-17 17:00 | 260K | |
![[ ]](/icons/layout.gif) | 610 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-06-17 17:00 | 267K | |
![[ ]](/icons/layout.gif) | 610 TENTHS PREMIUM 10 SEPTEMBER 2013.pdf | 2014-02-18 10:48 | 260K | |
![[ ]](/icons/layout.gif) | 610 TENTHS RACING OIL 0 JUNE 2013.pdf | 2013-07-05 15:18 | 266K | |
![[ ]](/icons/layout.gif) | 610 TENTHS RACING OIL 5 JUNE 2013.pdf | 2013-06-24 12:35 | 262K | |
![[ ]](/icons/layout.gif) | 610 TENTHS RACING OIL 10 JUNE 2013.pdf | 2013-06-24 12:35 | 259K | |
![[ ]](/icons/layout.gif) | 610 TENTHS RACING OIL 10 SEPTEMBER 2013.pdf | 2014-02-11 08:44 | 258K | |
![[ ]](/icons/layout.gif) | 610 TENTHS RACING OIL 15 JUNE 2013.pdf | 2013-06-24 12:36 | 289K | |
![[ ]](/icons/layout.gif) | 610 TENTHS RACING OIL 20 JUNE 2013.pdf | 2013-06-24 12:36 | 285K | |
![[ ]](/icons/layout.gif) | 610 TENTHS RACING OIL 20 SEPTEMBER 2013.pdf | 2014-02-24 17:22 | 280K | |
![[ ]](/icons/layout.gif) | 610 TENTHS RACING OILS NOV 2011.pdf | 2011-12-22 08:46 | 241K | |
![[ ]](/icons/layout.gif) | 710 TENTHS PREMIUM 0 JUNE 2013.pdf | 2013-06-17 16:59 | 261K | |
![[ ]](/icons/layout.gif) | 710 TENTHS PREMIUM 0 SEPTEMBER 2013.pdf | 2014-02-24 17:20 | 259K | |
![[ ]](/icons/layout.gif) | 710 TENTHS PREMIUM 5 JUNE 2013.pdf | 2013-06-17 17:00 | 260K | |
![[ ]](/icons/layout.gif) | 710 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-06-17 17:01 | 267K | |
![[ ]](/icons/layout.gif) | 710 TENTHS PREMIUM 10 SEPTEMBER 2013.pdf | 2014-02-18 10:49 | 260K | |
![[ ]](/icons/layout.gif) | 710 TENTHS RACING OIL 0 JUNE 2013.pdf | 2013-07-05 15:46 | 266K | |
![[ ]](/icons/layout.gif) | 710 TENTHS RACING OIL 5 JUNE 2013.pdf | 2013-07-05 15:46 | 262K | |
![[ ]](/icons/layout.gif) | 710 TENTHS RACING OIL 10 JUNE 2013.pdf | 2013-06-24 12:43 | 259K | |
![[ ]](/icons/layout.gif) | 710 TENTHS RACING OIL 10 SEPTEMBER 2013.pdf | 2014-02-24 17:17 | 258K | |
![[ ]](/icons/layout.gif) | 710 TENTHS RACING OIL 15 JUNE 2013.pdf | 2013-06-24 12:44 | 289K | |
![[ ]](/icons/layout.gif) | 710 TENTHS RACING OIL 20 JUNE 2013.pdf | 2013-06-24 12:44 | 285K | |
![[ ]](/icons/layout.gif) | 710 TENTHS RACING OILS NOV 2011.pdf | 2011-12-22 08:47 | 241K | |
![[ ]](/icons/layout.gif) | 810 TENTHS PREMIUM 0 JUNE 2013.pdf | 2013-06-17 16:59 | 261K | |
![[ ]](/icons/layout.gif) | 810 TENTHS PREMIUM 5 JUNE 2013.pdf | 2013-06-24 12:36 | 261K | |
![[ ]](/icons/layout.gif) | 810 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-06-17 17:14 | 266K | |
![[ ]](/icons/layout.gif) | 810 TENTHS PREMIUM 10 SEPTEMBER 2013.pdf | 2014-02-24 17:19 | 260K | |
![[ ]](/icons/layout.gif) | 810 TENTHS RACING OIL 10 JUNE 2013.pdf | 2013-06-25 10:30 | 259K | |
![[ ]](/icons/layout.gif) | 810 TENTHS RACING OIL 10 SEPTEMBER 2013.pdf | 2014-02-24 17:21 | 258K | |
![[ ]](/icons/layout.gif) | 810 TENTHS RACING OIL 15 JUNE 2013.pdf | 2013-07-05 15:47 | 289K | |
![[ ]](/icons/layout.gif) | 810 TENTHS RACING OIL 20 JUNE 2013.pdf | 2013-07-01 09:17 | 284K | |
![[ ]](/icons/layout.gif) | 910 TENTHS PREMIUM 0 JUNE 2013.pdf | 2013-06-24 12:36 | 261K | |
![[ ]](/icons/layout.gif) | 910 TENTHS PREMIUM 5 JUNE 2013.pdf | 2013-06-24 12:43 | 261K | |
![[ ]](/icons/layout.gif) | 910 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-06-17 17:14 | 266K | |
![[ ]](/icons/layout.gif) | 910 TENTHS PREMIUM 10 SEPTEMBER 2013.pdf | 2014-02-24 17:20 | 260K | |
![[ ]](/icons/layout.gif) | 910 TENTHS RACING OIL 10 JUNE 2013.pdf | 2013-06-25 10:31 | 259K | |
![[ ]](/icons/layout.gif) | 910 TENTHS RACING OIL 15 JUNE 2013.pdf | 2013-07-05 15:52 | 289K | |
![[ ]](/icons/layout.gif) | 910 TENTHS RACING OIL 20 JUNE 2013.pdf | 2013-07-01 09:18 | 284K | |
![[ ]](/icons/layout.gif) | 1010 TENTHS PREMIUM 0 JUNE 2013.pdf | 2013-06-24 12:37 | 261K | |
![[ ]](/icons/layout.gif) | 1010 TENTHS PREMIUM 5 JUNE 2013.pdf | 2013-06-24 15:47 | 261K | |
![[ ]](/icons/layout.gif) | 1010 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-06-24 12:37 | 267K | |
![[ ]](/icons/layout.gif) | 1010 TENTHS PREMIUM 10 SEPTEMBER 2013.pdf | 2014-02-24 17:21 | 260K | |
![[ ]](/icons/layout.gif) | 1010 TENTHS RACING OIL 10 JUNE 2013.pdf | 2013-07-05 15:46 | 259K | |
![[ ]](/icons/layout.gif) | 1010 TENTHS RACING OIL 20 JUNE 2013.pdf | 2013-07-02 09:35 | 284K | |
![[ ]](/icons/layout.gif) | 1110 TENTHS PREMIUM 0 JUNE 2013.pdf | 2013-06-24 12:42 | 261K | |
![[ ]](/icons/layout.gif) | 1110 TENTHS PREMIUM 5 JUNE 2013.pdf | 2013-06-24 15:48 | 261K | |
![[ ]](/icons/layout.gif) | 1110 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-06-24 12:38 | 267K | |
![[ ]](/icons/layout.gif) | 1110 TENTHS RACING OIL 10 JUNE 2013.pdf | 2013-07-05 15:50 | 259K | |
![[ ]](/icons/layout.gif) | 1110 TENTHS RACING OIL 20 JUNE 2013.pdf | 2013-07-02 09:36 | 284K | |
![[ ]](/icons/layout.gif) | 1210 TENTHS PREMIUM 0 JUNE 2013.pdf | 2013-06-24 15:47 | 261K | |
![[ ]](/icons/layout.gif) | 1210 TENTHS PREMIUM 5 JUNE 2013.pdf | 2013-07-05 15:19 | 261K | |
![[ ]](/icons/layout.gif) | 1210 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-06-24 12:43 | 267K | |
![[ ]](/icons/layout.gif) | 1210 TENTHS RACING OIL 10 JUNE 2013.pdf | 2013-07-05 15:52 | 259K | |
![[ ]](/icons/layout.gif) | 1210 TENTHS RACING OIL 20 JUNE 2013.pdf | 2013-07-05 15:46 | 285K | |
![[ ]](/icons/layout.gif) | 1310 TENTHS PREMIUM 0 JUNE 2013.pdf | 2013-06-24 15:48 | 261K | |
![[ ]](/icons/layout.gif) | 1310 TENTHS PREMIUM 5 JUNE 2013.pdf | 2013-07-05 15:20 | 261K | |
![[ ]](/icons/layout.gif) | 1310 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-06-24 15:48 | 267K | |
![[ ]](/icons/layout.gif) | 1310 TENTHS RACING OIL 20 JUNE 2013.pdf | 2013-07-05 15:53 | 285K | |
![[ ]](/icons/layout.gif) | 1350,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-04-14 16:37 | 475K | |
![[ ]](/icons/layout.gif) | 1410 TENTHS PREMIUM 0 JUNE 2013.pdf | 2013-06-24 15:49 | 261K | |
![[ ]](/icons/layout.gif) | 1410 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-06-24 15:49 | 267K | |
![[ ]](/icons/layout.gif) | 1510 TENTHS PREMIUM 0 JUNE 2013.pdf | 2013-07-05 15:13 | 262K | |
![[ ]](/icons/layout.gif) | 1510 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-06-24 15:50 | 267K | |
![[ ]](/icons/layout.gif) | 1610 TENTHS PREMIUM 0 JUNE 2013.pdf | 2013-07-05 15:19 | 262K | |
![[ ]](/icons/layout.gif) | 1610 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-06-24 15:50 | 267K | |
![[ ]](/icons/layout.gif) | 1710 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-07-05 15:20 | 268K | |
![[ ]](/icons/layout.gif) | 1810 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-07-05 15:21 | 268K | |
![[ ]](/icons/layout.gif) | 1910 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-07-05 15:21 | 268K | |
![[ ]](/icons/layout.gif) | 2010 TENTHS PREMIUM 10 JUNE 2013.pdf | 2013-07-05 15:21 | 268K | |
![[ ]](/icons/layout.gif) | 2350,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-04-14 16:39 | 475K | |
![[ ]](/icons/layout.gif) | 3350,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-06-22 10:58 | 475K | |
![[ ]](/icons/layout.gif) | 4350,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-06-22 10:59 | 475K | |
![[ ]](/icons/layout.gif) | 5350,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-07-20 17:21 | 475K | |
![[ ]](/icons/layout.gif) | 6350,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-07-20 17:23 | 475K | |
![[ ]](/icons/layout.gif) | 7350,000KM GREEN COOLANT - FEBRUARY 2015.pdf | 2015-07-20 17:29 | 475K | |
![[ ]](/icons/layout.gif) | ACT GREASE XEP2 AUGUST 2014.pdf | 2014-08-19 12:39 | 293K | |
![[ ]](/icons/layout.gif) | ACT GREASE XEP2 December 2012.pdf | 2012-12-10 14:11 | 204K | |
![[ ]](/icons/layout.gif) | ANTI FREEZE ANTI BOIL PREMIX BLUE April 2013.pdf | 2013-04-15 16:46 | 204K | |
![[ ]](/icons/layout.gif) | ANTI FREEZE ANTI BOIL PREMIX BLUE NOVEMBER 2013.pdf | 2013-11-15 16:25 | 220K | |
![[ ]](/icons/layout.gif) | ANTI FREEZE ANTI BOIL PREMIX BLUE SEPTEMBER 2013.pdf | 2013-09-27 11:50 | 219K | |
![[ ]](/icons/layout.gif) | ATF 33.pdf | 2011-12-15 20:50 | 66K | |
![[ ]](/icons/layout.gif) | ATF 33 August 2012.pdf | 2012-08-20 17:23 | 201K | |
![[ ]](/icons/layout.gif) | ATF 33 DECEMBER 2014.pdf | 2014-12-05 13:27 | 221K | |
![[ ]](/icons/layout.gif) | ATF 33 JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | ATF 33 JULY 2014.pdf | 2014-08-01 15:53 | 235K | |
![[ ]](/icons/layout.gif) | ATF 33 JUNE 2012.pdf | 2012-07-19 17:05 | 202K | |
![[ ]](/icons/layout.gif) | ATF 33 JUNE 2013.pdf | 2013-07-05 10:55 | 225K | |
![[ ]](/icons/layout.gif) | ATF 33 JUNE 2015.pdf | 2015-06-22 15:41 | 298K | |
![[ ]](/icons/layout.gif) | ATF 33 MARCH 2014.pdf | 2014-03-03 10:31 | 233K | |
![[ ]](/icons/layout.gif) | ATF 33 MARCH 2015.pdf | 2015-03-27 16:35 | 267K | |
![[ ]](/icons/layout.gif) | ATF 33 Oct 2011.pdf | 2011-12-15 20:50 | 146K | |
![[ ]](/icons/layout.gif) | ATF 95LE.pdf | 2011-12-15 20:50 | 75K | |
![[ ]](/icons/layout.gif) | ATF 95LE JAN 2010.pdf | 2011-12-15 20:50 | 198K | |
![[ ]](/icons/layout.gif) | ATF 95 LE REV 3 0 0710.pdf | 2011-12-15 20:50 | 84K | |
![[ ]](/icons/layout.gif) | ATF BMV.pdf | 2011-12-15 20:50 | 72K | |
![[ ]](/icons/layout.gif) | ATF BMV JUNE 2013.pdf | 2013-07-02 11:54 | 268K | |
![[ ]](/icons/layout.gif) | ATF BMV NOVEMBER 2014.pdf | 2014-11-10 14:34 | 284K | |
![[ ]](/icons/layout.gif) | ATF BMV Oct 2011.pdf | 2011-12-15 20:50 | 158K | |
![[ ]](/icons/layout.gif) | ATF DX-II.pdf | 2011-12-15 20:50 | 70K | |
![[ ]](/icons/layout.gif) | ATF DX-III.pdf | 2011-12-15 20:50 | 72K | |
![[ ]](/icons/layout.gif) | ATF DX-III JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | ATF DX-III JAN 2011.pdf | 2011-12-15 20:50 | 204K | |
![[ ]](/icons/layout.gif) | ATF DX-III JULY 2014.pdf | 2014-08-01 15:37 | 257K | |
![[ ]](/icons/layout.gif) | ATF DX-III JUNE 2013.pdf | 2013-07-05 10:54 | 244K | |
![[ ]](/icons/layout.gif) | ATF DX-III JUNE 2015.pdf | 2016-10-07 16:04 | 256K | |
![[ ]](/icons/layout.gif) | ATF DX-III June 2012.pdf | 2012-07-19 17:04 | 208K | |
![[ ]](/icons/layout.gif) | ATF DX-III MARCH 2015.pdf | 2015-03-24 12:11 | 257K | |
![[ ]](/icons/layout.gif) | ATF DX-III MINERAL MULTI-VEHICLE AUTO TRANS Mar 2012.pdf | 2012-03-05 13:02 | 119K | |
![[ ]](/icons/layout.gif) | ATF DX-III MINERAL MULTI VEHICLE AUTO TRANS Oct 2011.pdf | 2012-02-27 13:49 | 119K | |
![[ ]](/icons/layout.gif) | ATF DX-III MINERAL MULTIVEHICLE AUTO TRANS Oct 2011.pdf | 2011-12-15 20:50 | 157K | |
![[ ]](/icons/layout.gif) | ATF DX-III OCTOBER 2016.pdf | 2016-10-27 09:21 | 256K | |
![[ ]](/icons/layout.gif) | ATF DX-II JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | ATF DX-VI.pdf | 2011-12-15 20:50 | 69K | |
![[ ]](/icons/layout.gif) | ATF DX-VI APRIL 2014.pdf | 2014-04-04 09:26 | 318K | |
![[ ]](/icons/layout.gif) | ATF DX-VI JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | ATF DX-VI JUN 2010.pdf | 2011-12-15 20:50 | 93K | |
![[ ]](/icons/layout.gif) | ATF DX-VI JUNE 2013.pdf | 2013-07-01 15:39 | 305K | |
![[ ]](/icons/layout.gif) | ATF DX-VI June 2012.pdf | 2012-07-19 17:04 | 205K | |
![[ ]](/icons/layout.gif) | ATF DX-VI Oct 2011.pdf | 2011-12-15 20:50 | 154K | |
![[ ]](/icons/layout.gif) | ATF FM5.pdf | 2011-12-15 20:50 | 73K | |
![[ ]](/icons/layout.gif) | ATF FM5 JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | ATF FM5 JAN 2011.pdf | 2011-12-15 20:50 | 204K | |
![[ ]](/icons/layout.gif) | ATF FS AUGUST 2016.pdf | 2016-08-04 11:46 | 343K | |
![[ ]](/icons/layout.gif) | ATF FS FULL SYNTHETIC MULTI VEHICLE AUTO TRANS Feb 2012.pdf | 2012-02-27 14:02 | 119K | |
![[ ]](/icons/layout.gif) | ATF FS FULL SYNTHETIC MULTI VEHICLE AUTO TRANS Nov 2011.pdf | 2011-12-15 20:50 | 160K | |
![[ ]](/icons/layout.gif) | ATF FS JANUARY 2017.pdf | 2017-01-19 16:25 | 352K | |
![[ ]](/icons/layout.gif) | ATF FS JULY 2014.pdf | 2014-07-31 17:14 | 356K | |
![[ ]](/icons/layout.gif) | ATF FS JUNE 2013.pdf | 2013-07-01 15:39 | 280K | |
![[ ]](/icons/layout.gif) | ATF FS JUNE 2015.pdf | 2015-06-22 13:25 | 358K | |
![[ ]](/icons/layout.gif) | ATF FS June 2012.pdf | 2012-07-19 17:05 | 209K | |
![[ ]](/icons/layout.gif) | ATF FS MARCH 2015.pdf | 2015-03-27 15:54 | 358K | |
![[ ]](/icons/layout.gif) | ATF FS SEPTEMBER 2014.pdf | 2014-09-18 15:00 | 356K | |
![[ ]](/icons/layout.gif) | ATF FS SEPTEMBER 2016.pdf | 2016-10-27 16:55 | 357K | |
![[ ]](/icons/layout.gif) | ATF LV JUNE 2015.pdf | 2015-06-22 13:16 | 305K | |
![[ ]](/icons/layout.gif) | ATF LV MARCH 2015.pdf | 2015-03-27 14:42 | 305K | |
![[ ]](/icons/layout.gif) | ATF LV SEPTEMBER 2016.pdf | 2016-09-20 12:27 | 305K | |
![[ ]](/icons/layout.gif) | ATF MHP.pdf | 2011-12-15 20:50 | 75K | |
![[ ]](/icons/layout.gif) | ATF MHP AUGUST 2016.pdf | 2016-08-04 11:44 | 302K | |
![[ ]](/icons/layout.gif) | ATF MHP JAN 2010.pdf | 2011-12-15 20:50 | 198K | |
![[ ]](/icons/layout.gif) | ATF MHP JAN 2011.pdf | 2011-12-15 20:50 | 204K | |
![[ ]](/icons/layout.gif) | ATF MHP JULY 2014.pdf | 2014-08-01 10:27 | 325K | |
![[ ]](/icons/layout.gif) | ATF MHP JUNE 2013.pdf | 2013-07-01 16:43 | 308K | |
![[ ]](/icons/layout.gif) | ATF MHP JUNE 2015.pdf | 2015-06-22 14:47 | 318K | |
![[ ]](/icons/layout.gif) | ATF MHP June 2012.pdf | 2012-07-19 17:06 | 211K | |
![[ ]](/icons/layout.gif) | ATF MHP MARCH 2015.pdf | 2015-03-27 16:02 | 319K | |
![[ ]](/icons/layout.gif) | ATF MHP MAY 2016.pdf | 2016-05-26 11:53 | 318K | |
![[ ]](/icons/layout.gif) | ATF MHP NOVEMBER 2016.pdf | 2016-11-10 10:31 | 318K | |
![[ ]](/icons/layout.gif) | ATF MHP SEMI SYNTHETIC MULTI VEHICLE AUTO TRANS Feb 2012.pdf | 2012-02-27 14:01 | 116K | |
![[ ]](/icons/layout.gif) | ATF MHP SEMI SYNTHETIC MULTVEHICLE AUTO TRANS Nov 2011.pdf | 2011-12-15 20:50 | 160K | |
![[ ]](/icons/layout.gif) | ATF MHP SEPTEMBER 2014.pdf | 2014-09-18 15:05 | 325K | |
![[ ]](/icons/layout.gif) | ATF MHP SEPTEMBER 2016.pdf | 2016-10-27 16:51 | 317K | |
![[ ]](/icons/layout.gif) | ATF MULTI VEHICLE LV NOVEMBER 2014.pdf | 2014-11-28 12:08 | 314K | |
![[ ]](/icons/layout.gif) | ATF MULTI VEHICLE LV OCTOBER 2014.pdf | 2014-10-22 15:16 | 314K | |
![[ ]](/icons/layout.gif) | ATF MULTI VEHICLE LV SEPTEMBER 2014.pdf | 2014-10-02 10:37 | 313K | |
![[ ]](/icons/layout.gif) | ATF SYNTHETIC.pdf | 2011-12-15 20:50 | 70K | |
![[ ]](/icons/layout.gif) | ATF TOP UP.pdf | 2011-12-15 20:50 | 75K | |
![[ ]](/icons/layout.gif) | ATF TOP UP August 2012.pdf | 2012-09-03 10:32 | 201K | |
![[ ]](/icons/layout.gif) | ATF TOP UP JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | ATF TOP UP JUNE 2015.pdf | 2015-06-22 15:51 | 337K | |
![[ ]](/icons/layout.gif) | ATF TOP UP July 2012.pdf | 2012-07-20 15:05 | 202K | |
![[ ]](/icons/layout.gif) | ATF TOP UP OCTOBER 2014.pdf | 2014-10-09 15:29 | 274K | |
![[ ]](/icons/layout.gif) | ATF TOP UP Oct 2011.pdf | 2011-12-15 20:50 | 150K | |
![[ ]](/icons/layout.gif) | ATF Top Up June 2013.pdf | 2013-06-11 16:39 | 273K | |
![[ ]](/icons/layout.gif) | AUTO TRANS STOP LEAK - APRIL 2014.pdf | 2014-03-31 12:33 | 219K | |
![[ ]](/icons/layout.gif) | AUTO TRANS STOP LEAK - FEBRUARY 2015.pdf | 2015-02-17 09:07 | 222K | |
![[ ]](/icons/layout.gif) | AUTO TRANS STOP LEAK DECEMBER 2015.pdf | 2015-12-15 17:12 | 217K | |
![[ ]](/icons/layout.gif) | AUTO TRANS STOP LEAK MAY 2015.pdf | 2015-05-04 16:56 | 222K | |
![[ ]](/icons/layout.gif) | Auto Trans Stop Leak January 2013.pdf | 2013-01-29 14:35 | 227K | |
![[ ]](/icons/layout.gif) | BENTONE HD.pdf | 2011-12-15 20:50 | 73K | |
![[ ]](/icons/layout.gif) | BENTONE HD GREASE AUGUST 2014.pdf | 2014-08-25 11:52 | 215K | |
![[ ]](/icons/layout.gif) | BIO CLEAN APRIL 2016.pdf | 2016-04-15 11:43 | 220K | |
![[ ]](/icons/layout.gif) | BIOMARINE OB TS August 2012.pdf | 2012-08-30 12:52 | 213K | |
![[ ]](/icons/layout.gif) | BIOMARINE OUTBOARD TWO STROKE OIL APRIL 2015.pdf | 2015-04-16 12:51 | 256K | |
![[ ]](/icons/layout.gif) | BIOMARINE OUTBOARD TWO STROKE OIL FEBRUARY 2016.pdf | 2016-02-03 11:55 | 314K | |
![[ ]](/icons/layout.gif) | BIOMARINE OUTBOARD TWO STROKE OIL JUNE 2015.pdf | 2015-07-21 10:52 | 254K | |
![[ ]](/icons/layout.gif) | BIOMARINE OUTBOARD TWO STROKE OIL OCTOBER 2015.pdf | 2015-10-13 10:40 | 254K | |
![[ ]](/icons/layout.gif) | BRAKE & PARTS CLEANER MAY 2014.pdf | 2014-05-22 10:21 | 262K | |
![[ ]](/icons/layout.gif) | BRAKE & PARTS CLEANER SEPTEMBER 2013.pdf | 2013-10-11 10:17 | 256K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID 525 Oct 2011.pdf | 2011-12-15 20:50 | 149K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID DOT 3 APRIL 2014.pdf | 2014-04-11 15:04 | 225K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID DOT 3 APRIL 2015.pdf | 2015-04-01 15:24 | 227K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID DOT 3 JULY 2013.pdf | 2013-07-12 15:10 | 221K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID DOT 3 JUNE 2015.pdf | 2015-06-18 13:01 | 266K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID DOT 3 MARCH 2016.pdf | 2016-03-16 15:57 | 267K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID DOT 4 ESP JULY 2015.pdf | 2015-09-21 12:27 | 225K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID DOT 5.1 APRIL 2015.pdf | 2015-04-01 16:16 | 249K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID DOT 5.1 JULY 2014.pdf | 2014-07-11 12:09 | 224K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID DOT 5.1 JUNE 2015.pdf | 2015-06-18 13:15 | 222K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID RACING APRIL 2015.pdf | 2015-04-01 16:10 | 211K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID RACING AUGUST 2015.pdf | 2015-08-05 12:05 | 198K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID RACING JULY 2013.pdf | 2013-07-12 15:13 | 209K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID RACING JUNE 2015.pdf | 2015-06-18 13:22 | 212K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID RACING NOVEMBER 2013.pdf | 2013-11-22 10:53 | 209K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID SUPER DOT 4 APRIL 2014.pdf | 2014-04-11 14:51 | 226K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID SUPER DOT 4 APRIL 2015.pdf | 2015-04-01 16:07 | 228K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID SUPER DOT 4 JULY 2013.pdf | 2013-07-12 14:24 | 224K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID SUPER DOT 4 JUNE 2015.pdf | 2015-06-18 13:06 | 273K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID SUPER DOT 4 MARCH 2016.pdf | 2016-03-16 15:49 | 273K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID Super DOT 4 Aug 2012.pdf | 2012-08-01 16:38 | 202K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID Super DOT 4 February 2013.pdf | 2013-02-05 17:12 | 202K | |
![[ ]](/icons/layout.gif) | BRAKE FLUID Super DOT 4 March 2012.pdf | 2012-07-20 09:35 | 149K | |
![[ ]](/icons/layout.gif) | BRAKE PARTS CLEANER - OCTOBER 2016.pdf | 2016-10-03 12:43 | 288K | |
![[ ]](/icons/layout.gif) | BRAKE PARTS CLEANER JULY 2015.pdf | 2015-07-06 16:53 | 256K | |
![[ ]](/icons/layout.gif) | Bentone HD Grease December 2012.pdf | 2012-12-10 16:00 | 201K | |
![[ ]](/icons/layout.gif) | Bio Clean August 2013.pdf | 2013-10-11 10:52 | 195K | |
![[ ]](/icons/layout.gif) | Brake Cleaner.pdf | 2013-10-11 11:54 | 15K | |
![[ ]](/icons/layout.gif) | Brake Fluid 525.pdf | 2011-12-15 20:50 | 72K | |
![[ ]](/icons/layout.gif) | Brake Fluid 525 JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | Brake Fluid DOT 3 April 2013.pdf | 2013-06-24 15:16 | 203K | |
![[ ]](/icons/layout.gif) | Brake Fluid Super DOT 4 April 2013.pdf | 2013-06-06 10:14 | 202K | |
![[ ]](/icons/layout.gif) | CAM ASSEMBLY LUBE APRIL 2016.pdf | 2016-04-06 08:52 | 178K | |
![[ ]](/icons/layout.gif) | CAM ASSEMBLY LUBE AUGUST 2014.pdf | 2014-08-28 12:50 | 178K | |
![[ ]](/icons/layout.gif) | CAM ASSEMBLY LUBE Oct 2011.pdf | 2011-12-15 20:50 | 140K | |
![[ ]](/icons/layout.gif) | CAR & TRUCK WASH JANUARY 2014.pdf | 2014-02-27 12:59 | 196K | |
![[ ]](/icons/layout.gif) | CAR & TRUCK WASH MARCH 2014.pdf | 2014-03-27 13:37 | 195K | |
![[ ]](/icons/layout.gif) | CHAIN LUBE ROAD SEPTEMBER 2016.pdf | 2016-09-21 16:47 | 235K | |
![[ ]](/icons/layout.gif) | CHAINSAW BAR OIL JULY 2014.pdf | 2014-07-07 10:42 | 226K | |
![[ ]](/icons/layout.gif) | CHAIN SAW BAR OIL NOVEMBER 2014.pdf | 2014-11-18 12:16 | 225K | |
![[ ]](/icons/layout.gif) | CHAIN SAW BAR OIL OCTOBER 2014.pdf | 2014-10-06 16:39 | 226K | |
![[ ]](/icons/layout.gif) | CHAINSAW BAR OIL Oct 2011.pdf | 2011-12-15 20:50 | 140K | |
![[ ]](/icons/layout.gif) | CHAINSAW BAR OIL Oct 2012.pdf | 2012-10-08 09:02 | 199K | |
![[ ]](/icons/layout.gif) | CHAINSAW BAR OIL SEPTEMBER 2013.pdf | 2013-09-11 10:10 | 223K | |
![[ ]](/icons/layout.gif) | CLASSIC 20W-50 FEBRUARY 2017.pdf | 2017-02-16 12:58 | 252K | |
![[ ]](/icons/layout.gif) | CLASSIC 20W-50 MAY 2015.pdf | 2015-05-08 09:29 | 251K | |
![[ ]](/icons/layout.gif) | CLASSIC 20W-50 OCTOBER 2013.pdf | 2013-10-31 16:17 | 251K | |
![[ ]](/icons/layout.gif) | CLASSIC ATF FEBRUARY 2016.pdf | 2016-02-17 16:01 | 300K | |
![[ ]](/icons/layout.gif) | CLASSIC ATF JUNE 2014.pdf | 2014-12-09 11:26 | 278K | |
![[ ]](/icons/layout.gif) | CLASSIC ATF MARCH 2015.pdf | 2015-03-27 16:28 | 278K | |
![[ ]](/icons/layout.gif) | CLASSIC ATF MAY 2016.pdf | 2016-10-07 15:54 | 300K | |
![[ ]](/icons/layout.gif) | CLASSIC CAR COOLANT AUGUST 2013.pdf | 2013-08-28 12:03 | 207K | |
![[ ]](/icons/layout.gif) | CLASSIC CAR COOLANT DECEMBER 2013.pdf | 2013-12-18 10:30 | 220K | |
![[ ]](/icons/layout.gif) | CLASSIC CAR COOLANT FEBRUARY 2017.pdf | 2017-02-16 12:05 | 315K | |
![[ ]](/icons/layout.gif) | CLASSIC CAR COOLANT MARCH 2016.pdf | 2016-03-23 14:48 | 304K | |
![[ ]](/icons/layout.gif) | CLASSIC CAR COOLANT MAY 2015.pdf | 2015-05-01 13:07 | 221K | |
![[ ]](/icons/layout.gif) | CLASSIC CAR COOLANT Oct 2011.pdf | 2011-12-15 20:50 | 145K | |
![[ ]](/icons/layout.gif) | CLASSIC ENGINE OILS AUGUST 2013.pdf | 2013-08-28 11:52 | 312K | |
![[ ]](/icons/layout.gif) | CLASSIC ENGINE OILS FEBRUARY 2016.pdf | 2016-02-17 12:36 | 367K | |
![[ ]](/icons/layout.gif) | CLASSIC ENGINE OILS Feb 2012.pdf | 2012-02-14 10:00 | 145K | |
![[ ]](/icons/layout.gif) | CLASSIC ENGINE OILS Feb 2013.pdf | 2013-02-05 16:51 | 189K | |
![[ ]](/icons/layout.gif) | CLASSIC ENGINE OILS JANUARY 2017.pdf | 2017-02-16 12:59 | 368K | |
![[ ]](/icons/layout.gif) | CLASSIC ENGINE OILS JULY 2014.pdf | 2014-07-11 15:03 | 447K | |
![[ ]](/icons/layout.gif) | CLASSIC ENGINE OILS MARCH 2014.pdf | 2014-03-05 15:19 | 329K | |
![[ ]](/icons/layout.gif) | CLASSIC ENGINE OILS Oct 2011.pdf | 2011-12-15 20:50 | 145K | |
![[ ]](/icons/layout.gif) | CLASSIC MINI 20W-50 FEBRUARY 2016.pdf | 2016-02-09 12:35 | 319K | |
![[ ]](/icons/layout.gif) | CLASSIC MINI 20W-50 MAY 2015.pdf | 2015-05-06 16:14 | 297K | |
![[ ]](/icons/layout.gif) | CLASSIC MINI OIL APRIL 2014.pdf | 2014-04-11 09:26 | 268K | |
![[ ]](/icons/layout.gif) | CLASSIC MINI OIL DECEMBER 2013.pdf | 2013-12-16 14:46 | 269K | |
![[ ]](/icons/layout.gif) | CLASSIC MINI OIL JUNE 2014.pdf | 2014-06-04 11:11 | 269K | |
![[ ]](/icons/layout.gif) | CLASSIC TRIUMPH DECEMBER 2013.pdf | 2014-03-11 13:17 | 232K | |
![[ ]](/icons/layout.gif) | CLASSIC TRIUMPH MARCH 2014.pdf | 2014-08-04 10:11 | 247K | |
![[ ]](/icons/layout.gif) | CLASSIC TRIUMPH MAY 2015.pdf | 2015-05-06 16:26 | 247K | |
![[ ]](/icons/layout.gif) | CLASSIC V DUB MARCH 2016.pdf | 2016-03-31 13:03 | 391K | |
![[ ]](/icons/layout.gif) | CLEAR SCREEN APRIL 2015.pdf | 2015-04-02 13:28 | 391K | |
![[ ]](/icons/layout.gif) | CLEAR SCREEN AUGUST 2016.pdf | 2016-08-30 09:16 | 422K | |
![[ ]](/icons/layout.gif) | CLEAR SCREEN CONCENTRATE FEBRUARY 2014.pdf | 2014-02-04 12:53 | 388K | |
![[ ]](/icons/layout.gif) | CLEAR SCREEN CONCENTRATE SEPTEMBER 2013.pdf | 2013-10-11 14:56 | 388K | |
![[ ]](/icons/layout.gif) | CLEAR SCREEN JUNE 2015.pdf | 2015-06-24 14:32 | 389K | |
![[ ]](/icons/layout.gif) | CLEAR SCREEN November 2015.pdf | 2015-11-04 10:21 | 389K | |
![[ ]](/icons/layout.gif) | COMPETITION DIFF OIL.pdf | 2011-12-15 20:50 | 82K | |
![[ ]](/icons/layout.gif) | COOL 100 COOLANT INHIBITOR - DECEMEBR 2016.pdf | 2016-12-02 12:43 | 273K | |
![[ ]](/icons/layout.gif) | COOL 100 COOLANT INHIBITOR - FEBRUARY 2015.pdf | 2015-03-20 11:42 | 250K | |
![[ ]](/icons/layout.gif) | COOL 100 COOLANT INHIBITOR - FEBRUARY 2017.pdf | 2017-02-16 12:44 | 304K | |
![[ ]](/icons/layout.gif) | COOLANT TEST STRIPS - JULY 2016.pdf | 2016-07-12 09:12 | 375K | |
![[ ]](/icons/layout.gif) | COOLANT TEST STRIPS - JUNE 2015.pdf | 2015-06-01 11:52 | 375K | |
![[ ]](/icons/layout.gif) | COOLANT TEST STRIPS - OCTOBER 2014.pdf | 2014-12-03 08:52 | 375K | |
![[ ]](/icons/layout.gif) | COPPER EZE AUGUST 2014.pdf | 2014-08-28 13:01 | 212K | |
![[ ]](/icons/layout.gif) | COPPER EZE December 2012.pdf | 2012-12-10 15:42 | 185K | |
![[ ]](/icons/layout.gif) | COPPER EZE FEBRUARY 2014.pdf | 2014-02-05 16:03 | 199K | |
![[ ]](/icons/layout.gif) | COPPER EZE JULY 2014.pdf | 2014-07-01 11:45 | 202K | |
![[ ]](/icons/layout.gif) | COPPER EZE MAY 2013.pdf | 2013-05-10 14:53 | 185K | |
![[ ]](/icons/layout.gif) | COPPER EZE Oct 2011.pdf | 2011-12-15 20:50 | 139K | |
![[ ]](/icons/layout.gif) | CUTRITE ECO - DECEMBER 2014.pdf | 2014-12-08 11:39 | 202K | |
![[ ]](/icons/layout.gif) | CUTRITE ECO - JANUARY 2015.pdf | 2015-01-16 15:37 | 202K | |
![[ ]](/icons/layout.gif) | CV JOINT GREASE AUGUST 2016.pdf | 2016-10-18 16:23 | 270K | |
![[ ]](/icons/layout.gif) | CVT-V FLUID Oct 2011.pdf | 2011-12-15 20:50 | 146K | |
![[ ]](/icons/layout.gif) | CVT FLUID V JUNE 2012.pdf | 2012-07-19 17:06 | 192K | |
![[ ]](/icons/layout.gif) | CVT FLUID V JUNE 2015.pdf | 2015-06-22 14:28 | 365K | |
![[ ]](/icons/layout.gif) | CVT FLUID V MARCH 2015.pdf | 2015-03-27 16:15 | 226K | |
![[ ]](/icons/layout.gif) | CVT Fluid.pdf | 2011-12-15 20:50 | 87K | |
![[ ]](/icons/layout.gif) | CVT Fluid V.pdf | 2011-12-15 20:50 | 47K | |
![[ ]](/icons/layout.gif) | CVT Fluid V JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | CVTV FLUID MAY 2014.pdf | 2014-05-21 09:28 | 229K | |
![[ ]](/icons/layout.gif) | CVTV Fluid June 2013.pdf | 2013-06-11 16:06 | 285K | |
![[ ]](/icons/layout.gif) | CVTV Fluid October 2013.pdf | 2014-01-21 16:13 | 290K | |
![[ ]](/icons/layout.gif) | CYL900 March 2012.pdf | 2014-01-14 10:34 | 178K | |
![[ ]](/icons/layout.gif) | CYL OIL MINERAL 900 DECEMBER 2015.pdf | 2015-12-01 08:12 | 223K | |
![[ ]](/icons/layout.gif) | CYL OIL MINERAL 9000 DECEMBER 2014.pdf | 2014-12-02 16:42 | 212K | |
![[ ]](/icons/layout.gif) | Cam Assembly Lube JAN 2010.pdf | 2011-12-15 20:50 | 190K | |
![[ ]](/icons/layout.gif) | Cam Assembly Lubr.pdf | 2011-12-15 20:50 | 61K | |
![[ ]](/icons/layout.gif) | Chain Lube Road Rev 0.0 0916 .pdf | 2016-09-21 16:39 | 302K | |
![[ ]](/icons/layout.gif) | Chain Saw Bar.pdf | 2011-12-15 20:50 | 62K | |
![[ ]](/icons/layout.gif) | Chain Saw Bar JAN 2010.pdf | 2011-12-15 20:50 | 191K | |
![[ ]](/icons/layout.gif) | Classic Car Coolant.pdf | 2011-12-15 20:50 | 70K | |
![[ ]](/icons/layout.gif) | Classic Car Coolant MAR 2010.pdf | 2011-12-15 20:50 | 193K | |
![[ ]](/icons/layout.gif) | Classic Engine Oil 20W-50 Oct 2011.pdf | 2011-12-15 20:50 | 186K | |
![[ ]](/icons/layout.gif) | Classic Engine Oils.pdf | 2011-12-15 20:50 | 98K | |
![[ ]](/icons/layout.gif) | Classic Engine Oils JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | Classic Mini Oil January 2013.pdf | 2013-05-03 14:33 | 225K | |
![[ ]](/icons/layout.gif) | Classic Mini Oil July 2013.pdf | 2013-07-02 12:57 | 267K | |
![[ ]](/icons/layout.gif) | Competition Diff Oil Jan 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | Compressor Oil 4KH.pdf | 2011-12-15 20:50 | 69K | |
![[ ]](/icons/layout.gif) | Compressor Oil 4KH JAN 2010.pdf | 2011-12-15 20:50 | 215K | |
![[ ]](/icons/layout.gif) | Cooper Eze.pdf | 2011-12-15 20:50 | 61K | |
![[ ]](/icons/layout.gif) | Copper Eze.pdf | 2011-12-15 20:50 | 112K | |
![[ ]](/icons/layout.gif) | Copper Eze JAN 2010.pdf | 2011-12-15 20:50 | 192K | |
![[ ]](/icons/layout.gif) | DCT FLUID JANUARY 2015 .pdf | 2015-01-27 09:51 | 342K | |
![[ ]](/icons/layout.gif) | DCT FLUID JUNE 2015.pdf | 2015-06-22 14:38 | 323K | |
![[ ]](/icons/layout.gif) | DCT FLUID MARCH 2016.pdf | 2016-03-31 14:49 | 349K | |
![[ ]](/icons/layout.gif) | DEMINERALISED WATER APRIL 2017.pdf | 2017-04-05 11:06 | 385K | |
![[ ]](/icons/layout.gif) | DEMINERALISED WATER FEBRUARY 2017.pdf | 2017-03-29 13:20 | 363K | |
![[ ]](/icons/layout.gif) | DIESEL BIOCIDE FUEL TREATMENT APRIL 2016.pdf | 2016-04-15 09:59 | 224K | |
![[ ]](/icons/layout.gif) | DIESEL BIOCIDE FUEL TREATMENT APRIL 2017.pdf | 2017-04-11 15:14 | 337K | |
![[ ]](/icons/layout.gif) | DIESEL BIOCIDE FUEL TREATMENT OCTOBER 2016.pdf | 2016-10-18 16:34 | 224K | |
![[ ]](/icons/layout.gif) | DIESEL FUEL STABILISER APRIL 2017.pdf | 2017-04-11 15:09 | 422K | |
![[ ]](/icons/layout.gif) | DIESEL FUEL STABILISER JUNE 2016.pdf | 2016-06-07 08:18 | 317K | |
![[ ]](/icons/layout.gif) | DIESEL FUEL STABILISER MAY 2015.pdf | 2015-07-27 11:58 | 317K | |
![[ ]](/icons/layout.gif) | DIESEL FUEL TREATMENT APRIL 2016.pdf | 2016-04-08 11:53 | 217K | |
![[ ]](/icons/layout.gif) | DIESEL FUEL TREATMENT DECEMBER 2015.pdf | 2015-12-22 12:26 | 215K | |
![[ ]](/icons/layout.gif) | DIESEL FUEL TREATMENT JULY 2014.pdf | 2014-07-25 17:41 | 163K | |
![[ ]](/icons/layout.gif) | DIESEL FUEL TREATMENT JUNE 2015.pdf | 2015-06-23 17:06 | 189K | |
![[ ]](/icons/layout.gif) | DIESEL FX 15W-40 SEPTEMBER 2013.pdf | 2013-10-03 12:55 | 250K | |
![[ ]](/icons/layout.gif) | DIESEL FX August 2012.pdf | 2012-08-20 16:48 | 191K | |
![[ ]](/icons/layout.gif) | DIESEL FX February 2012.pdf | 2012-02-14 10:01 | 149K | |
![[ ]](/icons/layout.gif) | DIESEL FX January 2012.pdf | 2012-01-09 15:52 | 147K | |
![[ ]](/icons/layout.gif) | DIESEL FX MARCH 2015.pdf | 2015-03-27 13:00 | 252K | |
![[ ]](/icons/layout.gif) | DIESEL FX MAY 2016.pdf | 2016-05-02 10:30 | 309K | |
![[ ]](/icons/layout.gif) | DIESEL FX NOVEMBER 2015.pdf | 2015-11-23 16:18 | 306K | |
![[ ]](/icons/layout.gif) | DIESEL FX November 2012.pdf | 2012-11-08 16:31 | 190K | |
![[ ]](/icons/layout.gif) | DIESEL FX Oct 2011.pdf | 2011-12-15 20:50 | 146K | |
![[ ]](/icons/layout.gif) | DIESEL FX SEPTEMBER 2015.pdf | 2015-09-17 09:10 | 251K | |
![[ ]](/icons/layout.gif) | DIESEL GS Oct 2011.pdf | 2011-12-15 20:50 | 149K | |
![[ ]](/icons/layout.gif) | DIESEL HD 15W-40 August 2012.pdf | 2012-08-21 09:34 | 194K | |
![[ ]](/icons/layout.gif) | DIESEL HD 15W-40 JULY 2012.pdf | 2012-07-19 17:07 | 196K | |
![[ ]](/icons/layout.gif) | DIESEL HD 15W-40 JUNE 2014.pdf | 2014-06-16 12:43 | 365K | |
![[ ]](/icons/layout.gif) | DIESEL HD 15W-40 November 2012.pdf | 2012-11-13 12:19 | 194K | |
![[ ]](/icons/layout.gif) | DIESEL HD 15W-40 SEPTEMBER 2013.pdf | 2013-09-18 17:24 | 368K | |
![[ ]](/icons/layout.gif) | DIESEL HD 15W40 April 2012.pdf | 2012-04-11 16:50 | 111K | |
![[ ]](/icons/layout.gif) | DIESEL HD 15W40 February 2012.pdf | 2012-02-14 10:02 | 156K | |
![[ ]](/icons/layout.gif) | DIESEL HD 15W40 Oct 2011.pdf | 2011-12-15 20:50 | 155K | |
![[ ]](/icons/layout.gif) | DIESEL HD APRIL 2016.pdf | 2016-04-29 15:25 | 379K | |
![[ ]](/icons/layout.gif) | DIESEL HD FEBRUARY 2016.pdf | 2016-02-18 11:26 | 379K | |
![[ ]](/icons/layout.gif) | DIESEL HD MARCH 2015.pdf | 2015-03-26 14:57 | 368K | |
![[ ]](/icons/layout.gif) | DIESEL HD SEPTEMBER 2015.pdf | 2015-09-09 15:24 | 379K | |
![[ ]](/icons/layout.gif) | DIESEL INJECTOR CLEANER - APRIL 2014.pdf | 2014-04-01 09:09 | 177K | |
![[ ]](/icons/layout.gif) | DIESEL INJECTOR CLEANER - FEBRUARY 2015.pdf | 2015-02-17 09:50 | 180K | |
![[ ]](/icons/layout.gif) | DIESEL INJECTOR CLEANER - JANUARY 2015.pdf | 2015-01-14 08:24 | 180K | |
![[ ]](/icons/layout.gif) | DIESEL INJECTOR CLEANER APRIL 2017.pdf | 2017-04-11 12:30 | 312K | |
![[ ]](/icons/layout.gif) | DIESEL INJECTOR CLEANER MAY 2015.pdf | 2015-05-08 17:02 | 197K | |
![[ ]](/icons/layout.gif) | DIESEL LA Oct 2011.pdf | 2011-12-15 20:50 | 149K | |
![[ ]](/icons/layout.gif) | DIESEL NT JANUARY 2017.pdf | 2017-01-25 14:10 | 145K | |
![[ ]](/icons/layout.gif) | DIESEL NT JULY 2015.pdf | 2016-10-27 12:20 | 193K | |
![[ ]](/icons/layout.gif) | DIESEL NT MARCH 2017.pdf | 2017-03-23 15:56 | 168K | |
![[ ]](/icons/layout.gif) | DIESEL SP Oct 2011.pdf | 2011-12-15 20:50 | 148K | |
![[ ]](/icons/layout.gif) | DIESEL TOTAL SYSTEM CLEANER APRIL 2017.pdf | 2017-04-11 12:29 | 420K | |
![[ ]](/icons/layout.gif) | DIESEL TOTAL SYSTEM CLEANER MAY 2015.pdf | 2015-07-24 16:51 | 317K | |
![[ ]](/icons/layout.gif) | DOT 3 April 2013.pdf | 2013-04-18 13:03 | 203K | |
![[ ]](/icons/layout.gif) | DOT 3 BRAKE FLUID APRIL 2015.pdf | 2015-04-01 15:25 | 227K | |
![[ ]](/icons/layout.gif) | DOT 3 BRAKE FLUID Aug 2012.pdf | 2012-08-01 16:41 | 203K | |
![[ ]](/icons/layout.gif) | DOT 3 BRAKE FLUID February 2013.pdf | 2013-02-05 17:11 | 204K | |
![[ ]](/icons/layout.gif) | DOT 3 BRAKE FLUID JULY 2012.pdf | 2012-07-20 11:11 | 203K | |
![[ ]](/icons/layout.gif) | DOT 3 BRAKE FLUID January 2013.pdf | 2013-01-10 16:00 | 201K | |
![[ ]](/icons/layout.gif) | DPF CLEANER APRIL 2015.pdf | 2015-04-01 12:49 | 517K | |
![[ ]](/icons/layout.gif) | DPF CLEANER APRIL 2017.pdf | 2017-04-11 15:13 | 721K | |
![[ ]](/icons/layout.gif) | DPF CLEANER JANUARY 2014.pdf | 2014-03-06 16:15 | 560K | |
![[ ]](/icons/layout.gif) | DPF CLEANER JANUARY 2015.pdf | 2015-01-12 10:00 | 519K | |
![[ ]](/icons/layout.gif) | DPF CLEANER JULY 2016.pdf | 2016-07-11 14:31 | 592K | |
![[ ]](/icons/layout.gif) | DPF CLEANER NOVEMBER 2014.pdf | 2014-11-19 10:29 | 519K | |
![[ ]](/icons/layout.gif) | Diesel FX.pdf | 2011-12-15 20:50 | 69K | |
![[ ]](/icons/layout.gif) | Diesel FX April 2013.pdf | 2013-04-17 15:54 | 192K | |
![[ ]](/icons/layout.gif) | Diesel FX MAR 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | Diesel FX NOV 2010.pdf | 2011-12-15 20:50 | 200K | |
![[ ]](/icons/layout.gif) | Diesel FX September 2013.pdf | 2013-09-17 17:17 | 250K | |
![[ ]](/icons/layout.gif) | Diesel GS.pdf | 2011-12-15 20:50 | 78K | |
![[ ]](/icons/layout.gif) | Diesel GS JULY 2010.pdf | 2011-12-15 20:50 | 202K | |
![[ ]](/icons/layout.gif) | Diesel GS MAR 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | Diesel HD JAN 2011.pdf | 2011-12-15 20:50 | 202K | |
![[ ]](/icons/layout.gif) | Diesel Injector Cleaner January 2013.pdf | 2013-01-29 15:57 | 246K | |
![[ ]](/icons/layout.gif) | Diesel LA.pdf | 2011-12-15 20:50 | 80K | |
![[ ]](/icons/layout.gif) | Diesel LA JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | Diesel SP.pdf | 2011-12-15 20:50 | 76K | |
![[ ]](/icons/layout.gif) | Diesel SP MAR 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | Diesel SP MAR 2011.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | ENDURO APRIL 2015.pdf | 2015-05-01 10:48 | 283K | |
![[ ]](/icons/layout.gif) | ENDURO FEBRUARY 2015.pdf | 2015-02-23 17:28 | 282K | |
![[ ]](/icons/layout.gif) | ENDURO FEBRUARY 2016.pdf | 2016-02-18 08:06 | 284K | |
![[ ]](/icons/layout.gif) | ENDURO JULY 2014.pdf | 2014-07-17 11:42 | 406K | |
![[ ]](/icons/layout.gif) | ENDURO MARCH 2014.pdf | 2014-03-12 10:31 | 246K | |
![[ ]](/icons/layout.gif) | ENDURO Oct 2011.pdf | 2011-12-15 20:50 | 142K | |
![[ ]](/icons/layout.gif) | ENGINE FLUSH - APRIL 2014.pdf | 2014-04-01 16:42 | 242K | |
![[ ]](/icons/layout.gif) | ENGINE FLUSH - FEBRUARY 2015.pdf | 2015-02-17 11:32 | 238K | |
![[ ]](/icons/layout.gif) | ENGINE FLUSH JUNE 2015.pdf | 2015-06-23 15:39 | 257K | |
![[ ]](/icons/layout.gif) | ENGINE FLUSH MAY 2015.pdf | 2015-05-11 09:05 | 259K | |
![[ ]](/icons/layout.gif) | ENGINE STOP LEAK - APRIL 2014.pdf | 2014-04-02 14:28 | 262K | |
![[ ]](/icons/layout.gif) | ENGINE STOP LEAK - FEBRUARY 2015.pdf | 2015-02-17 11:56 | 265K | |
![[ ]](/icons/layout.gif) | ENGINE STOP LEAK JUNE 2015.pdf | 2015-06-23 15:23 | 266K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 0W-20 APRIL 2017.pdf | 2017-04-24 11:52 | 860K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 0W-20 JANUARY 2015.pdf | 2015-01-27 10:40 | 372K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 0W-20 MARCH 2015.pdf | 2015-03-02 11:08 | 361K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 0W-20 MARCH 2016.pdf | 2016-03-23 12:06 | 512K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 0W-20 MAY 2015.pdf | 2015-05-05 12:59 | 393K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 0W-20 NOVEMBER 2015.pdf | 2015-11-27 14:05 | 515K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 0W-20 SEPTEMBER 2015.pdf | 2015-09-09 10:53 | 515K | |
![[ ]](/icons/layout.gif) | ENVIRO+0W40 Nov 2011.pdf | 2011-12-15 20:50 | 146K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-20 APRIL 2017.pdf | 2017-04-24 12:01 | 601K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-20 April 2013.pdf | 2013-04-18 09:43 | 192K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-20 JANUARY 2015.pdf | 2015-01-14 08:45 | 323K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-20 JUNE 2013.pdf | 2013-07-05 12:01 | 280K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-20 MAY 2014.pdf | 2014-05-22 10:49 | 280K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-20 MAY 2015.pdf | 2015-05-05 13:23 | 387K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-20 NOVEMBER 2014.pdf | 2014-11-24 10:33 | 324K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-20 NOVEMBER 2015.pdf | 2015-11-27 14:14 | 416K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-20 OCTOBER 2014.pdf | 2014-10-02 12:51 | 323K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-20 SEPTEMBER 2015.pdf | 2015-09-25 10:55 | 416K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-30 APRIL 2017.pdf | 2017-04-13 12:54 | 642K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-30 DECEMBER 2015.pdf | 2015-12-03 11:10 | 375K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-30 JANUARY 2014.pdf | 2014-01-23 16:47 | 308K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-30 JANUARY 2015.pdf | 2015-01-14 08:51 | 361K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-30 JUNE 2013.pdf | 2013-06-18 15:54 | 313K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-30 JUNE 2016.pdf | 2016-06-07 10:54 | 446K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-30 June 2012.pdf | 2012-07-19 16:52 | 208K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-30 MAY 2015.pdf | 2015-05-05 15:30 | 379K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-30 May 2014.pdf | 2014-05-30 12:25 | 361K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-30 NOVEMBER 2015.pdf | 2015-11-27 15:30 | 374K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-30 NOVEMBER 2016.pdf | 2016-11-11 09:05 | 446K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-40 APRIL 2015.pdf | 2015-04-16 11:32 | 371K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-40 APRIL 2017.pdf | 2017-04-13 13:00 | 742K | |
![[ ]](/icons/layout.gif) | ENVIRO+5W-40 AUGUST 2014.pdf | 2014-08-29 11:42 | 371K | |
![[ ]](/icons/layout.gif) | ENVIRO+5W-40 April 2012.pdf | 2012-04-04 15:48 | 132K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-40 Aug 2012.pdf | 2012-08-13 15:19 | 220K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-40 DECEMBER 2015.pdf | 2015-12-03 11:02 | 513K | |
![[ ]](/icons/layout.gif) | ENVIRO+5W-40 FEBRUARY 2015.pdf | 2015-03-26 12:10 | 371K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-40 FEBRUARY 2016.pdf | 2016-02-18 11:28 | 472K | |
![[ ]](/icons/layout.gif) | ENVIRO+5W-40 JANUARY 2015.pdf | 2015-01-14 08:38 | 371K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-40 JULY 2015.pdf | 2015-07-22 16:14 | 508K | |
![[ ]](/icons/layout.gif) | ENVIRO+5W-40 JUNE 2013.pdf | 2013-06-19 12:24 | 328K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-40 JUNE 2016.pdf | 2016-06-08 10:31 | 485K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-40 June 2012.pdf | 2012-06-04 15:28 | 130K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-40 MAY 2015.pdf | 2015-05-05 15:31 | 426K | |
![[ ]](/icons/layout.gif) | ENVIRO+5W-40 May 2014.pdf | 2014-05-30 12:27 | 370K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-40 NOVEMBER 2015.pdf | 2015-11-27 14:47 | 513K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-40 Nov 2012.pdf | 2012-11-16 11:58 | 218K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 5W-40 SEPTEMBER 2015.pdf | 2015-09-09 16:16 | 472K | |
![[ ]](/icons/layout.gif) | ENVIRO+5W30 Dec 2011.pdf | 2011-12-15 20:50 | 155K | |
![[ ]](/icons/layout.gif) | ENVIRO+5W40 Nov 2011.pdf | 2011-12-15 20:50 | 151K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 10W-40 JULY 2014.pdf | 2014-07-14 13:16 | 475K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 10W-40 June 2012.pdf | 2012-07-19 16:54 | 196K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 10W-40 MAY 2014.pdf | 2014-05-26 16:39 | 277K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 10W-40 NOVEMBER 2013.pdf | 2014-02-26 15:34 | 276K | |
![[ ]](/icons/layout.gif) | ENVIRO+ 10W-40 SEPTEMBER 2013.pdf | 2013-09-18 13:13 | 275K | |
![[ ]](/icons/layout.gif) | ENVIRO+10W40 Jan 2012.pdf | 2012-04-12 14:29 | 154K | |
![[ ]](/icons/layout.gif) | ENVIRO+10W40 Oct 2011.pdf | 2011-12-15 20:50 | 153K | |
![[ ]](/icons/layout.gif) | ENVIRO+ C-4 AUGUST 2014.pdf | 2014-08-22 10:26 | 378K | |
![[ ]](/icons/layout.gif) | ENVIRO+ C-4 April 2013.pdf | 2013-04-09 11:58 | 196K | |
![[ ]](/icons/layout.gif) | ENVIRO+ C-4 JANUARY 2015.pdf | 2015-01-14 08:54 | 378K | |
![[ ]](/icons/layout.gif) | ENVIRO+ C-4 JUNE 2013.pdf | 2013-07-05 12:49 | 285K | |
![[ ]](/icons/layout.gif) | ENVIRO+ C-4 June 2012.pdf | 2012-07-19 16:55 | 201K | |
![[ ]](/icons/layout.gif) | ENVIRO+ C-4 MAY 2014.pdf | 2014-05-05 09:36 | 330K | |
![[ ]](/icons/layout.gif) | ENVIRO+ C2 APRIL 2016.pdf | 2016-04-29 09:56 | 430K | |
![[ ]](/icons/layout.gif) | ENVIRO+ C2 APRIL 2017.pdf | 2017-04-24 12:05 | 642K | |
![[ ]](/icons/layout.gif) | ENVIRO+ C2 MARCH 2017.pdf | 2017-03-06 11:53 | 557K | |
![[ ]](/icons/layout.gif) | ENVIRO+ C3 APRIL 2016.pdf | 2016-08-16 08:08 | 413K | |
![[ ]](/icons/layout.gif) | ENVIRO+ C3 APRIL 2017.pdf | 2017-04-13 13:31 | 581K | |
![[ ]](/icons/layout.gif) | ENVIRO+C3 AUGUST 2014.pdf | 2014-10-02 11:30 | 279K | |
![[ ]](/icons/layout.gif) | ENVIRO+ C3 AUGUST 2016.pdf | 2016-08-16 08:13 | 413K | |
![[ ]](/icons/layout.gif) | ENVIRO+C3 DECEMEBR 2015.pdf | 2015-12-08 13:58 | 430K | |
![[ ]](/icons/layout.gif) | ENVIRO+C3 JANUARY 2015.pdf | 2015-01-14 09:02 | 282K | |
![[ ]](/icons/layout.gif) | ENVIRO+ C3 JANUARY 2017.pdf | 2017-01-17 15:53 | 413K | |
![[ ]](/icons/layout.gif) | ENVIRO+C3 MARCH 2015.pdf | 2015-03-26 12:04 | 282K | |
![[ ]](/icons/layout.gif) | ENVIRO+C3 MAY 2015.pdf | 2015-05-05 16:36 | 332K | |
![[ ]](/icons/layout.gif) | ENVIRO+ C4 APRIL 2017.pdf | 2017-04-24 12:12 | 704K | |
![[ ]](/icons/layout.gif) | ENVIRO+ C4 DECEMBER 2015.pdf | 2015-12-08 12:56 | 474K | |
![[ ]](/icons/layout.gif) | ENVIRO+ C4 DECEMBER 2016.pdf | 2016-12-16 08:52 | 472K | |
![[ ]](/icons/layout.gif) | ENVIRO+ C4 MAY 2015.pdf | 2015-05-05 15:46 | 415K | |
![[ ]](/icons/layout.gif) | ENVIRO+ C4 NOVEMBER 2015.pdf | 2015-11-27 16:32 | 415K | |
![[ ]](/icons/layout.gif) | ENVIRO+C4 Oct 2011.pdf | 2011-12-15 20:50 | 205K | |
![[ ]](/icons/layout.gif) | ENVIRO+ DL-1 APRIL 2017.pdf | 2017-04-24 12:16 | 710K | |
![[ ]](/icons/layout.gif) | ENVIRO+ DL-1 Aug 2012.pdf | 2012-08-24 16:51 | 215K | |
![[ ]](/icons/layout.gif) | ENVIRO+ DL-1 DECEMBER 2015.pdf | 2015-12-08 13:04 | 453K | |
![[ ]](/icons/layout.gif) | ENVIRO+ DL-1 JANUARY 2015.pdf | 2015-01-14 08:56 | 367K | |
![[ ]](/icons/layout.gif) | ENVIRO+ DL-1 JUNE 2013.pdf | 2013-07-05 13:24 | 315K | |
![[ ]](/icons/layout.gif) | ENVIRO+ DL-1 JUNE 2016.pdf | 2016-08-15 16:56 | 463K | |
![[ ]](/icons/layout.gif) | ENVIRO+ DL-1 June 2012.pdf | 2012-07-19 16:56 | 215K | |
![[ ]](/icons/layout.gif) | ENVIRO+ DL-1 MARCH 2015.pdf | 2015-03-26 12:02 | 367K | |
![[ ]](/icons/layout.gif) | ENVIRO+ DL-1 MAY 2015.pdf | 2015-05-05 15:55 | 382K | |
![[ ]](/icons/layout.gif) | ENVIRO+ DL-1 May 2013.pdf | 2013-05-20 15:35 | 214K | |
![[ ]](/icons/layout.gif) | ENVIRO+ DL-1 May 2014.pdf | 2014-05-21 13:11 | 315K | |
![[ ]](/icons/layout.gif) | ENVIRO+ DL-1 NOVEMBER 2015.pdf | 2015-11-27 15:53 | 382K | |
![[ ]](/icons/layout.gif) | ENVIRO+DL-1 Oct 2011.pdf | 2011-12-15 20:50 | 171K | |
![[ ]](/icons/layout.gif) | ENVIRO+EU AUG 2016.pdf | 2016-10-27 12:21 | 433K | |
![[ ]](/icons/layout.gif) | ENVIRO+EU MARCH 2017.pdf | 2017-03-23 15:58 | 602K | |
![[ ]](/icons/layout.gif) | ENVIRO+EU NOVEMBER 2016.pdf | 2017-03-15 12:11 | 604K | |
![[ ]](/icons/layout.gif) | ENVIRO+ GF-5 APRIL 2017.pdf | 2017-04-24 12:20 | 739K | |
![[ ]](/icons/layout.gif) | ENVIRO+ GF-5 April 2012.pdf | 2012-04-30 15:27 | 134K | |
![[ ]](/icons/layout.gif) | ENVIRO+ GF-5 Aug 2012.pdf | 2012-08-30 10:06 | 214K | |
![[ ]](/icons/layout.gif) | ENVIRO+ GF-5 FEBRUARY 2016.pdf | 2016-02-18 11:39 | 537K | |
![[ ]](/icons/layout.gif) | ENVIRO+GF-5 Feb 2012.pdf | 2012-02-14 11:41 | 236K | |
![[ ]](/icons/layout.gif) | ENVIRO+ GF-5 JANUARY 2015.pdf | 2015-01-14 08:59 | 377K | |
![[ ]](/icons/layout.gif) | ENVIRO+ GF-5 JANUARY 2017.pdf | 2017-03-16 17:05 | 693K | |
![[ ]](/icons/layout.gif) | ENVIRO+ GF-5 JULY 2015.pdf | 2015-07-23 16:43 | 508K | |
![[ ]](/icons/layout.gif) | ENVIRO+ GF-5 JUNE 2013.pdf | 2013-06-19 11:06 | 319K | |
![[ ]](/icons/layout.gif) | ENVIRO+ GF-5 June 2012.pdf | 2012-06-04 13:56 | 134K | |
![[ ]](/icons/layout.gif) | ENVIRO+ GF-5 MARCH 2015.pdf | 2015-03-26 11:48 | 377K | |
![[ ]](/icons/layout.gif) | ENVIRO+ GF-5 MAY 2014.pdf | 2014-05-21 13:10 | 322K | |
![[ ]](/icons/layout.gif) | ENVIRO+ GF-5 MAY 2015.pdf | 2015-05-05 16:06 | 399K | |
![[ ]](/icons/layout.gif) | ENVIRO+ GF-5 NOVEMBER 2014.pdf | 2014-11-24 10:21 | 377K | |
![[ ]](/icons/layout.gif) | ENVIRO+ GF-5 NOVEMBER 2015.pdf | 2015-11-27 16:15 | 537K | |
![[ ]](/icons/layout.gif) | ENVIRO+GF-5 Oct 2011.pdf | 2011-12-15 20:50 | 217K | |
![[ ]](/icons/layout.gif) | ENVIRO+ GF-5 SEPTEMBER 2015.pdf | 2015-09-09 11:12 | 537K | |
![[ ]](/icons/layout.gif) | ENVIRO+ HD 5W-30 JULY 2015.pdf | 2015-10-12 14:50 | 188K | |
![[ ]](/icons/layout.gif) | ENVIRO+ HD 5W-30 MARCH 2015.pdf | 2015-03-27 13:06 | 188K | |
![[ ]](/icons/layout.gif) | ENVIRO+ HD 5W-30 MARCH 2016.pdf | 2016-03-22 14:56 | 208K | |
![[ ]](/icons/layout.gif) | ENVIRO+ HD 5W-30 SEPTEMBER 2014.pdf | 2015-03-20 12:06 | 173K | |
![[ ]](/icons/layout.gif) | ENVIRO+HYBRID 0W-16 DECEMBER 2015.pdf | 2015-12-08 14:05 | 515K | |
![[ ]](/icons/layout.gif) | ENVIRO+HYBRID 0W-16 JANUARY 2015.pdf | 2015-01-27 11:36 | 323K | |
![[ ]](/icons/layout.gif) | ENVIRO+HYBRID 0W-16 MARCH 2015.pdf | 2015-03-04 16:44 | 321K | |
![[ ]](/icons/layout.gif) | ENVIRO+HYBRID 0W-16 MAY 2015.pdf | 2015-05-06 10:35 | 390K | |
![[ ]](/icons/layout.gif) | ENVIRO+HYBRID 0W-16 NOVEMBER 2015.pdf | 2015-11-30 08:36 | 390K | |
![[ ]](/icons/layout.gif) | ENVIRO PLUS 5W-40 April 2012.pdf | 2012-04-24 13:01 | 109K | |
![[ ]](/icons/layout.gif) | ENVIRO PLUS 10W-40 APRIL 2017.pdf | 2017-04-24 11:45 | 559K | |
![[ ]](/icons/layout.gif) | ENVIRO PLUS 10W-40 April 2012.pdf | 2012-04-23 17:29 | 93K | |
![[ ]](/icons/layout.gif) | ENVIRO PLUS 10W-40 FEBRUARY 2016.pdf | 2016-02-18 11:35 | 341K | |
![[ ]](/icons/layout.gif) | ENVIRO PLUS 10W-40 JULY 2015.pdf | 2015-07-06 15:54 | 287K | |
![[ ]](/icons/layout.gif) | ENVIRO PLUS 10W-40 MARCH 2015.pdf | 2015-03-24 15:55 | 287K | |
![[ ]](/icons/layout.gif) | ENVIRO PLUS 10W-40 MARCH 2016.pdf | 2016-03-22 14:46 | 357K | |
![[ ]](/icons/layout.gif) | ENVIRO PLUS 10W-40 SEPTEMBER 2015.pdf | 2015-09-09 16:33 | 341K | |
![[ ]](/icons/layout.gif) | ENVIRO PLUS C4 MARCH 2015.pdf | 2015-03-26 12:08 | 378K | |
![[ ]](/icons/layout.gif) | ENVIRO PLUS GF-5 April 2012.pdf | 2012-04-12 16:25 | 135K | |
![[ ]](/icons/layout.gif) | ENVIRO PLUS K3 APRIL 2017.pdf | 2017-03-29 16:20 | 276K | |
![[ ]](/icons/layout.gif) | ENVIRO PLUS K3 MARCH 2017.pdf | 2017-03-23 15:56 | 347K | |
![[ ]](/icons/layout.gif) | ENVIRO PLUS K3 MAY 2016.pdf | 2016-10-27 10:51 | 278K | |
![[ ]](/icons/layout.gif) | EVERYDAY 5W-30 April 2013.pdf | 2013-04-16 17:43 | 240K | |
![[ ]](/icons/layout.gif) | EVERYDAY 5W-30 Aug 2012.pdf | 2012-08-15 08:38 | 203K | |
![[ ]](/icons/layout.gif) | EVERYDAY 5W-30 August 2012.pdf | 2012-08-31 15:32 | 203K | |
![[ ]](/icons/layout.gif) | EVERYDAY 5W-30 July 2013.pdf | 2013-09-17 10:40 | 319K | |
![[ ]](/icons/layout.gif) | EVERYDAY 5W-30 NOVEMBER 2014.pdf | 2014-11-24 12:03 | 321K | |
![[ ]](/icons/layout.gif) | EVERYDAY 5W-30 SEPTEMBER 2014.pdf | 2014-09-01 12:45 | 320K | |
![[ ]](/icons/layout.gif) | EVERYDAY 10W-30 April 2013.pdf | 2013-04-16 17:44 | 253K | |
![[ ]](/icons/layout.gif) | EVERYDAY 10W-30 Aug 2012.pdf | 2012-08-15 08:47 | 202K | |
![[ ]](/icons/layout.gif) | EVERYDAY 10W-30 JULY 2014.pdf | 2014-07-18 12:42 | 410K | |
![[ ]](/icons/layout.gif) | EVERYDAY 10W-30 NOVEMBER 2014.pdf | 2014-11-24 12:08 | 320K | |
![[ ]](/icons/layout.gif) | EVERYDAY 10W-30 SEPTEMBER 2013.pdf | 2013-09-17 10:56 | 319K | |
![[ ]](/icons/layout.gif) | EVERYDAY 10W-30 SEPTEMBER 2014.pdf | 2014-09-01 12:49 | 320K | |
![[ ]](/icons/layout.gif) | EVERYDAY 15W-40 April 2013.pdf | 2013-04-16 17:43 | 254K | |
![[ ]](/icons/layout.gif) | EVERYDAY 15W-40 Aug 2012.pdf | 2012-08-15 08:48 | 201K | |
![[ ]](/icons/layout.gif) | EVERYDAY 15W-40 FEBRUARY 2015.pdf | 2015-02-10 12:36 | 303K | |
![[ ]](/icons/layout.gif) | EVERYDAY 15W-40 JULY 2014.pdf | 2014-07-18 12:41 | 400K | |
![[ ]](/icons/layout.gif) | EVERYDAY 15W-40 SEPTEMBER 2013.pdf | 2013-09-17 11:32 | 305K | |
![[ ]](/icons/layout.gif) | EVERYDAY 15W-40 SEPTEMBER 2014.pdf | 2014-09-01 12:30 | 303K | |
![[ ]](/icons/layout.gif) | EVERYDAY 20W-50 APRIL 2014.pdf | 2014-04-16 12:19 | 307K | |
![[ ]](/icons/layout.gif) | EVERYDAY 20W-50 April 2013.pdf | 2013-04-16 17:44 | 240K | |
![[ ]](/icons/layout.gif) | EVERYDAY 20W-50 Aug 2012.pdf | 2012-08-15 08:49 | 201K | |
![[ ]](/icons/layout.gif) | EVERYDAY 20W-50 FEBRUARY 2015.pdf | 2015-02-10 12:42 | 303K | |
![[ ]](/icons/layout.gif) | EVERYDAY 20W-50 SEPTEMBER 2013.pdf | 2013-09-17 12:15 | 306K | |
![[ ]](/icons/layout.gif) | EVERYDAY 20W-50 SEPTEMBER 2014.pdf | 2014-09-01 12:33 | 304K | |
![[ ]](/icons/layout.gif) | EVERYDAY DRIVING 5W-30 MARCH 2015.pdf | 2015-03-26 12:22 | 321K | |
![[ ]](/icons/layout.gif) | EVERYDAY DRIVING 5W-30 SEPTEMBER 2015.pdf | 2015-09-09 11:57 | 342K | |
![[ ]](/icons/layout.gif) | EVERYDAY DRIVING 10W-30 MARCH 2015.pdf | 2015-03-26 12:26 | 321K | |
![[ ]](/icons/layout.gif) | EVERYDAY DRIVING 10W-30 SEPTEMBER 2015.pdf | 2015-09-09 12:04 | 342K | |
![[ ]](/icons/layout.gif) | EVERYDAY DRIVING 15W-40 MARCH 2015.pdf | 2015-03-26 12:34 | 315K | |
![[ ]](/icons/layout.gif) | EVERYDAY DRIVING 15W-40 SEPTEMBER 2015.pdf | 2015-09-09 17:12 | 304K | |
![[ ]](/icons/layout.gif) | EVERYDAY DRIVING 20W-50 MARCH 2015.pdf | 2015-03-26 12:42 | 315K | |
![[ ]](/icons/layout.gif) | EVERYDAY DRIVING OILS Oct 2011.pdf | 2011-12-15 20:50 | 149K | |
![[ ]](/icons/layout.gif) | EVERYDAY FULL SYNTHETIC 5W-30 FEB 2013.pdf | 2014-02-12 09:07 | 346K | |
![[ ]](/icons/layout.gif) | EVERYDAY FULL SYNTHETIC 5W-30 JUNE 2014.pdf | 2014-10-01 17:06 | 346K | |
![[ ]](/icons/layout.gif) | EVERYDAY FULL SYNTHETIC 10W-40 JUNE 2014.pdf | 2014-10-01 17:25 | 315K | |
![[ ]](/icons/layout.gif) | EVERYDAY PLUS 5W-40 APRIL 2015.pdf | 2015-04-28 10:37 | 253K | |
![[ ]](/icons/layout.gif) | EVERYDAY PLUS 5W-40 Aug 2012.pdf | 2012-08-14 17:57 | 189K | |
![[ ]](/icons/layout.gif) | EVERYDAY PLUS 5W-40 JULY 2014.pdf | 2014-07-18 08:57 | 433K | |
![[ ]](/icons/layout.gif) | EVERYDAY PLUS 5W-40 June 2012.pdf | 2012-07-02 15:56 | 92K | |
![[ ]](/icons/layout.gif) | EVERYDAY PLUS 5W-40 SEPTEMBER 2013.pdf | 2013-09-17 09:56 | 192K | |
![[ ]](/icons/layout.gif) | EVERYDAY PLUS 10W-40 APRIL 2015.pdf | 2015-04-28 09:33 | 261K | |
![[ ]](/icons/layout.gif) | EVERYDAY PLUS 10W-40 Aug 2012.pdf | 2012-08-14 17:58 | 189K | |
![[ ]](/icons/layout.gif) | EVERYDAY PLUS 10W-40 JULY 2014.pdf | 2014-07-18 08:58 | 429K | |
![[ ]](/icons/layout.gif) | EVERYDAY PLUS 10W-40 JUNE 2012.pdf | 2012-07-02 16:28 | 92K | |
![[ ]](/icons/layout.gif) | EVERYDAY PLUS 10W-40 MARCH 2015.pdf | 2015-03-26 10:29 | 261K | |
![[ ]](/icons/layout.gif) | EVERYDAY PLUS 10W-40 SEPTEMBER 2013.pdf | 2013-09-17 09:56 | 197K | |
![[ ]](/icons/layout.gif) | EVERYDAY PLUS 15W-40 APRIL 2015.pdf | 2015-04-28 10:40 | 255K | |
![[ ]](/icons/layout.gif) | EVERYDAY PLUS 15W-40 Aug 2012.pdf | 2012-08-14 17:59 | 189K | |
![[ ]](/icons/layout.gif) | EVERYDAY PLUS 15W-40 JULY 2014.pdf | 2014-07-18 08:58 | 432K | |
![[ ]](/icons/layout.gif) | EVERYDAY PLUS 15W-40 May 2012.pdf | 2012-07-02 16:30 | 92K | |
![[ ]](/icons/layout.gif) | EVERYDAY PLUS 15W-40 NOVEMBER 2015.pdf | 2015-11-23 08:17 | 273K | |
![[ ]](/icons/layout.gif) | EVERYDAY PLUS 15W-40 SEPTEMBER 2013.pdf | 2013-09-17 09:55 | 191K | |
![[ ]](/icons/layout.gif) | EXP0W-20 SPORT JAN 2016.pdf | 2016-10-27 12:22 | 250K | |
![[ ]](/icons/layout.gif) | EXP 0W-20 SPORT MARCH 2017.pdf | 2017-03-23 15:59 | 375K | |
![[ ]](/icons/layout.gif) | EXP0W-30 SPORT JAN 2016.pdf | 2016-10-27 12:20 | 250K | |
![[ ]](/icons/layout.gif) | EXP 0W-30 SPORT MARCH 2017.pdf | 2017-03-23 15:56 | 376K | |
![[ ]](/icons/layout.gif) | EXP5W-40 RACING JAN 2016.pdf | 2016-10-27 12:21 | 252K | |
![[ ]](/icons/layout.gif) | EXP 5W-40 RACING MARCH 2017.pdf | 2017-03-23 15:58 | 380K | |
![[ ]](/icons/layout.gif) | EXP10W-50 RACING JAN 2016.pdf | 2016-10-27 12:21 | 253K | |
![[ ]](/icons/layout.gif) | EXP 10W-50 RACING MARCH 2017.pdf | 2017-03-23 15:57 | 380K | |
![[ ]](/icons/layout.gif) | EXP SUPA DSL 10W-30 FEB 2017.pdf | 2017-03-23 16:00 | 441K | |
![[ ]](/icons/layout.gif) | EXTREME PRESSURE GREASE JULY 2014.pdf | 2014-07-21 09:43 | 181K | |
![[ ]](/icons/layout.gif) | EXTREME PRESSURE GREASE JULY 2015.pdf | 2015-07-03 11:47 | 180K | |
![[ ]](/icons/layout.gif) | EXTREME PRESSURE GREASE Oct 2011.pdf | 2011-12-15 20:50 | 144K | |
![[ ]](/icons/layout.gif) | Enduro.pdf | 2011-12-15 20:50 | 71K | |
![[ ]](/icons/layout.gif) | Enduro JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | Enduro Rev 0.0 0912.pdf | 2012-12-07 15:26 | 126K | |
![[ ]](/icons/layout.gif) | Engine Flush January 2013.pdf | 2013-01-29 15:31 | 244K | |
![[ ]](/icons/layout.gif) | Engine Stop Leak January 2013.pdf | 2013-01-29 15:23 | 230K | |
![[ ]](/icons/layout.gif) | Enviro + 0W40 and 10W50.pdf | 2011-12-15 20:50 | 61K | |
![[ ]](/icons/layout.gif) | Enviro + 5W-30.pdf | 2011-12-15 20:50 | 61K | |
![[ ]](/icons/layout.gif) | Enviro+ 5W-30 Rev 1.0 0713.pdf | 2015-04-16 11:17 | 131K | |
![[ ]](/icons/layout.gif) | Enviro+ 5W-40 Ver 2.0 MSDS 0111.pdf | 2011-12-15 20:50 | 83K | |
![[ ]](/icons/layout.gif) | Enviro + Engine Oils.pdf | 2011-12-15 20:50 | 101K | |
![[ ]](/icons/layout.gif) | Enviro Plus 0W40 and 10W50 APRIL 2010.pdf | 2011-12-15 20:50 | 200K | |
![[ ]](/icons/layout.gif) | Enviro Plus 0W40 and 10W50 JAN 2010.pdf | 2011-12-15 20:50 | 200K | |
![[ ]](/icons/layout.gif) | Enviro Plus 0W40 and 10W50 JAN 2011.pdf | 2011-12-15 20:50 | 208K | |
![[ ]](/icons/layout.gif) | Enviro Plus 0W40 and 10W50 OCT 2010.pdf | 2011-12-15 20:50 | 98K | |
![[ ]](/icons/layout.gif) | Enviro Plus 5W-30 APRIL 2011.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | Enviro Plus 5W-30 JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | Enviro Plus 5W-30 JAN 2011.pdf | 2011-12-15 20:50 | 198K | |
![[ ]](/icons/layout.gif) | Enviro Plus 5W-40 April2011.pdf | 2011-12-15 20:50 | 96K | |
![[ ]](/icons/layout.gif) | Enviro Plus 5W-40 JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | Enviro Plus 5W-40 MAR 2011.pdf | 2011-12-15 20:50 | 201K | |
![[ ]](/icons/layout.gif) | Enviro Plus DL1 JAN 2011.pdf | 2011-12-15 20:50 | 226K | |
![[ ]](/icons/layout.gif) | Enviro Plus GF5 APRIL 2011.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | Enviro Plus GF5 JAN 2011.pdf | 2011-12-15 20:50 | 227K | |
![[ ]](/icons/layout.gif) | Euro 15.pdf | 2011-12-15 20:50 | 101K | |
![[ ]](/icons/layout.gif) | Euro 25.pdf | 2011-12-15 20:50 | 98K | |
![[ ]](/icons/layout.gif) | Euro 25 JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | Everyday Diesel FX April 2013.pdf | 2013-04-17 15:54 | 192K | |
![[ ]](/icons/layout.gif) | Everyday Diesel FX September 2013.pdf | 2013-09-17 16:01 | 277K | |
![[ ]](/icons/layout.gif) | Everyday Driving Oils JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | Everyday Driving Oils JAN 2011.pdf | 2011-12-15 20:50 | 229K | |
![[ ]](/icons/layout.gif) | Everyday Driving Oils JUNE 2010.pdf | 2011-12-15 20:50 | 88K | |
![[ ]](/icons/layout.gif) | Everyday Driving oils.pdf | 2011-12-15 20:50 | 134K | |
![[ ]](/icons/layout.gif) | Everyday Euro Oils OCT 2011.pdf | 2011-12-15 20:50 | 186K | |
![[ ]](/icons/layout.gif) | Everyday Full Synthetic 5W-40 April 2011.pdf | 2011-12-15 20:50 | 93K | |
![[ ]](/icons/layout.gif) | Everyday Full Synthetic 5W-40 JAN 2011.pdf | 2011-12-15 20:50 | 228K | |
![[ ]](/icons/layout.gif) | Everyday Full Synthetic 10W-40 Aug 2012.pdf | 2012-08-15 09:12 | 202K | |
![[ ]](/icons/layout.gif) | Everyday Full Synthetic 10W-40 Jan 2011.pdf | 2011-12-15 20:50 | 202K | |
![[ ]](/icons/layout.gif) | Everyday Full Synthetic 10W-40 July 2013.pdf | 2013-07-09 17:22 | 313K | |
![[ ]](/icons/layout.gif) | Everyday Full Synthetic 10W-40 October 2012.pdf | 2012-10-02 08:27 | 203K | |
![[ ]](/icons/layout.gif) | Everyday Full Synthetic 10W-40 September 2012.pdf | 2012-09-11 12:36 | 202K | |
![[ ]](/icons/layout.gif) | Everyday Full Synthetic Oils.pdf | 2011-12-15 20:50 | 53K | |
![[ ]](/icons/layout.gif) | Everyday Full Synthetic Oils JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | Everyday Full Synthetic Oils OCT 2010.pdf | 2011-12-15 20:50 | 92K | |
![[ ]](/icons/layout.gif) | Everyday Full Sythetic Oils.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | Extreme Pressure Grease.pdf | 2011-12-15 20:50 | 87K | |
![[ ]](/icons/layout.gif) | Extreme Pressure Grease JAN 2010.pdf | 2011-12-15 20:50 | 213K | |
![[ ]](/icons/layout.gif) | Extreme Pressure Grease March 2011.pdf | 2011-12-15 20:50 | 86K | |
![[ ]](/icons/layout.gif) | FD01 FLUID December 2012.pdf | 2012-12-07 15:07 | 197K | |
![[ ]](/icons/layout.gif) | FD01 FLUID FEBRUARY 2015.pdf | 2015-02-10 10:22 | 163K | |
![[ ]](/icons/layout.gif) | FD01 FLUID JUNE 2010.pdf | 2011-12-15 20:50 | 89K | |
![[ ]](/icons/layout.gif) | FD01 FLUID MAY 2015.pdf | 2015-05-11 11:36 | 214K | |
![[ ]](/icons/layout.gif) | FD01 FLUID NOVEMBER 2103.pdf | 2013-11-28 15:31 | 163K | |
![[ ]](/icons/layout.gif) | FD01 FLUID Oct 2011.pdf | 2011-12-15 20:50 | 142K | |
![[ ]](/icons/layout.gif) | FLEET-GEAR 10 MAY 2015.pdf | 2015-05-11 10:52 | 215K | |
![[ ]](/icons/layout.gif) | FLEET-GEAR 30 MAY 2015.pdf | 2015-05-11 11:00 | 214K | |
![[ ]](/icons/layout.gif) | FLEET-GEAR 50 MAY 2015.pdf | 2015-05-11 11:15 | 214K | |
![[ ]](/icons/layout.gif) | FLEET GEAR 10 - NOVEMBER 2013.pdf | 2013-11-27 16:09 | 198K | |
![[ ]](/icons/layout.gif) | FLEET GEAR 30 - NOVEMBER 2013.pdf | 2013-11-27 16:03 | 196K | |
![[ ]](/icons/layout.gif) | FLEETGEAR 30and50, FLEETRANSC4 August 2012.pdf | 2012-08-21 10:28 | 202K | |
![[ ]](/icons/layout.gif) | FLEETGEAR 30and50, FLEETRANSC4 December 2012.pdf | 2012-12-07 15:15 | 201K | |
![[ ]](/icons/layout.gif) | FLEETGEAR 30and50, FLEETRANSC4 Oct 2011.pdf | 2011-12-15 20:50 | 152K | |
![[ ]](/icons/layout.gif) | FLEET GEAR 50 - NOVEMBER 2013.pdf | 2013-11-27 16:00 | 197K | |
![[ ]](/icons/layout.gif) | FULL SYNTHETIC 5W-30 APRIL 2016.pdf | 2016-04-13 11:18 | 353K | |
![[ ]](/icons/layout.gif) | FULL SYNTHETIC 5W-30 AUGUST 2016.pdf | 2016-08-26 09:51 | 384K | |
![[ ]](/icons/layout.gif) | FULL SYNTHETIC 5W-30 JANUARY 2017.pdf | 2017-01-20 08:46 | 384K | |
![[ ]](/icons/layout.gif) | FULL SYNTHETIC 5W-30 JUNE 2015.pdf | 2015-06-18 09:42 | 345K | |
![[ ]](/icons/layout.gif) | FULL SYNTHETIC 5W-30 MARCH 2015.pdf | 2015-03-26 13:21 | 324K | |
![[ ]](/icons/layout.gif) | FULL SYNTHETIC 5W-30 MAY 2016.pdf | 2016-05-02 10:19 | 354K | |
![[ ]](/icons/layout.gif) | FULL SYNTHETIC 5W-30 NOVEMBER 2015.pdf | 2015-11-23 10:40 | 354K | |
![[ ]](/icons/layout.gif) | FULL SYNTHETIC 10W-40 AUGUST 2015.pdf | 2015-07-31 15:39 | 307K | |
![[ ]](/icons/layout.gif) | FULL SYNTHETIC 10W-40 JUNE 2015.pdf | 2015-06-18 10:04 | 307K | |
![[ ]](/icons/layout.gif) | FULL SYNTHETIC 10W-40 MARCH 2015.pdf | 2015-03-26 13:25 | 306K | |
![[ ]](/icons/layout.gif) | FULL SYNTHETIC 10W-40 MARCH 2017.pdf | 2017-03-31 09:41 | 446K | |
![[ ]](/icons/layout.gif) | FULL SYNTHETIC 10W-40 MAY 2016.pdf | 2016-05-02 10:21 | 342K | |
![[ ]](/icons/layout.gif) | FULL SYNTHETIC 10W-40 NOVEMBER 2015.pdf | 2015-11-23 10:55 | 353K | |
![[ ]](/icons/layout.gif) | FULL SYNTHETIC 10W-40 NOVEMBER 2016.pdf | 2016-11-10 16:27 | 343K | |
![[ ]](/icons/layout.gif) | Fleet-Gear 50 Plus.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | Fleet Gear 30 and 50, Fleet-trans C4.pdf | 2011-12-15 20:50 | 139K | |
![[ ]](/icons/layout.gif) | Fleet Gear 30 and 50, Fleet-trans C4 JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | Fleet Gear 30 and 50 Fleet-trans C4 MAR 2010.pdf | 2011-12-15 20:50 | 185K | |
![[ ]](/icons/layout.gif) | Fleetgear 10, 30 & 50 April 2013.pdf | 2013-04-18 15:05 | 204K | |
![[ ]](/icons/layout.gif) | Foam Filter Cleaner June 2013.pdf | 2013-09-10 16:41 | 283K | |
![[ ]](/icons/layout.gif) | Foam Filter Oil November 2012.pdf | 2012-11-21 11:44 | 198K | |
![[ ]](/icons/layout.gif) | GEARBOX OIL 30 AND 40 MAY 2015.pdf | 2015-05-06 17:01 | 259K | |
![[ ]](/icons/layout.gif) | GEARBOX OIL 30 and 40 AUGUST 2013.pdf | 2013-08-28 11:54 | 237K | |
![[ ]](/icons/layout.gif) | GEARBOX OIL 30 and 40 Feb 2012.pdf | 2012-02-23 13:30 | 114K | |
![[ ]](/icons/layout.gif) | GEARBOX OIL 30and40Oct 2011.pdf | 2011-12-15 20:50 | 141K | |
![[ ]](/icons/layout.gif) | GEAR OIL 80W-90 AUGUST 2013.pdf | 2013-09-24 15:23 | 247K | |
![[ ]](/icons/layout.gif) | GEAR OIL 80W-90 August 2012.pdf | 2012-08-29 15:56 | 206K | |
![[ ]](/icons/layout.gif) | GEAR OIL 80W-90 December 2012.pdf | 2012-12-17 09:43 | 204K | |
![[ ]](/icons/layout.gif) | GEAR OIL 80W-90 JUNE 2015.pdf | 2015-06-23 13:04 | 259K | |
![[ ]](/icons/layout.gif) | GEAR OIL 80W-90 MARCH 2015.pdf | 2015-03-30 12:23 | 249K | |
![[ ]](/icons/layout.gif) | GEAR OIL 85W-140 AUGUST 2013.pdf | 2013-09-24 16:16 | 249K | |
![[ ]](/icons/layout.gif) | GEAR OIL 85W-140 August 2012.pdf | 2012-08-29 16:04 | 206K | |
![[ ]](/icons/layout.gif) | GEAR OIL 85W-140 December 2012.pdf | 2012-12-17 09:43 | 204K | |
![[ ]](/icons/layout.gif) | GEAR OIL 85W-140 JUNE 2015.pdf | 2015-06-23 13:12 | 263K | |
![[ ]](/icons/layout.gif) | GEAR OIL 85W-140 MARCH 2015.pdf | 2015-03-16 11:02 | 248K | |
![[ ]](/icons/layout.gif) | GEAR OIL 140 AUGUST 2013.pdf | 2013-09-24 16:16 | 183K | |
![[ ]](/icons/layout.gif) | GEAR OIL 140 August 2012.pdf | 2012-08-29 16:10 | 203K | |
![[ ]](/icons/layout.gif) | GEAR OIL 140 JUNE 2015.pdf | 2015-06-23 13:25 | 203K | |
![[ ]](/icons/layout.gif) | GEAR OIL 140 MARCH 2015.pdf | 2015-03-30 12:18 | 186K | |
![[ ]](/icons/layout.gif) | GEAROIL EP Oct 2011.pdf | 2011-12-15 20:50 | 146K | |
![[ ]](/icons/layout.gif) | GEAROIL SYN 220 Oct 2011.pdf | 2011-12-15 20:50 | 146K | |
![[ ]](/icons/layout.gif) | GENERAL PURPOSE TWO STROKE MAY 2012.pdf | 2012-05-07 16:09 | 117K | |
![[ ]](/icons/layout.gif) | GENERAL PURPOSE TWO STROKE OIL August 2012.pdf | 2012-08-28 12:27 | 213K | |
![[ ]](/icons/layout.gif) | GENERAL PURPOSE TWO STROKE OIL Oct 2011.pdf | 2011-12-15 20:50 | 143K | |
![[ ]](/icons/layout.gif) | GLASS CLEANER APRIL 2015.pdf | 2015-04-02 13:00 | 292K | |
![[ ]](/icons/layout.gif) | GLASS CLEANER DECEMBER 2015.pdf | 2015-12-08 14:42 | 369K | |
![[ ]](/icons/layout.gif) | GLASS CLEANER OCTOBER 2014.pdf | 2014-10-09 09:16 | 295K | |
![[ ]](/icons/layout.gif) | GLASS CLEANER SEPTEMBER 2013.pdf | 2013-10-10 17:05 | 296K | |
![[ ]](/icons/layout.gif) | GLASS CLEANER SEPTEMBER 2016.pdf | 2016-09-01 09:36 | 370K | |
![[ ]](/icons/layout.gif) | GRAPHITE GREASE JULY 2014.pdf | 2014-07-21 17:12 | 166K | |
![[ ]](/icons/layout.gif) | GRAPHITE GREASE MAY 2015.pdf | 2015-05-07 09:56 | 166K | |
![[ ]](/icons/layout.gif) | GRAPHITE GREASE MAY 2016.pdf | 2016-05-16 11:23 | 181K | |
![[ ]](/icons/layout.gif) | GRAPHITE GREASE Oct 2011.pdf | 2011-12-15 20:50 | 140K | |
![[ ]](/icons/layout.gif) | Gear Box 30 and 40.pdf | 2011-12-15 20:50 | 93K | |
![[ ]](/icons/layout.gif) | Gear Box 30 and 40 JAN 2010.pdf | 2011-12-15 20:50 | 192K | |
![[ ]](/icons/layout.gif) | Gear Box 30 and 40 JAN 2011.pdf | 2011-12-15 20:50 | 200K | |
![[ ]](/icons/layout.gif) | Gear Oil EP.pdf | 2011-12-15 20:50 | 131K | |
![[ ]](/icons/layout.gif) | Gear Oil EP220 REV 0 4 0910.pdf | 2011-12-15 20:50 | 85K | |
![[ ]](/icons/layout.gif) | Gear Oil EP JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | Gear Oil Syn 220.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | Gear Oil Syn 220 JAN 2010.pdf | 2011-12-15 20:50 | 193K | |
![[ ]](/icons/layout.gif) | General Purpose Two Stroke Oil JAN 2010.pdf | 2011-12-15 20:50 | 193K | |
![[ ]](/icons/layout.gif) | Graphite Grease.pdf | 2011-12-15 20:50 | 83K | |
![[ ]](/icons/layout.gif) | Graphite Grease JAN 2010.pdf | 2011-12-15 20:50 | 191K | |
![[ ]](/icons/layout.gif) | Greenkeepers Two Stroke.pdf | 2011-12-15 20:50 | 66K | |
![[ ]](/icons/layout.gif) | Greenkeepers Two Stroke JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | HARVESTER HYDRAULIC OIL MARCH 2016.pdf | 2016-04-29 12:39 | 187K | |
![[ ]](/icons/layout.gif) | HD GEAR OIL 80W-90 JANUARY 2016.pdf | 2016-11-07 15:25 | 195K | |
![[ ]](/icons/layout.gif) | HD GEAR OIL 80W-90 SEPTEMBER 2015.pdf | 2015-09-18 12:49 | 173K | |
![[ ]](/icons/layout.gif) | HD GEAR OIL 85W-140 JANUARY 2016.pdf | 2016-01-08 15:04 | 173K | |
![[ ]](/icons/layout.gif) | HD GEAR OIL 85W-140 SEPTEMBER 2015.pdf | 2015-09-18 13:04 | 173K | |
![[ ]](/icons/layout.gif) | HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL APRIL 2017.pdf | 2017-04-12 12:39 | 243K | |
![[ ]](/icons/layout.gif) | HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL AUGUST 2016.pdf | 2016-08-19 11:34 | 232K | |
![[ ]](/icons/layout.gif) | HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL Aug 2012.pdf | 2012-08-27 14:17 | 193K | |
![[ ]](/icons/layout.gif) | HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL August 2012.pdf | 2012-08-30 17:05 | 192K | |
![[ ]](/icons/layout.gif) | HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL JAN 2012.pdf | 2012-08-06 13:33 | 156K | |
![[ ]](/icons/layout.gif) | HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL JANUARY 2015.pdf | 2015-01-14 09:43 | 229K | |
![[ ]](/icons/layout.gif) | HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL MAY 2015.pdf | 2015-05-01 11:22 | 215K | |
![[ ]](/icons/layout.gif) | HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL NOVEMBER 2013.pdf | 2013-11-13 10:56 | 245K | |
![[ ]](/icons/layout.gif) | HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL NOVEMBER 2014.pdf | 2014-11-26 16:59 | 285K | |
![[ ]](/icons/layout.gif) | HD LONGLIFE EC01 ANTI FREEZE ANTI BOIL Nov 2011.pdf | 2011-12-15 20:50 | 156K | |
![[ ]](/icons/layout.gif) | HD OIL APRIL 2015.pdf | 2015-05-01 10:52 | 282K | |
![[ ]](/icons/layout.gif) | HD OIL FEB 2014.pdf | 2014-02-25 17:14 | 224K | |
![[ ]](/icons/layout.gif) | HD OIL FEB 2015.pdf | 2015-02-23 17:27 | 283K | |
![[ ]](/icons/layout.gif) | HD OIL FEBRUARY 2016.pdf | 2016-02-18 09:57 | 282K | |
![[ ]](/icons/layout.gif) | HD OIL Nov 2011.pdf | 2011-12-15 20:50 | 141K | |
![[ ]](/icons/layout.gif) | HD OIL Oct 2011.pdf | 2011-12-15 20:50 | 141K | |
![[ ]](/icons/layout.gif) | HD Oil.pdf | 2011-12-15 20:50 | 89K | |
![[ ]](/icons/layout.gif) | HD Oil JAN 2010.pdf | 2011-12-15 20:50 | 193K | |
![[ ]](/icons/layout.gif) | HDPS FLUID APRIL 2010.pdf | 2011-12-15 20:50 | 181K | |
![[ ]](/icons/layout.gif) | HDPS FLUID Aug 2012.pdf | 2012-08-30 14:50 | 200K | |
![[ ]](/icons/layout.gif) | HDPS FLUID JUNE 2015.pdf | 2015-06-23 14:57 | 173K | |
![[ ]](/icons/layout.gif) | HDPS FLUID MARCH 2015.pdf | 2015-03-30 14:26 | 173K | |
![[ ]](/icons/layout.gif) | HDPS FLUID March 2013.pdf | 2013-03-18 16:06 | 198K | |
![[ ]](/icons/layout.gif) | HDPS FLUID Oct 2011.pdf | 2011-12-15 20:50 | 142K | |
![[ ]](/icons/layout.gif) | HDPS FLUID SEPTEMBER 2013.pdf | 2013-09-10 11:30 | 154K | |
![[ ]](/icons/layout.gif) | HEAVY DUTY AFAB 5050 PREMIX Aug 2012.pdf | 2012-08-27 14:15 | 205K | |
![[ ]](/icons/layout.gif) | HEAVY DUTY AFAB 5050 PREMIX August 2012.pdf | 2012-08-30 16:52 | 202K | |
![[ ]](/icons/layout.gif) | HEAVY DUTY AFAB 5050 PREMIX Feb 2012.pdf | 2012-02-14 10:02 | 152K | |
![[ ]](/icons/layout.gif) | HEAVY DUTY AFAB 5050 PREMIX July 2012.pdf | 2012-07-31 15:55 | 204K | |
![[ ]](/icons/layout.gif) | HEAVY DUTY AFAB 5050 PREMIX March 2012.pdf | 2012-03-21 13:51 | 117K | |
![[ ]](/icons/layout.gif) | HEAVY DUTY AFAB 5050 PREMIX Oct 2011.pdf | 2011-12-15 20:50 | 151K | |
![[ ]](/icons/layout.gif) | HEAVY DUTY BEARING GREASE - MARCH 2016.pdf | 2016-03-30 11:57 | 188K | |
![[ ]](/icons/layout.gif) | HEAVY DUTY BEARING GREASE - OCTOBER 2015.pdf | 2015-11-05 10:50 | 188K | |
![[ ]](/icons/layout.gif) | HEAVY DUTY BEARING GREASE OCTOBER 2016.pdf | 2016-11-18 15:28 | 206K | |
![[ ]](/icons/layout.gif) | HERITAGE ENGINE OILS.pdf | 2011-12-15 20:50 | 90K | |
![[ ]](/icons/layout.gif) | HERITAGE LTM and MTH AUGUST 2013.pdf | 2013-08-28 11:50 | 227K | |
![[ ]](/icons/layout.gif) | HERITAGE LTM and MTH DECEMBER 2015.pdf | 2015-12-11 08:51 | 265K | |
![[ ]](/icons/layout.gif) | HERITAGE LTM and MTH FEBRUARY 2016.pdf | 2016-02-17 15:48 | 265K | |
![[ ]](/icons/layout.gif) | HERITAGE LTM and MTH MARCH 2014.pdf | 2014-03-28 16:40 | 227K | |
![[ ]](/icons/layout.gif) | HERITAGE LTMandMTH Oct 2011.pdf | 2011-12-15 20:50 | 143K | |
![[ ]](/icons/layout.gif) | HIGH TEMPERATURE WHEEL BEARING GREASE APRIL 2015.pdf | 2015-04-02 11:50 | 189K | |
![[ ]](/icons/layout.gif) | HIGH TEMPERATURE WHEEL BEARING GREASE JULY 2015.pdf | 2015-07-03 11:40 | 189K | |
![[ ]](/icons/layout.gif) | HIGH TEMP WHEEL BEARING GREASE JULY 2014.pdf | 2014-07-18 16:38 | 426K | |
![[ ]](/icons/layout.gif) | HIGH TEMP WHEEL BEARING GREASE JULY 2015.pdf | 2015-07-29 15:31 | 189K | |
![[ ]](/icons/layout.gif) | HIGH TEMP WHEEL BEARING GREASE JUNE 2012.pdf | 2012-07-19 16:59 | 203K | |
![[ ]](/icons/layout.gif) | HIGH TEMP WHEEL BEARING GREASE Mar 2012.pdf | 2012-03-28 11:58 | 116K | |
![[ ]](/icons/layout.gif) | HIGH TEMP WHEEL BEARING GREASE Oct 2011.pdf | 2011-12-15 20:50 | 146K | |
![[ ]](/icons/layout.gif) | HIPER TWO STROKE Oct 2011.pdf | 2011-12-15 20:50 | 143K | |
![[ ]](/icons/layout.gif) | HONING OIL.pdf | 2011-12-15 20:50 | 65K | |
![[ ]](/icons/layout.gif) | HONING OIL DECEMBER 2014.pdf | 2014-12-02 13:25 | 229K | |
![[ ]](/icons/layout.gif) | HONING OIL JAN 2010.pdf | 2011-12-15 20:50 | 193K | |
![[ ]](/icons/layout.gif) | HONING OIL Oct 2011.pdf | 2011-12-15 20:50 | 139K | |
![[ ]](/icons/layout.gif) | HONING OIL SEPTEMBER 2016.pdf | 2016-09-15 13:54 | 216K | |
![[ ]](/icons/layout.gif) | HPR 0 0W30 AUG 2012.pdf | 2012-08-09 08:19 | 216K | |
![[ ]](/icons/layout.gif) | HPR 0 0W30 August 2012.pdf | 2012-08-30 10:03 | 212K | |
![[ ]](/icons/layout.gif) | HPR 0 0W30 MAY 2012.pdf | 2012-05-23 12:46 | 114K | |
![[ ]](/icons/layout.gif) | HPR 0 0W30 Mar 2012.pdf | 2012-03-05 14:58 | 129K | |
![[ ]](/icons/layout.gif) | HPR 0 0W30 Oct 2011.pdf | 2011-12-15 20:50 | 208K | |
![[ ]](/icons/layout.gif) | HPR 0 August 2012.pdf | 2012-08-30 11:03 | 212K | |
![[ ]](/icons/layout.gif) | HPR 0 DECEMBER 2015.pdf | 2017-01-23 11:36 | 409K | |
![[ ]](/icons/layout.gif) | HPR 0 JANUARY 2015.pdf | 2015-01-20 14:27 | 295K | |
![[ ]](/icons/layout.gif) | HPR 0 June 2013.pdf | 2013-06-07 16:40 | 308K | |
![[ ]](/icons/layout.gif) | HPR 0 MARCH 2015.pdf | 2015-03-19 13:15 | 292K | |
![[ ]](/icons/layout.gif) | HPR 0 NOVEMEBR 2014.pdf | 2014-11-24 11:20 | 292K | |
![[ ]](/icons/layout.gif) | HPR 0 September 2014.pdf | 2014-09-19 12:15 | 291K | |
![[ ]](/icons/layout.gif) | HPR 0W30 APRIL 2011 .pdf | 2011-12-15 20:50 | 92K | |
![[ ]](/icons/layout.gif) | HPR 0W30 JAN 2011.pdf | 2011-12-15 20:50 | 227K | |
![[ ]](/icons/layout.gif) | HPR05.pdf | 2016-07-20 15:18 | 404K | |
![[ ]](/icons/layout.gif) | HPR 5.pdf | 2011-12-15 20:50 | 73K | |
![[ ]](/icons/layout.gif) | HPR 5 APRIL 2017.pdf | 2017-04-24 12:53 | 659K | |
![[ ]](/icons/layout.gif) | HPR 5 AUG 2012.pdf | 2012-08-13 14:34 | 221K | |
![[ ]](/icons/layout.gif) | HPR 5 DECEMBER 2015.pdf | 2015-12-07 10:04 | 404K | |
![[ ]](/icons/layout.gif) | HPR 5 Dec 2011.pdf | 2012-02-22 15:24 | 226K | |
![[ ]](/icons/layout.gif) | HPR 5 FEBRUARY 2015.pdf | 2015-02-03 13:35 | 313K | |
![[ ]](/icons/layout.gif) | HPR 5 FEBRUARY 2016.pdf | 2016-02-18 12:06 | 404K | |
![[ ]](/icons/layout.gif) | HPR 5 FEBRUARY 2017.pdf | 2017-03-09 17:11 | 546K | |
![[ ]](/icons/layout.gif) | HPR 5 JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | HPR 5 JAN 2011.pdf | 2011-12-15 20:50 | 201K | |
![[ ]](/icons/layout.gif) | HPR 5 JANUARY 2017.pdf | 2017-01-24 10:03 | 435K | |
![[ ]](/icons/layout.gif) | HPR 5 JUNE 2012.pdf | 2012-07-19 17:00 | 221K | |
![[ ]](/icons/layout.gif) | HPR 5 June 2013.pdf | 2013-06-06 10:38 | 306K | |
![[ ]](/icons/layout.gif) | HPR 5 MARCH 2015.pdf | 2015-03-19 13:11 | 308K | |
![[ ]](/icons/layout.gif) | HPR 5 MAY 2012.pdf | 2012-05-23 13:25 | 114K | |
![[ ]](/icons/layout.gif) | HPR 5 Mar 2012.pdf | 2012-03-30 16:06 | 145K | |
![[ ]](/icons/layout.gif) | HPR 5 NOVEMBER 2014.pdf | 2014-11-24 15:23 | 298K | |
![[ ]](/icons/layout.gif) | HPR 5 November 2013.pdf | 2013-11-19 14:34 | 294K | |
![[ ]](/icons/layout.gif) | HPR 5 OCTOBER 2015.pdf | 2015-10-19 09:17 | 309K | |
![[ ]](/icons/layout.gif) | HPR 5 Oct 2011.pdf | 2011-12-15 20:50 | 226K | |
![[ ]](/icons/layout.gif) | HPR 5 September 2012.pdf | 2012-09-19 09:06 | 216K | |
![[ ]](/icons/layout.gif) | HPR 5 September 2014.pdf | 2014-09-19 15:07 | 295K | |
![[ ]](/icons/layout.gif) | HPR 10.pdf | 2011-12-15 20:50 | 73K | |
![[ ]](/icons/layout.gif) | HPR 10 AUG 2012.pdf | 2012-08-09 08:23 | 219K | |
![[ ]](/icons/layout.gif) | HPR 10 DECEMBER 2015.pdf | 2015-12-07 10:04 | 379K | |
![[ ]](/icons/layout.gif) | HPR 10 FEBRUARY 2015.pdf | 2015-02-11 14:59 | 290K | |
![[ ]](/icons/layout.gif) | HPR 10 JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | HPR 10 JAN 2011.pdf | 2011-12-15 20:50 | 202K | |
![[ ]](/icons/layout.gif) | HPR 10 JUNE 2012.pdf | 2012-07-19 17:01 | 219K | |
![[ ]](/icons/layout.gif) | HPR 10 June 2013.pdf | 2013-06-06 10:39 | 300K | |
![[ ]](/icons/layout.gif) | HPR 10 MARCH 2015.pdf | 2015-03-19 13:12 | 301K | |
![[ ]](/icons/layout.gif) | HPR 10 MAY 2011.pdf | 2012-05-23 13:58 | 93K | |
![[ ]](/icons/layout.gif) | HPR 10 NOVEMBER 2016.pdf | 2016-11-10 15:48 | 413K | |
![[ ]](/icons/layout.gif) | HPR 10 Oct 2011.pdf | 2011-12-15 20:50 | 211K | |
![[ ]](/icons/layout.gif) | HPR 10 September 2012.pdf | 2012-09-19 09:22 | 215K | |
![[ ]](/icons/layout.gif) | HPR 10 September 2014.pdf | 2014-09-10 14:39 | 292K | |
![[ ]](/icons/layout.gif) | HPR 15.pdf | 2011-12-15 20:50 | 68K | |
![[ ]](/icons/layout.gif) | HPR 15 AUG 2012.pdf | 2012-08-09 08:24 | 217K | |
![[ ]](/icons/layout.gif) | HPR 15 DECEMBER 2015.pdf | 2015-12-07 10:05 | 373K | |
![[ ]](/icons/layout.gif) | HPR 15 JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | HPR 15 JAN 2011.pdf | 2011-12-15 20:50 | 200K | |
![[ ]](/icons/layout.gif) | HPR 15 JUNE 2012.pdf | 2012-07-19 17:01 | 217K | |
![[ ]](/icons/layout.gif) | HPR 15 June 2013.pdf | 2013-06-06 10:39 | 287K | |
![[ ]](/icons/layout.gif) | HPR 15 MARCH 2015.pdf | 2015-03-19 13:12 | 294K | |
![[ ]](/icons/layout.gif) | HPR 15 MAY 2012.pdf | 2012-05-03 15:44 | 113K | |
![[ ]](/icons/layout.gif) | HPR 15 NOVEMBER 2016.pdf | 2016-11-10 12:13 | 399K | |
![[ ]](/icons/layout.gif) | HPR 15 Nov 2011.pdf | 2011-12-15 20:50 | 209K | |
![[ ]](/icons/layout.gif) | HPR 15 September 2012.pdf | 2012-09-19 09:29 | 213K | |
![[ ]](/icons/layout.gif) | HPR 15 September 2014.pdf | 2014-09-10 14:39 | 288K | |
![[ ]](/icons/layout.gif) | HPR 30.pdf | 2011-12-15 20:50 | 71K | |
![[ ]](/icons/layout.gif) | HPR 30 DECEMBER 2015.pdf | 2015-12-07 10:06 | 377K | |
![[ ]](/icons/layout.gif) | HPR 30 FEBRUARY 2015.pdf | 2015-02-12 10:13 | 298K | |
![[ ]](/icons/layout.gif) | HPR 30 JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | HPR 30 JULY 2015.pdf | 2015-07-20 11:19 | 298K | |
![[ ]](/icons/layout.gif) | HPR 30 JUNE 2011.pdf | 2011-12-15 20:50 | 91K | |
![[ ]](/icons/layout.gif) | HPR 30 June 2013.pdf | 2013-06-06 10:37 | 236K | |
![[ ]](/icons/layout.gif) | HPR 30 MARCH 2015.pdf | 2015-03-19 13:12 | 298K | |
![[ ]](/icons/layout.gif) | HPR 30 MAY 2012.pdf | 2012-05-23 14:10 | 87K | |
![[ ]](/icons/layout.gif) | HPR 30 NOVEMBER 2014.pdf | 2014-11-05 16:20 | 298K | |
![[ ]](/icons/layout.gif) | HPR 30 NOVEMBER 2016.pdf | 2016-11-10 12:30 | 381K | |
![[ ]](/icons/layout.gif) | HPR 30 OCTOBER 2014.pdf | 2014-10-16 14:31 | 285K | |
![[ ]](/icons/layout.gif) | HPR 30 Oct 2011.pdf | 2011-12-15 20:50 | 208K | |
![[ ]](/icons/layout.gif) | HPR 30 SEPTEMBER 2014.pdf | 2014-09-19 16:28 | 285K | |
![[ ]](/icons/layout.gif) | HPR 30 September 2012.pdf | 2012-09-20 11:10 | 195K | |
![[ ]](/icons/layout.gif) | HPR 40.pdf | 2011-12-15 20:50 | 69K | |
![[ ]](/icons/layout.gif) | HPR 40 AUGUST 2016.pdf | 2016-08-26 16:12 | 378K | |
![[ ]](/icons/layout.gif) | HPR 40 DECEMBER 2015.pdf | 2015-12-07 10:06 | 371K | |
![[ ]](/icons/layout.gif) | HPR 40 JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | HPR 40 JULY 2014.pdf | 2014-07-17 10:50 | 454K | |
![[ ]](/icons/layout.gif) | HPR 40 JUNE 2015.pdf | 2015-06-17 15:20 | 348K | |
![[ ]](/icons/layout.gif) | HPR 40 June 2013.pdf | 2013-06-06 10:40 | 249K | |
![[ ]](/icons/layout.gif) | HPR 40 MARCH 2015.pdf | 2015-03-19 13:13 | 349K | |
![[ ]](/icons/layout.gif) | HPR 40 MAY 2012.pdf | 2012-05-23 15:29 | 92K | |
![[ ]](/icons/layout.gif) | HPR 40 Oct 2011.pdf | 2011-12-15 20:50 | 203K | |
![[ ]](/icons/layout.gif) | HPR 40 SEPTEMBER 2014.pdf | 2014-09-19 16:38 | 349K | |
![[ ]](/icons/layout.gif) | HPR 50.pdf | 2011-12-15 20:50 | 66K | |
![[ ]](/icons/layout.gif) | HPR 50 APRIL 2010.pdf | 2011-12-15 20:50 | 182K | |
![[ ]](/icons/layout.gif) | HPR 50 AUGUST 2016.pdf | 2016-08-26 16:18 | 379K | |
![[ ]](/icons/layout.gif) | HPR 50 DECEMEBR 2015.pdf | 2015-12-07 10:07 | 385K | |
![[ ]](/icons/layout.gif) | HPR 50 JAN 2011.pdf | 2011-12-15 20:50 | 199K | |
![[ ]](/icons/layout.gif) | HPR 50 JUNE 2015.pdf | 2015-06-17 15:13 | 373K | |
![[ ]](/icons/layout.gif) | HPR 50 June 2013.pdf | 2013-06-06 10:40 | 238K | |
![[ ]](/icons/layout.gif) | HPR 50 MAR 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | HPR 50 MARCH 2015.pdf | 2015-03-19 13:13 | 288K | |
![[ ]](/icons/layout.gif) | HPR 50 MAY 2012.pdf | 2012-05-23 15:37 | 91K | |
![[ ]](/icons/layout.gif) | HPR 50 Oct 2011.pdf | 2011-12-15 20:50 | 202K | |
![[ ]](/icons/layout.gif) | HPR 50 September 2014.pdf | 2014-09-19 17:15 | 282K | |
![[ ]](/icons/layout.gif) | HPR DIESEL - DECEMBER 2014.pdf | 2014-12-10 16:35 | 297K | |
![[ ]](/icons/layout.gif) | HPR DIESEL.pdf | 2011-12-15 20:50 | 70K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 5 - DECEMBER 2014.pdf | 2014-12-09 10:02 | 322K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 5.pdf | 2011-12-15 20:50 | 72K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 5 AUG 2012.pdf | 2012-08-09 08:27 | 219K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 5 April 2012.pdf | 2012-04-03 13:07 | 129K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 5 DECEMBER 2015.pdf | 2015-12-07 12:23 | 454K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 5 JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 5 JULY 2012.pdf | 2012-07-19 17:02 | 219K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 5 JUNE 2010.pdf | 2011-12-15 20:50 | 202K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 5 JUNE 2016.pdf | 2016-06-16 12:32 | 520K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 5 MARCH 2015.pdf | 2015-03-19 13:13 | 319K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 5 MARCH 2017.pdf | 2017-03-10 11:08 | 626K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 5 MAY 2012.pdf | 2012-05-23 15:43 | 94K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 5 NOVEMBER 2016.pdf | 2016-11-09 08:52 | 530K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 5 November 2012.pdf | 2012-12-04 17:57 | 215K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 5 Oct 2011.pdf | 2011-12-15 20:50 | 212K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 10 - DECEMBER 2014.pdf | 2014-12-09 10:23 | 301K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 10 DECEMBER 2015.pdf | 2015-12-07 12:25 | 471K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 10 JUNE 2016.pdf | 2016-06-16 12:34 | 471K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 10 MARCH 2015.pdf | 2015-03-19 13:15 | 300K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 10 NOVEMBER 2016.pdf | 2016-11-09 09:01 | 519K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 15 - DECEMBER 2014.pdf | 2014-12-09 10:34 | 310K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 15.pdf | 2011-12-15 20:50 | 72K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 15 AUG 2012.pdf | 2012-08-09 08:29 | 219K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 15 AUGUST 2010.pdf | 2011-12-15 20:50 | 200K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 15 DECEMBER 2015.pdf | 2015-12-07 12:23 | 536K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 15 JULY 2012.pdf | 2012-07-19 17:02 | 219K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 15 JUNE 2016.pdf | 2016-06-16 12:37 | 536K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 15 MAR 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 15 MARCH 2015.pdf | 2015-03-19 13:14 | 310K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 15 MAY 2012.pdf | 2012-05-23 15:57 | 114K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 15 NOVEMBER 2016.pdf | 2016-11-10 17:28 | 540K | |
![[ ]](/icons/layout.gif) | HPR DIESEL 15 Oct 2011.pdf | 2011-12-15 20:50 | 216K | |
![[ ]](/icons/layout.gif) | HPR DIESEL AUG 2012.pdf | 2012-08-09 08:31 | 216K | |
![[ ]](/icons/layout.gif) | HPR DIESEL August 2012.pdf | 2012-09-05 09:37 | 211K | |
![[ ]](/icons/layout.gif) | HPR DIESEL DECEMBER 2015.pdf | 2015-12-07 12:25 | 436K | |
![[ ]](/icons/layout.gif) | HPR DIESEL December 2012.pdf | 2012-12-14 17:34 | 211K | |
![[ ]](/icons/layout.gif) | HPR DIESEL February 2012.pdf | 2012-02-14 10:02 | 210K | |
![[ ]](/icons/layout.gif) | HPR DIESEL JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | HPR DIESEL JULY 2012.pdf | 2012-07-19 17:03 | 216K | |
![[ ]](/icons/layout.gif) | HPR DIESEL JULY 2015.pdf | 2015-07-20 11:28 | 353K | |
![[ ]](/icons/layout.gif) | HPR DIESEL MARCH 2015.pdf | 2015-03-19 13:14 | 297K | |
![[ ]](/icons/layout.gif) | HPR DIESEL MAY 2016.pdf | 2016-05-09 16:42 | 434K | |
![[ ]](/icons/layout.gif) | HPR DIESEL NOVEMBER 2016.pdf | 2016-11-25 12:04 | 512K | |
![[ ]](/icons/layout.gif) | HPR DIESEL Oct 2011.pdf | 2011-12-15 20:50 | 210K | |
![[ ]](/icons/layout.gif) | HPR Diesel 5 June 2013.pdf | 2013-06-17 10:22 | 299K | |
![[ ]](/icons/layout.gif) | HPR Diesel 10 June 2013.pdf | 2013-06-17 10:36 | 289K | |
![[ ]](/icons/layout.gif) | HPR Diesel 15 June 2013.pdf | 2013-06-17 10:24 | 293K | |
![[ ]](/icons/layout.gif) | HPR Diesel June 2013.pdf | 2013-06-17 10:27 | 286K | |
![[ ]](/icons/layout.gif) | HPR GAS - DECEMBER 2014.pdf | 2014-12-10 16:19 | 291K | |
![[ ]](/icons/layout.gif) | HPR GAS.pdf | 2011-12-15 20:50 | 72K | |
![[ ]](/icons/layout.gif) | HPR GAS 10 - DECEMBER 2014.pdf | 2014-12-10 16:52 | 297K | |
![[ ]](/icons/layout.gif) | HPR GAS 10.pdf | 2011-12-15 20:50 | 72K | |
![[ ]](/icons/layout.gif) | HPR GAS 10 AUG 2012.pdf | 2012-08-09 08:33 | 217K | |
![[ ]](/icons/layout.gif) | HPR GAS 10 AUGUST 2016.pdf | 2016-08-26 16:30 | 372K | |
![[ ]](/icons/layout.gif) | HPR GAS 10 April 2012.pdf | 2012-04-12 13:05 | 114K | |
![[ ]](/icons/layout.gif) | HPR GAS 10 DECEMBER 2015.pdf | 2015-12-07 10:32 | 409K | |
![[ ]](/icons/layout.gif) | HPR GAS 10 February 2012.pdf | 2012-02-14 10:24 | 211K | |
![[ ]](/icons/layout.gif) | HPR GAS 10 JULY 2015.pdf | 2015-07-13 15:52 | 370K | |
![[ ]](/icons/layout.gif) | HPR GAS 10 JUNE 2012.pdf | 2012-07-19 17:03 | 217K | |
![[ ]](/icons/layout.gif) | HPR GAS 10 MAR 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | HPR GAS 10 MAR 2011.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | HPR GAS 10 MARCH 2015.pdf | 2015-03-19 13:14 | 300K | |
![[ ]](/icons/layout.gif) | HPR GAS 10 MAY 2012.pdf | 2012-05-23 16:58 | 114K | |
![[ ]](/icons/layout.gif) | HPR GAS 10 NOVEMBER 2016.pdf | 2016-11-10 11:57 | 373K | |
![[ ]](/icons/layout.gif) | HPR GAS 10 Oct 2011.pdf | 2011-12-15 20:50 | 211K | |
![[ ]](/icons/layout.gif) | HPR GAS AUG 2012.pdf | 2012-08-09 08:34 | 214K | |
![[ ]](/icons/layout.gif) | HPR GAS AUGUST 2016.pdf | 2016-08-26 16:35 | 381K | |
![[ ]](/icons/layout.gif) | HPR GAS April 2012.pdf | 2012-04-12 13:41 | 113K | |
![[ ]](/icons/layout.gif) | HPR GAS DECEMBER 2015.pdf | 2015-12-07 10:37 | 413K | |
![[ ]](/icons/layout.gif) | HPR GAS February 2012.pdf | 2012-03-29 15:26 | 209K | |
![[ ]](/icons/layout.gif) | HPR GAS JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | HPR GAS JUNE 2010.pdf | 2011-12-15 20:50 | 89K | |
![[ ]](/icons/layout.gif) | HPR GAS JUNE 2012.pdf | 2012-07-19 17:03 | 214K | |
![[ ]](/icons/layout.gif) | HPR GAS MARCH 2015.pdf | 2015-03-19 13:16 | 292K | |
![[ ]](/icons/layout.gif) | HPR GAS MAY 2012.pdf | 2012-05-23 17:42 | 113K | |
![[ ]](/icons/layout.gif) | HPR GAS NOVEMBER 2016.pdf | 2016-11-10 12:16 | 409K | |
![[ ]](/icons/layout.gif) | HPR GAS Oct 2011.pdf | 2011-12-15 20:50 | 208K | |
![[ ]](/icons/layout.gif) | HPR Gas 10 June 2013.pdf | 2013-06-17 13:11 | 288K | |
![[ ]](/icons/layout.gif) | HPR Gas June 2013.pdf | 2013-06-17 13:13 | 287K | |
![[ ]](/icons/layout.gif) | HPSO.pdf | 2011-12-15 20:50 | 65K | |
![[ ]](/icons/layout.gif) | HPSO APRIL 2015.pdf | 2015-04-01 17:10 | 271K | |
![[ ]](/icons/layout.gif) | HPSO December 2012.pdf | 2012-12-13 17:15 | 198K | |
![[ ]](/icons/layout.gif) | HPSO JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | HPSO JULY 2013.pdf | 2013-07-31 16:58 | 252K | |
![[ ]](/icons/layout.gif) | HPSO March 2013.pdf | 2013-03-19 10:05 | 199K | |
![[ ]](/icons/layout.gif) | HPSO Oct 2011.pdf | 2011-12-15 20:50 | 148K | |
![[ ]](/icons/layout.gif) | HTO 32 68 100 DECEMBER 2015.pdf | 2015-12-09 11:40 | 213K | |
![[ ]](/icons/layout.gif) | HTO 32 68 100 January 2014.pdf | 2014-01-24 10:35 | 202K | |
![[ ]](/icons/layout.gif) | HYDRAULIC JACK OIL DECEMBER 2014.pdf | 2014-12-11 10:32 | 163K | |
![[ ]](/icons/layout.gif) | HYDRAULIC JACK OIL OCT 2011.pdf | 2011-12-15 20:50 | 146K | |
![[ ]](/icons/layout.gif) | HYPOID 80W-90 MAY 2015.pdf | 2015-05-07 15:02 | 233K | |
![[ ]](/icons/layout.gif) | HYPOID 80W-90 MAY 2016.pdf | 2016-05-16 09:29 | 232K | |
![[ ]](/icons/layout.gif) | HYPOID 80W90 February 2012.pdf | 2012-02-14 10:26 | 148K | |
![[ ]](/icons/layout.gif) | HYPOID 80W90 OCT 2011.pdf | 2011-12-15 20:50 | 148K | |
![[ ]](/icons/layout.gif) | HYPOID 85W-140 MAY 2015.pdf | 2015-05-07 15:26 | 234K | |
![[ ]](/icons/layout.gif) | HYPOID 85W-140 MAY 2016.pdf | 2016-05-16 09:36 | 233K | |
![[ ]](/icons/layout.gif) | HYPOID 85W140 February 2012.pdf | 2012-02-14 10:28 | 147K | |
![[ ]](/icons/layout.gif) | HYPOID 85W140 OCT 2011.pdf | 2011-12-15 20:50 | 147K | |
![[ ]](/icons/layout.gif) | HYPOID 140 OCT 2011.pdf | 2011-12-15 20:50 | 143K | |
![[ ]](/icons/layout.gif) | Heavy Duty AFAB.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | Heavy Duty AFAB 50% Premix.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | Heavy Duty AFAB 50 Premix.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | Heavy Duty AFAB 50 Premix JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | Heritage Engine Oil MTH_PSD.pdf | 2011-12-15 20:50 | 87K | |
![[ ]](/icons/layout.gif) | Heritage LTM AND MTH JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | Heritage LTM AND MTH MAY 2010.pdf | 2011-12-15 20:50 | 200K | |
![[ ]](/icons/layout.gif) | Heritage LTM and MTH.pdf | 2011-12-15 20:50 | 87K | |
![[ ]](/icons/layout.gif) | HiPer Two Stroke JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | HiPer Two Stroke JAN 2011.pdf | 2011-12-15 20:50 | 199K | |
![[ ]](/icons/layout.gif) | HiPer Two Strokel.pdf | 2011-12-15 20:50 | 63K | |
![[ ]](/icons/layout.gif) | High Temperature Wheel Bearing Grease JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | High Temperature Wheel Bearing Grease March 2011.pdf | 2011-12-15 20:50 | 87K | |
![[ ]](/icons/layout.gif) | High temperature grease_docx.pdf | 2011-12-15 20:50 | 66K | |
![[ ]](/icons/layout.gif) | Hydralic Jack Oil.pdf | 2011-12-15 20:50 | 67K | |
![[ ]](/icons/layout.gif) | Hydraulic Jack Oil JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | Hypoid 80W-90.pdf | 2011-12-15 20:50 | 82K | |
![[ ]](/icons/layout.gif) | Hypoid 80W-90 JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | Hypoid 80W-90 OCT 2010.pdf | 2011-12-15 20:50 | 200K | |
![[ ]](/icons/layout.gif) | Hypoid 85W-140.pdf | 2011-12-15 20:50 | 77K | |
![[ ]](/icons/layout.gif) | Hypoid 85W-140 JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | Hypoid 85W-140 OCT 2010.pdf | 2011-12-15 20:50 | 201K | |
![[ ]](/icons/layout.gif) | Hypoid 140.pdf | 2011-12-15 20:50 | 69K | |
![[ ]](/icons/layout.gif) | Hypoid 140 JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | INDGEAR MP90 - DECEMBER 2015.pdf | 2015-12-09 12:18 | 234K | |
![[ ]](/icons/layout.gif) | INDGEAR MP90 April 2013.pdf | 2013-04-22 14:04 | 202K | |
![[ ]](/icons/layout.gif) | INDGREASE 100 LXEP2 AUGUST 2014.pdf | 2014-08-18 10:49 | 241K | |
![[ ]](/icons/layout.gif) | INDGREASE 100 LXEP2 December 2012.pdf | 2012-12-10 16:32 | 202K | |
![[ ]](/icons/layout.gif) | INDGREASE 100LX EP2 MARCH 2015.pdf | 2015-04-02 12:20 | 241K | |
![[ ]](/icons/layout.gif) | INDGREASE 100LX EP2 MAY 2016.pdf | 2016-05-24 14:35 | 216K | |
![[ ]](/icons/layout.gif) | INDGREASE 100 LXEP2 Oct 2011.pdf | 2011-12-15 20:50 | 147K | |
![[ ]](/icons/layout.gif) | INDGREASE 100 LXEP2 September 2013.pdf | 2013-09-12 14:26 | 204K | |
![[ ]](/icons/layout.gif) | INDGREASE 1615WR GREASE AUGUST 2014.pdf | 2014-08-25 14:51 | 169K | |
![[ ]](/icons/layout.gif) | INDGREASE 1615WR GREASE FEBRUARY 2016.pdf | 2016-02-03 14:52 | 169K | |
![[ ]](/icons/layout.gif) | INDGREASE 1615WR GREASE JULY 2015.pdf | 2015-07-03 14:34 | 169K | |
![[ ]](/icons/layout.gif) | INDGREASE BM3 AUGUST 2014.pdf | 2014-08-21 17:07 | 218K | |
![[ ]](/icons/layout.gif) | INDGREASE BM3 JANUARY 2015.pdf | 2015-01-12 12:26 | 218K | |
![[ ]](/icons/layout.gif) | INDGREASE BM3 JULY 2015.pdf | 2015-07-03 15:02 | 218K | |
![[ ]](/icons/layout.gif) | INDGREASE BM3 Oct 2011.pdf | 2011-12-15 20:50 | 148K | |
![[ ]](/icons/layout.gif) | INDGREASE CX 152WR - DECEMBER 2015.pdf | 2015-12-09 12:34 | 240K | |
![[ ]](/icons/layout.gif) | INDGREASE CX 152 WR - MARCH 2015.pdf | 2015-03-23 09:23 | 208K | |
![[ ]](/icons/layout.gif) | INDGREASE CX 152WR - MARCH 2015.pdf | 2015-04-02 12:29 | 208K | |
![[ ]](/icons/layout.gif) | INDGREASE CXOG-05 AUGUST 2014.pdf | 2014-08-21 14:45 | 236K | |
![[ ]](/icons/layout.gif) | INDGREASE CXOG-05 MAY 2015.pdf | 2015-05-08 16:28 | 242K | |
![[ ]](/icons/layout.gif) | INDGREASE LCX 1100 AUGUST 2014.pdf | 2014-08-21 12:26 | 174K | |
![[ ]](/icons/layout.gif) | INDGREASE LITH EP 0 APRIL 2016.pdf | 2016-04-15 11:30 | 166K | |
![[ ]](/icons/layout.gif) | INDGREASE LITH EP 0 AUGUST 2014.pdf | 2014-08-18 09:31 | 162K | |
![[ ]](/icons/layout.gif) | INDGREASE LITH EP 0 Aug 2012.pdf | 2012-09-04 15:51 | 199K | |
![[ ]](/icons/layout.gif) | INDGREASE LITH EP 0 August 2013.pdf | 2013-08-26 14:28 | 199K | |
![[ ]](/icons/layout.gif) | INDGREASE LITH EP 0 DECEMBER 2014.pdf | 2014-12-01 13:52 | 162K | |
![[ ]](/icons/layout.gif) | INDGREASE LITH EP 0 DECEMBER 2015.pdf | 2015-12-09 12:45 | 165K | |
![[ ]](/icons/layout.gif) | INDGREASE LITH EP 0 December 2012.pdf | 2012-12-10 17:56 | 199K | |
![[ ]](/icons/layout.gif) | INDGREASE LITH EP 0 JULY 2015.pdf | 2015-07-03 14:02 | 162K | |
![[ ]](/icons/layout.gif) | INDGREASE LITH EP 2 DECEMBER 2014.pdf | 2015-01-12 13:30 | 155K | |
![[ ]](/icons/layout.gif) | INDGREASE LITH EP2 DECEMBER 2015.pdf | 2015-12-09 12:50 | 158K | |
![[ ]](/icons/layout.gif) | INDGREASE LITH EP 2 MARCH 2015.pdf | 2015-03-02 09:30 | 156K | |
![[ ]](/icons/layout.gif) | INDGREASE LITH EP2 MAY 2015.pdf | 2015-05-08 10:35 | 157K | |
![[ ]](/icons/layout.gif) | INDGREASE LITH R3 AUGUST 2014.pdf | 2014-08-25 15:52 | 216K | |
![[ ]](/icons/layout.gif) | INDGREASE LITH R3 December 2012.pdf | 2012-12-10 16:17 | 200K | |
![[ ]](/icons/layout.gif) | INDGREASE LITH R3 JULY 2015.pdf | 2015-07-03 14:18 | 216K | |
![[ ]](/icons/layout.gif) | INDGREASE MOLY HT AUGUST 2014.pdf | 2014-09-10 14:43 | 255K | |
![[ ]](/icons/layout.gif) | INDGREASE MOLY HT JUNE 2014.pdf | 2014-06-17 12:30 | 252K | |
![[ ]](/icons/layout.gif) | INDGREASE MOLY HT MARCH 2015.pdf | 2015-03-02 09:28 | 256K | |
![[ ]](/icons/layout.gif) | INDGREASE MOLY HT MAY 2015.pdf | 2016-05-03 14:15 | 244K | |
![[ ]](/icons/layout.gif) | INDGREASE MOLY HT OCTOBER 2014.pdf | 2014-10-24 15:22 | 255K | |
![[ ]](/icons/layout.gif) | INDUS COMPRESSOL OIL 2KH SERIES June 2012.pdf | 2012-06-12 16:01 | 118K | |
![[ ]](/icons/layout.gif) | INDUS COMPRESSOR OIL 2KH SERIES DECEMBER 2014.pdf | 2014-12-02 11:54 | 223K | |
![[ ]](/icons/layout.gif) | INDUS COMPRESSOR OIL 4KH August 2012.pdf | 2012-08-21 16:03 | 188K | |
![[ ]](/icons/layout.gif) | INDUS COMPRESSOR OIL 4KH Oct 2011.pdf | 2011-12-15 20:50 | 148K | |
![[ ]](/icons/layout.gif) | INDUS COMPRESSOR OIL 4KH SERIES DECEMBER 2014.pdf | 2014-12-02 12:19 | 363K | |
![[ ]](/icons/layout.gif) | INDUS COMPRESSOR OIL 4KH SERIES FEBRUARY 2016.pdf | 2016-02-24 12:52 | 325K | |
![[ ]](/icons/layout.gif) | INDUS COMPRESSOR OIL 4KH SERIES MAY 2015.pdf | 2015-05-15 09:30 | 325K | |
![[ ]](/icons/layout.gif) | INDUS COMPRESSOR OIL 4KH Series April 2013.pdf | 2013-04-22 16:28 | 191K | |
![[ ]](/icons/layout.gif) | INDUS COMPRESSOR OIL 4KH Series December 2012.pdf | 2012-12-10 13:41 | 189K | |
![[ ]](/icons/layout.gif) | INDUS COMPRESSOR OIL 4KH Series July 2014.pdf | 2014-07-15 10:45 | 193K | |
![[ ]](/icons/layout.gif) | INDUS COMPRESSOR OIL 8KH Oct 2011.pdf | 2011-12-15 20:50 | 149K | |
![[ ]](/icons/layout.gif) | INDUS FRIGOL ABS 68 - DECEMBER 2014.pdf | 2014-12-17 09:28 | 221K | |
![[ ]](/icons/layout.gif) | INDUS FRIGOL ABS 68 - FEBRUARY 2015.pdf | 2015-02-20 12:12 | 206K | |
![[ ]](/icons/layout.gif) | INDUS GEAR OIL EJ - DECEMBER 2014.pdf | 2014-12-09 17:02 | 163K | |
![[ ]](/icons/layout.gif) | INDUS GEAR OIL EJ December 2012.pdf | 2012-12-10 10:13 | 198K | |
![[ ]](/icons/layout.gif) | INDUS GEAR OIL EP - DECEMBER 2014.pdf | 2014-12-10 11:39 | 203K | |
![[ ]](/icons/layout.gif) | INDUS GEAR OIL EP August 2012.pdf | 2012-08-21 15:48 | 206K | |
![[ ]](/icons/layout.gif) | INDUS GEAR OIL EP MAY 2012.pdf | 2012-05-11 12:55 | 116K | |
![[ ]](/icons/layout.gif) | INDUS GEAROIL EP Oct 2011.pdf | 2011-12-15 20:50 | 146K | |
![[ ]](/icons/layout.gif) | INDUS GEAR OIL SYN 220, 320 - DECEMBER 2014.pdf | 2014-12-09 15:55 | 169K | |
![[ ]](/icons/layout.gif) | INDUS GEAR OIL SYN 220 - DECEMBER 2014.pdf | 2014-12-09 16:25 | 146K | |
![[ ]](/icons/layout.gif) | INDUS HV HYDRAULIC OIL APRIL 2016.pdf | 2016-04-26 09:21 | 214K | |
![[ ]](/icons/layout.gif) | INDUS HV HYDRAULIC OIL APRIL 2017.pdf | 2017-04-24 11:15 | 193K | |
![[ ]](/icons/layout.gif) | INDUS HV HYDRAULIC OIL AUGUST 2014.pdf | 2014-08-12 15:00 | 214K | |
![[ ]](/icons/layout.gif) | INDUS HV HYDRAULIC OIL April 2013.pdf | 2013-04-22 10:28 | 203K | |
![[ ]](/icons/layout.gif) | INDUS HV HYDRAULIC OIL August 2012.pdf | 2012-08-21 14:22 | 203K | |
![[ ]](/icons/layout.gif) | INDUS HV HYDRAULIC OIL DECEMBER 2014.pdf | 2014-12-05 13:18 | 214K | |
![[ ]](/icons/layout.gif) | INDUS HV HYDRAULIC OIL December 2011.pdf | 2011-12-15 20:50 | 149K | |
![[ ]](/icons/layout.gif) | INDUS HV HYDRAULIC OIL FEBRUARY 2014.pdf | 2014-02-18 12:00 | 214K | |
![[ ]](/icons/layout.gif) | INDUS HV HYDRAULIC OIL MAY 2016.pdf | 2016-05-03 14:36 | 181K | |
![[ ]](/icons/layout.gif) | INDUS HV HYDRAULIC OIL NOVEMBER 2013.pdf | 2013-11-14 15:47 | 211K | |
![[ ]](/icons/layout.gif) | INDUS HV HYDRAULIC OIL NOVEMBER 2014.pdf | 2014-11-19 12:14 | 215K | |
![[ ]](/icons/layout.gif) | INDUS HV HYDRAULIC OIL September 2012.pdf | 2012-10-01 12:28 | 203K | |
![[ ]](/icons/layout.gif) | INDUS INDGEAR B - DECEMBER 2014.pdf | 2014-12-10 13:08 | 160K | |
![[ ]](/icons/layout.gif) | INDUS INDGEAR B - DECEMBER 2015.pdf | 2015-12-09 13:05 | 174K | |
![[ ]](/icons/layout.gif) | INDUS INDGEAR B December 2012.pdf | 2012-12-10 09:33 | 201K | |
![[ ]](/icons/layout.gif) | INDUS MR 68 HYDRAULIC OIL April 2013.pdf | 2013-04-24 16:35 | 202K | |
![[ ]](/icons/layout.gif) | INDUS MR 68 HYDRAULIC OIL MAY 2016.pdf | 2016-05-17 10:28 | 188K | |
![[ ]](/icons/layout.gif) | INDUS MR 68 HYDRAULIC OIL NOVEMBER 2013.pdf | 2013-11-29 09:29 | 186K | |
![[ ]](/icons/layout.gif) | INDUS MR HYDRAULIC OIL December2011.pdf | 2013-11-28 15:14 | 150K | |
![[ ]](/icons/layout.gif) | INDUS PRO HYDRAULIC OILS DEC 2011.pdf | 2012-08-06 13:36 | 148K | |
![[ ]](/icons/layout.gif) | INDUS PRO HYDRAULIC OILS DECEMBER 2013.pdf | 2013-12-04 15:58 | 234K | |
![[ ]](/icons/layout.gif) | INDUS PRO HYDRAULIC OILS DECEMBER 2014.pdf | 2014-12-15 17:02 | 234K | |
![[ ]](/icons/layout.gif) | INDUS PRO HYDRAULIC OILS MAY 2015.pdf | 2015-05-27 09:48 | 232K | |
![[ ]](/icons/layout.gif) | INDUS PRO HYDRAULIC OILS OCTOBER 2015.pdf | 2015-10-21 17:34 | 203K | |
![[ ]](/icons/layout.gif) | INDUS TM 46 - DECEMBER 2014.pdf | 2014-12-10 17:23 | 166K | |
![[ ]](/icons/layout.gif) | INDUS TM 46 August 2012.pdf | 2012-09-03 11:51 | 203K | |
![[ ]](/icons/layout.gif) | INSECT REMOVER APRIL 2015.pdf | 2015-04-02 13:08 | 245K | |
![[ ]](/icons/layout.gif) | INSECT REMOVER DECEMBER 2015.pdf | 2015-12-08 15:08 | 322K | |
![[ ]](/icons/layout.gif) | INSECT REMOVER SEPTEMBER 2013.pdf | 2013-10-10 16:58 | 249K | |
![[ ]](/icons/layout.gif) | INSTANT CAR WASH NOVEMBER 2015.pdf | 2016-04-27 11:27 | 321K | |
![[ ]](/icons/layout.gif) | INSTANT INSECT REMOVER NOVEMBER 2016.pdf | 2016-11-18 11:42 | 315K | |
![[ ]](/icons/layout.gif) | INSTANT ODOUR ELIMINATOR NOVEMBER 2016.pdf | 2016-11-11 15:25 | 326K | |
![[ ]](/icons/layout.gif) | INSTANT SHINE DETAILER NOVEMBER 2015.pdf | 2016-04-27 16:31 | 298K | |
![[ ]](/icons/layout.gif) | INSTANT TYRE SHINE AEROSOL NOVEMBER 2015.pdf | 2016-04-27 11:21 | 291K | |
![[ ]](/icons/layout.gif) | INTERIOR CLEANER APRIL 2015.pdf | 2015-04-02 12:40 | 293K | |
![[ ]](/icons/layout.gif) | INTERIOR CLEANER JUNE 2015.pdf | 2015-06-26 11:13 | 350K | |
![[ ]](/icons/layout.gif) | INTERIOR CLEANER SEPTEMBER 2013.pdf | 2013-10-10 16:26 | 294K | |
![[ ]](/icons/layout.gif) | INTERIOR CLEANER SEPTEMBER 2016.pdf | 2016-09-01 14:00 | 377K | |
![[ ]](/icons/layout.gif) | Indgrease 1615WR December 2012.pdf | 2012-12-10 16:51 | 200K | |
![[ ]](/icons/layout.gif) | Indgrease 1615WR February 2013.pdf | 2013-02-07 13:18 | 200K | |
![[ ]](/icons/layout.gif) | Indgrease BM 3.pdf | 2011-12-15 20:50 | 137K | |
![[ ]](/icons/layout.gif) | Indgrease BM 3 JAN 2010.pdf | 2011-12-15 20:50 | 215K | |
![[ ]](/icons/layout.gif) | Indgrease CXOG-05 December 2012.pdf | 2012-12-10 17:46 | 203K | |
![[ ]](/icons/layout.gif) | Indgrease LCX 1100 December 2012.pdf | 2012-12-10 17:02 | 200K | |
![[ ]](/icons/layout.gif) | Indgrease LCX 1100 Rev 0.0 0812.pdf | 2012-12-10 17:00 | 120K | |
![[ ]](/icons/layout.gif) | Indgrease Moly HT April 2013.pdf | 2013-04-23 09:48 | 189K | |
![[ ]](/icons/layout.gif) | IndusFRHF.pdf | 2012-01-10 13:22 | 201K | |
![[ ]](/icons/layout.gif) | Indus HV.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | Indus HV JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | Indus HV March 2011.pdf | 2011-12-15 20:50 | 93K | |
![[ ]](/icons/layout.gif) | Japan 15.pdf | 2011-12-15 20:50 | 133K | |
![[ ]](/icons/layout.gif) | Japan 25.pdf | 2011-12-15 20:50 | 91K | |
![[ ]](/icons/layout.gif) | Japan 25 JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | KO2ST FULL SYNTHETIC TWO STROKE OIL MARCH 2015.pdf | 2015-04-29 10:28 | 307K | |
![[ ]](/icons/layout.gif) | LDAS APRIL 2011.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | LDAS APRIL 2015.pdf | 2015-04-01 16:58 | 222K | |
![[ ]](/icons/layout.gif) | LDAS FLUID AUGUST 2013.pdf | 2013-08-08 14:41 | 166K | |
![[ ]](/icons/layout.gif) | LDAS FLUID JULY 2013.pdf | 2013-07-31 17:04 | 166K | |
![[ ]](/icons/layout.gif) | LDAS FLUID MARCH 2015.pdf | 2015-03-30 16:43 | 222K | |
![[ ]](/icons/layout.gif) | LDAS FLUID MAY 2012.pdf | 2012-05-04 13:45 | 116K | |
![[ ]](/icons/layout.gif) | LDAS FLUID Oct 2011.pdf | 2011-12-15 20:50 | 157K | |
![[ ]](/icons/layout.gif) | LDAS JUNE 2015.pdf | 2015-06-24 17:07 | 236K | |
![[ ]](/icons/layout.gif) | LDAS MAR 2011.pdf | 2011-12-15 20:50 | 228K | |
![[ ]](/icons/layout.gif) | LDAS MAY 2016.pdf | 2017-01-24 11:26 | 236K | |
![[ ]](/icons/layout.gif) | LHM PLUS.pdf | 2011-12-15 20:50 | 91K | |
![[ ]](/icons/layout.gif) | LHM PLUS APRIL 2015.pdf | 2015-04-01 16:55 | 222K | |
![[ ]](/icons/layout.gif) | LHM PLUS JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | LHM PLUS JAN 2011.pdf | 2011-12-15 20:50 | 200K | |
![[ ]](/icons/layout.gif) | LHM PLUS JULY 2013.pdf | 2013-07-31 16:41 | 218K | |
![[ ]](/icons/layout.gif) | LHM PLUS JULY 2016.pdf | 2016-07-04 11:49 | 234K | |
![[ ]](/icons/layout.gif) | LHM PLUS JUNE 2015.pdf | 2015-06-24 16:15 | 234K | |
![[ ]](/icons/layout.gif) | LHM PLUS MAY 2011.pdf | 2011-12-15 20:50 | 90K | |
![[ ]](/icons/layout.gif) | LHM PLUS MAY 2016.pdf | 2016-05-13 10:42 | 234K | |
![[ ]](/icons/layout.gif) | LHM PLUS Oct 2011.pdf | 2011-12-15 20:50 | 154K | |
![[ ]](/icons/layout.gif) | LIMSLIP 85W-140 APRIL 2014.pdf | 2014-04-29 14:46 | 202K | |
![[ ]](/icons/layout.gif) | LIMSLIP 85W-140 MAY 2015.pdf | 2015-05-07 16:12 | 269K | |
![[ ]](/icons/layout.gif) | LIMSLIP 85W-140 MAY 2016.pdf | 2016-05-16 10:33 | 268K | |
![[ ]](/icons/layout.gif) | LIMSLIP 90, 854W140, 140 Oct 2011.pdf | 2011-12-15 20:50 | 149K | |
![[ ]](/icons/layout.gif) | LIMSLIP 90 MAY 2015.pdf | 2015-05-07 16:01 | 257K | |
![[ ]](/icons/layout.gif) | LIMSLIP 90 MAY 2016.pdf | 2016-05-16 10:02 | 257K | |
![[ ]](/icons/layout.gif) | LIMSLIP ADDITIVE FEBRUARY 2017.pdf | 2017-02-27 10:05 | 227K | |
![[ ]](/icons/layout.gif) | LIMSLIP ADDITIVE JUNE 2015.pdf | 2015-06-02 13:09 | 213K | |
![[ ]](/icons/layout.gif) | LIMSLIP ADDITIVE July 2012.pdf | 2012-07-24 09:56 | 202K | |
![[ ]](/icons/layout.gif) | LIMSLIP ADDITIVE MARCH 2015.pdf | 2015-03-30 13:02 | 213K | |
![[ ]](/icons/layout.gif) | LIMSLIP ADDITIVE Oct 2011.pdf | 2011-12-15 20:50 | 145K | |
![[ ]](/icons/layout.gif) | LIMSLIP ADDITIVE SEPTEMBER 2013.pdf | 2013-09-25 12:56 | 210K | |
![[ ]](/icons/layout.gif) | LZ 7906.pdf | 2011-12-15 20:50 | 82K | |
![[ ]](/icons/layout.gif) | LZ 7906 JAN 2010.pdf | 2011-12-15 20:50 | 193K | |
![[ ]](/icons/layout.gif) | LZ 7906 July 2012.pdf | 2012-07-24 10:06 | 202K | |
![[ ]](/icons/layout.gif) | LZ7906 Oct 2011.pdf | 2011-12-15 20:50 | 141K | |
![[ ]](/icons/layout.gif) | Limslip 90, 85-140 and 140.pdf | 2011-12-15 20:50 | 95K | |
![[ ]](/icons/layout.gif) | Limslip 90, 85W-140 and 140 April 2011.pdf | 2011-12-15 20:50 | 92K | |
![[ ]](/icons/layout.gif) | Limslip 90, 85W-140 and 140 JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | Limslip 90, 85W-140 and 140 JAN 2011.pdf | 2011-12-15 20:50 | 202K | |
![[ ]](/icons/layout.gif) | Limslip Additive.pdf | 2011-12-15 20:50 | 88K | |
![[ ]](/icons/layout.gif) | Limslip Additive JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | Long Life Inhibitor.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | MANUAL GEAR OIL 70 MAY 2012.pdf | 2012-05-01 13:38 | 117K | |
![[ ]](/icons/layout.gif) | MANUAL GEAR OIL 70 OCT 2011.pdf | 2011-12-15 20:50 | 151K | |
![[ ]](/icons/layout.gif) | MANUAL GEAR OIL 75 MAY 2012.pdf | 2012-05-01 13:56 | 115K | |
![[ ]](/icons/layout.gif) | MANUAL GEAR OIL 75 OCT 2011.pdf | 2011-12-15 20:50 | 151K | |
![[ ]](/icons/layout.gif) | MANUAL GEAR OIL 80.pdf | 2011-12-15 20:50 | 84K | |
![[ ]](/icons/layout.gif) | MANUAL GEAR OIL 80 OCT 2011.pdf | 2011-12-15 20:50 | 150K | |
![[ ]](/icons/layout.gif) | MAR CYL OIL 7050 DECEMBER 2014.pdf | 2014-12-15 10:10 | 156K | |
![[ ]](/icons/layout.gif) | MAR CYL OIL 7050 DECEMBER 2015.pdf | 2015-12-09 13:10 | 171K | |
![[ ]](/icons/layout.gif) | MARINE BIOMARINE TWO STROKE AUGUST 2014.pdf | 2014-08-07 12:52 | 237K | |
![[ ]](/icons/layout.gif) | MARINE BIOMARINE TWO STROKE DECEMBER 2013.pdf | 2013-12-20 16:36 | 256K | |
![[ ]](/icons/layout.gif) | MARINE BIOMARINE TWO STROKE FEBRUARY 2015.pdf | 2015-02-16 12:40 | 256K | |
![[ ]](/icons/layout.gif) | MARINE BIOMARINE TWO STROKE JANUARY 2015.pdf | 2015-01-30 17:20 | 255K | |
![[ ]](/icons/layout.gif) | MARINE DIESEL 15W-40 MARCH 2015.pdf | 2015-03-31 15:35 | 263K | |
![[ ]](/icons/layout.gif) | MARINE DIESEL 15W40 APRIL 2013.pdf | 2013-05-01 11:45 | 193K | |
![[ ]](/icons/layout.gif) | MARINE DIESEL 15W40 April 2013.pdf | 2013-04-19 10:37 | 193K | |
![[ ]](/icons/layout.gif) | MARINE DIESEL 15W40 FEBRUARY 2014.pdf | 2014-02-21 15:24 | 260K | |
![[ ]](/icons/layout.gif) | MARINE DIESEL 15W40 SEPTEMBER 2014.pdf | 2014-09-24 16:09 | 262K | |
![[ ]](/icons/layout.gif) | MARINE GEAR OIL 75W90 AUGUST 2014.pdf | 2014-08-12 14:41 | 228K | |
![[ ]](/icons/layout.gif) | MARINE GEAR OIL 75W90 FEBRUARY 2015.pdf | 2015-02-13 15:01 | 231K | |
![[ ]](/icons/layout.gif) | MARINE GEAR OIL 75W90 June 2012.pdf | 2012-08-06 13:37 | 206K | |
![[ ]](/icons/layout.gif) | MARINE GEAR OIL 75W90 MAY 2015.pdf | 2015-05-04 17:13 | 319K | |
![[ ]](/icons/layout.gif) | MARINE GEAR OIL 75W90 OCT 2011.pdf | 2011-12-15 20:50 | 151K | |
![[ ]](/icons/layout.gif) | MARINE GEAR OIL 75W90 SEPTEMBER 2014.pdf | 2014-09-24 16:16 | 228K | |
![[ ]](/icons/layout.gif) | MARINE GEAR OIL SS150 & SS300 DECEMBER 2014.pdf | 2014-12-12 16:31 | 290K | |
![[ ]](/icons/layout.gif) | MARINE GEAR OIL SS150 & SS300 DECEMBER 2015.pdf | 2015-12-09 15:40 | 349K | |
![[ ]](/icons/layout.gif) | MARINE GEAR OIL SS150 & SS300 MARCH 2015.pdf | 2015-03-04 10:12 | 344K | |
![[ ]](/icons/layout.gif) | MARINE GREASE FEBRUARY 2015.pdf | 2015-02-11 11:50 | 177K | |
![[ ]](/icons/layout.gif) | MARINE GREASE JULY 2015.pdf | 2015-07-03 13:41 | 239K | |
![[ ]](/icons/layout.gif) | MARINE GREASE JUNE 2014.pdf | 2014-06-20 09:58 | 173K | |
![[ ]](/icons/layout.gif) | MARINE GREASE NOVEMBER 2013.pdf | 2013-11-22 09:55 | 155K | |
![[ ]](/icons/layout.gif) | MARINE INBOARD 25W-40 APRIL 2015.pdf | 2015-04-16 12:03 | 183K | |
![[ ]](/icons/layout.gif) | MARINE INBOARD 25W40 MARCH 2015.pdf | 2015-03-31 09:06 | 183K | |
![[ ]](/icons/layout.gif) | MARINE INBOARD FOUR STROKE 25W40 August 2012.pdf | 2012-08-30 12:50 | 213K | |
![[ ]](/icons/layout.gif) | MARINE INBOARD FOUR STROKE 25W40 DECEMBER 2013.pdf | 2013-12-20 12:42 | 193K | |
![[ ]](/icons/layout.gif) | MARINE INBOARD FOUR STROKE 25W40 FEBRUARY 2015.pdf | 2015-02-10 10:43 | 196K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD 10W-30 APRIL 2015.pdf | 2015-04-16 11:53 | 179K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD 10W-30 OCTOBER 2015.pdf | 2015-10-13 10:44 | 179K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD 10W-40 APRIL 2015.pdf | 2015-04-16 11:57 | 183K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD 10W-40 OCTOBER 2015.pdf | 2015-10-13 11:10 | 178K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD 10W40 MARCH 2015.pdf | 2015-03-31 09:01 | 183K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD FOUR STROKE 10W30 August 2012.pdf | 2012-08-30 12:53 | 219K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD FOUR STROKE 10W30 DECEMBER 2013.pdf | 2013-12-13 12:27 | 182K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD FOUR STROKE 10W30 DECEMBER 2014.pdf | 2014-12-05 12:57 | 184K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD FOUR STROKE 10W30 FEBRUARY 2015.pdf | 2015-02-13 09:51 | 184K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD FOUR STROKE 10W40 APRIL 2014.pdf | 2014-04-24 10:46 | 183K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD FOUR STROKE 10W40 August 2012.pdf | 2012-08-30 12:54 | 214K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD FOUR STROKE 10W40 DECEMBER 2013.pdf | 2013-12-13 15:39 | 181K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD FOUR STROKE 10W40 JULY 2014.pdf | 2014-08-05 12:00 | 183K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD FOUR STROKE OIL 10W50 AUG 2012.pdf | 2012-08-09 08:36 | 205K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD FOUR STROKE OIL OCT 2011.pdf | 2011-12-15 20:50 | 146K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD FOUR STROKE SEMI SYNTHETIC 10W40 FEBRUARY 2015.pdf | 2015-02-12 17:15 | 183K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD TWO STROKE OIL APRIL 2015.pdf | 2015-04-16 12:46 | 260K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD TWO STROKE OIL DECEMBER 2013.pdf | 2013-12-20 16:05 | 257K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD TWO STROKE OIL FEBRUARY 2015.pdf | 2015-02-16 12:37 | 259K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD TWO STROKE OIL June 2012.pdf | 2012-08-06 13:38 | 217K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD TWO STROKE OIL OCT 2011.pdf | 2011-12-15 20:50 | 153K | |
![[ ]](/icons/layout.gif) | MARINE OUTBOARD TWO STROKE OIL OCTOBER 2015.pdf | 2015-10-13 10:43 | 260K | |
![[ ]](/icons/layout.gif) | MB 15.pdf | 2011-12-15 20:50 | 88K | |
![[ ]](/icons/layout.gif) | MB 15 JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | MB 15 SUSPENSION FLUID APRIL 2015.pdf | 2015-04-01 17:17 | 283K | |
![[ ]](/icons/layout.gif) | MB 15 SUSPENSION FLUID August 2012.pdf | 2012-08-20 17:55 | 199K | |
![[ ]](/icons/layout.gif) | MB 15 SUSPENSION FLUID JULY 2013.pdf | 2013-07-31 16:59 | 265K | |
![[ ]](/icons/layout.gif) | MB 15 SUSPENSION FLUID March 2013.pdf | 2013-03-19 10:06 | 199K | |
![[ ]](/icons/layout.gif) | MB 15 SUSPENSION FLUID NOVEMBER 2015.pdf | 2015-11-19 09:09 | 270K | |
![[ ]](/icons/layout.gif) | MB 15 SUSPENSION FLUID OCT 2011.pdf | 2011-12-15 20:50 | 150K | |
![[ ]](/icons/layout.gif) | MC-2 FULL SYNTHETIC TWO STROKE OIL APRIL 2015.pdf | 2015-04-16 13:03 | 308K | |
![[ ]](/icons/layout.gif) | MC-2 FULL SYNTHETIC TWO STROKE OIL JUNE 2015.pdf | 2015-06-30 10:06 | 309K | |
![[ ]](/icons/layout.gif) | MC-2 FULL SYNTHETIC TWO STROKE OIL MARCH 2016.pdf | 2016-03-04 11:57 | 346K | |
![[ ]](/icons/layout.gif) | MC-2 SEMI SYNTHETIC TWO STROKE OIL APRIL 2015.pdf | 2015-04-29 13:18 | 328K | |
![[ ]](/icons/layout.gif) | MC-2 SEMI SYNTHETIC TWO STROKE OIL MARCH 2016.pdf | 2016-03-04 12:19 | 331K | |
![[ ]](/icons/layout.gif) | MC-2 SEMI SYNTHETIC TWO STROKE OIL MAY 2016.pdf | 2016-05-24 15:04 | 292K | |
![[ ]](/icons/layout.gif) | MC-4 FULL SYNTHETIC 10W-40 FEBRUARY 2017.pdf | 2017-03-06 11:33 | 452K | |
![[ ]](/icons/layout.gif) | MC-4 FULL SYNTHETIC 10W-40 MARCH 2015.pdf | 2015-03-31 11:55 | 342K | |
![[ ]](/icons/layout.gif) | MC-4 FULL SYNTHETIC 10W-40 MARCH 2016.pdf | 2016-03-03 17:00 | 348K | |
![[ ]](/icons/layout.gif) | MC-4 FULL SYNTHETIC 10W-40 MARCH 2017.pdf | 2017-04-24 09:45 | 444K | |
![[ ]](/icons/layout.gif) | MC-4 MINERAL 15W-50 APRIL 2015.pdf | 2015-05-01 10:30 | 322K | |
![[ ]](/icons/layout.gif) | MC-4 MINERAL 15W-50 MARCH 2017.pdf | 2017-03-03 12:29 | 440K | |
![[ ]](/icons/layout.gif) | MC-4 MINERAL 20W-50 APRIL 2015.pdf | 2015-05-01 10:37 | 356K | |
![[ ]](/icons/layout.gif) | MC-4 MINERAL 20W-50 DECEMBER 2016.pdf | 2017-01-24 13:13 | 396K | |
![[ ]](/icons/layout.gif) | MC-4 MINERAL 20W-50 JULY 2015.pdf | 2015-07-20 11:31 | 356K | |
![[ ]](/icons/layout.gif) | MC-4 MINERAL 20W-50 MARCH 2016.pdf | 2016-03-04 12:27 | 396K | |
![[ ]](/icons/layout.gif) | MC-4 MINERAL 20W-50 MARCH 2017.pdf | 2017-03-03 12:26 | 500K | |
![[ ]](/icons/layout.gif) | MC-4 MINERAL 20W50 MARCH 2015.pdf | 2015-03-31 11:38 | 366K | |
![[ ]](/icons/layout.gif) | MC-4 MINERAL HD 50 MARCH 2015.pdf | 2015-03-31 12:16 | 294K | |
![[ ]](/icons/layout.gif) | MC-4 MINERAL HD 50 MARCH 2016.pdf | 2016-03-03 16:21 | 318K | |
![[ ]](/icons/layout.gif) | MC-4 SEMI SYNTHETIC 10W-30 APRIL 2015.pdf | 2015-05-01 10:13 | 305K | |
![[ ]](/icons/layout.gif) | MC-4 SEMI SYNTHETIC 10W-30 MARCH 2015.pdf | 2015-03-31 11:00 | 305K | |
![[ ]](/icons/layout.gif) | MC-4 SEMI SYNTHETIC 10W-30 MARCH 2016.pdf | 2016-03-03 16:32 | 356K | |
![[ ]](/icons/layout.gif) | MC-4 SEMI SYNTHETIC 10W-30 MARCH 2017.pdf | 2017-03-03 12:27 | 441K | |
![[ ]](/icons/layout.gif) | MC-4 SEMI SYNTHETIC 10W-50 APRIL 2015.pdf | 2015-05-01 10:12 | 341K | |
![[ ]](/icons/layout.gif) | MC-4 SEMI SYNTHETIC 10W-50 FEBRUARY 2016.pdf | 2016-02-08 09:56 | 342K | |
![[ ]](/icons/layout.gif) | MC-4 SEMI SYNTHETIC 10W-50 MARCH 2015.pdf | 2015-03-31 12:05 | 352K | |
![[ ]](/icons/layout.gif) | MC-4 SEMI SYNTHETIC 10W-50 MARCH 2016.pdf | 2016-03-03 16:38 | 384K | |
![[ ]](/icons/layout.gif) | MC-4 SEMI SYNTHETIC 10W-50 MARCH 2017.pdf | 2017-03-03 12:24 | 486K | |
![[ ]](/icons/layout.gif) | MC-4 SEMI SYNTHETIC 15W-50 APRIL 2015.pdf | 2015-05-01 10:13 | 297K | |
![[ ]](/icons/layout.gif) | MC-4 SEMI SYNTHETIC 15W-50 MARCH 2016.pdf | 2016-03-03 16:44 | 332K | |
![[ ]](/icons/layout.gif) | MC-4 SEMI SYNTHETIC 15W-50 MARCH 2017.pdf | 2017-03-03 12:28 | 417K | |
![[ ]](/icons/layout.gif) | MC-4 V TWIN 20W-50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2017.pdf | 2017-03-03 12:30 | 471K | |
![[ ]](/icons/layout.gif) | MC-4 V TWIN 20W-50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MAY 2016.pdf | 2016-05-13 15:07 | 366K | |
![[ ]](/icons/layout.gif) | MC2ST FULL SYNTHETIC TWO STROKE MOTORCYCLE OIL JULY 2013.pdf | 2013-09-05 16:30 | 373K | |
![[ ]](/icons/layout.gif) | MC2ST FULL SYNTHETIC TWO STROKE MOTORCYCLE OIL MARCH 2015.pdf | 2015-03-03 10:59 | 309K | |
![[ ]](/icons/layout.gif) | MC2ST FULL SYNTH TWO STROKE MOTORCYCLE OIL August 2012.pdf | 2012-08-21 10:57 | 226K | |
![[ ]](/icons/layout.gif) | MC2ST FULL SYNTH TWO STROKE MOTORCYCLE OIL Feb 2012.pdf | 2012-02-14 10:29 | 156K | |
![[ ]](/icons/layout.gif) | MC2ST FULL SYNTH TWO STROKE MOTORCYCLE OIL February 2013.pdf | 2013-02-01 11:35 | 214K | |
![[ ]](/icons/layout.gif) | MC2ST FULL SYNTH TWO STROKE MOTORCYCLE OIL OCT 2011.pdf | 2011-12-15 20:50 | 156K | |
![[ ]](/icons/layout.gif) | MC2ST SEMI SYNTHETIC TWO STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-01-30 13:12 | 305K | |
![[ ]](/icons/layout.gif) | MC2ST SEMI SYNTHETIC TWO STROKE MOTORCYCLE OIL JULY 2013.pdf | 2013-09-20 12:15 | 305K | |
![[ ]](/icons/layout.gif) | MC2ST SEMI SYNTHETIC TWO STROKE MOTORCYCLE OIL MARCH 2015.pdf | 2015-03-03 10:57 | 329K | |
![[ ]](/icons/layout.gif) | MC2ST SEMI SYNTH TWO STROKE MOTORCYCLE OIL August 2012.pdf | 2012-08-21 11:25 | 202K | |
![[ ]](/icons/layout.gif) | MC2ST SEMI SYNTH TWO STROKE MOTORCYCLE OIL Feb 2012.pdf | 2012-02-14 10:29 | 145K | |
![[ ]](/icons/layout.gif) | MC2ST SEMI SYNTH TWO STROKE MOTORCYCLE OIL OCT 2011.pdf | 2011-12-15 20:50 | 145K | |
![[ ]](/icons/layout.gif) | MC4-ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL APRIL 2015.pdf | 2015-04-30 12:21 | 320K | |
![[ ]](/icons/layout.gif) | MC4-ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL AUGUST 2015.pdf | 2015-08-27 12:35 | 304K | |
![[ ]](/icons/layout.gif) | MC4-ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2016.pdf | 2016-03-04 11:07 | 342K | |
![[ ]](/icons/layout.gif) | MC4-ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2017.pdf | 2017-03-03 12:24 | 424K | |
![[ ]](/icons/layout.gif) | MC4-ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL APRIL 2015.pdf | 2015-04-30 12:32 | 327K | |
![[ ]](/icons/layout.gif) | MC4-ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL AUGUST 2015.pdf | 2015-08-27 12:40 | 327K | |
![[ ]](/icons/layout.gif) | MC4-ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2016.pdf | 2016-03-04 11:14 | 372K | |
![[ ]](/icons/layout.gif) | MC4-ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2017.pdf | 2017-03-03 12:23 | 456K | |
![[ ]](/icons/layout.gif) | MC4-ST 10W60 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL AUGUST 2015.pdf | 2015-08-27 12:53 | 323K | |
![[ ]](/icons/unknown.gif) | MC4-ST 10W60 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL JULY 2015.docx | 2015-08-04 12:39 | 924K | |
![[ ]](/icons/layout.gif) | MC4-ST 10W60 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL JULY 2015.pdf | 2015-08-04 12:41 | 324K | |
![[ ]](/icons/layout.gif) | MC4-ST 10W60 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2017.pdf | 2017-03-03 12:26 | 410K | |
![[ ]](/icons/layout.gif) | MC4-ST 10W60 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL OCTOBER 2015.pdf | 2015-10-29 08:10 | 324K | |
![[ ]](/icons/layout.gif) | MC4-ST 15W50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL APRIL 2015.pdf | 2015-04-30 13:14 | 317K | |
![[ ]](/icons/layout.gif) | MC4-ST 15W50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL AUGUST 2015.pdf | 2015-08-27 12:49 | 317K | |
![[ ]](/icons/layout.gif) | MC4-ST 15W50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2016.pdf | 2016-03-04 11:49 | 370K | |
![[ ]](/icons/layout.gif) | MC4-ST 15W50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2017.pdf | 2017-03-03 12:25 | 454K | |
![[ ]](/icons/layout.gif) | MC4 FULL SYNTHETIC 10W40 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-02-27 11:28 | 344K | |
![[ ]](/icons/layout.gif) | MC4 FULL SYNTHETIC 10W40 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2015.pdf | 2015-02-23 17:05 | 344K | |
![[ ]](/icons/layout.gif) | MC4 MINERAL 10W-40 FOUR STROKE MOTORCYCLE OIL APRIL 2015.pdf | 2016-10-27 11:10 | 292K | |
![[ ]](/icons/layout.gif) | MC4 MINERAL 10W-40 FOUR STROKE MOTORCYCLE OIL MARCH 2017.pdf | 2017-03-23 15:57 | 364K | |
![[ ]](/icons/layout.gif) | MC4 MINERAL 15W-40 FOUR STROKE MOTORCYCLE OIL MARCH 2017.pdf | 2017-03-23 15:59 | 364K | |
![[ ]](/icons/layout.gif) | MC4 MINERAL 15W-40 FOUR STROKE MOTORCYCLE OIL OCTOBER 2015.pdf | 2016-10-27 11:21 | 293K | |
![[ ]](/icons/layout.gif) | MC4 MINERAL 15W50 FOUR STROKE MOTORCYCLE OIL AUGUST 2014.pdf | 2014-08-15 13:01 | 323K | |
![[ ]](/icons/layout.gif) | MC4 MINERAL 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-02-27 11:10 | 315K | |
![[ ]](/icons/layout.gif) | MC4 MINERAL 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2015.pdf | 2015-02-23 17:20 | 310K | |
![[ ]](/icons/layout.gif) | MC4 MINERAL 25W-50 FOUR STROKE MOTORCYCLE OIL MARCH 2017.pdf | 2017-03-23 16:00 | 363K | |
![[ ]](/icons/layout.gif) | MC4 MINERAL 25W-50 FOUR STROKE MOTORCYCLE OIL OCTOBER 2015.pdf | 2016-10-27 11:26 | 293K | |
![[ ]](/icons/layout.gif) | MC4 SEMI SYNTHETIC 10W-30 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2015.pdf | 2015-02-23 17:26 | 290K | |
![[ ]](/icons/layout.gif) | MC4 SEMI SYNTHETIC 10W-30 FOUR STROKE MOTORCYCLE OIL JANUARY 2015.pdf | 2015-02-03 16:05 | 291K | |
![[ ]](/icons/layout.gif) | MC4 SEMI SYNTHETIC 15W50 FOUR STROKE MOTORCYCLE OIL DECEMBER 2014.pdf | 2014-12-09 13:16 | 316K | |
![[ ]](/icons/layout.gif) | MC4 SEMI SYNTHETIC 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2014.pdf | 2014-02-27 09:19 | 322K | |
![[ ]](/icons/layout.gif) | MC4 SEMI SYNTHETIC 15W50 FOUR STROKE MOTORCYCLE OIL FEBRUARY 2015.pdf | 2015-02-23 17:19 | 300K | |
![[ ]](/icons/layout.gif) | MC4 SEMI SYNTHETIC 15W50 FOUR STROKE MOTORCYCLE OIL JANUARY 2015.pdf | 2015-01-12 11:26 | 300K | |
![[ ]](/icons/layout.gif) | MC4 SEMI SYNTHETIC 15W50 MARCH 2015.pdf | 2015-03-31 10:54 | 297K | |
![[ ]](/icons/layout.gif) | MC4ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL FEBRUARY 2015.pdf | 2015-02-23 17:01 | 320K | |
![[ ]](/icons/layout.gif) | MC4ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL JULY 2013.pdf | 2013-09-04 16:08 | 320K | |
![[ ]](/icons/layout.gif) | MC4ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL JULY 2014.pdf | 2014-07-18 11:52 | 468K | |
![[ ]](/icons/layout.gif) | MC4ST 5W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-13 12:29 | 307K | |
![[ ]](/icons/layout.gif) | MC4ST 5W50 FULLY SYNTH FOUR STROKE MOTORCYCLE OIL Feb 2102.pdf | 2012-02-14 09:20 | 155K | |
![[ ]](/icons/layout.gif) | MC4ST 5W50 FULLY SYNTH FOUR STROKE MOTORCYCLE OIL OCT 2011.pdf | 2011-12-15 20:50 | 155K | |
![[ ]](/icons/layout.gif) | MC4ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL FEBRUARY 2015.pdf | 2015-02-23 17:02 | 327K | |
![[ ]](/icons/layout.gif) | MC4ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL JULY 2013.pdf | 2013-09-04 11:59 | 337K | |
![[ ]](/icons/layout.gif) | MC4ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL JULY 2014.pdf | 2014-07-18 11:48 | 471K | |
![[ ]](/icons/layout.gif) | MC4ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-13 12:53 | 336K | |
![[ ]](/icons/layout.gif) | MC4ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL OCTOBER 2013.pdf | 2013-10-03 15:42 | 337K | |
![[ ]](/icons/layout.gif) | MC4ST 10W40 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL SEPTEMBER 2013.pdf | 2013-10-03 15:26 | 337K | |
![[ ]](/icons/layout.gif) | MC4ST 10W50 SEMI SYNTHETIC FOUR STROKE MOTORCYCLE OIL FEBRUARY 2015.pdf | 2015-02-23 17:07 | 355K | |
![[ ]](/icons/layout.gif) | MC4ST 10W50 SEMI SYNTHETIC FOUR STROKE MOTORCYCLE OIL JANUARY 2015.pdf | 2015-01-16 12:19 | 357K | |
![[ ]](/icons/layout.gif) | MC4ST 10W50 SEMI SYNTHETIC FOUR STROKE MOTORCYCLE OIL JULY 2013.pdf | 2013-07-11 16:36 | 363K | |
![[ ]](/icons/layout.gif) | MC4ST 10W50 SEMI SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-13 17:55 | 324K | |
![[ ]](/icons/layout.gif) | MC4ST 10W50 SEMI SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2015.pdf | 2015-03-31 10:33 | 352K | |
![[ ]](/icons/layout.gif) | MC4ST 10W50 SEMI SYNTH FOUR STROKE MOTORCYCLE OIL AUG 2012.pdf | 2012-08-09 08:39 | 225K | |
![[ ]](/icons/layout.gif) | MC4ST 10W50 SEMI SYNTH FOUR STROKE MOTORCYCLE OIL Feb 2012.pdf | 2012-02-14 09:41 | 153K | |
![[ ]](/icons/layout.gif) | MC4ST 10W50 SEMI SYNTH FOUR STROKE MOTORCYCLE OIL OCT 2011.pdf | 2011-12-15 20:50 | 153K | |
![[ ]](/icons/layout.gif) | MC4ST 15W50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL FEBRUARY 2015.pdf | 2015-02-23 17:04 | 317K | |
![[ ]](/icons/layout.gif) | MC4ST 15W50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL JULY 2013.pdf | 2013-09-04 15:28 | 350K | |
![[ ]](/icons/layout.gif) | MC4ST 15W50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL JULY 2014.pdf | 2014-07-18 12:10 | 470K | |
![[ ]](/icons/layout.gif) | MC4ST 15W50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-13 13:15 | 336K | |
![[ ]](/icons/layout.gif) | MC4ST 15W50 FULL SYNTHETIC FOUR STROKE MOTORCYCLE OIL OCTOBER 2013.pdf | 2013-10-03 15:42 | 350K | |
![[ ]](/icons/layout.gif) | MC4ST 15W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL AUG 2012.pdf | 2012-08-09 08:46 | 192K | |
![[ ]](/icons/layout.gif) | MC4ST 15W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL Feb 2012.pdf | 2012-02-14 09:40 | 92K | |
![[ ]](/icons/layout.gif) | MC4ST 15W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL OCT 2011.pdf | 2011-12-15 20:50 | 92K | |
![[ ]](/icons/layout.gif) | MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL FEBRUARY 2015.pdf | 2015-02-23 17:22 | 365K | |
![[ ]](/icons/layout.gif) | MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2013.pdf | 2014-01-23 14:25 | 334K | |
![[ ]](/icons/layout.gif) | MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2014.pdf | 2014-01-23 14:26 | 334K | |
![[ ]](/icons/layout.gif) | MC4ST 20W50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JULY 2013.pdf | 2013-09-05 15:29 | 349K | |
![[ ]](/icons/layout.gif) | MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL AUG 2012.pdf | 2012-08-09 08:49 | 208K | |
![[ ]](/icons/layout.gif) | MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL JANUARY 2015.pdf | 2015-01-21 15:23 | 294K | |
![[ ]](/icons/layout.gif) | MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL MARCH 2014.pdf | 2014-03-13 11:26 | 248K | |
![[ ]](/icons/layout.gif) | MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL NOV 2011.pdf | 2011-12-15 20:50 | 149K | |
![[ ]](/icons/layout.gif) | MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL NOV 2012.pdf | 2013-12-16 12:04 | 206K | |
![[ ]](/icons/layout.gif) | MC4ST HD50 PREMIUM MINERAL FOUR STROKE MOTORCYCLE OIL SEPTEMBER 2014.pdf | 2014-09-10 15:17 | 313K | |
![[ ]](/icons/layout.gif) | MC4VTWIN004 JULY 2015.pdf | 2015-07-24 11:37 | 365K | |
![[ ]](/icons/layout.gif) | MC4VTWIN004 OCTOBER 2015.pdf | 2015-10-29 08:08 | 366K | |
![[ ]](/icons/layout.gif) | MC CHAIN LUBE - ROAD DECEMBER 2015.pdf | 2016-09-21 16:40 | 264K | |
![[ ]](/icons/layout.gif) | MC CHAIN LUBE APRIL 2015.pdf | 2015-05-01 08:57 | 214K | |
![[ ]](/icons/layout.gif) | MC CHAIN LUBE DECEMBER 2015.pdf | 2015-12-08 15:21 | 235K | |
![[ ]](/icons/layout.gif) | MC FOAM FILTER CLEANER APRIL 2015.pdf | 2015-05-01 09:01 | 274K | |
![[ ]](/icons/layout.gif) | MC FOAM FILTER CLEANER JUNE 2013.pdf | 2013-09-19 12:58 | 280K | |
![[ ]](/icons/layout.gif) | MC FOAM FILTER OIL APRIL 2015.pdf | 2015-05-01 09:04 | 229K | |
![[ ]](/icons/layout.gif) | MC FOAM FILTER OIL FEBRUARY 2016.pdf | 2016-02-19 10:55 | 291K | |
![[ ]](/icons/layout.gif) | MC FOAM FILTER OIL JULY 2014.pdf | 2014-07-22 11:40 | 224K | |
![[ ]](/icons/layout.gif) | MC FOAM FILTER OIL JUNE 2014.pdf | 2014-06-03 13:05 | 218K | |
![[ ]](/icons/layout.gif) | MC FOAM FILTER OIL SEPTEMBER 2013.pdf | 2013-09-19 12:57 | 223K | |
![[ ]](/icons/layout.gif) | MC FORK OIL APRIL 2015.pdf | 2015-04-30 16:07 | 203K | |
![[ ]](/icons/layout.gif) | MC FORK OIL AUGUST 2016.pdf | 2016-08-10 12:38 | 248K | |
![[ ]](/icons/layout.gif) | MC FORK OIL DECEMEBR 2015.pdf | 2015-12-08 15:28 | 248K | |
![[ ]](/icons/layout.gif) | MC FORK OIL JUNE 2015.pdf | 2015-06-30 11:28 | 232K | |
![[ ]](/icons/layout.gif) | MC GEAR OIL APRIL 2015.pdf | 2015-05-01 09:06 | 315K | |
![[ ]](/icons/layout.gif) | MDEO RANGE (12 & 15 TBN) DECEMBER 2014.pdf | 2014-12-15 11:40 | 179K | |
![[ ]](/icons/layout.gif) | MEGOL GETRIEBEOEL POWER TRANSMISSION SAE 80W90 OCT 2011.pdf | 2011-12-15 20:50 | 149K | |
![[ ]](/icons/layout.gif) | MILD EP GEAR OIL AUGUST 2013.pdf | 2013-08-28 11:55 | 270K | |
![[ ]](/icons/layout.gif) | MILD EP GEAR OIL MAY 2015.pdf | 2015-05-07 13:20 | 318K | |
![[ ]](/icons/layout.gif) | MILD EP GEAR OIL OCT 2011.pdf | 2011-12-15 20:50 | 144K | |
![[ ]](/icons/layout.gif) | MOLYGREASE EP 3% OCT 2011.pdf | 2011-12-15 20:50 | 144K | |
![[ ]](/icons/layout.gif) | MOLYGREASE EP 3 APRIL 2014.pdf | 2014-07-18 09:17 | 468K | |
![[ ]](/icons/layout.gif) | MOLYGREASE EP 3 OCT 2011.pdf | 2011-12-20 12:27 | 144K | |
![[ ]](/icons/layout.gif) | MONO TRUCK 30 APRIL 2014.pdf | 2014-04-16 12:31 | 172K | |
![[ ]](/icons/layout.gif) | MONO TRUCK 30 MAY 2016.pdf | 2016-05-16 12:13 | 160K | |
![[ ]](/icons/layout.gif) | MONO TRUCK 30 NOVEMBER 2013.pdf | 2013-11-27 16:58 | 169K | |
![[ ]](/icons/layout.gif) | MONO TRUCK 40 APRIL 2014.pdf | 2014-04-16 15:23 | 180K | |
![[ ]](/icons/layout.gif) | MONO TRUCK 40 FEBRUARY 2014.pdf | 2014-02-18 15:53 | 178K | |
![[ ]](/icons/layout.gif) | MONO TRUCK 40 JANUARY 2015.pdf | 2015-02-04 10:33 | 180K | |
![[ ]](/icons/layout.gif) | MONO TRUCK 40 MAY 2016.pdf | 2016-05-16 12:05 | 162K | |
![[ ]](/icons/layout.gif) | MONO TRUCK 40 NOVEMBER 2013.pdf | 2013-11-27 17:15 | 182K | |
![[ ]](/icons/layout.gif) | MONO TRUCK 50 APRIL 2014.pdf | 2014-04-16 12:27 | 173K | |
![[ ]](/icons/layout.gif) | MONO TRUCK 50 MAY 2016.pdf | 2016-05-16 11:57 | 161K | |
![[ ]](/icons/layout.gif) | MONO TRUCK 50 NOVEMBER 2013.pdf | 2013-11-28 09:03 | 171K | |
![[ ]](/icons/layout.gif) | MONO TRUCK December 2012.pdf | 2012-12-07 14:59 | 201K | |
![[ ]](/icons/layout.gif) | MONO TRUCK OCT 2011.pdf | 2011-12-15 20:50 | 156K | |
![[ ]](/icons/layout.gif) | MOTORCYCLE CHAIN LUBE APRIL 2015.pdf | 2015-04-30 16:44 | 214K | |
![[ ]](/icons/layout.gif) | MOTORCYCLE CHAIN LUBE MAY 2012.pdf | 2012-10-24 15:13 | 95K | |
![[ ]](/icons/layout.gif) | MOTORCYCLE FOAM FILTER CLEANER APRIL 2015.pdf | 2015-04-30 17:13 | 287K | |
![[ ]](/icons/layout.gif) | MOTORCYCLE FOAM FILTER OIL APRIL 2015.pdf | 2015-04-30 17:00 | 229K | |
![[ ]](/icons/layout.gif) | MOTORCYCLE FOAM FILTER OIL MAY 2012.pdf | 2012-10-24 15:26 | 95K | |
![[ ]](/icons/layout.gif) | MOTORCYCLE FORK OILS MAY 2012.pdf | 2012-08-30 13:11 | 96K | |
![[ ]](/icons/layout.gif) | MOTORCYCLE FORK OILS OCTOBER 2014.pdf | 2014-10-23 16:58 | 193K | |
![[ ]](/icons/layout.gif) | MOTORCYCLE FORK OILS SEPTEMBER 2013.pdf | 2013-09-12 12:00 | 173K | |
![[ ]](/icons/layout.gif) | MOTORCYCLE GEAR OIL APRIL 2015.pdf | 2015-04-20 10:52 | 315K | |
![[ ]](/icons/layout.gif) | MULTIFLEET DIESEL 15W-40 MAY 2016.pdf | 2016-05-04 12:01 | 281K | |
![[ ]](/icons/layout.gif) | MULTI PURPOSE WASH APRIL 2014.pdf | 2014-04-04 13:20 | 218K | |
![[ ]](/icons/layout.gif) | MULTI PURPOSE WASH DECEMBER 2015.pdf | 2015-12-03 08:46 | 207K | |
![[ ]](/icons/layout.gif) | MULTI PURPOSE WASH JULY 2014.pdf | 2014-08-01 10:58 | 220K | |
![[ ]](/icons/layout.gif) | MULTI PURPOSE WASH JUNE 2015.pdf | 2015-06-29 17:22 | 207K | |
![[ ]](/icons/layout.gif) | MULTI TRUCK 25 MAR 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | MULTI TRUCK 25 OCT 2011.pdf | 2011-12-15 20:50 | 153K | |
![[ ]](/icons/layout.gif) | Manual Gear Oil 70.pdf | 2011-12-15 20:50 | 92K | |
![[ ]](/icons/layout.gif) | Manual Gear Oil 70 JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | Manual Gear Oil 75.pdf | 2011-12-15 20:50 | 89K | |
![[ ]](/icons/layout.gif) | Manual Gear Oil 75 April 2011.pdf | 2011-12-15 20:50 | 91K | |
![[ ]](/icons/layout.gif) | Manual Gear Oil 75 JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | Manual Gear Oil 80.pdf | 2011-12-15 20:50 | 98K | |
![[ ]](/icons/layout.gif) | Manual Gear Oil 80 APRIL 2010.pdf | 2011-12-15 20:50 | 184K | |
![[ ]](/icons/layout.gif) | Manual Gear Oil 80 JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | Marine Gear Oil.pdf | 2011-12-15 20:50 | 96K | |
![[ ]](/icons/layout.gif) | Marine Gear Oil JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | Marine Grease April 2012.pdf | 2012-08-30 10:10 | 201K | |
![[ ]](/icons/layout.gif) | Marine Inboard 25W-40 REV 0 0 1211.pdf | 2012-08-28 14:12 | 79K | |
![[ ]](/icons/layout.gif) | Marine Outboard 10W-30 Rev 0.1 0712.pdf | 2012-08-28 13:05 | 120K | |
![[ ]](/icons/layout.gif) | Marine Outboard 10W-40 REV 0 0 1211.pdf | 2012-08-28 13:16 | 84K | |
![[ ]](/icons/layout.gif) | Marine Outboard Four Stroke.pdf | 2011-12-15 20:50 | 90K | |
![[ ]](/icons/layout.gif) | Marine Outboard Four Stroke JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | Marine Outboard Gear Oil REV 1.0 0711.pdf | 2012-08-28 15:10 | 81K | |
![[ ]](/icons/layout.gif) | Marine Outboard Two Stroke.pdf | 2011-12-15 20:50 | 92K | |
![[ ]](/icons/layout.gif) | Mild EP Gear oil.pdf | 2011-12-15 20:50 | 88K | |
![[ ]](/icons/layout.gif) | Mild EP Gear oil JAN 2010.pdf | 2011-12-15 20:50 | 193K | |
![[ ]](/icons/layout.gif) | Moly 3% Grease.pdf | 2011-12-15 20:50 | 86K | |
![[ ]](/icons/layout.gif) | Moly 3 Grease.pdf | 2011-12-15 20:50 | 86K | |
![[ ]](/icons/layout.gif) | Moly 3pc Grease.pdf | 2011-12-15 20:50 | 86K | |
![[ ]](/icons/layout.gif) | Moly Grease HT.pdf | 2011-12-15 20:50 | 88K | |
![[ ]](/icons/layout.gif) | Molygrease EP3% JAN 2010.pdf | 2011-12-15 20:50 | 215K | |
![[ ]](/icons/layout.gif) | Molygrease EP3 JAN 2010.pdf | 2011-12-15 20:50 | 215K | |
![[ ]](/icons/layout.gif) | Mono 30 Rev 7.3 0716.pdf | 2016-10-05 16:36 | 360K | |
![[ ]](/icons/layout.gif) | Mono 40 Rev 6.0 1213.pdf | 2015-02-04 10:32 | 130K | |
![[ ]](/icons/layout.gif) | Mono Truck.pdf | 2011-12-15 20:50 | 99K | |
![[ ]](/icons/layout.gif) | Mono Truck JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | Motorcycle Chain Lube November 2012.pdf | 2012-11-21 11:54 | 196K | |
![[ ]](/icons/layout.gif) | Motorcycle Gear Oil July 2013.pdf | 2013-09-10 12:25 | 381K | |
![[ ]](/icons/layout.gif) | NGEO HD - DECEMBER 2014.pdf | 2014-12-11 08:59 | 224K | |
![[ ]](/icons/layout.gif) | NGEO HD - OCTOBER 2015.pdf | 2015-10-01 14:21 | 224K | |
![[ ]](/icons/layout.gif) | NGEO HD August 2012.pdf | 2012-09-03 09:58 | 205K | |
![[ ]](/icons/layout.gif) | OCTANE BOOSTER - APRIL 2014.pdf | 2014-04-01 15:33 | 234K | |
![[ ]](/icons/layout.gif) | OCTANE BOOSTER - FEBRUARY 2015.pdf | 2015-02-17 11:44 | 236K | |
![[ ]](/icons/layout.gif) | OCTANE BOOSTER APRIL 2017.pdf | 2017-04-10 15:29 | 293K | |
![[ ]](/icons/layout.gif) | OCTANE BOOSTER FEBRUARY 2017.pdf | 2017-02-28 13:04 | 250K | |
![[ ]](/icons/layout.gif) | OCTANE BOOSTER JUNE 2015.pdf | 2015-06-23 16:29 | 236K | |
![[ ]](/icons/layout.gif) | Octane Booster January 2013.pdf | 2013-01-29 16:37 | 227K | |
![[ ]](/icons/layout.gif) | P26 BRAKE PARTS CLEANER APRIL 2016.pdf | 2016-04-20 13:45 | 267K | |
![[ ]](/icons/layout.gif) | P26 BRAKE PARTS CLEANER JANUARY 2016.pdf | 2016-01-11 15:31 | 263K | |
![[ ]](/icons/layout.gif) | P26 Brake and Parts Cleaner (Aerosol) Rev 0.0 0715.pdf | 2016-01-11 15:34 | 186K | |
![[ ]](/icons/layout.gif) | P26 MULTI-PURPOSE DEGREASER JANUARY 2016.pdf | 2016-01-12 07:53 | 203K | |
![[ ]](/icons/layout.gif) | P26 MULTI-PURPOSE MoS2 LUBE JANUARY 2016.pdf | 2016-01-14 10:46 | 315K | |
![[ ]](/icons/layout.gif) | P26 MULTI-PURPOSE MoS2 LUBE JULY 2015.pdf | 2015-10-29 10:30 | 320K | |
![[ ]](/icons/layout.gif) | P26 MULTI-PURPOSE MoS2 LUBE JUNE 2016.pdf | 2016-06-08 07:53 | 315K | |
![[ ]](/icons/layout.gif) | P26 THROTTLE BODY & CARB CLEANER JANUARY 2016.pdf | 2016-01-11 16:21 | 204K | |
![[ ]](/icons/layout.gif) | PAS FLUID APRIL 2015.pdf | 2015-04-01 16:45 | 157K | |
![[ ]](/icons/layout.gif) | PAS FLUID Aug 2012.pdf | 2012-08-30 14:42 | 211K | |
![[ ]](/icons/layout.gif) | PAS FLUID December 2012.pdf | 2012-12-07 14:41 | 198K | |
![[ ]](/icons/layout.gif) | PAS FLUID JULY 2013.pdf | 2013-07-31 16:58 | 171K | |
![[ ]](/icons/layout.gif) | PAS FLUID JUNE 2015.pdf | 2015-06-24 15:55 | 236K | |
![[ ]](/icons/layout.gif) | PAS FLUID June 2013.pdf | 2013-06-12 13:09 | 200K | |
![[ ]](/icons/layout.gif) | PAS FLUID MAY 2016.pdf | 2016-05-13 10:22 | 236K | |
![[ ]](/icons/layout.gif) | PAS FLUID OCT 2011.pdf | 2011-12-15 20:50 | 151K | |
![[ ]](/icons/layout.gif) | PAS Fluid.pdf | 2011-12-15 20:50 | 98K | |
![[ ]](/icons/layout.gif) | PAS Fluid JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | PAS Fluid Rev 0.0 0612.pdf | 2012-12-07 14:42 | 120K | |
![[ ]](/icons/layout.gif) | PEN 4297.pdf | 2011-12-15 20:50 | 261K | |
![[ ]](/icons/layout.gif) | PEN 4297 April 2013.pdf | 2013-04-22 12:25 | 200K | |
![[ ]](/icons/layout.gif) | PEN 4297 Aug 2012.pdf | 2012-08-13 12:38 | 197K | |
![[ ]](/icons/layout.gif) | PEN 4297 FEBRUARY 2017.pdf | 2017-02-27 10:07 | 207K | |
![[ ]](/icons/layout.gif) | PEN 4297 JAN 2010.pdf | 2011-12-15 20:50 | 192K | |
![[ ]](/icons/layout.gif) | PEN 4297 JULY 2013.pdf | 2014-03-31 13:03 | 195K | |
![[ ]](/icons/layout.gif) | PEN 4297 JUNE 2015.pdf | 2015-06-22 16:47 | 207K | |
![[ ]](/icons/layout.gif) | PEN 4297 MARCH 2015.pdf | 2015-03-30 13:08 | 207K | |
![[ ]](/icons/layout.gif) | PEN 4297 OCT 2011.pdf | 2011-12-15 20:50 | 141K | |
![[ ]](/icons/layout.gif) | PEN 4297 SEPTEMBER 2015.pdf | 2015-09-18 12:28 | 207K | |
![[ ]](/icons/layout.gif) | PENBLUE NOVEMBER 2013.pdf | 2013-11-22 16:33 | 163K | |
![[ ]](/icons/layout.gif) | PENBLUE Nov 2011.pdf | 2011-12-15 20:50 | 149K | |
![[ ]](/icons/layout.gif) | PENBLUE October 2012.pdf | 2012-10-26 11:40 | 197K | |
![[ ]](/icons/layout.gif) | PENRITE HAND CLEANER APRIL 2017.pdf | 2017-04-04 14:35 | 350K | |
![[ ]](/icons/layout.gif) | PENRITE HAND CLEANER AUGUST 2016.pdf | 2016-08-10 15:53 | 284K | |
![[ ]](/icons/layout.gif) | PENRITE HAND CLEANER JANUARY 2016.pdf | 2016-02-19 10:02 | 228K | |
![[ ]](/icons/layout.gif) | PENRITE PENBLUE DECEMBER 2015.pdf | 2015-12-09 11:52 | 165K | |
![[ ]](/icons/layout.gif) | PENRITE PENBLUE MARCH 2015.pdf | 2015-03-26 15:05 | 166K | |
![[ ]](/icons/layout.gif) | PENRITE PENBLUE OCTOBER 2016.pdf | 2016-10-07 17:09 | 202K | |
![[ ]](/icons/layout.gif) | PETROL FUEL STABILISER APRIL 2017.pdf | 2017-04-10 15:18 | 419K | |
![[ ]](/icons/layout.gif) | PETROL FUEL STABILISER JUNE 2016.pdf | 2016-06-07 08:48 | 315K | |
![[ ]](/icons/layout.gif) | PETROL FUEL STABILISER MAY 2015.pdf | 2015-07-27 10:01 | 315K | |
![[ ]](/icons/layout.gif) | PETROL INJECTOR CLEANER - APRIL 2014.pdf | 2014-04-01 10:41 | 174K | |
![[ ]](/icons/layout.gif) | PETROL INJECTOR CLEANER - FEBRUARY 2015.pdf | 2015-02-17 11:49 | 236K | |
![[ ]](/icons/layout.gif) | PETROL INJECTOR CLEANER APRIL 2017.pdf | 2017-04-10 15:16 | 335K | |
![[ ]](/icons/layout.gif) | PETROL INJECTOR CLEANER DECEMBER 2015.pdf | 2015-12-04 13:13 | 281K | |
![[ ]](/icons/layout.gif) | PETROL INJECTOR CLEANER MAY 2015.pdf | 2015-05-08 16:54 | 281K | |
![[ ]](/icons/layout.gif) | PETROL TOTAL SYSTEM CLEANER APRIL 2017.pdf | 2017-04-10 15:17 | 428K | |
![[ ]](/icons/layout.gif) | PETROL TOTAL SYSTEM CLEANER MAY 2015.pdf | 2015-07-24 16:31 | 322K | |
![[ ]](/icons/layout.gif) | PGXL COOLANT CONCENTRATE MARCH 2017.pdf | 2017-03-31 17:39 | 329K | |
![[ ]](/icons/layout.gif) | PGXL COOLANT PREMIX DECEMBER 2016.pdf | 2016-12-15 15:33 | 269K | |
![[ ]](/icons/layout.gif) | PGXL COOLANT PREMIX MARCH 2017.pdf | 2017-04-03 14:40 | 338K | |
![[ ]](/icons/layout.gif) | PGXL COOLANT PREMIX MAY 2013.pdf | 2015-05-01 11:55 | 256K | |
![[ ]](/icons/layout.gif) | PGXL COOLANT PREMIX MAY 2015.pdf | 2015-05-01 12:00 | 256K | |
![[ ]](/icons/layout.gif) | PGXL COOLANT PREMIX MAY 2016.pdf | 2016-05-12 16:54 | 255K | |
![[ ]](/icons/layout.gif) | PGXL Coolant Premix April 2013.pdf | 2013-04-18 12:20 | 191K | |
![[ ]](/icons/layout.gif) | PGXL Coolant Premix May 2013.pdf | 2013-07-18 10:34 | 252K | |
![[ ]](/icons/layout.gif) | PI_ATF 33.pdf | 2011-12-15 20:50 | 66K | |
![[ ]](/icons/layout.gif) | PI_ATF 95LE.pdf | 2011-12-15 20:50 | 75K | |
![[ ]](/icons/layout.gif) | PI_ATF BMV.pdf | 2011-12-15 20:50 | 72K | |
![[ ]](/icons/layout.gif) | PI_ATF DX-II.pdf | 2011-12-15 20:50 | 70K | |
![[ ]](/icons/layout.gif) | PI_ATF DX-III.pdf | 2011-12-15 20:50 | 72K | |
![[ ]](/icons/layout.gif) | PI_ATF DX-VI.pdf | 2011-12-15 20:50 | 69K | |
![[ ]](/icons/layout.gif) | PI_ATF FM5.pdf | 2011-12-15 20:50 | 73K | |
![[ ]](/icons/layout.gif) | PI_ATF MHP.pdf | 2011-12-15 20:50 | 75K | |
![[ ]](/icons/layout.gif) | PI_ATF SYNTHETIC.pdf | 2011-12-15 20:50 | 70K | |
![[ ]](/icons/layout.gif) | PI_ATF TOP UP.pdf | 2011-12-15 20:50 | 75K | |
![[ ]](/icons/layout.gif) | PI_BENTONE HD.pdf | 2011-12-15 20:50 | 73K | |
![[ ]](/icons/layout.gif) | PI_Brake Fluid 525.pdf | 2011-12-15 20:50 | 72K | |
![[ ]](/icons/layout.gif) | PI_CVT Fluid.pdf | 2011-12-15 20:50 | 87K | |
![[ ]](/icons/layout.gif) | PI_Cam Assembly Lubr.pdf | 2011-12-15 20:50 | 61K | |
![[ ]](/icons/layout.gif) | PI_Chain Saw Bar.pdf | 2011-12-15 20:50 | 62K | |
![[ ]](/icons/layout.gif) | PI_Classic Car Coolant.pdf | 2011-12-15 20:50 | 70K | |
![[ ]](/icons/layout.gif) | PI_Classic Engine Oils.pdf | 2011-12-15 20:50 | 98K | |
![[ ]](/icons/layout.gif) | PI_Compressor Oil 4KH.pdf | 2011-12-15 20:50 | 69K | |
![[ ]](/icons/layout.gif) | PI_Cooper Eze.pdf | 2011-12-15 20:50 | 61K | |
![[ ]](/icons/layout.gif) | PI_Diesel FX.pdf | 2011-12-15 20:50 | 69K | |
![[ ]](/icons/layout.gif) | PI_Diesel GS.pdf | 2011-12-15 20:50 | 78K | |
![[ ]](/icons/layout.gif) | PI_Diesel LA.pdf | 2011-12-15 20:50 | 80K | |
![[ ]](/icons/layout.gif) | PI_Diesel SP.pdf | 2011-12-15 20:50 | 76K | |
![[ ]](/icons/layout.gif) | PI_Enduro.pdf | 2011-12-15 20:50 | 71K | |
![[ ]](/icons/layout.gif) | PI_Enviro + Engine Oils.pdf | 2011-12-15 20:50 | 101K | |
![[ ]](/icons/layout.gif) | PI_Euro 15.pdf | 2011-12-15 20:50 | 101K | |
![[ ]](/icons/layout.gif) | PI_Euro 25.pdf | 2011-12-15 20:50 | 98K | |
![[ ]](/icons/layout.gif) | PI_Everyday Driving oils.pdf | 2011-12-15 20:50 | 134K | |
![[ ]](/icons/layout.gif) | PI_Everyday Full Sythetic Oils.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | PI_Extreme Pressure Grease.pdf | 2011-12-15 20:50 | 87K | |
![[ ]](/icons/layout.gif) | PI_Fleet-Gear 50 Plus.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | PI_Fleet-trans C4.pdf | 2011-12-15 20:50 | 139K | |
![[ ]](/icons/layout.gif) | PI_Fleet Gear 30.pdf | 2011-12-15 20:50 | 139K | |
![[ ]](/icons/layout.gif) | PI_Fleet Gear 50.pdf | 2011-12-15 20:50 | 139K | |
![[ ]](/icons/layout.gif) | PI_Gear Box 30.pdf | 2011-12-15 20:50 | 93K | |
![[ ]](/icons/layout.gif) | PI_Gear Box 40.pdf | 2011-12-15 20:50 | 93K | |
![[ ]](/icons/layout.gif) | PI_Gear Oil EP.pdf | 2011-12-15 20:50 | 131K | |
![[ ]](/icons/layout.gif) | PI_Gear Oil EP_PSD.pdf | 2011-12-15 20:50 | 131K | |
![[ ]](/icons/layout.gif) | PI_Gear Oil Syn 220.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | PI_Graphite Grease.pdf | 2011-12-15 20:50 | 83K | |
![[ ]](/icons/layout.gif) | PI_Greenkeepers Two Stroke.pdf | 2011-12-15 20:50 | 66K | |
![[ ]](/icons/layout.gif) | PI_HD Oil.pdf | 2011-12-15 20:50 | 89K | |
![[ ]](/icons/layout.gif) | PI_HONING OIL.pdf | 2011-12-15 20:50 | 65K | |
![[ ]](/icons/layout.gif) | PI_HPR 5.pdf | 2011-12-15 20:50 | 73K | |
![[ ]](/icons/layout.gif) | PI_HPR 10.pdf | 2011-12-15 20:50 | 73K | |
![[ ]](/icons/layout.gif) | PI_HPR 15.pdf | 2011-12-15 20:50 | 68K | |
![[ ]](/icons/layout.gif) | PI_HPR 30.pdf | 2011-12-15 20:50 | 71K | |
![[ ]](/icons/layout.gif) | PI_HPR 40.pdf | 2011-12-15 20:50 | 69K | |
![[ ]](/icons/layout.gif) | PI_HPR 50.pdf | 2011-12-15 20:50 | 66K | |
![[ ]](/icons/layout.gif) | PI_HPR DIESEL 15.pdf | 2011-12-15 20:50 | 72K | |
![[ ]](/icons/layout.gif) | PI_HPR GAS.pdf | 2011-12-15 20:50 | 72K | |
![[ ]](/icons/layout.gif) | PI_HPR GAS 10.pdf | 2011-12-15 20:50 | 72K | |
![[ ]](/icons/layout.gif) | PI_HPSO.pdf | 2011-12-15 20:50 | 65K | |
![[ ]](/icons/layout.gif) | PI_Heavy Duty AFAB.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | PI_Heritage LTM and MTH.pdf | 2011-12-15 20:50 | 87K | |
![[ ]](/icons/layout.gif) | PI_HiPer Two Stroke.pdf | 2011-12-15 20:50 | 63K | |
![[ ]](/icons/layout.gif) | PI_High temperature grease.pdf | 2011-12-15 20:50 | 66K | |
![[ ]](/icons/layout.gif) | PI_Hydralic Jack Oil.pdf | 2011-12-15 20:50 | 67K | |
![[ ]](/icons/layout.gif) | PI_Hypoid 80W-90.pdf | 2011-12-15 20:50 | 82K | |
![[ ]](/icons/layout.gif) | PI_Hypoid 85W-140.pdf | 2011-12-15 20:50 | 77K | |
![[ ]](/icons/layout.gif) | PI_Hypoid 140.pdf | 2011-12-15 20:50 | 69K | |
![[ ]](/icons/layout.gif) | PI_Indgrease BM 3.pdf | 2011-12-15 20:50 | 137K | |
![[ ]](/icons/layout.gif) | PI_Indus HV.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | PI_Japan 15.pdf | 2011-12-15 20:50 | 133K | |
![[ ]](/icons/layout.gif) | PI_Japan 25.pdf | 2011-12-15 20:50 | 91K | |
![[ ]](/icons/layout.gif) | PI_LHM PLUS.pdf | 2011-12-15 20:50 | 91K | |
![[ ]](/icons/layout.gif) | PI_LZ 7906.pdf | 2011-12-15 20:50 | 82K | |
![[ ]](/icons/layout.gif) | PI_Limslip 85-140.pdf | 2011-12-15 20:50 | 95K | |
![[ ]](/icons/layout.gif) | PI_Limslip 90.pdf | 2011-12-15 20:50 | 95K | |
![[ ]](/icons/layout.gif) | PI_Limslip140.pdf | 2011-12-15 20:50 | 95K | |
![[ ]](/icons/layout.gif) | PI_Limslip Additive.pdf | 2011-12-15 20:50 | 88K | |
![[ ]](/icons/layout.gif) | PI_Long Life Inhibitor.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | PI_MB 15.pdf | 2011-12-15 20:50 | 88K | |
![[ ]](/icons/layout.gif) | PI_Manual Gear Oil 70.pdf | 2011-12-15 20:50 | 92K | |
![[ ]](/icons/layout.gif) | PI_Manual Gear Oil 75.pdf | 2011-12-15 20:50 | 89K | |
![[ ]](/icons/layout.gif) | PI_Manual Gear Oil 80.pdf | 2011-12-15 20:50 | 98K | |
![[ ]](/icons/layout.gif) | PI_Marine Gear Oil.pdf | 2011-12-15 20:50 | 96K | |
![[ ]](/icons/layout.gif) | PI_Marine Outboard Four Stroke.pdf | 2011-12-15 20:50 | 90K | |
![[ ]](/icons/layout.gif) | PI_Marine Outboard Two Stroke.pdf | 2011-12-15 20:50 | 92K | |
![[ ]](/icons/layout.gif) | PI_Mild EP Gear oil.pdf | 2011-12-15 20:50 | 88K | |
![[ ]](/icons/layout.gif) | PI_Moly 3% Grease.pdf | 2011-12-15 20:50 | 86K | |
![[ ]](/icons/layout.gif) | PI_Moly Grease HT.pdf | 2011-12-15 20:50 | 88K | |
![[ ]](/icons/layout.gif) | PI_Mono Truck.pdf | 2011-12-15 20:50 | 99K | |
![[ ]](/icons/layout.gif) | PI_PAS Fluid.pdf | 2011-12-15 20:50 | 98K | |
![[ ]](/icons/layout.gif) | PI_Power Steering Fluid.pdf | 2011-12-15 20:50 | 128K | |
![[ ]](/icons/layout.gif) | PI_Premium Anti Freeze Anti Boil.pdf | 2011-12-15 20:50 | 93K | |
![[ ]](/icons/layout.gif) | PI_Premixed Inhibitor Plus.pdf | 2011-12-15 20:50 | 95K | |
![[ ]](/icons/layout.gif) | PI_Pro Anti Freeze Anti Boil.pdf | 2011-12-15 20:50 | 91K | |
![[ ]](/icons/layout.gif) | PI_Pro Cooling System Inhibitor.pdf | 2011-12-15 20:50 | 85K | |
![[ ]](/icons/layout.gif) | PI_Pro Engine Oils.pdf | 2011-12-15 20:50 | 95K | |
![[ ]](/icons/layout.gif) | PI_Pro Hydraulic Oil.pdf | 2011-12-15 20:50 | 85K | |
![[ ]](/icons/layout.gif) | PI_QCA Grease MX 9.pdf | 2011-12-15 20:50 | 93K | |
![[ ]](/icons/layout.gif) | PI_Rapid 7 Flush.pdf | 2011-12-15 20:50 | 84K | |
![[ ]](/icons/layout.gif) | PI_Rockslide.pdf | 2011-12-15 20:50 | 88K | |
![[ ]](/icons/layout.gif) | PI_Rubber Grease.pdf | 2011-12-15 20:50 | 85K | |
![[ ]](/icons/layout.gif) | PI_Running in oil.pdf | 2011-12-15 20:50 | 87K | |
![[ ]](/icons/layout.gif) | PI_SIN ATF.pdf | 2011-12-15 20:50 | 71K | |
![[ ]](/icons/layout.gif) | PI_SIN Brake Fluid.pdf | 2011-12-15 20:50 | 65K | |
![[ ]](/icons/layout.gif) | PI_SIN Comp Auto.pdf | 2011-12-15 20:50 | 70K | |
![[ ]](/icons/layout.gif) | PI_SIN Diesel.pdf | 2011-12-15 20:50 | 76K | |
![[ ]](/icons/layout.gif) | PI_SIN Diff Oil.pdf | 2011-12-15 20:50 | 88K | |
![[ ]](/icons/layout.gif) | PI_SIN Engine Oil 0.pdf | 2011-12-15 20:50 | 71K | |
![[ ]](/icons/layout.gif) | PI_SIN Engine Oil 5.pdf | 2011-12-15 20:50 | 70K | |
![[ ]](/icons/layout.gif) | PI_SIN Engine Oil 10.pdf | 2011-12-15 20:50 | 67K | |
![[ ]](/icons/layout.gif) | PI_SIN Engine Oil 15.pdf | 2011-12-15 20:50 | 73K | |
![[ ]](/icons/layout.gif) | PI_SIN Engine Oil 25.pdf | 2011-12-15 20:50 | 73K | |
![[ ]](/icons/layout.gif) | PI_SIN Gear Oil 75.pdf | 2011-12-15 20:50 | 89K | |
![[ ]](/icons/layout.gif) | PI_SIN Gear Oil 80.pdf | 2011-12-15 20:50 | 89K | |
![[ ]](/icons/layout.gif) | PI_SIN Grease.pdf | 2011-12-15 20:50 | 86K | |
![[ ]](/icons/layout.gif) | PI_SIN Manual Trans.pdf | 2011-12-15 20:50 | 71K | |
![[ ]](/icons/layout.gif) | PI_SIN RG110.pdf | 2011-12-15 20:50 | 71K | |
![[ ]](/icons/layout.gif) | PI_SIN Race Castor.pdf | 2011-12-15 20:50 | 66K | |
![[ ]](/icons/layout.gif) | PI_SIN Racing Coolant.pdf | 2011-12-15 20:50 | 65K | |
![[ ]](/icons/layout.gif) | PI_SIN Two Stroke Oil.pdf | 2011-12-15 20:50 | 67K | |
![[ ]](/icons/layout.gif) | PI_SSF.pdf | 2011-12-15 20:50 | 79K | |
![[ ]](/icons/layout.gif) | PI_SU Damper.pdf | 2011-12-15 20:50 | 66K | |
![[ ]](/icons/layout.gif) | PI_SU Dashpot.pdf | 2011-12-15 20:50 | 66K | |
![[ ]](/icons/layout.gif) | PI_Semi Fluid Grease.pdf | 2011-12-15 20:50 | 64K | |
![[ ]](/icons/layout.gif) | PI_Shelsley Engine Oils.pdf | 2011-12-15 20:50 | 75K | |
![[ ]](/icons/layout.gif) | PI_Shocker Oils.pdf | 2011-12-15 20:50 | 68K | |
![[ ]](/icons/layout.gif) | PI_Small Engine Four Stroke 10W-30.pdf | 2011-12-15 20:50 | 79K | |
![[ ]](/icons/layout.gif) | PI_Small Engine Four Stroke 20W-50.pdf | 2011-12-15 20:50 | 79K | |
![[ ]](/icons/layout.gif) | PI_Small Engine Four Stroke Monograde 30.pdf | 2011-12-15 20:50 | 72K | |
![[ ]](/icons/layout.gif) | PI_Soluble Oil.pdf | 2011-12-15 20:50 | 63K | |
![[ ]](/icons/layout.gif) | PI_Steering Box Lube.pdf | 2011-12-15 20:50 | 67K | |
![[ ]](/icons/layout.gif) | PI_Storage Oil Supplement.pdf | 2011-12-15 20:50 | 61K | |
![[ ]](/icons/layout.gif) | PI_Synfleet 50.pdf | 2011-12-15 20:50 | 93K | |
![[ ]](/icons/layout.gif) | PI_Synmarine 2 Stroke.pdf | 2011-12-15 20:50 | 70K | |
![[ ]](/icons/layout.gif) | PI_Tractor Transmission Hydraulic Oil.pdf | 2011-12-15 20:50 | 76K | |
![[ ]](/icons/layout.gif) | PI_Transaxle 75.pdf | 2011-12-15 20:50 | 72K | |
![[ ]](/icons/layout.gif) | PI_Transaxle 80.pdf | 2011-12-15 20:50 | 73K | |
![[ ]](/icons/layout.gif) | PI_Transoil 90 140250l.pdf | 2011-12-15 20:50 | 71K | |
![[ ]](/icons/layout.gif) | PI_USA 15.pdf | 2011-12-15 20:50 | 77K | |
![[ ]](/icons/layout.gif) | PI_USA 25.pdf | 2011-12-15 20:50 | 69K | |
![[ ]](/icons/layout.gif) | PI_Universal Farm Oil.pdf | 2011-12-15 20:50 | 80K | |
![[ ]](/icons/layout.gif) | PI_Upper Cylinder LPG Lubricant.pdf | 2011-12-15 20:50 | 82K | |
![[ ]](/icons/layout.gif) | PI_Water Pump Grease.pdf | 2011-12-15 20:50 | 89K | |
![[ ]](/icons/layout.gif) | POWER SPORTS GREASE AUGUST 2015.pdf | 2016-02-02 15:24 | 208K | |
![[ ]](/icons/layout.gif) | POWER SPORTS GREASE FEBRUARY 2016.pdf | 2016-02-02 15:27 | 246K | |
![[ ]](/icons/layout.gif) | POWER STEERING FLUID December 2012.pdf | 2012-12-07 14:33 | 200K | |
![[ ]](/icons/layout.gif) | POWER STEERING FLUID JULY 2013.pdf | 2013-07-31 17:00 | 235K | |
![[ ]](/icons/layout.gif) | POWER STEERING FLUID JULY 2016.pdf | 2016-08-01 14:33 | 261K | |
![[ ]](/icons/layout.gif) | POWER STEERING FLUID JUNE 2015.pdf | 2015-06-24 15:43 | 283K | |
![[ ]](/icons/layout.gif) | POWER STEERING FLUID Jan 2012.pdf | 2012-08-06 13:39 | 154K | |
![[ ]](/icons/layout.gif) | POWER STEERING FLUID MARCH 2015.pdf | 2015-03-26 15:41 | 236K | |
![[ ]](/icons/layout.gif) | POWER STEERING FLUID May 2013.pdf | 2013-05-20 16:35 | 265K | |
![[ ]](/icons/layout.gif) | POWER STEERING FLUID OCT 2011.pdf | 2011-12-15 20:50 | 154K | |
![[ ]](/icons/layout.gif) | POWER STEERING STOP LEAK - APRIL 2014.pdf | 2014-04-01 11:58 | 218K | |
![[ ]](/icons/layout.gif) | POWER STEERING STOP LEAK - FEBRUARY 2015.pdf | 2015-02-17 09:16 | 221K | |
![[ ]](/icons/layout.gif) | POWER STEERING STOP LEAK FEBRUARY 2017.pdf | 2017-02-28 12:57 | 248K | |
![[ ]](/icons/layout.gif) | POWER STEERING STOP LEAK JUNE 2015.pdf | 2015-06-24 09:28 | 221K | |
![[ ]](/icons/layout.gif) | PREMIUM MINERAL 5W-30 FEBRUARY 2016.pdf | 2016-02-18 11:44 | 333K | |
![[ ]](/icons/layout.gif) | PREMIUM MINERAL 5W-30 MARCH 2017.pdf | 2017-03-27 12:37 | 436K | |
![[ ]](/icons/layout.gif) | PREMIUM MINERAL 5W-30 NOVEMBER 2015.pdf | 2015-11-23 09:25 | 333K | |
![[ ]](/icons/layout.gif) | PREMIUM MINERAL 10W-30 FEBRUARY 2016.pdf | 2016-02-18 11:47 | 336K | |
![[ ]](/icons/layout.gif) | PREMIUM MINERAL 10W-30 MARCH 2016.pdf | 2016-03-22 13:28 | 336K | |
![[ ]](/icons/layout.gif) | PREMIUM MINERAL 10W-30 NOVEMBER 2015.pdf | 2015-11-23 09:42 | 336K | |
![[ ]](/icons/layout.gif) | PREMIUM MINERAL 15W-40 FEBRUARY 2016.pdf | 2016-02-18 11:52 | 336K | |
![[ ]](/icons/layout.gif) | PREMIUM MINERAL 15W-40 MARCH 2016.pdf | 2016-03-22 13:33 | 336K | |
![[ ]](/icons/layout.gif) | PREMIUM MINERAL 15W-40 NOVEMBER 2015.pdf | 2015-11-23 09:57 | 336K | |
![[ ]](/icons/layout.gif) | PREMIUM MINERAL 20W-50 APRIL 2016.pdf | 2016-04-12 08:28 | 335K | |
![[ ]](/icons/layout.gif) | PREMIUM MINERAL 20W-50 NOVEMBER 2015.pdf | 2015-11-23 10:15 | 335K | |
![[ ]](/icons/layout.gif) | PRO 5 5W-30 DECEMBER 2016.pdf | 2016-12-08 12:15 | 351K | |
![[ ]](/icons/layout.gif) | PRO 5 5W-30 FEBRUARY 2016.pdf | 2016-02-23 10:09 | 339K | |
![[ ]](/icons/layout.gif) | PRO 5 5W-30 MARCH 2015.pdf | 2015-03-26 17:05 | 330K | |
![[ ]](/icons/layout.gif) | PRO 5 5W-30 MARCH 2016.pdf | 2016-03-04 10:11 | 339K | |
![[ ]](/icons/layout.gif) | PRO 5 5W-30 MARCH 2017.pdf | 2017-03-29 16:49 | 455K | |
![[ ]](/icons/layout.gif) | PRO 5 5W-30 MAY 2016.pdf | 2016-05-03 14:00 | 339K | |
![[ ]](/icons/layout.gif) | PRO 5 5W-30 OCTOBER 2016.pdf | 2016-10-26 14:46 | 339K | |
![[ ]](/icons/layout.gif) | PRO 10 10W-30 JUNE 2015.pdf | 2015-06-18 12:13 | 286K | |
![[ ]](/icons/layout.gif) | PRO 10 10W-30 MARCH 2015.pdf | 2015-03-27 10:50 | 288K | |
![[ ]](/icons/layout.gif) | PRO 10 10W-30 NOVEMBER 2015.pdf | 2015-11-10 13:06 | 286K | |
![[ ]](/icons/layout.gif) | PRO 15 PLUS 15W-50 JUNE 2014.pdf | 2015-03-27 10:55 | 283K | |
![[ ]](/icons/layout.gif) | PRO 15 PLUS 15W-50 MARCH 2015.pdf | 2015-03-27 10:58 | 283K | |
![[ ]](/icons/layout.gif) | PRO 15 PLUS 15W-50 NOVEMBER 2016.pdf | 2016-11-10 15:35 | 328K | |
![[ ]](/icons/layout.gif) | PRO 20 20W-50 MARCH 2015.pdf | 2015-03-27 10:58 | 282K | |
![[ ]](/icons/layout.gif) | PRO 20 20W-50 NOVEMBER 2015.pdf | 2015-11-23 12:30 | 282K | |
![[ ]](/icons/layout.gif) | PRO CHAIN OIL OCT 2011.pdf | 2011-12-15 20:50 | 140K | |
![[ ]](/icons/layout.gif) | PRO COOLANT RADIATOR INHIBITOR AUGUST 2014.pdf | 2014-08-15 14:48 | 282K | |
![[ ]](/icons/layout.gif) | PRO COOLING SYSTEM OCT 2011.pdf | 2011-12-15 20:50 | 144K | |
![[ ]](/icons/layout.gif) | PRO ENGINE OIL 20 Aug 2012.pdf | 2012-08-15 13:58 | 199K | |
![[ ]](/icons/layout.gif) | PRO ENGINE OIL Pro Extra Aug 2012.pdf | 2012-08-15 13:56 | 200K | |
![[ ]](/icons/layout.gif) | PRO ENGINE OILS 5 & 10 Aug 2012.pdf | 2012-08-15 13:57 | 202K | |
![[ ]](/icons/layout.gif) | PRO ENGINE OILS 5 10 and 20 Aug 2012.pdf | 2012-08-09 17:15 | 203K | |
![[ ]](/icons/layout.gif) | PRO ENGINE OILS 5 10 and 20 OCT 2011.pdf | 2011-12-15 20:50 | 156K | |
![[ ]](/icons/layout.gif) | PRO ENGINE OILS 15 Plus Aug 2012.pdf | 2012-08-15 13:58 | 199K | |
![[ ]](/icons/layout.gif) | PRO ENGINE OILS Extra and 15 Plus Aug 2012.pdf | 2012-08-13 15:42 | 201K | |
![[ ]](/icons/layout.gif) | PRO ENGINE OILS Extra and 15 Plus Nov 2011.pdf | 2011-12-15 20:50 | 148K | |
![[ ]](/icons/layout.gif) | PRO EXTRA 10W-40 JUNE 2015.pdf | 2015-06-15 12:23 | 285K | |
![[ ]](/icons/layout.gif) | PRO EXTRA 10W-40 MARCH 2015.pdf | 2015-03-27 10:53 | 284K | |
![[ ]](/icons/layout.gif) | PRO EXTRA 10W-40 NOVEMBER 2016.pdf | 2016-12-14 12:21 | 327K | |
![[ ]](/icons/layout.gif) | PRO GEAR 70W-75 AUGUST 2013.pdf | 2013-09-24 17:08 | 183K | |
![[ ]](/icons/layout.gif) | PRO GEAR 70W-75 August 2012.pdf | 2012-08-29 16:15 | 203K | |
![[ ]](/icons/layout.gif) | PRO GEAR 70W-75 JUNE 2015.pdf | 2015-06-22 16:55 | 173K | |
![[ ]](/icons/layout.gif) | PRO GEAR 70W-75 MARCH 2015.pdf | 2015-03-30 12:31 | 185K | |
![[ ]](/icons/layout.gif) | PRO GEAR 70W-75 MARCH 2017.pdf | 2017-03-29 15:32 | 186K | |
![[ ]](/icons/layout.gif) | PRO GEAR 70W-75 NOVEMBER 2016.pdf | 2016-11-29 14:17 | 173K | |
![[ ]](/icons/layout.gif) | PRO GEAR 75W-85 AUGUST 2013.pdf | 2013-09-25 09:05 | 191K | |
![[ ]](/icons/layout.gif) | PRO GEAR 75W-85 August 2012.pdf | 2012-08-29 16:22 | 203K | |
![[ ]](/icons/layout.gif) | PRO GEAR 75W-85 JUNE 2015.pdf | 2015-06-22 17:01 | 176K | |
![[ ]](/icons/layout.gif) | PRO GEAR 75W-85 MARCH 2015.pdf | 2015-03-30 12:26 | 191K | |
![[ ]](/icons/layout.gif) | PRO GEAR 75W-85 OCTOBER 2015.pdf | 2015-10-07 16:36 | 176K | |
![[ ]](/icons/layout.gif) | PRO GEAR 75W-85 OCTOBER 2016.pdf | 2016-10-20 15:54 | 176K | |
![[ ]](/icons/layout.gif) | PRO GEAR 75W-85 SEPTEMBER 2015.pdf | 2015-09-17 11:23 | 176K | |
![[ ]](/icons/layout.gif) | PRO GEAR 75W-90 AUGUST 2013.pdf | 2013-09-25 09:11 | 194K | |
![[ ]](/icons/layout.gif) | PRO GEAR 75W-90 August 2012.pdf | 2012-08-29 16:29 | 205K | |
![[ ]](/icons/layout.gif) | PRO GEAR 75W-90 JUNE 2015.pdf | 2015-06-02 13:06 | 193K | |
![[ ]](/icons/layout.gif) | PRO GEAR 75W-90 MARCH 2015.pdf | 2015-03-30 12:36 | 194K | |
![[ ]](/icons/layout.gif) | PRO GEAR 75W-90 OCTOBER 2016.pdf | 2016-10-25 14:46 | 180K | |
![[ ]](/icons/layout.gif) | PRO GEAR 75W-90 October 2012.pdf | 2012-10-08 08:54 | 204K | |
![[ ]](/icons/layout.gif) | PRO GEAR 80W-140 - JUNE 2014.pdf | 2014-06-17 12:39 | 186K | |
![[ ]](/icons/layout.gif) | PRO GEAR 80W-140 AUGUST 2013.pdf | 2013-09-25 11:57 | 188K | |
![[ ]](/icons/layout.gif) | PRO GEAR 80W-140 August 2012.pdf | 2012-08-29 16:50 | 206K | |
![[ ]](/icons/layout.gif) | PRO GEAR 80W-140 JUNE 2015.pdf | 2015-06-22 17:23 | 175K | |
![[ ]](/icons/layout.gif) | PRO GEAR 80W-140 MARCH 2015.pdf | 2015-03-30 12:38 | 188K | |
![[ ]](/icons/layout.gif) | PRO GEAR 85W-110 AUGUST 2013.pdf | 2013-09-25 12:07 | 182K | |
![[ ]](/icons/layout.gif) | PRO GEAR 85W-110 August 2012.pdf | 2012-08-29 16:54 | 209K | |
![[ ]](/icons/layout.gif) | PRO GEAR 85W-110 JUNE 2015.pdf | 2015-06-02 13:03 | 175K | |
![[ ]](/icons/layout.gif) | PRO GEAR 85W-110 MARCH 2015.pdf | 2015-03-30 12:42 | 182K | |
![[ ]](/icons/layout.gif) | PRO GEAR GL-5 75W-85 FEBRUARY 2017.pdf | 2017-02-27 12:52 | 326K | |
![[ ]](/icons/layout.gif) | PRO GEAR GL-5 75W-85 SEPTEMBER 2015.pdf | 2015-10-12 14:13 | 327K | |
![[ ]](/icons/layout.gif) | PRO HYDRAULIC OILS August 2012.pdf | 2012-08-21 12:36 | 201K | |
![[ ]](/icons/layout.gif) | PRO HYDRAULIC OILS OCT 2011.pdf | 2011-12-15 20:50 | 148K | |
![[ ]](/icons/layout.gif) | PRO WORKSHOP - PRO 5 JAN 2014.pdf | 2014-01-21 11:46 | 336K | |
![[ ]](/icons/layout.gif) | PRO WORKSHOP - PRO 5 JUNE 2014.pdf | 2014-06-27 16:57 | 327K | |
![[ ]](/icons/layout.gif) | PRO WORKSHOP - PRO 5 NOVEMBER 2014.pdf | 2014-11-24 13:14 | 330K | |
![[ ]](/icons/layout.gif) | PRO WORKSHOP - PRO 10 JAN 2014.pdf | 2014-01-24 09:11 | 282K | |
![[ ]](/icons/layout.gif) | PRO WORKSHOP - PRO 10 JUNE 2014.pdf | 2014-06-27 17:16 | 282K | |
![[ ]](/icons/layout.gif) | PRO WORKSHOP - PRO 10 NOVEMBER 2014.pdf | 2014-11-24 13:20 | 288K | |
![[ ]](/icons/layout.gif) | PRO WORKSHOP - PRO 15 PLUS JAN 2014.pdf | 2014-02-06 09:19 | 280K | |
![[ ]](/icons/layout.gif) | PRO WORKSHOP - PRO 15 PLUS JUNE 2014.pdf | 2014-06-27 17:17 | 280K | |
![[ ]](/icons/layout.gif) | PRO WORKSHOP - PRO 20 JAN 2014.pdf | 2014-02-06 09:38 | 279K | |
![[ ]](/icons/layout.gif) | PRO WORKSHOP - PRO 20 JUNE 2014.pdf | 2014-06-27 17:18 | 279K | |
![[ ]](/icons/layout.gif) | PRO WORKSHOP - PRO EXTRA 10W-40 JAN 2014.pdf | 2014-02-18 16:16 | 281K | |
![[ ]](/icons/layout.gif) | PRO WORKSHOP - PRO EXTRA 10W-40 JUNE 2014.pdf | 2014-06-04 12:45 | 281K | |
![[ ]](/icons/layout.gif) | Penblue Oct 2011.pdf | 2011-12-15 20:50 | 149K | |
![[ ]](/icons/layout.gif) | Petrol Injector Cleaner Dec 2012.pdf | 2012-12-06 08:51 | 224K | |
![[ ]](/icons/layout.gif) | Power Steering Fluid.pdf | 2011-12-15 20:50 | 128K | |
![[ ]](/icons/layout.gif) | Power Steering Fluid JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | Power Steering Stop Leak January 2013.pdf | 2013-01-29 15:10 | 233K | |
![[ ]](/icons/layout.gif) | Premium Anti Freeze Anti Boil.pdf | 2011-12-15 20:50 | 93K | |
![[ ]](/icons/layout.gif) | Premium Anti Freeze Anti Boil JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | Premixed Inhibitor Plus.pdf | 2011-12-15 20:50 | 95K | |
![[ ]](/icons/layout.gif) | Pro Anti Freeze Anti Boil.pdf | 2011-12-15 20:50 | 91K | |
![[ ]](/icons/layout.gif) | Pro Anti Freeze Anti Boil JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | Pro Cooling System Inhibitor.pdf | 2011-12-15 20:50 | 85K | |
![[ ]](/icons/layout.gif) | Pro Cooling System Inhibitor JAN 2010.pdf | 2011-12-15 20:50 | 193K | |
![[ ]](/icons/layout.gif) | Pro Engine Oils.pdf | 2011-12-15 20:50 | 95K | |
![[ ]](/icons/layout.gif) | Pro Engine Oils AUGUST 2011.pdf | 2011-12-15 20:50 | 99K | |
![[ ]](/icons/layout.gif) | Pro Engine Oils DEC 2010.pdf | 2011-12-15 20:50 | 204K | |
![[ ]](/icons/layout.gif) | Pro Engine Oils MAR 2010.pdf | 2011-12-15 20:50 | 206K | |
![[ ]](/icons/layout.gif) | Pro Engine Oils SEPTEMBER 2011 (2).pdf | 2011-12-15 20:50 | 98K | |
![[ ]](/icons/layout.gif) | Pro Hydraulic Oil.pdf | 2011-12-15 20:50 | 85K | |
![[ ]](/icons/layout.gif) | Pro Hydraulic Oil JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | Product Listing December 2011.pdf | 2011-12-15 20:50 | 336K | |
![[ ]](/icons/layout.gif) | Product Listing February 2012.pdf | 2012-02-17 17:29 | 798K | |
![[ ]](/icons/layout.gif) | QCA GREASE MX9 AUG 2012.pdf | 2012-08-15 12:46 | 207K | |
![[ ]](/icons/layout.gif) | QCA GREASE MX9 AUGUST 2014.pdf | 2014-08-20 14:48 | 244K | |
![[ ]](/icons/layout.gif) | QCA GREASE MX9 December 2012.pdf | 2012-12-10 14:31 | 204K | |
![[ ]](/icons/layout.gif) | QCA GREASE MX9 OCT 2011.pdf | 2011-12-15 20:50 | 143K | |
![[ ]](/icons/layout.gif) | QCA Grease MX 9.pdf | 2011-12-15 20:50 | 93K | |
![[ ]](/icons/layout.gif) | QCA Grease MX 9 JAN 2010.pdf | 2011-12-15 20:50 | 219K | |
![[ ]](/icons/layout.gif) | QCS GREASE MXG 0 AUGUST 2014.pdf | 2014-08-21 09:06 | 240K | |
![[ ]](/icons/layout.gif) | QCS Grease MXG 0 December 2012.pdf | 2012-12-10 15:10 | 204K | |
![[ ]](/icons/layout.gif) | QCS Grease MXG 0 September 2012.pdf | 2012-12-10 15:06 | 204K | |
![[ ]](/icons/layout.gif) | RACE CASTOR OIL JULY 2012.pdf | 2012-08-03 13:30 | 203K | |
![[ ]](/icons/layout.gif) | RACE CASTOR OIL NOV 2012.pdf | 2012-11-16 12:03 | 200K | |
![[ ]](/icons/layout.gif) | RACING BRAKE FLUID Aug 2012.pdf | 2013-03-01 14:05 | 200K | |
![[ ]](/icons/layout.gif) | RACING BRAKE FLUID JUNE 2012.pdf | 2012-07-20 11:15 | 99K | |
![[ ]](/icons/layout.gif) | RADIATOR FLUSH - APRIL 2014.pdf | 2014-04-02 10:04 | 269K | |
![[ ]](/icons/layout.gif) | RADIATOR FLUSH - FEBRUARY 2015.pdf | 2015-02-17 11:23 | 269K | |
![[ ]](/icons/layout.gif) | RADIATOR FLUSH Aug 2012.pdf | 2012-11-01 09:57 | 203K | |
![[ ]](/icons/layout.gif) | RADIATOR FLUSH DECEMBER 2012.pdf | 2012-12-07 14:17 | 204K | |
![[ ]](/icons/layout.gif) | RADIATOR FLUSH JUNE 2015.pdf | 2015-06-24 09:26 | 281K | |
![[ ]](/icons/layout.gif) | RADIATOR FLUSH October 2012.pdf | 2012-11-01 11:02 | 204K | |
![[ ]](/icons/layout.gif) | RADIATOR FLUSH SEPTEMBER 2013.pdf | 2013-09-12 09:59 | 269K | |
![[ ]](/icons/layout.gif) | RADIATOR INHIBITOR CONCENTRATE - APRIL 2014.pdf | 2014-04-02 11:23 | 284K | |
![[ ]](/icons/layout.gif) | RADIATOR INHIBITOR CONCENTRATE MAY 2015.pdf | 2015-05-04 16:31 | 272K | |
![[ ]](/icons/layout.gif) | RADIATOR INHIBITOR NOVEMBER 2013.pdf | 2013-11-13 16:34 | 271K | |
![[ ]](/icons/layout.gif) | RADIATOR STOP LEAK - APRIL 2014.pdf | 2014-04-02 12:45 | 219K | |
![[ ]](/icons/layout.gif) | RADIATOR STOP LEAK FEBRUARY 2017.pdf | 2017-02-28 13:19 | 256K | |
![[ ]](/icons/layout.gif) | RADIATOR STOP LEAK JUNE 2015.pdf | 2015-06-22 11:48 | 223K | |
![[ ]](/icons/layout.gif) | ROCKSLIDE DECEMBER 2014.pdf | 2014-12-02 14:55 | 273K | |
![[ ]](/icons/layout.gif) | ROCKSLIDE December 2012.pdf | 2012-12-10 09:02 | 204K | |
![[ ]](/icons/layout.gif) | ROCKSLIDE FEBRUARY 2017.pdf | 2017-02-27 15:00 | 273K | |
![[ ]](/icons/layout.gif) | ROCKSLIDE November 2014.pdf | 2014-12-01 13:15 | 255K | |
![[ ]](/icons/layout.gif) | ROCKSLIDE OCT 2011.pdf | 2011-12-15 20:50 | 152K | |
![[ ]](/icons/layout.gif) | RUBBER GREASE AUGUST 2015.pdf | 2015-08-05 11:21 | 227K | |
![[ ]](/icons/layout.gif) | RUBBER GREASE DECEMBER 2014.pdf | 2014-12-05 12:25 | 226K | |
![[ ]](/icons/layout.gif) | RUBBER GREASE JULY 2014.pdf | 2014-07-21 11:34 | 227K | |
![[ ]](/icons/layout.gif) | RUBBER GREASE OCT 2011.pdf | 2011-12-15 20:50 | 140K | |
![[ ]](/icons/layout.gif) | RUBBER GREASE OCTOBER 2015.pdf | 2015-10-01 16:08 | 255K | |
![[ ]](/icons/layout.gif) | RUBBER PROTECTANT APRIL 2015.pdf | 2015-04-02 13:22 | 299K | |
![[ ]](/icons/layout.gif) | RUBBER PROTECTANT SEPTEMBER 2013.pdf | 2013-10-11 09:33 | 297K | |
![[ ]](/icons/layout.gif) | RUNNING IN OIL February 2013.pdf | 2013-02-07 17:31 | 200K | |
![[ ]](/icons/layout.gif) | RUNNING IN OIL OCT 2011.pdf | 2011-12-15 20:50 | 144K | |
![[ ]](/icons/layout.gif) | RX-30 April 2014.pdf | 2015-05-12 13:47 | 122K | |
![[ ]](/icons/layout.gif) | RX-30 MARCH 2017.pdf | 2017-03-23 15:57 | 438K | |
![[ ]](/icons/layout.gif) | Radiator Flush January 2013.pdf | 2013-01-29 17:08 | 204K | |
![[ ]](/icons/layout.gif) | Radiator Inhibitor Aug 2012.pdf | 2012-08-06 13:39 | 197K | |
![[ ]](/icons/layout.gif) | Radiator Inhibitor Concentrate January 2013.pdf | 2013-01-29 17:05 | 224K | |
![[ ]](/icons/layout.gif) | Radiator Stop Leak January 2013.pdf | 2013-01-29 17:51 | 225K | |
![[ ]](/icons/layout.gif) | Rapid 7 Flush.pdf | 2011-12-15 20:50 | 84K | |
![[ ]](/icons/layout.gif) | Rapid 7 Flush Oct 2011.pdf | 2011-12-15 20:50 | 181K | |
![[ ]](/icons/layout.gif) | Rockslide.pdf | 2011-12-15 20:50 | 88K | |
![[ ]](/icons/layout.gif) | Rockslide JAN 2010.pdf | 2011-12-15 20:50 | 217K | |
![[ ]](/icons/layout.gif) | Rubber Grease.pdf | 2011-12-15 20:50 | 85K | |
![[ ]](/icons/layout.gif) | Rubber Grease JAN 2010.pdf | 2011-12-15 20:50 | 211K | |
![[ ]](/icons/layout.gif) | Running in oil.pdf | 2011-12-15 20:50 | 87K | |
![[ ]](/icons/layout.gif) | Running in oil JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | SEMI FLUID GREASE JULY 2014.pdf | 2014-07-15 10:36 | 430K | |
![[ ]](/icons/layout.gif) | SEMI FLUID GREASE MAY 2015.pdf | 2015-05-07 10:09 | 218K | |
![[ ]](/icons/layout.gif) | SEMI FLUID GREASE OCT 2011.pdf | 2011-12-15 20:50 | 140K | |
![[ ]](/icons/layout.gif) | SEMI FLUID GREASE OCTOBER 2013.pdf | 2013-10-31 16:31 | 216K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 5W-40 APRIL 2016.pdf | 2016-04-29 11:41 | 328K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 5W-40 JANUARY 2017.pdf | 2017-01-24 15:31 | 328K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 5W-40 MARCH 2016.pdf | 2016-03-31 08:27 | 328K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 5W-40 MAY 2016.pdf | 2016-05-02 10:41 | 328K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 5W-40 NOVEMBER 2015.pdf | 2015-11-23 08:43 | 328K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 5W-40 NOVEMBER 2016.pdf | 2016-11-10 15:54 | 329K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 10W-30 MAY 2016.pdf | 2016-08-02 16:41 | 352K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 10W-40 APRIL 2016.pdf | 2016-04-29 11:48 | 337K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 10W-40 FEBRUARY 2016.pdf | 2016-02-18 11:57 | 337K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 10W-40 JANUARY 2016.pdf | 2016-01-15 09:27 | 337K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 10W-40 JULY 2015.pdf | 2015-08-31 16:44 | 287K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 10W-40 MARCH 2016.pdf | 2016-03-31 08:38 | 337K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 10W-40 MAY 2016.pdf | 2016-05-02 10:33 | 334K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 10W-40 NOVEMBER 2015.pdf | 2015-11-23 08:57 | 337K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 15W-40 APRIL 2016.pdf | 2016-04-29 11:44 | 331K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 15W-40 AUGUST 2015.pdf | 2015-08-31 17:32 | 287K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 15W-40 FEBRUARY 2016.pdf | 2016-02-18 12:04 | 331K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 15W-40 MARCH 2016.pdf | 2016-03-31 08:36 | 330K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 15W-40 MAY 2016.pdf | 2016-05-02 10:37 | 339K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 15W-40 NOVEMBER 2015.pdf | 2015-11-23 09:03 | 331K | |
![[ ]](/icons/layout.gif) | SEMI SYNTHETIC 15W-40 NOVEMBER 2016.pdf | 2016-11-10 15:57 | 342K | |
![[ ]](/icons/layout.gif) | SHELSLEY ENGINE OILS AUGUST 2013.pdf | 2013-08-28 11:51 | 338K | |
![[ ]](/icons/layout.gif) | SHELSLEY ENGINE OILS August 2012.pdf | 2012-08-21 16:23 | 201K | |
![[ ]](/icons/layout.gif) | SHELSLEY ENGINE OILS FEBRUARY 2016.pdf | 2016-02-18 14:37 | 412K | |
![[ ]](/icons/layout.gif) | SHELSLEY ENGINE OILS JULY 2014.pdf | 2014-07-16 15:42 | 591K | |
![[ ]](/icons/layout.gif) | SHELSLEY ENGINE OILS MARCH 2014.pdf | 2014-03-05 14:12 | 409K | |
![[ ]](/icons/layout.gif) | SHELSLEY ENGINE OILS OCT 2011.pdf | 2011-12-15 20:50 | 146K | |
![[ ]](/icons/layout.gif) | SHOCKER OILS AUGUST 2013.pdf | 2013-08-28 12:02 | 277K | |
![[ ]](/icons/layout.gif) | SHOCKER OILS JUNE 2014.pdf | 2014-06-02 16:35 | 277K | |
![[ ]](/icons/layout.gif) | SHOCKER OILS MAY 2015.pdf | 2015-05-08 09:02 | 301K | |
![[ ]](/icons/layout.gif) | SHOCKER OILS OCT 2011.pdf | 2011-12-15 20:50 | 140K | |
![[ ]](/icons/layout.gif) | SILICONE BRAKE FLUID SEPTEMBER 2015.pdf | 2016-02-29 09:05 | 240K | |
![[ ]](/icons/layout.gif) | SIN ATF.pdf | 2011-12-15 20:50 | 71K | |
![[ ]](/icons/layout.gif) | SIN ATF JAN 2010.pdf | 2011-12-15 20:50 | 199K | |
![[ ]](/icons/layout.gif) | SIN ATF SEPT2010.pdf | 2011-12-15 20:50 | 96K | |
![[ ]](/icons/layout.gif) | SIN BRAKE FLUID OCT 2011.pdf | 2011-12-15 20:50 | 149K | |
![[ ]](/icons/layout.gif) | SIN Brake Fluid.pdf | 2011-12-15 20:50 | 65K | |
![[ ]](/icons/layout.gif) | SIN Brake Fluid JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | SIN Comp Auto.pdf | 2011-12-15 20:50 | 70K | |
![[ ]](/icons/layout.gif) | SIN Comp Auto 33 JAN 2011.pdf | 2011-12-15 20:50 | 225K | |
![[ ]](/icons/layout.gif) | SIN Comp Auto 33 MAR 2011.pdf | 2011-12-15 20:50 | 87K | |
![[ ]](/icons/layout.gif) | SIN Comp Auto JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | SIN Diesel.pdf | 2011-12-15 20:50 | 76K | |
![[ ]](/icons/layout.gif) | SIN Diff Oil.pdf | 2011-12-15 20:50 | 88K | |
![[ ]](/icons/layout.gif) | SIN ENGINE OIL 15W50and20W60 OCT 2011.pdf | 2011-12-15 20:50 | 149K | |
![[ ]](/icons/layout.gif) | SIN Engine Oil 0.pdf | 2011-12-15 20:50 | 71K | |
![[ ]](/icons/layout.gif) | SIN Engine Oil 0 JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | SIN Engine Oil 0 OCT 2010.pdf | 2011-12-15 20:50 | 93K | |
![[ ]](/icons/layout.gif) | SIN Engine Oil 5.pdf | 2011-12-15 20:50 | 70K | |
![[ ]](/icons/layout.gif) | SIN Engine Oil 5 JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | SIN Engine Oil 5 OCT 2010.pdf | 2011-12-15 20:50 | 93K | |
![[ ]](/icons/layout.gif) | SIN Engine Oil 10.pdf | 2011-12-15 20:50 | 67K | |
![[ ]](/icons/layout.gif) | SIN Engine Oil 10 JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | SIN Engine Oil 10 OCT 2010.pdf | 2011-12-15 20:50 | 92K | |
![[ ]](/icons/layout.gif) | SIN Engine Oil 15 and 20 JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | SIN Engine Oil 15 and 20 JAN 2011.pdf | 2011-12-15 20:50 | 203K | |
![[ ]](/icons/layout.gif) | SIN Engine Oil 15 and 20 OCT 2010.pdf | 2011-12-15 20:50 | 94K | |
![[ ]](/icons/layout.gif) | SIN Engine Oil 15 and 25.pdf | 2011-12-15 20:50 | 73K | |
![[ ]](/icons/layout.gif) | SIN GEAR 75W90and80W140 OCT 2011.pdf | 2011-12-15 20:50 | 152K | |
![[ ]](/icons/layout.gif) | SIN Gear Oil 75 and 80.pdf | 2011-12-15 20:50 | 89K | |
![[ ]](/icons/layout.gif) | SIN Gear Oil 75 and 80 JAN 2010.pdf | 2011-12-15 20:50 | 197K | |
![[ ]](/icons/layout.gif) | SIN Gear Oil 75 and 80 JAN 2011.pdf | 2011-12-15 20:50 | 203K | |
![[ ]](/icons/layout.gif) | SIN Grease.pdf | 2011-12-15 20:50 | 86K | |
![[ ]](/icons/layout.gif) | SIN Grease JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | SIN MANUAL TRANS OCT 2011.pdf | 2011-12-15 20:50 | 148K | |
![[ ]](/icons/layout.gif) | SIN Manual Trans.pdf | 2011-12-15 20:50 | 71K | |
![[ ]](/icons/layout.gif) | SIN Manual Trans JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | SIN RACE CASTOR OCT 2011.pdf | 2011-12-15 20:50 | 140K | |
![[ ]](/icons/layout.gif) | SIN RACE COOLANT OCT 2011.pdf | 2011-12-15 20:50 | 144K | |
![[ ]](/icons/layout.gif) | SIN RG110.pdf | 2011-12-15 20:50 | 71K | |
![[ ]](/icons/layout.gif) | SIN Race Castor.pdf | 2011-12-15 20:50 | 66K | |
![[ ]](/icons/layout.gif) | SIN Race Castor JAN 2010.pdf | 2011-12-15 20:50 | 211K | |
![[ ]](/icons/layout.gif) | SIN Race Gear 110 JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | SIN Racing Coolant.pdf | 2011-12-15 20:50 | 65K | |
![[ ]](/icons/layout.gif) | SIN Racing Coolant JAN 2010.pdf | 2011-12-15 20:50 | 194K | |
![[ ]](/icons/layout.gif) | SIN TWO STROKE OIL OCT 2011.pdf | 2011-12-15 20:50 | 146K | |
![[ ]](/icons/layout.gif) | SIN Two Stroke Oil.pdf | 2011-12-15 20:50 | 67K | |
![[ ]](/icons/layout.gif) | SIN Two Stroke Oil JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE MONOGRADE 30 April 2013.pdf | 2013-04-18 15:38 | 201K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE MONOGRADE 30 December 2012.pdf | 2012-12-07 16:49 | 199K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE MONOGRADE 30 OCT 2011.pdf | 2011-12-15 20:50 | 153K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE MONOGRADE 30 SEPTEMBER 2013.pdf | 2013-09-30 13:18 | 192K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE MULTIGRADE 10W-30 APRIL 2017.pdf | 2017-04-13 09:45 | 183K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE MULTIGRADE 10W-30 MARCH 2015.pdf | 2015-03-26 16:17 | 207K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE MULTIGRADE 20W-50 JANUARY 2017.pdf | 2017-01-24 11:59 | 182K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE MULTIGRADE 20W-50 MARCH 2015.pdf | 2015-03-26 15:47 | 182K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE OIL 10W-30 APRIL 2012.pdf | 2012-04-19 13:36 | 96K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE OIL 10W-30 April 2013.pdf | 2013-04-18 10:38 | 205K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE OIL 10W-30 August 2014.pdf | 2014-08-15 12:57 | 185K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE OIL 10W-30 DECEMBER 2014.pdf | 2014-12-09 13:10 | 207K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE OIL 10W-30 October 2012.pdf | 2012-10-26 15:50 | 201K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE OIL 10W-30 SEPTEMBER 2013.pdf | 2013-09-30 11:53 | 188K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE OIL 10W-30 SEPTEMBER 2014.pdf | 2014-09-10 15:11 | 185K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE OIL 20W-50 APRIL 2012.pdf | 2012-04-19 16:01 | 96K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE OIL 20W-50 April 2013.pdf | 2013-04-18 10:45 | 203K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE OIL 20W-50 JANUARY 2015.pdf | 2015-01-21 15:19 | 182K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE OIL 20W-50 November 2012.pdf | 2012-11-21 16:49 | 200K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE OIL 20W-50 October 2012.pdf | 2012-10-26 15:51 | 200K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE OIL 20W-50 SEPTEMBER 2013.pdf | 2013-09-30 12:51 | 185K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE FOUR STROKE OILS 10W30 and 20W50 OCT 2011.pdf | 2011-12-15 20:50 | 161K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE GREENKEEPERS TWO STROKE August 2011.pdf | 2012-08-28 12:00 | 213K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE GREENKEEPERS TWO STROKE MAY 2011.pdf | 2012-05-07 11:31 | 92K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE GREENKEEPERS TWO STROKE OIL FEBRUARY 2017.pdf | 2017-03-06 11:38 | 190K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE GREENKEEPERS TWO STROKE OIL MARCH 2015.pdf | 2015-03-26 16:33 | 211K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE GREENKEEPERS TWO STROKE Oct 2011.pdf | 2011-12-15 20:50 | 144K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE GREENKEEPERS TWO STROKE SEPTEMBER 2013.pdf | 2013-09-30 14:14 | 188K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE HI-PER TWO STROKE August 2012.pdf | 2012-08-28 11:54 | 212K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE HI-PER TWO STROKE DECEMBER 2014.pdf | 2014-12-05 12:38 | 183K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE HI-PER TWO STROKE ENGINE OIL APRIL 2017.pdf | 2017-04-13 08:59 | 234K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE HI-PER TWO STROKE ENGINE OIL MARCH 2015.pdf | 2015-03-26 16:43 | 208K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE HI-PER TWO STROKE MAY 2012.pdf | 2012-05-07 12:50 | 116K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE HI-PER TWO STROKE SEPTEMBER 2013.pdf | 2013-09-30 15:26 | 188K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE MONO 30 JANUARY 2017.pdf | 2017-01-24 10:50 | 179K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE MONO 30 MARCH 2015.pdf | 2015-03-26 16:25 | 194K | |
![[ ]](/icons/layout.gif) | SMALL ENGINE SAE 30 JANUARY 2017.pdf | 2017-01-24 11:51 | 205K | |
![[ ]](/icons/layout.gif) | SOLUBLE OIL APRIL 2015.pdf | 2015-04-07 08:36 | 178K | |
![[ ]](/icons/layout.gif) | SOLUBLE OIL August 2012.pdf | 2012-08-21 15:03 | 208K | |
![[ ]](/icons/layout.gif) | SOLUBLE OIL DECEMBER 2014.pdf | 2014-12-11 11:30 | 178K | |
![[ ]](/icons/layout.gif) | SOLUBLE OIL OCT 2011.pdf | 2011-12-15 20:50 | 143K | |
![[ ]](/icons/layout.gif) | SOLVENT DEGREASER JANUARY 2016.pdf | 2016-02-01 16:51 | 258K | |
![[ ]](/icons/layout.gif) | SSF.pdf | 2011-12-15 20:50 | 79K | |
![[ ]](/icons/layout.gif) | SSF JAN 2010.pdf | 2011-12-15 20:50 | 196K | |
![[ ]](/icons/layout.gif) | STEERING BOX LUBE JULY 2014.pdf | 2014-07-15 10:31 | 355K | |
![[ ]](/icons/layout.gif) | STEERING BOX LUBE MAY 2016.pdf | 2016-05-16 11:04 | 268K | |
![[ ]](/icons/layout.gif) | STEERING BOX LUBE OCT 2011.pdf | 2011-12-15 20:50 | 140K | |
![[ ]](/icons/layout.gif) | STEERING BOX LUBE OCTOBER 2013.pdf | 2013-10-31 16:45 | 213K | |
![[ ]](/icons/layout.gif) | STOPS OIL BURNING 30-70 April 2013.pdf | 2013-04-16 17:42 | 224K | |
![[ ]](/icons/layout.gif) | STOPS OIL BURNING 30-70 August 2012.pdf | 2012-09-03 09:46 | 200K | |
![[ ]](/icons/layout.gif) | STOPS OIL BURNING 30-70 June 2012.pdf | 2012-08-30 13:12 | 202K | |
![[ ]](/icons/layout.gif) | STOPS OIL BURNING DECEMBER 2015.pdf | 2015-12-22 08:32 | 300K | |
![[ ]](/icons/layout.gif) | STOPS OIL BURNING SEPTEMBER 2013.pdf | 2013-09-17 13:24 | 301K | |
![[ ]](/icons/layout.gif) | STOPS OIL BURNING SEPTEMBER 2014.pdf | 2014-09-01 12:56 | 299K | |
![[ ]](/icons/layout.gif) | SU DASHPOT AND SU DAMPER FEBRUARY 2017.pdf | 2017-02-27 10:10 | 236K | |
![[ ]](/icons/layout.gif) | SU DASHPOT and SU DAMPER AUGUST 2013.pdf | 2013-08-28 13:21 | 212K | |
![[ ]](/icons/layout.gif) | SU DASHPOT and SU DAMPER MAY 2015.pdf | 2015-05-08 08:56 | 237K | |
![[ ]](/icons/layout.gif) | SU DASHPOTandSU DAMPER OCT 2011.pdf | 2011-12-15 20:50 | 141K | |
![[ ]](/icons/layout.gif) | SU DASHPOTand SU DAMPER OCT 2012.pdf | 2012-10-01 13:20 | 185K | |
![[ ]](/icons/layout.gif) | SU Damper SU Dashpot.pdf | 2011-12-15 20:50 | 66K | |
![[ ]](/icons/layout.gif) | SU Damper SU Dashpot JAN 2010.pdf | 2011-12-15 20:50 | 181K | |
![[ ]](/icons/layout.gif) | SYNFLEET 50 MAY 2015.pdf | 2015-05-20 13:27 | 244K | |
![[ ]](/icons/layout.gif) | SYNFLEET 50 NOVEMBER 2013.pdf | 2013-11-26 14:28 | 230K | |
![[ ]](/icons/layout.gif) | SYNFLEET 50 OCT 2011.pdf | 2011-12-15 20:50 | 155K | |
![[ ]](/icons/layout.gif) | SYNMARINE OB TS OCT 2011.pdf | 2011-12-15 20:50 | 152K | |
![[ ]](/icons/layout.gif) | Semi Fluid Grease.pdf | 2011-12-15 20:50 | 64K | |
![[ ]](/icons/layout.gif) | Semi Fluid Grease JAN 2010.pdf | 2011-12-15 20:50 | 210K | |
![[ ]](/icons/layout.gif) | Semi Fluid Grease March 2011.pdf | 2011-12-15 20:50 | 64K | |
![[ ]](/icons/layout.gif) | Shelsley Engine Oils.pdf | 2011-12-15 20:50 | 75K | |
![[ ]](/icons/layout.gif) | Shelsley Engine Oils JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | Shelsley Heavy Rev 5.0 0911.pdf | 2014-07-14 16:10 | 81K | |
![[ ]](/icons/layout.gif) | Shocker Oils.pdf | 2011-12-15 20:50 | 68K | |
![[ ]](/icons/layout.gif) | Small Engine Four Stroke 10W-30 and 20W-50.pdf | 2011-12-15 20:50 | 79K | |
![[ ]](/icons/layout.gif) | Small Engine Four Stroke 10W-30 and 20W-50 MAR 2010.pdf | 2011-12-15 20:50 | 198K | |
![[ ]](/icons/layout.gif) | Small Engine Four Stroke 10W-30 and 20W-50 MAR 2011.pdf | 2011-12-15 20:50 | 100K | |
![[ ]](/icons/layout.gif) | Small Engine Four Stroke Monograde 30.pdf | 2011-12-15 20:50 | 72K | |
![[ ]](/icons/layout.gif) | Small Engine Four Stroke Monograde 30 AUGUST 2010.pdf | 2011-12-15 20:50 | 200K | |
![[ ]](/icons/layout.gif) | Small Engine Four Stroke Monograde 30 JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | Small Engine HI-PER Two Stroke April 2013.pdf | 2013-04-18 14:26 | 214K | |
![[ ]](/icons/layout.gif) | Soluble Oil.pdf | 2011-12-15 20:50 | 63K | |
![[ ]](/icons/layout.gif) | Soluble Oil JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | Steering Box Lube.pdf | 2011-12-15 20:50 | 67K | |
![[ ]](/icons/layout.gif) | Steering Box Lube AUGUST 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | Steering Box Lube JAN 2010.pdf | 2011-12-15 20:50 | 210K | |
![[ ]](/icons/layout.gif) | Steering Box Lube March 2011.pdf | 2011-12-15 20:50 | 62K | |
![[ ]](/icons/layout.gif) | Storage Oil Supplement.pdf | 2011-12-15 20:50 | 61K | |
![[ ]](/icons/layout.gif) | Super DOT 4 April 2013.pdf | 2013-04-18 12:58 | 202K | |
![[ ]](/icons/layout.gif) | Synfleet 50.pdf | 2011-12-15 20:50 | 93K | |
![[ ]](/icons/layout.gif) | Synfleet 50 JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | Synmarine 2 Stroke.pdf | 2011-12-15 20:50 | 70K | |
![[ ]](/icons/layout.gif) | Synmarine 2 Stroke JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | TRACTOR TRANSMISSION AND HYDRAULIC OIL MARCH 2015.pdf | 2015-03-24 16:45 | 240K | |
![[ ]](/icons/layout.gif) | TRACTOR TRANSMISSION AND HYDRAULIC OIL MAY 2015.pdf | 2015-05-11 12:04 | 331K | |
![[ ]](/icons/layout.gif) | TRAC TRANS AND HYD OIL December 2012.pdf | 2012-12-07 15:39 | 203K | |
![[ ]](/icons/layout.gif) | TRAC TRANS AND HYD OIL MAY 2014.pdf | 2014-05-15 11:54 | 239K | |
![[ ]](/icons/layout.gif) | TRAC TRANS AND HYD OIL NOVEMBER 2013.pdf | 2013-11-08 09:39 | 235K | |
![[ ]](/icons/layout.gif) | TRAC TRANS AND HYD OIL OCT 2011.pdf | 2011-12-15 20:50 | 155K | |
![[ ]](/icons/layout.gif) | TRAC TRANS AND HYD OIL October 2012.pdf | 2012-10-26 10:11 | 203K | |
![[ ]](/icons/layout.gif) | TRANSAXLE 75 APRIL 2012.pdf | 2012-04-27 13:20 | 118K | |
![[ ]](/icons/layout.gif) | TRANSAXLE 75 MAY 2012.pdf | 2012-05-01 15:10 | 118K | |
![[ ]](/icons/layout.gif) | TRANSAXLE 75 OCT 2011.pdf | 2011-12-15 20:50 | 150K | |
![[ ]](/icons/layout.gif) | TRANSAXLE 80 OCT 2011.pdf | 2011-12-15 20:50 | 151K | |
![[ ]](/icons/layout.gif) | TRANS GEAR 75W-80 AUGUST 2013.pdf | 2013-09-24 16:40 | 183K | |
![[ ]](/icons/layout.gif) | TRANS GEAR 75W-80 August 2012.pdf | 2012-08-29 16:59 | 202K | |
![[ ]](/icons/layout.gif) | TRANS GEAR 75W-80 JUNE 2015.pdf | 2015-06-23 14:39 | 208K | |
![[ ]](/icons/layout.gif) | TRANS GEAR 75W-80 MARCH 2015.pdf | 2015-03-30 12:54 | 183K | |
![[ ]](/icons/layout.gif) | TRANS GEAR 75W-90 AUGUST 2013.pdf | 2013-09-24 17:00 | 250K | |
![[ ]](/icons/layout.gif) | TRANS GEAR 75W-90 August 2012.pdf | 2012-08-29 17:03 | 207K | |
![[ ]](/icons/layout.gif) | TRANS GEAR 75W-90 JANUARY 2017.pdf | 2017-01-24 10:37 | 275K | |
![[ ]](/icons/layout.gif) | TRANS GEAR 75W-90 JUNE 2014.pdf | 2014-06-17 15:31 | 247K | |
![[ ]](/icons/layout.gif) | TRANS GEAR 75W-90 JUNE 2015.pdf | 2015-06-23 14:47 | 267K | |
![[ ]](/icons/layout.gif) | TRANS GEAR 75W-90 MARCH 2015.pdf | 2015-03-30 12:54 | 250K | |
![[ ]](/icons/layout.gif) | TRANS GEAR 75W-90 NOVEMBER 2016.pdf | 2016-11-07 12:32 | 275K | |
![[ ]](/icons/layout.gif) | TRANSOIL 90 140 250 AUGUST 2013.pdf | 2013-08-28 11:58 | 237K | |
![[ ]](/icons/layout.gif) | TRANSOIL 90 140 250 JANUARY 2017.pdf | 2017-01-24 10:31 | 311K | |
![[ ]](/icons/layout.gif) | TRANSOIL 90 140 250 MAY 2015.pdf | 2015-05-07 13:10 | 292K | |
![[ ]](/icons/layout.gif) | TRANSOIL 90 140 250 OCT 2011.pdf | 2011-12-15 20:50 | 144K | |
![[ ]](/icons/layout.gif) | TRANSOIL 90 140 250 OCTOBER 2013.pdf | 2013-10-18 12:32 | 240K | |
![[ ]](/icons/layout.gif) | TRANSOIL 90 140 250 OCTOBER 2015.pdf | 2015-10-05 14:58 | 292K | |
![[ ]](/icons/layout.gif) | TYRE SHINE JULY 2014.pdf | 2014-08-05 16:00 | 325K | |
![[ ]](/icons/layout.gif) | TYRE SHINE SEPTEMBER 2013.pdf | 2013-10-11 09:58 | 299K | |
![[ ]](/icons/layout.gif) | Tractor Transmission Hydraulic Oil.pdf | 2011-12-15 20:50 | 76K | |
![[ ]](/icons/layout.gif) | Tractor Transmission and Hydraulic Oil JAN 2010.pdf | 2011-12-15 20:50 | 215K | |
![[ ]](/icons/layout.gif) | Tractor Transmission and Hydraulic Oil Rev 3.2 0612.pdf | 2012-12-07 15:39 | 125K | |
![[ ]](/icons/layout.gif) | Transaxle 75.pdf | 2011-12-15 20:50 | 72K | |
![[ ]](/icons/layout.gif) | Transaxle 75 JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | Transaxle 80.pdf | 2011-12-15 20:50 | 73K | |
![[ ]](/icons/layout.gif) | Transaxle 80 JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | Transoil 90 140 250 JAN 2010.pdf | 2011-12-15 20:50 | 192K | |
![[ ]](/icons/layout.gif) | Transoil 90 140250l.pdf | 2011-12-15 20:50 | 71K | |
![[ ]](/icons/layout.gif) | UNIVERSAL COOLANT TOP UP MAY 2015.pdf | 2015-05-11 14:55 | 326K | |
![[ ]](/icons/layout.gif) | UNIVERSAL FARM OIL 15W-40 MARCH 2015.pdf | 2015-03-26 15:23 | 266K | |
![[ ]](/icons/layout.gif) | UNIVERSAL FARM OIL 15W-40 MARCH 2017.pdf | 2017-03-31 09:00 | 280K | |
![[ ]](/icons/layout.gif) | UNIVERSAL FARM OIL NOV 2013.pdf | 2013-11-08 09:23 | 237K | |
![[ ]](/icons/layout.gif) | UNIVERSAL FARM OIL OCT 2011.pdf | 2011-12-15 20:50 | 156K | |
![[ ]](/icons/layout.gif) | UNIVERSAL TOP UP COOLANT PREMIX AUGUST 2016.pdf | 2016-08-16 10:56 | 325K | |
![[ ]](/icons/layout.gif) | UNIVERSAL TOP UP COOLANT PREMIX MAY 2015.pdf | 2015-05-20 08:37 | 326K | |
![[ ]](/icons/layout.gif) | UNIVERSAL TOP UP COOLANT PREMIX MAY 2016.pdf | 2016-05-05 08:19 | 325K | |
![[ ]](/icons/layout.gif) | UNIVERSAL TOP UP COOLANT PREMIX SEPTEMBER 2016.pdf | 2016-08-19 11:51 | 357K | |
![[ ]](/icons/layout.gif) | UPPER CYLINDER and LPG LUBRICANT APRIL 2014.pdf | 2014-04-22 10:07 | 219K | |
![[ ]](/icons/layout.gif) | UPPER CYLINDER and LPG LUBRICANT Aug 2012.pdf | 2012-08-21 11:37 | 201K | |
![[ ]](/icons/layout.gif) | UPPER CYLINDER and LPG LUBRICANT DECEMBER 2013.pdf | 2013-12-04 12:27 | 217K | |
![[ ]](/icons/layout.gif) | UPPER CYLINDER and LPG LUBRICANT December 2012.pdf | 2012-12-07 08:57 | 202K | |
![[ ]](/icons/layout.gif) | UPPER CYLINDER and LPG LUBRICANT OCT 2011.pdf | 2011-12-15 20:50 | 141K | |
![[ ]](/icons/layout.gif) | UPPER CYLINDER and LPG LUBRICANT October 2012.pdf | 2012-10-31 15:34 | 201K | |
![[ ]](/icons/layout.gif) | UPPER CYLINDER and LPG LUBRICANT SEPTEMBER 2014.pdf | 2014-09-10 15:01 | 219K | |
![[ ]](/icons/layout.gif) | USA 15.pdf | 2011-12-15 20:50 | 77K | |
![[ ]](/icons/layout.gif) | USA 25.pdf | 2011-12-15 20:50 | 69K | |
![[ ]](/icons/layout.gif) | USA 25 JAN 2010.pdf | 2011-12-15 20:50 | 195K | |
![[ ]](/icons/layout.gif) | Universal Coolant Top Up July 2013.pdf | 2013-09-05 12:07 | 340K | |
![[ ]](/icons/layout.gif) | Universal Farm Oil.pdf | 2011-12-15 20:50 | 80K | |
![[ ]](/icons/layout.gif) | Universal Farm Oil APRIL 2010.pdf | 2011-12-15 20:50 | 201K | |
![[ ]](/icons/layout.gif) | Universal Farm Oil JAN 2010.pdf | 2011-12-15 20:50 | 215K | |
![[ ]](/icons/layout.gif) | Universal Farm Oil Rev 5.7 0613.pdf | 2013-12-16 11:49 | 129K | |
![[ ]](/icons/layout.gif) | Upper Cylinder LPG Lubricant.pdf | 2011-12-15 20:50 | 82K | |
![[ ]](/icons/layout.gif) | Upper Cylinder LPG Lubricant JAN 2010.pdf | 2011-12-15 20:50 | 213K | |
![[ ]](/icons/layout.gif) | VALVE SHIELD APRIL 2015.pdf | 2015-05-04 16:06 | 299K | |
![[ ]](/icons/layout.gif) | VALVESHIELD APRIL 2015.pdf | 2015-04-01 14:54 | 281K | |
![[ ]](/icons/layout.gif) | VALVESHIELD AUGUST 2013.pdf | 2013-09-11 08:42 | 268K | |
![[ ]](/icons/layout.gif) | VALVESHIELD April 2013.pdf | 2013-04-18 12:41 | 217K | |
![[ ]](/icons/layout.gif) | VALVESHIELD FEBRUARY 2015.pdf | 2015-02-19 09:17 | 260K | |
![[ ]](/icons/layout.gif) | VALVESHIELD MARCH 2014.pdf | 2014-04-02 15:02 | 279K | |
![[ ]](/icons/layout.gif) | VALVE SHIELD MAY 2016.pdf | 2016-05-26 09:17 | 299K | |
![[ ]](/icons/layout.gif) | VALVESHIELD OCT 2011.pdf | 2011-12-15 20:50 | 149K | |
![[ ]](/icons/layout.gif) | VALVESHIELD SEPTEMBER 2014.pdf | 2014-09-10 14:53 | 282K | |
![[ ]](/icons/layout.gif) | VANTAGE 5W-30 JUNE 2014.pdf | 2014-10-01 12:25 | 313K | |
![[ ]](/icons/layout.gif) | VANTAGE 5W-30 NOVEMBER 2014.pdf | 2014-11-24 08:56 | 314K | |
![[ ]](/icons/layout.gif) | VANTAGE 10W-30 JUNE 2014.pdf | 2014-10-01 14:23 | 313K | |
![[ ]](/icons/layout.gif) | VANTAGE 10W-30 NOVEMBER 2014.pdf | 2014-11-24 09:01 | 313K | |
![[ ]](/icons/layout.gif) | VANTAGE 15W-40 FEBRUARY 2015.pdf | 2015-02-10 13:40 | 311K | |
![[ ]](/icons/layout.gif) | VANTAGE 15W-40 JUNE 2014.pdf | 2014-10-01 14:39 | 312K | |
![[ ]](/icons/layout.gif) | VANTAGE 15W-40 NOVEMBER 2014.pdf | 2014-11-24 09:25 | 312K | |
![[ ]](/icons/layout.gif) | VANTAGE 20W-50 FEBRUARY 2015.pdf | 2015-02-10 13:44 | 311K | |
![[ ]](/icons/layout.gif) | VANTAGE 20W-50 JUNE 2014.pdf | 2014-10-01 14:45 | 312K | |
![[ ]](/icons/layout.gif) | VANTAGE 20W-50 NOVEMBER 2014.pdf | 2014-11-24 09:26 | 312K | |
![[ ]](/icons/layout.gif) | VANTAGE DIESEL 15W-40 APRIL 2016.pdf | 2016-05-04 15:08 | 279K | |
![[ ]](/icons/layout.gif) | VANTAGE FULL SYNTHETIC 5W-30 AUGUST 2016.pdf | 2016-08-26 09:45 | 429K | |
![[ ]](/icons/layout.gif) | VANTAGE FULL SYNTHETIC 5W-30 JANUARY 2017.pdf | 2017-01-20 08:44 | 430K | |
![[ ]](/icons/layout.gif) | VANTAGE FULL SYNTHETIC 5W-30 MAY 2015.pdf | 2015-05-08 11:40 | 305K | |
![[ ]](/icons/layout.gif) | VANTAGE FULL SYNTHETIC 5W-30 MAY 2016.pdf | 2016-05-04 14:57 | 429K | |
![[ ]](/icons/layout.gif) | VANTAGE FULL SYNTHETIC 5W-30 OCTOBER 2015.pdf | 2015-10-20 16:53 | 363K | |
![[ ]](/icons/layout.gif) | VANTAGE FULL SYNTHETIC 5W-30 SEPTEMBER 2015.pdf | 2015-09-08 12:24 | 363K | |
![[ ]](/icons/layout.gif) | VANTAGE FULL SYNTHETIC 10W-40 JANUARY 2016.pdf | 2016-03-31 11:07 | 296K | |
![[ ]](/icons/layout.gif) | VANTAGE FULL SYNTHETIC 10W-40 NOVEMBER 2016.pdf | 2016-11-10 17:09 | 331K | |
![[ ]](/icons/layout.gif) | VANTAGE PREMIUM MINERAL 5W-30 FEBRUARY 2016.pdf | 2016-02-18 12:10 | 334K | |
![[ ]](/icons/layout.gif) | VANTAGE PREMIUM MINERAL 5W-30 MARCH 2015.pdf | 2015-03-24 13:09 | 314K | |
![[ ]](/icons/layout.gif) | VANTAGE PREMIUM MINERAL 5W-30 NOVEMBER 2015.pdf | 2015-11-23 15:10 | 334K | |
![[ ]](/icons/layout.gif) | VANTAGE PREMIUM MINERAL 5W-30 SEPTEMBER 2015.pdf | 2015-09-09 12:26 | 334K | |
![[ ]](/icons/layout.gif) | VANTAGE PREMIUM MINERAL 10W-30 FEBRUARY 2016.pdf | 2016-02-18 12:13 | 333K | |
![[ ]](/icons/layout.gif) | VANTAGE PREMIUM MINERAL 10W-30 MARCH 2015.pdf | 2015-03-24 13:16 | 313K | |
![[ ]](/icons/layout.gif) | VANTAGE PREMIUM MINERAL 15W-40 FEBRUARY 2016.pdf | 2016-02-18 12:19 | 312K | |
![[ ]](/icons/layout.gif) | VANTAGE PREMIUM MINERAL 15W-40 MARCH 2015.pdf | 2015-03-24 13:17 | 311K | |
![[ ]](/icons/layout.gif) | VANTAGE PREMIUM MINERAL 15W-40 OCTOBER 2015.pdf | 2015-10-20 17:05 | 312K | |
![[ ]](/icons/layout.gif) | VANTAGE PREMIUM MINERAL 20W-50 MARCH 2015.pdf | 2015-03-24 13:19 | 312K | |
![[ ]](/icons/layout.gif) | VANTAGE PREMIUM MINERAL 20W-50 NOVEMBER 2015.pdf | 2015-11-23 13:17 | 312K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI 5W-30 FEBRUARY 2015.pdf | 2015-02-10 13:10 | 313K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI 5W-30 JUNE 2014.pdf | 2014-10-01 14:58 | 313K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI 5W-30 NOVEMBER 2014.pdf | 2014-11-24 09:00 | 314K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI 10W-40 JUNE 2014.pdf | 2014-10-01 15:18 | 255K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI 10W-40 NOVEMBER 2014.pdf | 2014-11-24 09:30 | 255K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI 15W-40 JUNE 2014.pdf | 2014-10-29 08:50 | 254K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI 15W-40 NOVEMBER 2014.pdf | 2014-11-24 09:30 | 254K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI SYNTHETIC 5W-30 MARCH 2015.pdf | 2015-03-24 13:28 | 311K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI SYNTHETIC 5W-30 SEPTEMBER 2015.pdf | 2015-09-09 13:14 | 331K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI SYNTHETIC 10W-30 JANUARY 2016.pdf | 2016-04-26 09:54 | 337K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI SYNTHETIC 10W-40 APRIL 2015.pdf | 2015-04-20 15:42 | 255K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI SYNTHETIC 10W-40 DECEMBER 2015.pdf | 2015-12-09 09:53 | 312K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI SYNTHETIC 10W-40 FEBRUARY 2016.pdf | 2016-02-18 12:41 | 316K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI SYNTHETIC 10W-40 MARCH 2015.pdf | 2015-03-24 13:29 | 255K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI SYNTHETIC 10W-40 MAY 2016.pdf | 2016-05-02 10:59 | 335K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI SYNTHETIC 10W-40 NOVEMBER 2016.pdf | 2016-11-10 14:36 | 331K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI SYNTHETIC 10W-40 OCTOBER 2015.pdf | 2015-10-20 16:44 | 256K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI SYNTHETIC 15W-40 APRIL 2015.pdf | 2015-04-20 15:43 | 255K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI SYNTHETIC 15W-40 DECEMBER 2015.pdf | 2015-12-09 09:56 | 312K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI SYNTHETIC 15W-40 FEBRUARY 2016.pdf | 2016-02-18 12:47 | 315K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI SYNTHETIC 15W-40 MARCH 2015.pdf | 2015-03-24 13:29 | 254K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI SYNTHETIC 15W-40 MAY 2016.pdf | 2016-05-02 13:45 | 330K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI SYNTHETIC 15W-40 NOVEMBER 2016.pdf | 2016-11-10 14:42 | 331K | |
![[ ]](/icons/layout.gif) | VANTAGE SEMI SYNTHETIC 15W-40 OCTOBER 2015.pdf | 2015-10-20 16:45 | 311K | |
![[ ]](/icons/layout.gif) | Valveshield.pdf | 2011-12-15 20:50 | 656K | |
![[ ]](/icons/layout.gif) | Valveshield JAN 2010.pdf | 2011-12-15 20:50 | 213K | |
![[ ]](/icons/layout.gif) | Vantage Full Synthetic 5W-30 Rev 0.0 0315.pdf | 2015-05-08 12:01 | 170K | |
![[ ]](/icons/layout.gif) | Vantage Semi Synthetic 15W-40 Rev 0.0 0814.pdf | 2014-10-01 15:28 | 131K | |
![[ ]](/icons/layout.gif) | WATER PUMP GREASE JULY 2014.pdf | 2014-07-25 13:33 | 275K | |
![[ ]](/icons/layout.gif) | WATER PUMP GREASE JULY 2015.pdf | 2015-07-03 12:03 | 275K | |
![[ ]](/icons/layout.gif) | WATER PUMP GREASE OCT 2011.pdf | 2011-12-15 20:50 | 140K | |
![[ ]](/icons/layout.gif) | WHEEL CLEANER APRIL 2015.pdf | 2015-04-02 13:13 | 269K | |
![[ ]](/icons/layout.gif) | WHEEL CLEANER NOVEMBER 2015.pdf | 2015-11-04 10:38 | 283K | |
![[ ]](/icons/layout.gif) | WHEEL CLEANER SEPTEMBER 2015.pdf | 2015-09-11 11:33 | 283K | |
![[ ]](/icons/layout.gif) | WHEEL RIM CLEANER JULY 2014.pdf | 2014-07-22 12:46 | 269K | |
![[ ]](/icons/layout.gif) | WHEEL RIM CLEANER SEPTEMBER 2013.pdf | 2013-10-10 17:25 | 266K | |
![[ ]](/icons/layout.gif) | Water Pump Grease.pdf | 2011-12-15 20:50 | 89K | |
![[ ]](/icons/layout.gif) | Water Pump Grease JAN 2010.pdf | 2011-12-15 20:50 | 208K | |
![[ ]](/icons/layout.gif) | contact cleaner.pdf | 2013-10-11 12:24 | 6.2K | |
![[ ]](/icons/layout.gif) | id_categ=1&id_brand=1&id_products=1.pdf | 2016-07-20 12:40 | 135K | |
|